
Generated from the ITM data structure schemas.
| datainfo | amns%datainfo (datainfo) |
| dataprovider | amns%datainfo%dataprovider (string) |
| putdate | amns%datainfo%putdate (string) |
| source | amns%datainfo%source (string) |
| comment | amns%datainfo%comment (string) |
| cocos | amns%datainfo%cocos (integer) |
| id | amns%datainfo%id (integer) |
| isref | amns%datainfo%isref (integer) |
| whatref | amns%datainfo%whatref (whatref) |
| user | amns%datainfo%whatref%user (string) |
| machine | amns%datainfo%whatref%machine (string) |
| shot | amns%datainfo%whatref%shot (integer) |
| run | amns%datainfo%whatref%run (integer) |
| occurrence | amns%datainfo%whatref%occurrence (integer) |
| putinfo | amns%datainfo%putinfo (putinfo) |
| putmethod | amns%datainfo%putinfo%putmethod (string) |
| putaccess | amns%datainfo%putinfo%putaccess (string) |
| putlocation | amns%datainfo%putinfo%putlocation (string) |
| rights | amns%datainfo%putinfo%rights (string) |
| version | amns%version (string) |
| source | amns%source (string) |
| zn | amns%zn (integer) |
| amn | amns%amn (float) |
| process | amns%process(:) (amns_processType) |
| proc_label | amns%process(:)%proc_label (string) |
| reactant | amns%process(:)%reactant(:) (reacprodType) |
| label | amns%process(:)%reactant(:)%label (string) |
| constituents | amns%process(:)%reactant(:)%constituents(:) (amns_constituentType) |
| label | amns%process(:)%reactant(:)%constituents(:)%label (string) |
| zn | amns%process(:)%reactant(:)%constituents(:)%zn (integer) |
| mn | amns%process(:)%reactant(:)%constituents(:)%mn (integer) |
| multiplicity | amns%process(:)%reactant(:)%constituents(:)%multiplicity (float) |
| role | amns%process(:)%reactant(:)%role (identifier) |
| id | amns%process(:)%reactant(:)%role%id (string) |
| flag | amns%process(:)%reactant(:)%role%flag (integer) |
| description | amns%process(:)%reactant(:)%role%description (string) |
| amn | amns%process(:)%reactant(:)%amn (float) |
| relative | amns%process(:)%reactant(:)%relative (integer) |
| za | amns%process(:)%reactant(:)%za (float) |
| multiplicity | amns%process(:)%reactant(:)%multiplicity (float) |
| metastable | amns%process(:)%reactant(:)%metastable (vecint_type) |
| metastable_label | amns%process(:)%reactant(:)%metastable_label (string) |
| product | amns%process(:)%product(:) (reacprodType) |
| label | amns%process(:)%product(:)%label (string) |
| constituents | amns%process(:)%product(:)%constituents(:) (amns_constituentType) |
| label | amns%process(:)%product(:)%constituents(:)%label (string) |
| zn | amns%process(:)%product(:)%constituents(:)%zn (integer) |
| mn | amns%process(:)%product(:)%constituents(:)%mn (integer) |
| multiplicity | amns%process(:)%product(:)%constituents(:)%multiplicity (float) |
| role | amns%process(:)%product(:)%role (identifier) |
| id | amns%process(:)%product(:)%role%id (string) |
| flag | amns%process(:)%product(:)%role%flag (integer) |
| description | amns%process(:)%product(:)%role%description (string) |
| amn | amns%process(:)%product(:)%amn (float) |
| relative | amns%process(:)%product(:)%relative (integer) |
| za | amns%process(:)%product(:)%za (float) |
| multiplicity | amns%process(:)%product(:)%multiplicity (float) |
| metastable | amns%process(:)%product(:)%metastable (vecint_type) |
| metastable_label | amns%process(:)%product(:)%metastable_label (string) |
| sup_string | amns%process(:)%sup_string (string) |
| sup_real | amns%process(:)%sup_real (float) |
| sup_int | amns%process(:)%sup_int (integer) |
| quality | amns%process(:)%quality (identifier) |
| id | amns%process(:)%quality%id (string) |
| flag | amns%process(:)%quality%flag (integer) |
| description | amns%process(:)%quality%description (string) |
| err_proc_label | amns%process(:)%err_proc_label (string) |
| tables | amns%tables(:) (tables) |
| ndim | amns%tables(:)%ndim (integer) |
| coord_index | amns%tables(:)%coord_index (integer) |
| result_label | amns%tables(:)%result_label (string) |
| result_unit | amns%tables(:)%result_unit (string) |
| result_trans | amns%tables(:)%result_trans (integer) |
| zmin | amns%tables(:)%zmin (vecint_type) |
| zmax | amns%tables(:)%zmax (vecint_type) |
| state_label | amns%tables(:)%state_label (vecstring_type) |
| table | amns%tables(:)%table(:) (table) |
| filled | amns%tables(:)%table(:)%filled (integer) |
| table_0d | amns%tables(:)%table(:)%table_0d (float) |
| table_1d | amns%tables(:)%table(:)%table_1d (vecflt_type) |
| table_2d | amns%tables(:)%table(:)%table_2d (matflt_type) |
| table_3d | amns%tables(:)%table(:)%table_3d (array3dflt_type) |
| table_4d | amns%tables(:)%table(:)%table_4d (array4dflt_type) |
| table_5d | amns%tables(:)%table(:)%table_5d (array5dflt_type) |
| table_6d | amns%tables(:)%table(:)%table_6d (array6dflt_type) |
| coord1_str | amns%tables(:)%table(:)%coord1_str (vecstring_type) |
| coord2_str | amns%tables(:)%table(:)%coord2_str (vecstring_type) |
| coord3_str | amns%tables(:)%table(:)%coord3_str (vecstring_type) |
| coord4_str | amns%tables(:)%table(:)%coord4_str (vecstring_type) |
| coord5_str | amns%tables(:)%table(:)%coord5_str (vecstring_type) |
| coord6_str | amns%tables(:)%table(:)%coord6_str (vecstring_type) |
| quality | amns%tables(:)%table(:)%quality (identifier) |
| id | amns%tables(:)%table(:)%quality%id (string) |
| flag | amns%tables(:)%table(:)%quality%flag (integer) |
| description | amns%tables(:)%table(:)%quality%description (string) |
| data_source | amns%tables(:)%data_source (string) |
| data_provide | amns%tables(:)%data_provide (string) |
| data_citation | amns%tables(:)%data_citation (string) |
| tables_coord | amns%tables_coord(:) (tables_coord) |
| coords | amns%tables_coord(:)%coords(:) (coords) |
| coord | amns%tables_coord(:)%coords(:)%coord (vecflt_type) |
| coord_label | amns%tables_coord(:)%coords(:)%coord_label (vecstring_type) |
| extrap_type | amns%tables_coord(:)%coords(:)%extrap_type (vecint_type) |
| interp_type | amns%tables_coord(:)%coords(:)%interp_type (integer) |
| label | amns%tables_coord(:)%coords(:)%label (string) |
| unit | amns%tables_coord(:)%coords(:)%unit (string) |
| transform | amns%tables_coord(:)%coords(:)%transform (integer) |
| spacing | amns%tables_coord(:)%coords(:)%spacing (integer) |
| version_ind | amns%version_ind(:) (version_ind) |
| description | amns%version_ind(:)%description (vecstring_type) |
| releasedate | amns%version_ind(:)%releasedate (string) |
| data_release | amns%version_ind(:)%data_release(:) (data_release) |
| shot | amns%version_ind(:)%data_release(:)%shot (integer) |
| run | amns%version_ind(:)%data_release(:)%run (integer) |
| description | amns%version_ind(:)%data_release(:)%description (vecstring_type) |
| codeparam | amns%codeparam (codeparam) |
| codename | amns%codeparam%codename (string) |
| codeversion | amns%codeparam%codeversion (string) |
| parameters | amns%codeparam%parameters (string) |
| output_diag | amns%codeparam%output_diag (string) |
| output_flag | amns%codeparam%output_flag (integer) |
| time | amns%time (float) |
| datainfo | antennas%datainfo (datainfo) |
| dataprovider | antennas%datainfo%dataprovider (string) |
| putdate | antennas%datainfo%putdate (string) |
| source | antennas%datainfo%source (string) |
| comment | antennas%datainfo%comment (string) |
| cocos | antennas%datainfo%cocos (integer) |
| id | antennas%datainfo%id (integer) |
| isref | antennas%datainfo%isref (integer) |
| whatref | antennas%datainfo%whatref (whatref) |
| user | antennas%datainfo%whatref%user (string) |
| machine | antennas%datainfo%whatref%machine (string) |
| shot | antennas%datainfo%whatref%shot (integer) |
| run | antennas%datainfo%whatref%run (integer) |
| occurrence | antennas%datainfo%whatref%occurrence (integer) |
| putinfo | antennas%datainfo%putinfo (putinfo) |
| putmethod | antennas%datainfo%putinfo%putmethod (string) |
| putaccess | antennas%datainfo%putinfo%putaccess (string) |
| putlocation | antennas%datainfo%putinfo%putlocation (string) |
| rights | antennas%datainfo%putinfo%rights (string) |
| antenna_ec | antennas%antenna_ec(:) (antenna_ec) |
| name | antennas%antenna_ec(:)%name (string) |
| frequency | antennas%antenna_ec(:)%frequency (float) |
| power | antennas%antenna_ec(:)%power (exp0D) |
| value | antennas%antenna_ec(:)%power%value (float) |
| abserror | antennas%antenna_ec(:)%power%abserror (float) |
| relerror | antennas%antenna_ec(:)%power%relerror (float) |
| mode | antennas%antenna_ec(:)%mode (integer) |
| position | antennas%antenna_ec(:)%position (rzphi0D) |
| r | antennas%antenna_ec(:)%position%r (float) |
| z | antennas%antenna_ec(:)%position%z (float) |
| phi | antennas%antenna_ec(:)%position%phi (float) |
| launchangles | antennas%antenna_ec(:)%launchangles (launchangles) |
| alpha | antennas%antenna_ec(:)%launchangles%alpha (float) |
| beta | antennas%antenna_ec(:)%launchangles%beta (float) |
| beam | antennas%antenna_ec(:)%beam (rfbeam) |
| spot | antennas%antenna_ec(:)%beam%spot (spot) |
| size | antennas%antenna_ec(:)%beam%spot%size (vecflt_type) |
| angle | antennas%antenna_ec(:)%beam%spot%angle (float) |
| phaseellipse | antennas%antenna_ec(:)%beam%phaseellipse (phaseellipse) |
| invcurvrad | antennas%antenna_ec(:)%beam%phaseellipse%invcurvrad (vecflt_type) |
| angle | antennas%antenna_ec(:)%beam%phaseellipse%angle (float) |
| codeparam | antennas%antenna_ec(:)%codeparam (codeparam) |
| codename | antennas%antenna_ec(:)%codeparam%codename (string) |
| codeversion | antennas%antenna_ec(:)%codeparam%codeversion (string) |
| parameters | antennas%antenna_ec(:)%codeparam%parameters (string) |
| output_diag | antennas%antenna_ec(:)%codeparam%output_diag (string) |
| output_flag | antennas%antenna_ec(:)%codeparam%output_flag (integer) |
| antenna_ic | antennas%antenna_ic(:) (antenna_ic) |
| name | antennas%antenna_ic(:)%name (string) |
| frequency | antennas%antenna_ic(:)%frequency (exp0D) |
| value | antennas%antenna_ic(:)%frequency%value (float) |
| abserror | antennas%antenna_ic(:)%frequency%abserror (float) |
| relerror | antennas%antenna_ic(:)%frequency%relerror (float) |
| power | antennas%antenna_ic(:)%power (exp0D) |
| value | antennas%antenna_ic(:)%power%value (float) |
| abserror | antennas%antenna_ic(:)%power%abserror (float) |
| relerror | antennas%antenna_ic(:)%power%relerror (float) |
| setup | antennas%antenna_ic(:)%setup (antennaic_setup) |
| straps | antennas%antenna_ic(:)%setup%straps(:) (straps) |
| current | antennas%antenna_ic(:)%setup%straps(:)%current (exp0D) |
| value | antennas%antenna_ic(:)%setup%straps(:)%current%value (float) |
| abserror | antennas%antenna_ic(:)%setup%straps(:)%current%abserror (float) |
| relerror | antennas%antenna_ic(:)%setup%straps(:)%current%relerror (float) |
| phase | antennas%antenna_ic(:)%setup%straps(:)%phase (exp0D) |
| value | antennas%antenna_ic(:)%setup%straps(:)%phase%value (float) |
| abserror | antennas%antenna_ic(:)%setup%straps(:)%phase%abserror (float) |
| relerror | antennas%antenna_ic(:)%setup%straps(:)%phase%relerror (float) |
| phi_centre | antennas%antenna_ic(:)%setup%straps(:)%phi_centre (float) |
| width | antennas%antenna_ic(:)%setup%straps(:)%width (float) |
| dist2wall | antennas%antenna_ic(:)%setup%straps(:)%dist2wall (float) |
| coord_strap | antennas%antenna_ic(:)%setup%straps(:)%coord_strap (rz1D) |
| r | antennas%antenna_ic(:)%setup%straps(:)%coord_strap%r (vecflt_type) |
| z | antennas%antenna_ic(:)%setup%straps(:)%coord_strap%z (vecflt_type) |
| current | antennas%antenna_ic(:)%setup%current (current) |
| mpol | antennas%antenna_ic(:)%setup%current%mpol (vecint_type) |
| ntor | antennas%antenna_ic(:)%setup%current%ntor (vecint_type) |
| spectrum | antennas%antenna_ic(:)%setup%current%spectrum (exp1D) |
| value | antennas%antenna_ic(:)%setup%current%spectrum%value (vecflt_type) |
| abserror | antennas%antenna_ic(:)%setup%current%spectrum%abserror (vecflt_type) |
| relerror | antennas%antenna_ic(:)%setup%current%spectrum%relerror (vecflt_type) |
| rz_reference | antennas%antenna_ic(:)%setup%current%rz_reference (rz0D) |
| r | antennas%antenna_ic(:)%setup%current%rz_reference%r (float) |
| z | antennas%antenna_ic(:)%setup%current%rz_reference%z (float) |
| codeparam | antennas%antenna_ic(:)%codeparam (codeparam) |
| codename | antennas%antenna_ic(:)%codeparam%codename (string) |
| codeversion | antennas%antenna_ic(:)%codeparam%codeversion (string) |
| parameters | antennas%antenna_ic(:)%codeparam%parameters (string) |
| output_diag | antennas%antenna_ic(:)%codeparam%output_diag (string) |
| output_flag | antennas%antenna_ic(:)%codeparam%output_flag (integer) |
| antenna_lh | antennas%antenna_lh(:) (antenna_lh) |
| name | antennas%antenna_lh(:)%name (string) |
| frequency | antennas%antenna_lh(:)%frequency (float) |
| power | antennas%antenna_lh(:)%power (exp0D) |
| value | antennas%antenna_lh(:)%power%value (float) |
| abserror | antennas%antenna_lh(:)%power%abserror (float) |
| relerror | antennas%antenna_lh(:)%power%relerror (float) |
| n_par | antennas%antenna_lh(:)%n_par (float) |
| position | antennas%antenna_lh(:)%position (rzphi0D) |
| r | antennas%antenna_lh(:)%position%r (float) |
| z | antennas%antenna_lh(:)%position%z (float) |
| phi | antennas%antenna_lh(:)%position%phi (float) |
| setup | antennas%antenna_lh(:)%setup (antennalh_setup) |
| modules | antennas%antenna_lh(:)%setup%modules (modules) |
| nma_theta | antennas%antenna_lh(:)%setup%modules%nma_theta (integer) |
| nma_phi | antennas%antenna_lh(:)%setup%modules%nma_phi (integer) |
| ima_theta | antennas%antenna_lh(:)%setup%modules%ima_theta (vecint_type) |
| ima_phi | antennas%antenna_lh(:)%setup%modules%ima_phi (vecint_type) |
| sm_theta | antennas%antenna_lh(:)%setup%modules%sm_theta (float) |
| amplitude | antennas%antenna_lh(:)%setup%modules%amplitude (exp1D) |
| value | antennas%antenna_lh(:)%setup%modules%amplitude%value (vecflt_type) |
| abserror | antennas%antenna_lh(:)%setup%modules%amplitude%abserror (vecflt_type) |
| relerror | antennas%antenna_lh(:)%setup%modules%amplitude%relerror (vecflt_type) |
| phase | antennas%antenna_lh(:)%setup%modules%phase (exp1D) |
| value | antennas%antenna_lh(:)%setup%modules%phase%value (vecflt_type) |
| abserror | antennas%antenna_lh(:)%setup%modules%phase%abserror (vecflt_type) |
| relerror | antennas%antenna_lh(:)%setup%modules%phase%relerror (vecflt_type) |
| waveguides | antennas%antenna_lh(:)%setup%modules%waveguides (waveguides) |
| nwm_theta | antennas%antenna_lh(:)%setup%modules%waveguides%nwm_theta (integer) |
| nwm_phi | antennas%antenna_lh(:)%setup%modules%waveguides%nwm_phi (integer) |
| mask | antennas%antenna_lh(:)%setup%modules%waveguides%mask (vecint_type) |
| npwbm_phi | antennas%antenna_lh(:)%setup%modules%waveguides%npwbm_phi (integer) |
| npwe_phi | antennas%antenna_lh(:)%setup%modules%waveguides%npwe_phi (integer) |
| sw_theta | antennas%antenna_lh(:)%setup%modules%waveguides%sw_theta (float) |
| hw_theta | antennas%antenna_lh(:)%setup%modules%waveguides%hw_theta (float) |
| bwa | antennas%antenna_lh(:)%setup%modules%waveguides%bwa (float) |
| biwp | antennas%antenna_lh(:)%setup%modules%waveguides%biwp (float) |
| bewp | antennas%antenna_lh(:)%setup%modules%waveguides%bewp (float) |
| e_phi | antennas%antenna_lh(:)%setup%modules%waveguides%e_phi (vecflt_type) |
| scl | antennas%antenna_lh(:)%setup%modules%waveguides%scl (vecflt_type) |
| plasmaedge | antennas%antenna_lh(:)%plasmaedge (plasmaedge) |
| npoints | antennas%antenna_lh(:)%plasmaedge%npoints (integer) |
| distance | antennas%antenna_lh(:)%plasmaedge%distance (vecflt_type) |
| density | antennas%antenna_lh(:)%plasmaedge%density (vecflt_type) |
| beam | antennas%antenna_lh(:)%beam (rfbeam) |
| spot | antennas%antenna_lh(:)%beam%spot (spot) |
| size | antennas%antenna_lh(:)%beam%spot%size (vecflt_type) |
| angle | antennas%antenna_lh(:)%beam%spot%angle (float) |
| phaseellipse | antennas%antenna_lh(:)%beam%phaseellipse (phaseellipse) |
| invcurvrad | antennas%antenna_lh(:)%beam%phaseellipse%invcurvrad (vecflt_type) |
| angle | antennas%antenna_lh(:)%beam%phaseellipse%angle (float) |
| codeparam | antennas%antenna_lh(:)%codeparam (codeparam) |
| codename | antennas%antenna_lh(:)%codeparam%codename (string) |
| codeversion | antennas%antenna_lh(:)%codeparam%codeversion (string) |
| parameters | antennas%antenna_lh(:)%codeparam%parameters (string) |
| output_diag | antennas%antenna_lh(:)%codeparam%output_diag (string) |
| output_flag | antennas%antenna_lh(:)%codeparam%output_flag (integer) |
| codeparam | antennas%codeparam (codeparam) |
| codename | antennas%codeparam%codename (string) |
| codeversion | antennas%codeparam%codeversion (string) |
| parameters | antennas%codeparam%parameters (string) |
| output_diag | antennas%codeparam%output_diag (string) |
| output_flag | antennas%codeparam%output_flag (integer) |
| time | antennas%time (float) |
| datainfo | bb_shield%datainfo (datainfo) |
| dataprovider | bb_shield%datainfo%dataprovider (string) |
| putdate | bb_shield%datainfo%putdate (string) |
| source | bb_shield%datainfo%source (string) |
| comment | bb_shield%datainfo%comment (string) |
| cocos | bb_shield%datainfo%cocos (integer) |
| id | bb_shield%datainfo%id (integer) |
| isref | bb_shield%datainfo%isref (integer) |
| whatref | bb_shield%datainfo%whatref (whatref) |
| user | bb_shield%datainfo%whatref%user (string) |
| machine | bb_shield%datainfo%whatref%machine (string) |
| shot | bb_shield%datainfo%whatref%shot (integer) |
| run | bb_shield%datainfo%whatref%run (integer) |
| occurrence | bb_shield%datainfo%whatref%occurrence (integer) |
| putinfo | bb_shield%datainfo%putinfo (putinfo) |
| putmethod | bb_shield%datainfo%putinfo%putmethod (string) |
| putaccess | bb_shield%datainfo%putinfo%putaccess (string) |
| putlocation | bb_shield%datainfo%putinfo%putlocation (string) |
| rights | bb_shield%datainfo%putinfo%rights (string) |
| type | bb_shield%type (string) |
| limits | bb_shield%limits (limits) |
| fw_dpa | bb_shield%limits%fw_dpa (float) |
| he_appm | bb_shield%limits%he_appm (float) |
| ins_dose | bb_shield%limits%ins_dose (float) |
| fn_flu | bb_shield%limits%fn_flu (float) |
| dpa_cu | bb_shield%limits%dpa_cu (float) |
| wp_nh | bb_shield%limits%wp_nh (float) |
| li6_enrich | bb_shield%li6_enrich (float) |
| geom | bb_shield%geom (geom) |
| dr_bb_sh_ib | bb_shield%geom%dr_bb_sh_ib (float) |
| dr_sh_vv_ib | bb_shield%geom%dr_sh_vv_ib (float) |
| dr_bb_sh_ob | bb_shield%geom%dr_bb_sh_ob (float) |
| dr_sh_vv_ob | bb_shield%geom%dr_sh_vv_ob (float) |
| dr_bb__sh_ib | bb_shield%geom%dr_bb__sh_ib (float) |
| dr_bb__sh_ob | bb_shield%geom%dr_bb__sh_ob (float) |
| delta_int | bb_shield%geom%delta_int (float) |
| neut_results | bb_shield%neut_results (neut_results) |
| tbr_bk | bb_shield%neut_results%tbr_bk (float) |
| tbr_bk_inb | bb_shield%neut_results%tbr_bk_inb (float) |
| tbr_bk_outb | bb_shield%neut_results%tbr_bk_outb (float) |
| me_bk | bb_shield%neut_results%me_bk (float) |
| me_shield | bb_shield%neut_results%me_shield (float) |
| he_appm_res | bb_shield%neut_results%he_appm_res (float) |
| ins_dose_max | bb_shield%neut_results%ins_dose_max (float) |
| fn_flu_max | bb_shield%neut_results%fn_flu_max (float) |
| dpa_cu_max | bb_shield%neut_results%dpa_cu_max (float) |
| fn_flux_bz | bb_shield%neut_results%fn_flux_bz (float) |
| fn_flux_bp | bb_shield%neut_results%fn_flux_bp (float) |
| fn_flux_man | bb_shield%neut_results%fn_flux_man (float) |
| fn_flux_sh | bb_shield%neut_results%fn_flux_sh (float) |
| p_nh_bk | bb_shield%neut_results%p_nh_bk (float) |
| p_nh_sh | bb_shield%neut_results%p_nh_sh (float) |
| shield | bb_shield%shield (shield) |
| inboard | bb_shield%shield%inboard (shield_specs) |
| nmat | bb_shield%shield%inboard%nmat (integer) |
| composition | bb_shield%shield%inboard%composition (vecflt_type) |
| r1 | bb_shield%shield%inboard%r1 (float) |
| r2 | bb_shield%shield%inboard%r2 (float) |
| mass | bb_shield%shield%inboard%mass (float) |
| outboard | bb_shield%shield%outboard (shield_specs) |
| nmat | bb_shield%shield%outboard%nmat (integer) |
| composition | bb_shield%shield%outboard%composition (vecflt_type) |
| r1 | bb_shield%shield%outboard%r1 (float) |
| r2 | bb_shield%shield%outboard%r2 (float) |
| mass | bb_shield%shield%outboard%mass (float) |
| bb | bb_shield%bb (bb) |
| nb_bb | bb_shield%bb%nb_bb (float) |
| nb_bb_polcut | bb_shield%bb%nb_bb_polcut (float) |
| teta_bb | bb_shield%bb%teta_bb (float) |
| tbr | bb_shield%bb%tbr (float) |
| neutro_resul | bb_shield%bb%neutro_resul (neutro_resul) |
| nwl_max | bb_shield%bb%neutro_resul%nwl_max (float) |
| nwl_pol_prof | bb_shield%bb%neutro_resul%nwl_pol_prof (vecflt_type) |
| inboard | bb_shield%bb%inboard (bb_specs) |
| nbb | bb_shield%bb%inboard%nbb (float) |
| r1 | bb_shield%bb%inboard%r1 (float) |
| r2 | bb_shield%bb%inboard%r2 (float) |
| dimension | bb_shield%bb%inboard%dimension (bb_dimension) |
| radial | bb_shield%bb%inboard%dimension%radial (vecflt_type) |
| toroidal | bb_shield%bb%inboard%dimension%toroidal (vecflt_type) |
| poloidal | bb_shield%bb%inboard%dimension%poloidal (vecflt_type) |
| outboard | bb_shield%bb%outboard (bb_specs) |
| nbb | bb_shield%bb%outboard%nbb (float) |
| r1 | bb_shield%bb%outboard%r1 (float) |
| r2 | bb_shield%bb%outboard%r2 (float) |
| dimension | bb_shield%bb%outboard%dimension (bb_dimension) |
| radial | bb_shield%bb%outboard%dimension%radial (vecflt_type) |
| toroidal | bb_shield%bb%outboard%dimension%toroidal (vecflt_type) |
| poloidal | bb_shield%bb%outboard%dimension%poloidal (vecflt_type) |
| hcll | bb_shield%hcll (hcll) |
| mat_lim | bb_shield%hcll%mat_lim (mat_lim) |
| cool_t_lim | bb_shield%hcll%mat_lim%cool_t_lim (float) |
| steel_t_lim | bb_shield%hcll%mat_lim%steel_t_lim (float) |
| lipb_t_lim | bb_shield%hcll%mat_lim%lipb_t_lim (float) |
| hcll_bb | bb_shield%hcll%hcll_bb (hcll_bb) |
| bb_lifetime | bb_shield%hcll%hcll_bb%bb_lifetime (float) |
| he_inl_t | bb_shield%hcll%hcll_bb%he_inl_t (float) |
| he_fr | bb_shield%hcll%hcll_bb%he_fr (float) |
| he_inl_p | bb_shield%hcll%hcll_bb%he_inl_p (float) |
| loca_des_p | bb_shield%hcll%hcll_bb%loca_des_p (float) |
| he_dp | bb_shield%hcll%hcll_bb%he_dp (float) |
| lipb_dp | bb_shield%hcll%hcll_bb%lipb_dp (float) |
| react | bb_shield%hcll%hcll_bb%react (react) |
| he_fr | bb_shield%hcll%hcll_bb%react%he_fr (float) |
| lp_fr | bb_shield%hcll%hcll_bb%react%lp_fr (float) |
| he_dp | bb_shield%hcll%hcll_bb%react%he_dp (float) |
| lipb_dp | bb_shield%hcll%hcll_bb%react%lipb_dp (float) |
| inboard | bb_shield%hcll%hcll_bb%inboard (hcllbb_specs) |
| mass | bb_shield%hcll%hcll_bb%inboard%mass (vecflt_type) |
| dr | bb_shield%hcll%hcll_bb%inboard%dr (vecflt_type) |
| mat | bb_shield%hcll%hcll_bb%inboard%mat (vecflt_type) |
| composition | bb_shield%hcll%hcll_bb%inboard%composition (matflt_type) |
| mod_geom | bb_shield%hcll%hcll_bb%inboard%mod_geom (bb_geometry) |
| dr_fw | bb_shield%hcll%hcll_bb%inboard%mod_geom%dr_fw (float) |
| dr_bz | bb_shield%hcll%hcll_bb%inboard%mod_geom%dr_bz (float) |
| dr_bp | bb_shield%hcll%hcll_bb%inboard%mod_geom%dr_bp (float) |
| dr_bp_plates | bb_shield%hcll%hcll_bb%inboard%mod_geom%dr_bp_plates (vecflt_type) |
| dr_bp_he | bb_shield%hcll%hcll_bb%inboard%mod_geom%dr_bp_he (vecflt_type) |
| dr_man | bb_shield%hcll%hcll_bb%inboard%mod_geom%dr_man (float) |
| dt_sw | bb_shield%hcll%hcll_bb%inboard%mod_geom%dt_sw (float) |
| dt_bz | bb_shield%hcll%hcll_bb%inboard%mod_geom%dt_bz (float) |
| dp_bz | bb_shield%hcll%hcll_bb%inboard%mod_geom%dp_bz (float) |
| top_cap_dim | bb_shield%hcll%hcll_bb%inboard%mod_geom%top_cap_dim (bb_dimension) |
| radial | bb_shield%hcll%hcll_bb%inboard%mod_geom%top_cap_dim%radial (vecflt_type) |
| toroidal | bb_shield%hcll%hcll_bb%inboard%mod_geom%top_cap_dim%toroidal (vecflt_type) |
| poloidal | bb_shield%hcll%hcll_bb%inboard%mod_geom%top_cap_dim%poloidal (vecflt_type) |
| bot_cap_dim | bb_shield%hcll%hcll_bb%inboard%mod_geom%bot_cap_dim (bb_dimension) |
| radial | bb_shield%hcll%hcll_bb%inboard%mod_geom%bot_cap_dim%radial (vecflt_type) |
| toroidal | bb_shield%hcll%hcll_bb%inboard%mod_geom%bot_cap_dim%toroidal (vecflt_type) |
| poloidal | bb_shield%hcll%hcll_bb%inboard%mod_geom%bot_cap_dim%poloidal (vecflt_type) |
| a_fw_ch | bb_shield%hcll%hcll_bb%inboard%mod_geom%a_fw_ch (float) |
| b_fw_ch | bb_shield%hcll%hcll_bb%inboard%mod_geom%b_fw_ch (float) |
| td_tc_ch | bb_shield%hcll%hcll_bb%inboard%mod_geom%td_tc_ch (float) |
| rd_tc_ch | bb_shield%hcll%hcll_bb%inboard%mod_geom%rd_tc_ch (float) |
| td_bc_ch | bb_shield%hcll%hcll_bb%inboard%mod_geom%td_bc_ch (float) |
| rd_bc_ch | bb_shield%hcll%hcll_bb%inboard%mod_geom%rd_bc_ch (float) |
| n_fw_ch | bb_shield%hcll%hcll_bb%inboard%mod_geom%n_fw_ch (float) |
| n_fw_circ | bb_shield%hcll%hcll_bb%inboard%mod_geom%n_fw_circ (float) |
| a_sg_ch | bb_shield%hcll%hcll_bb%inboard%mod_geom%a_sg_ch (float) |
| b_sg_ch | bb_shield%hcll%hcll_bb%inboard%mod_geom%b_sg_ch (float) |
| n_sg_ch | bb_shield%hcll%hcll_bb%inboard%mod_geom%n_sg_ch (float) |
| sg_thick | bb_shield%hcll%hcll_bb%inboard%mod_geom%sg_thick (float) |
| sg_weld | bb_shield%hcll%hcll_bb%inboard%mod_geom%sg_weld (float) |
| sg_in_out | bb_shield%hcll%hcll_bb%inboard%mod_geom%sg_in_out (float) |
| r_sg_cp | bb_shield%hcll%hcll_bb%inboard%mod_geom%r_sg_cp (float) |
| cp_tor_gap | bb_shield%hcll%hcll_bb%inboard%mod_geom%cp_tor_gap (float) |
| a_cp_ch | bb_shield%hcll%hcll_bb%inboard%mod_geom%a_cp_ch (float) |
| b_cp_ch | bb_shield%hcll%hcll_bb%inboard%mod_geom%b_cp_ch (float) |
| n_cp_ch | bb_shield%hcll%hcll_bb%inboard%mod_geom%n_cp_ch (float) |
| cp_thick | bb_shield%hcll%hcll_bb%inboard%mod_geom%cp_thick (float) |
| n_pol_bu | bb_shield%hcll%hcll_bb%inboard%mod_geom%n_pol_bu (float) |
| n_tor_bu | bb_shield%hcll%hcll_bb%inboard%mod_geom%n_tor_bu (float) |
| n_cp_bu | bb_shield%hcll%hcll_bb%inboard%mod_geom%n_cp_bu (float) |
| cp_in_out | bb_shield%hcll%hcll_bb%inboard%mod_geom%cp_in_out (float) |
| he_man_tck | bb_shield%hcll%hcll_bb%inboard%mod_geom%he_man_tck (float) |
| man_tck | bb_shield%hcll%hcll_bb%inboard%mod_geom%man_tck (float) |
| pbli_bptb_od | bb_shield%hcll%hcll_bb%inboard%mod_geom%pbli_bptb_od (float) |
| pbli_bptb_id | bb_shield%hcll%hcll_bb%inboard%mod_geom%pbli_bptb_id (float) |
| he_bptb_od | bb_shield%hcll%hcll_bb%inboard%mod_geom%he_bptb_od (float) |
| he_bptb_id | bb_shield%hcll%hcll_bb%inboard%mod_geom%he_bptb_id (float) |
| dr_max_fw | bb_shield%hcll%hcll_bb%inboard%mod_geom%dr_max_fw (float) |
| dr_fwpl | bb_shield%hcll%hcll_bb%inboard%mod_geom%dr_fwpl (float) |
| mod_neutr | bb_shield%hcll%hcll_bb%inboard%mod_neutr (mode_neutr) |
| r | bb_shield%hcll%hcll_bb%inboard%mod_neutr%r (vecflt_type) |
| pd_rad | bb_shield%hcll%hcll_bb%inboard%mod_neutr%pd_rad (vecflt_type) |
| lipb_coef_pd | bb_shield%hcll%hcll_bb%inboard%mod_neutr%lipb_coef_pd (vecflt_type) |
| steel_coef_pd | bb_shield%hcll%hcll_bb%inboard%mod_neutr%steel_coef_pd (vecflt_type) |
| pow_exchange | bb_shield%hcll%hcll_bb%inboard%mod_neutr%pow_exchange (power_exchange) |
| dep_pow | bb_shield%hcll%hcll_bb%inboard%mod_neutr%pow_exchange%dep_pow (vecflt_type) |
| dep_fw | bb_shield%hcll%hcll_bb%inboard%mod_neutr%pow_exchange%dep_fw (float) |
| dep_sg | bb_shield%hcll%hcll_bb%inboard%mod_neutr%pow_exchange%dep_sg (float) |
| dep_cp | bb_shield%hcll%hcll_bb%inboard%mod_neutr%pow_exchange%dep_cp (float) |
| dep_lp | bb_shield%hcll%hcll_bb%inboard%mod_neutr%pow_exchange%dep_lp (float) |
| dep_man | bb_shield%hcll%hcll_bb%inboard%mod_neutr%pow_exchange%dep_man (float) |
| dep_pl | bb_shield%hcll%hcll_bb%inboard%mod_neutr%pow_exchange%dep_pl (float) |
| rec_fw | bb_shield%hcll%hcll_bb%inboard%mod_neutr%pow_exchange%rec_fw (float) |
| rec_sg | bb_shield%hcll%hcll_bb%inboard%mod_neutr%pow_exchange%rec_sg (float) |
| rec_cp | bb_shield%hcll%hcll_bb%inboard%mod_neutr%pow_exchange%rec_cp (float) |
| pow_dens_fw | bb_shield%hcll%hcll_bb%inboard%mod_neutr%pow_exchange%pow_dens_fw (float) |
| pow_dens_bz | bb_shield%hcll%hcll_bb%inboard%mod_neutr%pow_exchange%pow_dens_bz (float) |
| pow_dens_bz10 | bb_shield%hcll%hcll_bb%inboard%mod_neutr%pow_exchange%pow_dens_bz10 (float) |
| pow_dens_bp | bb_shield%hcll%hcll_bb%inboard%mod_neutr%pow_exchange%pow_dens_bp (float) |
| pow_dens_man | bb_shield%hcll%hcll_bb%inboard%mod_neutr%pow_exchange%pow_dens_man (float) |
| pow_dens_sh | bb_shield%hcll%hcll_bb%inboard%mod_neutr%pow_exchange%pow_dens_sh (float) |
| mod_therm | bb_shield%hcll%hcll_bb%inboard%mod_therm (mode_therm) |
| he_fr | bb_shield%hcll%hcll_bb%inboard%mod_therm%he_fr (float) |
| perc_bp_he | bb_shield%hcll%hcll_bb%inboard%mod_therm%perc_bp_he (float) |
| he_out_t | bb_shield%hcll%hcll_bb%inboard%mod_therm%he_out_t (float) |
| fw_he_out_t | bb_shield%hcll%hcll_bb%inboard%mod_therm%fw_he_out_t (float) |
| sg_he_out_t | bb_shield%hcll%hcll_bb%inboard%mod_therm%sg_he_out_t (float) |
| cp_he_out_t | bb_shield%hcll%hcll_bb%inboard%mod_therm%cp_he_out_t (float) |
| fw_st_max_t | bb_shield%hcll%hcll_bb%inboard%mod_therm%fw_st_max_t (float) |
| sg_st_max_t | bb_shield%hcll%hcll_bb%inboard%mod_therm%sg_st_max_t (float) |
| cp_st_max_t | bb_shield%hcll%hcll_bb%inboard%mod_therm%cp_st_max_t (float) |
| mod_th_hyd | bb_shield%hcll%hcll_bb%inboard%mod_th_hyd (mode_th_hyd) |
| fw_dp_he | bb_shield%hcll%hcll_bb%inboard%mod_th_hyd%fw_dp_he (float) |
| sg_dp_he | bb_shield%hcll%hcll_bb%inboard%mod_th_hyd%sg_dp_he (float) |
| cp_dp_he | bb_shield%hcll%hcll_bb%inboard%mod_th_hyd%cp_dp_he (float) |
| man_dp_he | bb_shield%hcll%hcll_bb%inboard%mod_th_hyd%man_dp_he (float) |
| tot_dp_he | bb_shield%hcll%hcll_bb%inboard%mod_th_hyd%tot_dp_he (float) |
| bp_dp_he | bb_shield%hcll%hcll_bb%inboard%mod_th_hyd%bp_dp_he (float) |
| circ_dp_he | bb_shield%hcll%hcll_bb%inboard%mod_th_hyd%circ_dp_he (float) |
| mod_mech | bb_shield%hcll%hcll_bb%inboard%mod_mech (mode_mech) |
| fw_min_ts_mg | bb_shield%hcll%hcll_bb%inboard%mod_mech%fw_min_ts_mg (float) |
| fw_min_bd_mg | bb_shield%hcll%hcll_bb%inboard%mod_mech%fw_min_bd_mg (float) |
| sg_min_ts_mg | bb_shield%hcll%hcll_bb%inboard%mod_mech%sg_min_ts_mg (float) |
| sg_min_bd_mg | bb_shield%hcll%hcll_bb%inboard%mod_mech%sg_min_bd_mg (float) |
| cp_min_ts_mg | bb_shield%hcll%hcll_bb%inboard%mod_mech%cp_min_ts_mg (float) |
| cp_min_bd_mg | bb_shield%hcll%hcll_bb%inboard%mod_mech%cp_min_bd_mg (float) |
| min_ts_mg_ac | bb_shield%hcll%hcll_bb%inboard%mod_mech%min_ts_mg_ac (float) |
| min_bd_mg_ac | bb_shield%hcll%hcll_bb%inboard%mod_mech%min_bd_mg_ac (float) |
| mod_lipb | bb_shield%hcll%hcll_bb%inboard%mod_lipb (mode_lipb) |
| lp_rec_day | bb_shield%hcll%hcll_bb%inboard%mod_lipb%lp_rec_day (float) |
| bb_lp_fr | bb_shield%hcll%hcll_bb%inboard%mod_lipb%bb_lp_fr (vecflt_type) |
| lp_inl_p | bb_shield%hcll%hcll_bb%inboard%mod_lipb%lp_inl_p (float) |
| bu_dp_lp | bb_shield%hcll%hcll_bb%inboard%mod_lipb%bu_dp_lp (float) |
| man_dp_lp | bb_shield%hcll%hcll_bb%inboard%mod_lipb%man_dp_lp (float) |
| tot_dp_lp | bb_shield%hcll%hcll_bb%inboard%mod_lipb%tot_dp_lp (float) |
| bu_lp_ave_t | bb_shield%hcll%hcll_bb%inboard%mod_lipb%bu_lp_ave_t (float) |
| bu_lp_max_t | bb_shield%hcll%hcll_bb%inboard%mod_lipb%bu_lp_max_t (float) |
| mod_tritium | bb_shield%hcll%hcll_bb%inboard%mod_tritium (mode_tritium) |
| t_conc_lipb | bb_shield%hcll%hcll_bb%inboard%mod_tritium%t_conc_lipb (float) |
| t_conc_he | bb_shield%hcll%hcll_bb%inboard%mod_tritium%t_conc_he (float) |
| outboard | bb_shield%hcll%hcll_bb%outboard (hcllbb_specs) |
| mass | bb_shield%hcll%hcll_bb%outboard%mass (vecflt_type) |
| dr | bb_shield%hcll%hcll_bb%outboard%dr (vecflt_type) |
| mat | bb_shield%hcll%hcll_bb%outboard%mat (vecflt_type) |
| composition | bb_shield%hcll%hcll_bb%outboard%composition (matflt_type) |
| mod_geom | bb_shield%hcll%hcll_bb%outboard%mod_geom (bb_geometry) |
| dr_fw | bb_shield%hcll%hcll_bb%outboard%mod_geom%dr_fw (float) |
| dr_bz | bb_shield%hcll%hcll_bb%outboard%mod_geom%dr_bz (float) |
| dr_bp | bb_shield%hcll%hcll_bb%outboard%mod_geom%dr_bp (float) |
| dr_bp_plates | bb_shield%hcll%hcll_bb%outboard%mod_geom%dr_bp_plates (vecflt_type) |
| dr_bp_he | bb_shield%hcll%hcll_bb%outboard%mod_geom%dr_bp_he (vecflt_type) |
| dr_man | bb_shield%hcll%hcll_bb%outboard%mod_geom%dr_man (float) |
| dt_sw | bb_shield%hcll%hcll_bb%outboard%mod_geom%dt_sw (float) |
| dt_bz | bb_shield%hcll%hcll_bb%outboard%mod_geom%dt_bz (float) |
| dp_bz | bb_shield%hcll%hcll_bb%outboard%mod_geom%dp_bz (float) |
| top_cap_dim | bb_shield%hcll%hcll_bb%outboard%mod_geom%top_cap_dim (bb_dimension) |
| radial | bb_shield%hcll%hcll_bb%outboard%mod_geom%top_cap_dim%radial (vecflt_type) |
| toroidal | bb_shield%hcll%hcll_bb%outboard%mod_geom%top_cap_dim%toroidal (vecflt_type) |
| poloidal | bb_shield%hcll%hcll_bb%outboard%mod_geom%top_cap_dim%poloidal (vecflt_type) |
| bot_cap_dim | bb_shield%hcll%hcll_bb%outboard%mod_geom%bot_cap_dim (bb_dimension) |
| radial | bb_shield%hcll%hcll_bb%outboard%mod_geom%bot_cap_dim%radial (vecflt_type) |
| toroidal | bb_shield%hcll%hcll_bb%outboard%mod_geom%bot_cap_dim%toroidal (vecflt_type) |
| poloidal | bb_shield%hcll%hcll_bb%outboard%mod_geom%bot_cap_dim%poloidal (vecflt_type) |
| a_fw_ch | bb_shield%hcll%hcll_bb%outboard%mod_geom%a_fw_ch (float) |
| b_fw_ch | bb_shield%hcll%hcll_bb%outboard%mod_geom%b_fw_ch (float) |
| td_tc_ch | bb_shield%hcll%hcll_bb%outboard%mod_geom%td_tc_ch (float) |
| rd_tc_ch | bb_shield%hcll%hcll_bb%outboard%mod_geom%rd_tc_ch (float) |
| td_bc_ch | bb_shield%hcll%hcll_bb%outboard%mod_geom%td_bc_ch (float) |
| rd_bc_ch | bb_shield%hcll%hcll_bb%outboard%mod_geom%rd_bc_ch (float) |
| n_fw_ch | bb_shield%hcll%hcll_bb%outboard%mod_geom%n_fw_ch (float) |
| n_fw_circ | bb_shield%hcll%hcll_bb%outboard%mod_geom%n_fw_circ (float) |
| a_sg_ch | bb_shield%hcll%hcll_bb%outboard%mod_geom%a_sg_ch (float) |
| b_sg_ch | bb_shield%hcll%hcll_bb%outboard%mod_geom%b_sg_ch (float) |
| n_sg_ch | bb_shield%hcll%hcll_bb%outboard%mod_geom%n_sg_ch (float) |
| sg_thick | bb_shield%hcll%hcll_bb%outboard%mod_geom%sg_thick (float) |
| sg_weld | bb_shield%hcll%hcll_bb%outboard%mod_geom%sg_weld (float) |
| sg_in_out | bb_shield%hcll%hcll_bb%outboard%mod_geom%sg_in_out (float) |
| r_sg_cp | bb_shield%hcll%hcll_bb%outboard%mod_geom%r_sg_cp (float) |
| cp_tor_gap | bb_shield%hcll%hcll_bb%outboard%mod_geom%cp_tor_gap (float) |
| a_cp_ch | bb_shield%hcll%hcll_bb%outboard%mod_geom%a_cp_ch (float) |
| b_cp_ch | bb_shield%hcll%hcll_bb%outboard%mod_geom%b_cp_ch (float) |
| n_cp_ch | bb_shield%hcll%hcll_bb%outboard%mod_geom%n_cp_ch (float) |
| cp_thick | bb_shield%hcll%hcll_bb%outboard%mod_geom%cp_thick (float) |
| n_pol_bu | bb_shield%hcll%hcll_bb%outboard%mod_geom%n_pol_bu (float) |
| n_tor_bu | bb_shield%hcll%hcll_bb%outboard%mod_geom%n_tor_bu (float) |
| n_cp_bu | bb_shield%hcll%hcll_bb%outboard%mod_geom%n_cp_bu (float) |
| cp_in_out | bb_shield%hcll%hcll_bb%outboard%mod_geom%cp_in_out (float) |
| he_man_tck | bb_shield%hcll%hcll_bb%outboard%mod_geom%he_man_tck (float) |
| man_tck | bb_shield%hcll%hcll_bb%outboard%mod_geom%man_tck (float) |
| pbli_bptb_od | bb_shield%hcll%hcll_bb%outboard%mod_geom%pbli_bptb_od (float) |
| pbli_bptb_id | bb_shield%hcll%hcll_bb%outboard%mod_geom%pbli_bptb_id (float) |
| he_bptb_od | bb_shield%hcll%hcll_bb%outboard%mod_geom%he_bptb_od (float) |
| he_bptb_id | bb_shield%hcll%hcll_bb%outboard%mod_geom%he_bptb_id (float) |
| dr_max_fw | bb_shield%hcll%hcll_bb%outboard%mod_geom%dr_max_fw (float) |
| dr_fwpl | bb_shield%hcll%hcll_bb%outboard%mod_geom%dr_fwpl (float) |
| mod_neutr | bb_shield%hcll%hcll_bb%outboard%mod_neutr (mode_neutr) |
| r | bb_shield%hcll%hcll_bb%outboard%mod_neutr%r (vecflt_type) |
| pd_rad | bb_shield%hcll%hcll_bb%outboard%mod_neutr%pd_rad (vecflt_type) |
| lipb_coef_pd | bb_shield%hcll%hcll_bb%outboard%mod_neutr%lipb_coef_pd (vecflt_type) |
| steel_coef_pd | bb_shield%hcll%hcll_bb%outboard%mod_neutr%steel_coef_pd (vecflt_type) |
| pow_exchange | bb_shield%hcll%hcll_bb%outboard%mod_neutr%pow_exchange (power_exchange) |
| dep_pow | bb_shield%hcll%hcll_bb%outboard%mod_neutr%pow_exchange%dep_pow (vecflt_type) |
| dep_fw | bb_shield%hcll%hcll_bb%outboard%mod_neutr%pow_exchange%dep_fw (float) |
| dep_sg | bb_shield%hcll%hcll_bb%outboard%mod_neutr%pow_exchange%dep_sg (float) |
| dep_cp | bb_shield%hcll%hcll_bb%outboard%mod_neutr%pow_exchange%dep_cp (float) |
| dep_lp | bb_shield%hcll%hcll_bb%outboard%mod_neutr%pow_exchange%dep_lp (float) |
| dep_man | bb_shield%hcll%hcll_bb%outboard%mod_neutr%pow_exchange%dep_man (float) |
| dep_pl | bb_shield%hcll%hcll_bb%outboard%mod_neutr%pow_exchange%dep_pl (float) |
| rec_fw | bb_shield%hcll%hcll_bb%outboard%mod_neutr%pow_exchange%rec_fw (float) |
| rec_sg | bb_shield%hcll%hcll_bb%outboard%mod_neutr%pow_exchange%rec_sg (float) |
| rec_cp | bb_shield%hcll%hcll_bb%outboard%mod_neutr%pow_exchange%rec_cp (float) |
| pow_dens_fw | bb_shield%hcll%hcll_bb%outboard%mod_neutr%pow_exchange%pow_dens_fw (float) |
| pow_dens_bz | bb_shield%hcll%hcll_bb%outboard%mod_neutr%pow_exchange%pow_dens_bz (float) |
| pow_dens_bz10 | bb_shield%hcll%hcll_bb%outboard%mod_neutr%pow_exchange%pow_dens_bz10 (float) |
| pow_dens_bp | bb_shield%hcll%hcll_bb%outboard%mod_neutr%pow_exchange%pow_dens_bp (float) |
| pow_dens_man | bb_shield%hcll%hcll_bb%outboard%mod_neutr%pow_exchange%pow_dens_man (float) |
| pow_dens_sh | bb_shield%hcll%hcll_bb%outboard%mod_neutr%pow_exchange%pow_dens_sh (float) |
| mod_therm | bb_shield%hcll%hcll_bb%outboard%mod_therm (mode_therm) |
| he_fr | bb_shield%hcll%hcll_bb%outboard%mod_therm%he_fr (float) |
| perc_bp_he | bb_shield%hcll%hcll_bb%outboard%mod_therm%perc_bp_he (float) |
| he_out_t | bb_shield%hcll%hcll_bb%outboard%mod_therm%he_out_t (float) |
| fw_he_out_t | bb_shield%hcll%hcll_bb%outboard%mod_therm%fw_he_out_t (float) |
| sg_he_out_t | bb_shield%hcll%hcll_bb%outboard%mod_therm%sg_he_out_t (float) |
| cp_he_out_t | bb_shield%hcll%hcll_bb%outboard%mod_therm%cp_he_out_t (float) |
| fw_st_max_t | bb_shield%hcll%hcll_bb%outboard%mod_therm%fw_st_max_t (float) |
| sg_st_max_t | bb_shield%hcll%hcll_bb%outboard%mod_therm%sg_st_max_t (float) |
| cp_st_max_t | bb_shield%hcll%hcll_bb%outboard%mod_therm%cp_st_max_t (float) |
| mod_th_hyd | bb_shield%hcll%hcll_bb%outboard%mod_th_hyd (mode_th_hyd) |
| fw_dp_he | bb_shield%hcll%hcll_bb%outboard%mod_th_hyd%fw_dp_he (float) |
| sg_dp_he | bb_shield%hcll%hcll_bb%outboard%mod_th_hyd%sg_dp_he (float) |
| cp_dp_he | bb_shield%hcll%hcll_bb%outboard%mod_th_hyd%cp_dp_he (float) |
| man_dp_he | bb_shield%hcll%hcll_bb%outboard%mod_th_hyd%man_dp_he (float) |
| tot_dp_he | bb_shield%hcll%hcll_bb%outboard%mod_th_hyd%tot_dp_he (float) |
| bp_dp_he | bb_shield%hcll%hcll_bb%outboard%mod_th_hyd%bp_dp_he (float) |
| circ_dp_he | bb_shield%hcll%hcll_bb%outboard%mod_th_hyd%circ_dp_he (float) |
| mod_mech | bb_shield%hcll%hcll_bb%outboard%mod_mech (mode_mech) |
| fw_min_ts_mg | bb_shield%hcll%hcll_bb%outboard%mod_mech%fw_min_ts_mg (float) |
| fw_min_bd_mg | bb_shield%hcll%hcll_bb%outboard%mod_mech%fw_min_bd_mg (float) |
| sg_min_ts_mg | bb_shield%hcll%hcll_bb%outboard%mod_mech%sg_min_ts_mg (float) |
| sg_min_bd_mg | bb_shield%hcll%hcll_bb%outboard%mod_mech%sg_min_bd_mg (float) |
| cp_min_ts_mg | bb_shield%hcll%hcll_bb%outboard%mod_mech%cp_min_ts_mg (float) |
| cp_min_bd_mg | bb_shield%hcll%hcll_bb%outboard%mod_mech%cp_min_bd_mg (float) |
| min_ts_mg_ac | bb_shield%hcll%hcll_bb%outboard%mod_mech%min_ts_mg_ac (float) |
| min_bd_mg_ac | bb_shield%hcll%hcll_bb%outboard%mod_mech%min_bd_mg_ac (float) |
| mod_lipb | bb_shield%hcll%hcll_bb%outboard%mod_lipb (mode_lipb) |
| lp_rec_day | bb_shield%hcll%hcll_bb%outboard%mod_lipb%lp_rec_day (float) |
| bb_lp_fr | bb_shield%hcll%hcll_bb%outboard%mod_lipb%bb_lp_fr (vecflt_type) |
| lp_inl_p | bb_shield%hcll%hcll_bb%outboard%mod_lipb%lp_inl_p (float) |
| bu_dp_lp | bb_shield%hcll%hcll_bb%outboard%mod_lipb%bu_dp_lp (float) |
| man_dp_lp | bb_shield%hcll%hcll_bb%outboard%mod_lipb%man_dp_lp (float) |
| tot_dp_lp | bb_shield%hcll%hcll_bb%outboard%mod_lipb%tot_dp_lp (float) |
| bu_lp_ave_t | bb_shield%hcll%hcll_bb%outboard%mod_lipb%bu_lp_ave_t (float) |
| bu_lp_max_t | bb_shield%hcll%hcll_bb%outboard%mod_lipb%bu_lp_max_t (float) |
| mod_tritium | bb_shield%hcll%hcll_bb%outboard%mod_tritium (mode_tritium) |
| t_conc_lipb | bb_shield%hcll%hcll_bb%outboard%mod_tritium%t_conc_lipb (float) |
| t_conc_he | bb_shield%hcll%hcll_bb%outboard%mod_tritium%t_conc_he (float) |
| codeparam | bb_shield%codeparam (codeparam) |
| codename | bb_shield%codeparam%codename (string) |
| codeversion | bb_shield%codeparam%codeversion (string) |
| parameters | bb_shield%codeparam%parameters (string) |
| output_diag | bb_shield%codeparam%output_diag (string) |
| output_flag | bb_shield%codeparam%output_flag (integer) |
| time | bb_shield%time (float) |
| datainfo | compositionc%datainfo (datainfo) |
| dataprovider | compositionc%datainfo%dataprovider (string) |
| putdate | compositionc%datainfo%putdate (string) |
| source | compositionc%datainfo%source (string) |
| comment | compositionc%datainfo%comment (string) |
| cocos | compositionc%datainfo%cocos (integer) |
| id | compositionc%datainfo%id (integer) |
| isref | compositionc%datainfo%isref (integer) |
| whatref | compositionc%datainfo%whatref (whatref) |
| user | compositionc%datainfo%whatref%user (string) |
| machine | compositionc%datainfo%whatref%machine (string) |
| shot | compositionc%datainfo%whatref%shot (integer) |
| run | compositionc%datainfo%whatref%run (integer) |
| occurrence | compositionc%datainfo%whatref%occurrence (integer) |
| putinfo | compositionc%datainfo%putinfo (putinfo) |
| putmethod | compositionc%datainfo%putinfo%putmethod (string) |
| putaccess | compositionc%datainfo%putinfo%putaccess (string) |
| putlocation | compositionc%datainfo%putinfo%putlocation (string) |
| rights | compositionc%datainfo%putinfo%rights (string) |
| compositions | compositionc%compositions (compositions_type) |
| nuclei | compositionc%compositions%nuclei(:) (nuclei) |
| zn | compositionc%compositions%nuclei(:)%zn (float) |
| amn | compositionc%compositions%nuclei(:)%amn (float) |
| label | compositionc%compositions%nuclei(:)%label (string) |
| ions | compositionc%compositions%ions(:) (ions) |
| nucindex | compositionc%compositions%ions(:)%nucindex (integer) |
| zion | compositionc%compositions%ions(:)%zion (float) |
| imp_flag | compositionc%compositions%ions(:)%imp_flag (integer) |
| label | compositionc%compositions%ions(:)%label (string) |
| impurities | compositionc%compositions%impurities(:) (impurities) |
| nucindex | compositionc%compositions%impurities(:)%nucindex (integer) |
| i_ion | compositionc%compositions%impurities(:)%i_ion (integer) |
| nzimp | compositionc%compositions%impurities(:)%nzimp (integer) |
| zmin | compositionc%compositions%impurities(:)%zmin (vecflt_type) |
| zmax | compositionc%compositions%impurities(:)%zmax (vecflt_type) |
| label | compositionc%compositions%impurities(:)%label (vecstring_type) |
| neutralscomp | compositionc%compositions%neutralscomp(:) (composition_neutralscomp) |
| neutcomp | compositionc%compositions%neutralscomp(:)%neutcomp(:) (composition_neutrals_neutcomp) |
| nucindex | compositionc%compositions%neutralscomp(:)%neutcomp(:)%nucindex (integer) |
| multiplicity | compositionc%compositions%neutralscomp(:)%neutcomp(:)%multiplicity (integer) |
| type | compositionc%compositions%neutralscomp(:)%type(:) (identifier) |
| id | compositionc%compositions%neutralscomp(:)%type(:)%id (string) |
| flag | compositionc%compositions%neutralscomp(:)%type(:)%flag (integer) |
| description | compositionc%compositions%neutralscomp(:)%type(:)%description (string) |
| label | compositionc%compositions%neutralscomp(:)%label (string) |
| edgespecies | compositionc%compositions%edgespecies(:) (edgespecies) |
| nucindex | compositionc%compositions%edgespecies(:)%nucindex (integer) |
| zmin | compositionc%compositions%edgespecies(:)%zmin (float) |
| zmax | compositionc%compositions%edgespecies(:)%zmax (float) |
| label | compositionc%compositions%edgespecies(:)%label (string) |
| signature | compositionc%compositions%signature (identifier) |
| id | compositionc%compositions%signature%id (string) |
| flag | compositionc%compositions%signature%flag (integer) |
| description | compositionc%compositions%signature%description (string) |
| codeparam | compositionc%codeparam (codeparam) |
| codename | compositionc%codeparam%codename (string) |
| codeversion | compositionc%codeparam%codeversion (string) |
| parameters | compositionc%codeparam%parameters (string) |
| output_diag | compositionc%codeparam%output_diag (string) |
| output_flag | compositionc%codeparam%output_flag (integer) |
| time | compositionc%time (float) |
| datainfo | coredelta%datainfo (datainfo) |
| dataprovider | coredelta%datainfo%dataprovider (string) |
| putdate | coredelta%datainfo%putdate (string) |
| source | coredelta%datainfo%source (string) |
| comment | coredelta%datainfo%comment (string) |
| cocos | coredelta%datainfo%cocos (integer) |
| id | coredelta%datainfo%id (integer) |
| isref | coredelta%datainfo%isref (integer) |
| whatref | coredelta%datainfo%whatref (whatref) |
| user | coredelta%datainfo%whatref%user (string) |
| machine | coredelta%datainfo%whatref%machine (string) |
| shot | coredelta%datainfo%whatref%shot (integer) |
| run | coredelta%datainfo%whatref%run (integer) |
| occurrence | coredelta%datainfo%whatref%occurrence (integer) |
| putinfo | coredelta%datainfo%putinfo (putinfo) |
| putmethod | coredelta%datainfo%putinfo%putmethod (string) |
| putaccess | coredelta%datainfo%putinfo%putaccess (string) |
| putlocation | coredelta%datainfo%putinfo%putlocation (string) |
| rights | coredelta%datainfo%putinfo%rights (string) |
| composition | coredelta%composition (composition) |
| amn | coredelta%composition%amn (vecflt_type) |
| zn | coredelta%composition%zn (vecflt_type) |
| zion | coredelta%composition%zion (vecflt_type) |
| imp_flag | coredelta%composition%imp_flag (vecint_type) |
| label | coredelta%composition%label (vecstring_type) |
| desc_impur | coredelta%desc_impur (desc_impur) |
| amn | coredelta%desc_impur%amn (vecflt_type) |
| zn | coredelta%desc_impur%zn (vecint_type) |
| i_ion | coredelta%desc_impur%i_ion (vecint_type) |
| nzimp | coredelta%desc_impur%nzimp (vecint_type) |
| zmin | coredelta%desc_impur%zmin (matint_type) |
| zmax | coredelta%desc_impur%zmax (matint_type) |
| label | coredelta%desc_impur%label (vecstring_type) |
| compositions | coredelta%compositions (compositions_type) |
| nuclei | coredelta%compositions%nuclei(:) (nuclei) |
| zn | coredelta%compositions%nuclei(:)%zn (float) |
| amn | coredelta%compositions%nuclei(:)%amn (float) |
| label | coredelta%compositions%nuclei(:)%label (string) |
| ions | coredelta%compositions%ions(:) (ions) |
| nucindex | coredelta%compositions%ions(:)%nucindex (integer) |
| zion | coredelta%compositions%ions(:)%zion (float) |
| imp_flag | coredelta%compositions%ions(:)%imp_flag (integer) |
| label | coredelta%compositions%ions(:)%label (string) |
| impurities | coredelta%compositions%impurities(:) (impurities) |
| nucindex | coredelta%compositions%impurities(:)%nucindex (integer) |
| i_ion | coredelta%compositions%impurities(:)%i_ion (integer) |
| nzimp | coredelta%compositions%impurities(:)%nzimp (integer) |
| zmin | coredelta%compositions%impurities(:)%zmin (vecflt_type) |
| zmax | coredelta%compositions%impurities(:)%zmax (vecflt_type) |
| label | coredelta%compositions%impurities(:)%label (vecstring_type) |
| neutralscomp | coredelta%compositions%neutralscomp(:) (composition_neutralscomp) |
| neutcomp | coredelta%compositions%neutralscomp(:)%neutcomp(:) (composition_neutrals_neutcomp) |
| nucindex | coredelta%compositions%neutralscomp(:)%neutcomp(:)%nucindex (integer) |
| multiplicity | coredelta%compositions%neutralscomp(:)%neutcomp(:)%multiplicity (integer) |
| type | coredelta%compositions%neutralscomp(:)%type(:) (identifier) |
| id | coredelta%compositions%neutralscomp(:)%type(:)%id (string) |
| flag | coredelta%compositions%neutralscomp(:)%type(:)%flag (integer) |
| description | coredelta%compositions%neutralscomp(:)%type(:)%description (string) |
| label | coredelta%compositions%neutralscomp(:)%label (string) |
| edgespecies | coredelta%compositions%edgespecies(:) (edgespecies) |
| nucindex | coredelta%compositions%edgespecies(:)%nucindex (integer) |
| zmin | coredelta%compositions%edgespecies(:)%zmin (float) |
| zmax | coredelta%compositions%edgespecies(:)%zmax (float) |
| label | coredelta%compositions%edgespecies(:)%label (string) |
| signature | coredelta%compositions%signature (identifier) |
| id | coredelta%compositions%signature%id (string) |
| flag | coredelta%compositions%signature%flag (integer) |
| description | coredelta%compositions%signature%description (string) |
| values | coredelta%values(:) (coredelta_values) |
| deltaid | coredelta%values(:)%deltaid (identifier) |
| id | coredelta%values(:)%deltaid%id (string) |
| flag | coredelta%values(:)%deltaid%flag (integer) |
| description | coredelta%values(:)%deltaid%description (string) |
| rho_tor | coredelta%values(:)%rho_tor (vecflt_type) |
| rho_tor_norm | coredelta%values(:)%rho_tor_norm (vecflt_type) |
| psi | coredelta%values(:)%psi (vecflt_type) |
| volume | coredelta%values(:)%volume (vecflt_type) |
| area | coredelta%values(:)%area (vecflt_type) |
| delta_psi | coredelta%values(:)%delta_psi (vecflt_type) |
| delta_te | coredelta%values(:)%delta_te (vecflt_type) |
| delta_ti | coredelta%values(:)%delta_ti (matflt_type) |
| delta_tz | coredelta%values(:)%delta_tz (array3dflt_type) |
| delta_ne | coredelta%values(:)%delta_ne (vecflt_type) |
| delta_ni | coredelta%values(:)%delta_ni (matflt_type) |
| delta_nz | coredelta%values(:)%delta_nz (array3dflt_type) |
| delta_vtor | coredelta%values(:)%delta_vtor (matflt_type) |
| codeparam | coredelta%values(:)%codeparam (codeparam) |
| codename | coredelta%values(:)%codeparam%codename (string) |
| codeversion | coredelta%values(:)%codeparam%codeversion (string) |
| parameters | coredelta%values(:)%codeparam%parameters (string) |
| output_diag | coredelta%values(:)%codeparam%output_diag (string) |
| output_flag | coredelta%values(:)%codeparam%output_flag (integer) |
| codeparam | coredelta%codeparam (codeparam) |
| codename | coredelta%codeparam%codename (string) |
| codeversion | coredelta%codeparam%codeversion (string) |
| parameters | coredelta%codeparam%parameters (string) |
| output_diag | coredelta%codeparam%output_diag (string) |
| output_flag | coredelta%codeparam%output_flag (integer) |
| time | coredelta%time (float) |
| datainfo | corefast%datainfo (datainfo) |
| dataprovider | corefast%datainfo%dataprovider (string) |
| putdate | corefast%datainfo%putdate (string) |
| source | corefast%datainfo%source (string) |
| comment | corefast%datainfo%comment (string) |
| cocos | corefast%datainfo%cocos (integer) |
| id | corefast%datainfo%id (integer) |
| isref | corefast%datainfo%isref (integer) |
| whatref | corefast%datainfo%whatref (whatref) |
| user | corefast%datainfo%whatref%user (string) |
| machine | corefast%datainfo%whatref%machine (string) |
| shot | corefast%datainfo%whatref%shot (integer) |
| run | corefast%datainfo%whatref%run (integer) |
| occurrence | corefast%datainfo%whatref%occurrence (integer) |
| putinfo | corefast%datainfo%putinfo (putinfo) |
| putmethod | corefast%datainfo%putinfo%putmethod (string) |
| putaccess | corefast%datainfo%putinfo%putaccess (string) |
| putlocation | corefast%datainfo%putinfo%putlocation (string) |
| rights | corefast%datainfo%putinfo%rights (string) |
| composition | corefast%composition (composition) |
| amn | corefast%composition%amn (vecflt_type) |
| zn | corefast%composition%zn (vecflt_type) |
| zion | corefast%composition%zion (vecflt_type) |
| imp_flag | corefast%composition%imp_flag (vecint_type) |
| label | corefast%composition%label (vecstring_type) |
| desc_impur | corefast%desc_impur (desc_impur) |
| amn | corefast%desc_impur%amn (vecflt_type) |
| zn | corefast%desc_impur%zn (vecint_type) |
| i_ion | corefast%desc_impur%i_ion (vecint_type) |
| nzimp | corefast%desc_impur%nzimp (vecint_type) |
| zmin | corefast%desc_impur%zmin (matint_type) |
| zmax | corefast%desc_impur%zmax (matint_type) |
| label | corefast%desc_impur%label (vecstring_type) |
| compositions | corefast%compositions (compositions_type) |
| nuclei | corefast%compositions%nuclei(:) (nuclei) |
| zn | corefast%compositions%nuclei(:)%zn (float) |
| amn | corefast%compositions%nuclei(:)%amn (float) |
| label | corefast%compositions%nuclei(:)%label (string) |
| ions | corefast%compositions%ions(:) (ions) |
| nucindex | corefast%compositions%ions(:)%nucindex (integer) |
| zion | corefast%compositions%ions(:)%zion (float) |
| imp_flag | corefast%compositions%ions(:)%imp_flag (integer) |
| label | corefast%compositions%ions(:)%label (string) |
| impurities | corefast%compositions%impurities(:) (impurities) |
| nucindex | corefast%compositions%impurities(:)%nucindex (integer) |
| i_ion | corefast%compositions%impurities(:)%i_ion (integer) |
| nzimp | corefast%compositions%impurities(:)%nzimp (integer) |
| zmin | corefast%compositions%impurities(:)%zmin (vecflt_type) |
| zmax | corefast%compositions%impurities(:)%zmax (vecflt_type) |
| label | corefast%compositions%impurities(:)%label (vecstring_type) |
| neutralscomp | corefast%compositions%neutralscomp(:) (composition_neutralscomp) |
| neutcomp | corefast%compositions%neutralscomp(:)%neutcomp(:) (composition_neutrals_neutcomp) |
| nucindex | corefast%compositions%neutralscomp(:)%neutcomp(:)%nucindex (integer) |
| multiplicity | corefast%compositions%neutralscomp(:)%neutcomp(:)%multiplicity (integer) |
| type | corefast%compositions%neutralscomp(:)%type(:) (identifier) |
| id | corefast%compositions%neutralscomp(:)%type(:)%id (string) |
| flag | corefast%compositions%neutralscomp(:)%type(:)%flag (integer) |
| description | corefast%compositions%neutralscomp(:)%type(:)%description (string) |
| label | corefast%compositions%neutralscomp(:)%label (string) |
| edgespecies | corefast%compositions%edgespecies(:) (edgespecies) |
| nucindex | corefast%compositions%edgespecies(:)%nucindex (integer) |
| zmin | corefast%compositions%edgespecies(:)%zmin (float) |
| zmax | corefast%compositions%edgespecies(:)%zmax (float) |
| label | corefast%compositions%edgespecies(:)%label (string) |
| signature | corefast%compositions%signature (identifier) |
| id | corefast%compositions%signature%id (string) |
| flag | corefast%compositions%signature%flag (integer) |
| description | corefast%compositions%signature%description (string) |
| toroid_field | corefast%toroid_field (b0r0) |
| r0 | corefast%toroid_field%r0 (float) |
| b0 | corefast%toroid_field%b0 (float) |
| values | corefast%values(:) (corefast_values) |
| fastid | corefast%values(:)%fastid (identifier) |
| id | corefast%values(:)%fastid%id (string) |
| flag | corefast%values(:)%fastid%flag (integer) |
| description | corefast%values(:)%fastid%description (string) |
| filter | corefast%values(:)%filter (fast_thermal_separation_filter) |
| method | corefast%values(:)%filter%method (identifier) |
| id | corefast%values(:)%filter%method%id (string) |
| flag | corefast%values(:)%filter%method%flag (integer) |
| description | corefast%values(:)%filter%method%description (string) |
| energy_sep | corefast%values(:)%filter%energy_sep (vecflt_type) |
| rho_tor | corefast%values(:)%rho_tor (vecflt_type) |
| rho_tor_norm | corefast%values(:)%rho_tor_norm (vecflt_type) |
| psi | corefast%values(:)%psi (vecflt_type) |
| volume | corefast%values(:)%volume (vecflt_type) |
| area | corefast%values(:)%area (vecflt_type) |
| j | corefast%values(:)%j (vecflt_type) |
| sigma | corefast%values(:)%sigma (vecflt_type) |
| ni | corefast%values(:)%ni (matflt_type) |
| ne | corefast%values(:)%ne (vecflt_type) |
| nz | corefast%values(:)%nz (matflt_type) |
| pi | corefast%values(:)%pi (matflt_type) |
| pe | corefast%values(:)%pe (vecflt_type) |
| pz | corefast%values(:)%pz (matflt_type) |
| pi_para | corefast%values(:)%pi_para (matflt_type) |
| pe_para | corefast%values(:)%pe_para (vecflt_type) |
| pz_para | corefast%values(:)%pz_para (matflt_type) |
| ui | corefast%values(:)%ui (matflt_type) |
| uz | corefast%values(:)%uz (matflt_type) |
| codeparam | corefast%values(:)%codeparam (codeparam) |
| codename | corefast%values(:)%codeparam%codename (string) |
| codeversion | corefast%values(:)%codeparam%codeversion (string) |
| parameters | corefast%values(:)%codeparam%parameters (string) |
| output_diag | corefast%values(:)%codeparam%output_diag (string) |
| output_flag | corefast%values(:)%codeparam%output_flag (integer) |
| codeparam | corefast%codeparam (codeparam) |
| codename | corefast%codeparam%codename (string) |
| codeversion | corefast%codeparam%codeversion (string) |
| parameters | corefast%codeparam%parameters (string) |
| output_diag | corefast%codeparam%output_diag (string) |
| output_flag | corefast%codeparam%output_flag (integer) |
| time | corefast%time (float) |
| datainfo | coreimpur%datainfo (datainfo) |
| dataprovider | coreimpur%datainfo%dataprovider (string) |
| putdate | coreimpur%datainfo%putdate (string) |
| source | coreimpur%datainfo%source (string) |
| comment | coreimpur%datainfo%comment (string) |
| cocos | coreimpur%datainfo%cocos (integer) |
| id | coreimpur%datainfo%id (integer) |
| isref | coreimpur%datainfo%isref (integer) |
| whatref | coreimpur%datainfo%whatref (whatref) |
| user | coreimpur%datainfo%whatref%user (string) |
| machine | coreimpur%datainfo%whatref%machine (string) |
| shot | coreimpur%datainfo%whatref%shot (integer) |
| run | coreimpur%datainfo%whatref%run (integer) |
| occurrence | coreimpur%datainfo%whatref%occurrence (integer) |
| putinfo | coreimpur%datainfo%putinfo (putinfo) |
| putmethod | coreimpur%datainfo%putinfo%putmethod (string) |
| putaccess | coreimpur%datainfo%putinfo%putaccess (string) |
| putlocation | coreimpur%datainfo%putinfo%putlocation (string) |
| rights | coreimpur%datainfo%putinfo%rights (string) |
| rho_tor_norm | coreimpur%rho_tor_norm (vecflt_type) |
| rho_tor | coreimpur%rho_tor (vecflt_type) |
| psi | coreimpur%psi (vecflt_type) |
| volume | coreimpur%volume (vecflt_type) |
| area | coreimpur%area (vecflt_type) |
| source | coreimpur%source (vecstring_type) |
| flag | coreimpur%flag (vecint_type) |
| desc_impur | coreimpur%desc_impur (desc_impur) |
| amn | coreimpur%desc_impur%amn (vecflt_type) |
| zn | coreimpur%desc_impur%zn (vecint_type) |
| i_ion | coreimpur%desc_impur%i_ion (vecint_type) |
| nzimp | coreimpur%desc_impur%nzimp (vecint_type) |
| zmin | coreimpur%desc_impur%zmin (matint_type) |
| zmax | coreimpur%desc_impur%zmax (matint_type) |
| label | coreimpur%desc_impur%label (vecstring_type) |
| compositions | coreimpur%compositions (compositions_type) |
| nuclei | coreimpur%compositions%nuclei(:) (nuclei) |
| zn | coreimpur%compositions%nuclei(:)%zn (float) |
| amn | coreimpur%compositions%nuclei(:)%amn (float) |
| label | coreimpur%compositions%nuclei(:)%label (string) |
| ions | coreimpur%compositions%ions(:) (ions) |
| nucindex | coreimpur%compositions%ions(:)%nucindex (integer) |
| zion | coreimpur%compositions%ions(:)%zion (float) |
| imp_flag | coreimpur%compositions%ions(:)%imp_flag (integer) |
| label | coreimpur%compositions%ions(:)%label (string) |
| impurities | coreimpur%compositions%impurities(:) (impurities) |
| nucindex | coreimpur%compositions%impurities(:)%nucindex (integer) |
| i_ion | coreimpur%compositions%impurities(:)%i_ion (integer) |
| nzimp | coreimpur%compositions%impurities(:)%nzimp (integer) |
| zmin | coreimpur%compositions%impurities(:)%zmin (vecflt_type) |
| zmax | coreimpur%compositions%impurities(:)%zmax (vecflt_type) |
| label | coreimpur%compositions%impurities(:)%label (vecstring_type) |
| neutralscomp | coreimpur%compositions%neutralscomp(:) (composition_neutralscomp) |
| neutcomp | coreimpur%compositions%neutralscomp(:)%neutcomp(:) (composition_neutrals_neutcomp) |
| nucindex | coreimpur%compositions%neutralscomp(:)%neutcomp(:)%nucindex (integer) |
| multiplicity | coreimpur%compositions%neutralscomp(:)%neutcomp(:)%multiplicity (integer) |
| type | coreimpur%compositions%neutralscomp(:)%type(:) (identifier) |
| id | coreimpur%compositions%neutralscomp(:)%type(:)%id (string) |
| flag | coreimpur%compositions%neutralscomp(:)%type(:)%flag (integer) |
| description | coreimpur%compositions%neutralscomp(:)%type(:)%description (string) |
| label | coreimpur%compositions%neutralscomp(:)%label (string) |
| edgespecies | coreimpur%compositions%edgespecies(:) (edgespecies) |
| nucindex | coreimpur%compositions%edgespecies(:)%nucindex (integer) |
| zmin | coreimpur%compositions%edgespecies(:)%zmin (float) |
| zmax | coreimpur%compositions%edgespecies(:)%zmax (float) |
| label | coreimpur%compositions%edgespecies(:)%label (string) |
| signature | coreimpur%compositions%signature (identifier) |
| id | coreimpur%compositions%signature%id (string) |
| flag | coreimpur%compositions%signature%flag (integer) |
| description | coreimpur%compositions%signature%description (string) |
| atomic_data | coreimpur%atomic_data (vecstring_type) |
| impurity | coreimpur%impurity(:) (impurity_type) |
| z | coreimpur%impurity(:)%z (matflt_type) |
| zsq | coreimpur%impurity(:)%zsq (matflt_type) |
| nz | coreimpur%impurity(:)%nz (matflt_type) |
| tz | coreimpur%impurity(:)%tz (matflt_type) |
| source_term | coreimpur%impurity(:)%source_term (sourceimp) |
| value | coreimpur%impurity(:)%source_term%value (matflt_type) |
| integral | coreimpur%impurity(:)%source_term%integral (matflt_type) |
| source | coreimpur%impurity(:)%source_term%source (vecstring_type) |
| boundary | coreimpur%impurity(:)%boundary (boundaryimp) |
| value | coreimpur%impurity(:)%boundary%value (matflt_type) |
| source | coreimpur%impurity(:)%boundary%source (string) |
| type | coreimpur%impurity(:)%boundary%type (vecint_type) |
| rho | coreimpur%impurity(:)%boundary%rho (vecflt_type) |
| codeparam | coreimpur%impurity(:)%boundary%codeparam (codeparam) |
| codename | coreimpur%impurity(:)%boundary%codeparam%codename (string) |
| codeversion | coreimpur%impurity(:)%boundary%codeparam%codeversion (string) |
| parameters | coreimpur%impurity(:)%boundary%codeparam%parameters (string) |
| output_diag | coreimpur%impurity(:)%boundary%codeparam%output_diag (string) |
| output_flag | coreimpur%impurity(:)%boundary%codeparam%output_flag (integer) |
| transp_coef | coreimpur%impurity(:)%transp_coef (coretransimp) |
| diff | coreimpur%impurity(:)%transp_coef%diff (matflt_type) |
| vconv | coreimpur%impurity(:)%transp_coef%vconv (matflt_type) |
| source | coreimpur%impurity(:)%transp_coef%source (vecstring_type) |
| flux | coreimpur%impurity(:)%flux (fluximp) |
| flux_dv | coreimpur%impurity(:)%flux%flux_dv (matflt_type) |
| flux_interp | coreimpur%impurity(:)%flux%flux_interp (matflt_type) |
| time_deriv | coreimpur%impurity(:)%time_deriv (matflt_type) |
| diagnostic | coreimpur%impurity(:)%diagnostic (coreimpurediag_type) |
| radiation | coreimpur%impurity(:)%diagnostic%radiation (coreimpurediag_radiation) |
| line_rad | coreimpur%impurity(:)%diagnostic%radiation%line_rad (coreimpurediagprof_type) |
| profile | coreimpur%impurity(:)%diagnostic%radiation%line_rad%profile (matflt_type) |
| integral | coreimpur%impurity(:)%diagnostic%radiation%line_rad%integral (matflt_type) |
| brem_radrec | coreimpur%impurity(:)%diagnostic%radiation%brem_radrec (coreimpurediagprof_type) |
| profile | coreimpur%impurity(:)%diagnostic%radiation%brem_radrec%profile (matflt_type) |
| integral | coreimpur%impurity(:)%diagnostic%radiation%brem_radrec%integral (matflt_type) |
| sum | coreimpur%impurity(:)%diagnostic%radiation%sum (coreimpurediagprof_type) |
| profile | coreimpur%impurity(:)%diagnostic%radiation%sum%profile (matflt_type) |
| integral | coreimpur%impurity(:)%diagnostic%radiation%sum%integral (matflt_type) |
| energy | coreimpur%impurity(:)%diagnostic%energy (coreimpurediag_energy) |
| ionization | coreimpur%impurity(:)%diagnostic%energy%ionization (coreimpurediagprof_type) |
| profile | coreimpur%impurity(:)%diagnostic%energy%ionization%profile (matflt_type) |
| integral | coreimpur%impurity(:)%diagnostic%energy%ionization%integral (matflt_type) |
| recombin | coreimpur%impurity(:)%diagnostic%energy%recombin (coreimpurediagprof_type) |
| profile | coreimpur%impurity(:)%diagnostic%energy%recombin%profile (matflt_type) |
| integral | coreimpur%impurity(:)%diagnostic%energy%recombin%integral (matflt_type) |
| sum | coreimpur%impurity(:)%diagnostic%energy%sum (coreimpurediagprof_type) |
| profile | coreimpur%impurity(:)%diagnostic%energy%sum%profile (matflt_type) |
| integral | coreimpur%impurity(:)%diagnostic%energy%sum%integral (matflt_type) |
| diagnostic | coreimpur%diagnostic (coreimpurediag_type) |
| radiation | coreimpur%diagnostic%radiation (coreimpurediag_radiation) |
| line_rad | coreimpur%diagnostic%radiation%line_rad (coreimpurediagprof_type) |
| profile | coreimpur%diagnostic%radiation%line_rad%profile (matflt_type) |
| integral | coreimpur%diagnostic%radiation%line_rad%integral (matflt_type) |
| brem_radrec | coreimpur%diagnostic%radiation%brem_radrec (coreimpurediagprof_type) |
| profile | coreimpur%diagnostic%radiation%brem_radrec%profile (matflt_type) |
| integral | coreimpur%diagnostic%radiation%brem_radrec%integral (matflt_type) |
| sum | coreimpur%diagnostic%radiation%sum (coreimpurediagprof_type) |
| profile | coreimpur%diagnostic%radiation%sum%profile (matflt_type) |
| integral | coreimpur%diagnostic%radiation%sum%integral (matflt_type) |
| energy | coreimpur%diagnostic%energy (coreimpurediag_energy) |
| ionization | coreimpur%diagnostic%energy%ionization (coreimpurediagprof_type) |
| profile | coreimpur%diagnostic%energy%ionization%profile (matflt_type) |
| integral | coreimpur%diagnostic%energy%ionization%integral (matflt_type) |
| recombin | coreimpur%diagnostic%energy%recombin (coreimpurediagprof_type) |
| profile | coreimpur%diagnostic%energy%recombin%profile (matflt_type) |
| integral | coreimpur%diagnostic%energy%recombin%integral (matflt_type) |
| sum | coreimpur%diagnostic%energy%sum (coreimpurediagprof_type) |
| profile | coreimpur%diagnostic%energy%sum%profile (matflt_type) |
| integral | coreimpur%diagnostic%energy%sum%integral (matflt_type) |
| diagnosticsum | coreimpur%diagnosticsum (coreimpurediag_sum) |
| radiation | coreimpur%diagnosticsum%radiation (coreimpurdiag_sum_radiation) |
| line_rad | coreimpur%diagnosticsum%radiation%line_rad (coreimpurediagsum_type) |
| profile | coreimpur%diagnosticsum%radiation%line_rad%profile (vecflt_type) |
| integral | coreimpur%diagnosticsum%radiation%line_rad%integral (vecflt_type) |
| brem_radrec | coreimpur%diagnosticsum%radiation%brem_radrec (coreimpurediagsum_type) |
| profile | coreimpur%diagnosticsum%radiation%brem_radrec%profile (vecflt_type) |
| integral | coreimpur%diagnosticsum%radiation%brem_radrec%integral (vecflt_type) |
| sum | coreimpur%diagnosticsum%radiation%sum (coreimpurediagsum_type) |
| profile | coreimpur%diagnosticsum%radiation%sum%profile (vecflt_type) |
| integral | coreimpur%diagnosticsum%radiation%sum%integral (vecflt_type) |
| energy | coreimpur%diagnosticsum%energy (coreimpurediag_sum_energy) |
| ionization | coreimpur%diagnosticsum%energy%ionization (coreimpurediagsum_type) |
| profile | coreimpur%diagnosticsum%energy%ionization%profile (vecflt_type) |
| integral | coreimpur%diagnosticsum%energy%ionization%integral (vecflt_type) |
| recombin | coreimpur%diagnosticsum%energy%recombin (coreimpurediagsum_type) |
| profile | coreimpur%diagnosticsum%energy%recombin%profile (vecflt_type) |
| integral | coreimpur%diagnosticsum%energy%recombin%integral (vecflt_type) |
| sum | coreimpur%diagnosticsum%energy%sum (coreimpurediagsum_type) |
| profile | coreimpur%diagnosticsum%energy%sum%profile (vecflt_type) |
| integral | coreimpur%diagnosticsum%energy%sum%integral (vecflt_type) |
| codeparam | coreimpur%codeparam (codeparam) |
| codename | coreimpur%codeparam%codename (string) |
| codeversion | coreimpur%codeparam%codeversion (string) |
| parameters | coreimpur%codeparam%parameters (string) |
| output_diag | coreimpur%codeparam%output_diag (string) |
| output_flag | coreimpur%codeparam%output_flag (integer) |
| time | coreimpur%time (float) |
| datainfo | coreneutrals%datainfo (datainfo) |
| dataprovider | coreneutrals%datainfo%dataprovider (string) |
| putdate | coreneutrals%datainfo%putdate (string) |
| source | coreneutrals%datainfo%source (string) |
| comment | coreneutrals%datainfo%comment (string) |
| cocos | coreneutrals%datainfo%cocos (integer) |
| id | coreneutrals%datainfo%id (integer) |
| isref | coreneutrals%datainfo%isref (integer) |
| whatref | coreneutrals%datainfo%whatref (whatref) |
| user | coreneutrals%datainfo%whatref%user (string) |
| machine | coreneutrals%datainfo%whatref%machine (string) |
| shot | coreneutrals%datainfo%whatref%shot (integer) |
| run | coreneutrals%datainfo%whatref%run (integer) |
| occurrence | coreneutrals%datainfo%whatref%occurrence (integer) |
| putinfo | coreneutrals%datainfo%putinfo (putinfo) |
| putmethod | coreneutrals%datainfo%putinfo%putmethod (string) |
| putaccess | coreneutrals%datainfo%putinfo%putaccess (string) |
| putlocation | coreneutrals%datainfo%putinfo%putlocation (string) |
| rights | coreneutrals%datainfo%putinfo%rights (string) |
| rho_tor | coreneutrals%rho_tor (vecflt_type) |
| rho_tor_norm | coreneutrals%rho_tor_norm (vecflt_type) |
| psi | coreneutrals%psi (vecflt_type) |
| volume | coreneutrals%volume (vecflt_type) |
| area | coreneutrals%area (vecflt_type) |
| neutcompo | coreneutrals%neutcompo (composition_neutrals) |
| atomlist | coreneutrals%neutcompo%atomlist(:) (coreneutrals_atomlist) |
| amn | coreneutrals%neutcompo%atomlist(:)%amn (float) |
| zn | coreneutrals%neutcompo%atomlist(:)%zn (float) |
| ionimptype | coreneutrals%neutcompo%atomlist(:)%ionimptype (identifier) |
| id | coreneutrals%neutcompo%atomlist(:)%ionimptype%id (string) |
| flag | coreneutrals%neutcompo%atomlist(:)%ionimptype%flag (integer) |
| description | coreneutrals%neutcompo%atomlist(:)%ionimptype%description (string) |
| ionimpindex | coreneutrals%neutcompo%atomlist(:)%ionimpindex (integer) |
| neutral | coreneutrals%neutcompo%neutral(:) (composition_neutralscomp) |
| neutcomp | coreneutrals%neutcompo%neutral(:)%neutcomp(:) (composition_neutrals_neutcomp) |
| nucindex | coreneutrals%neutcompo%neutral(:)%neutcomp(:)%nucindex (integer) |
| multiplicity | coreneutrals%neutcompo%neutral(:)%neutcomp(:)%multiplicity (integer) |
| type | coreneutrals%neutcompo%neutral(:)%type(:) (identifier) |
| id | coreneutrals%neutcompo%neutral(:)%type(:)%id (string) |
| flag | coreneutrals%neutcompo%neutral(:)%type(:)%flag (integer) |
| description | coreneutrals%neutcompo%neutral(:)%type(:)%description (string) |
| label | coreneutrals%neutcompo%neutral(:)%label (string) |
| composition | coreneutrals%composition (composition) |
| amn | coreneutrals%composition%amn (vecflt_type) |
| zn | coreneutrals%composition%zn (vecflt_type) |
| zion | coreneutrals%composition%zion (vecflt_type) |
| imp_flag | coreneutrals%composition%imp_flag (vecint_type) |
| label | coreneutrals%composition%label (vecstring_type) |
| desc_impur | coreneutrals%desc_impur (desc_impur) |
| amn | coreneutrals%desc_impur%amn (vecflt_type) |
| zn | coreneutrals%desc_impur%zn (vecint_type) |
| i_ion | coreneutrals%desc_impur%i_ion (vecint_type) |
| nzimp | coreneutrals%desc_impur%nzimp (vecint_type) |
| zmin | coreneutrals%desc_impur%zmin (matint_type) |
| zmax | coreneutrals%desc_impur%zmax (matint_type) |
| label | coreneutrals%desc_impur%label (vecstring_type) |
| compositions | coreneutrals%compositions (compositions_type) |
| nuclei | coreneutrals%compositions%nuclei(:) (nuclei) |
| zn | coreneutrals%compositions%nuclei(:)%zn (float) |
| amn | coreneutrals%compositions%nuclei(:)%amn (float) |
| label | coreneutrals%compositions%nuclei(:)%label (string) |
| ions | coreneutrals%compositions%ions(:) (ions) |
| nucindex | coreneutrals%compositions%ions(:)%nucindex (integer) |
| zion | coreneutrals%compositions%ions(:)%zion (float) |
| imp_flag | coreneutrals%compositions%ions(:)%imp_flag (integer) |
| label | coreneutrals%compositions%ions(:)%label (string) |
| impurities | coreneutrals%compositions%impurities(:) (impurities) |
| nucindex | coreneutrals%compositions%impurities(:)%nucindex (integer) |
| i_ion | coreneutrals%compositions%impurities(:)%i_ion (integer) |
| nzimp | coreneutrals%compositions%impurities(:)%nzimp (integer) |
| zmin | coreneutrals%compositions%impurities(:)%zmin (vecflt_type) |
| zmax | coreneutrals%compositions%impurities(:)%zmax (vecflt_type) |
| label | coreneutrals%compositions%impurities(:)%label (vecstring_type) |
| neutralscomp | coreneutrals%compositions%neutralscomp(:) (composition_neutralscomp) |
| neutcomp | coreneutrals%compositions%neutralscomp(:)%neutcomp(:) (composition_neutrals_neutcomp) |
| nucindex | coreneutrals%compositions%neutralscomp(:)%neutcomp(:)%nucindex (integer) |
| multiplicity | coreneutrals%compositions%neutralscomp(:)%neutcomp(:)%multiplicity (integer) |
| type | coreneutrals%compositions%neutralscomp(:)%type(:) (identifier) |
| id | coreneutrals%compositions%neutralscomp(:)%type(:)%id (string) |
| flag | coreneutrals%compositions%neutralscomp(:)%type(:)%flag (integer) |
| description | coreneutrals%compositions%neutralscomp(:)%type(:)%description (string) |
| label | coreneutrals%compositions%neutralscomp(:)%label (string) |
| edgespecies | coreneutrals%compositions%edgespecies(:) (edgespecies) |
| nucindex | coreneutrals%compositions%edgespecies(:)%nucindex (integer) |
| zmin | coreneutrals%compositions%edgespecies(:)%zmin (float) |
| zmax | coreneutrals%compositions%edgespecies(:)%zmax (float) |
| label | coreneutrals%compositions%edgespecies(:)%label (string) |
| signature | coreneutrals%compositions%signature (identifier) |
| id | coreneutrals%compositions%signature%id (string) |
| flag | coreneutrals%compositions%signature%flag (integer) |
| description | coreneutrals%compositions%signature%description (string) |
| profiles | coreneutrals%profiles(:) (neutral_complex_type) |
| neutraltype | coreneutrals%profiles(:)%neutraltype(:) (coreneutrals_neutraltype) |
| n0 | coreneutrals%profiles(:)%neutraltype(:)%n0 (corefieldneutral) |
| value | coreneutrals%profiles(:)%neutraltype(:)%n0%value (vecflt_type) |
| flux | coreneutrals%profiles(:)%neutraltype(:)%n0%flux (vecflt_type) |
| boundary | coreneutrals%profiles(:)%neutraltype(:)%n0%boundary (boundary_neutrals) |
| value | coreneutrals%profiles(:)%neutraltype(:)%n0%boundary%value (vecflt_type) |
| type | coreneutrals%profiles(:)%neutraltype(:)%n0%boundary%type (integer) |
| rho_tor | coreneutrals%profiles(:)%neutraltype(:)%n0%boundary%rho_tor (float) |
| t0 | coreneutrals%profiles(:)%neutraltype(:)%t0 (corefieldneutrale) |
| value | coreneutrals%profiles(:)%neutraltype(:)%t0%value (vecflt_type) |
| flux | coreneutrals%profiles(:)%neutraltype(:)%t0%flux (vecflt_type) |
| boundary | coreneutrals%profiles(:)%neutraltype(:)%t0%boundary (boundary_neutrals) |
| value | coreneutrals%profiles(:)%neutraltype(:)%t0%boundary%value (vecflt_type) |
| type | coreneutrals%profiles(:)%neutraltype(:)%t0%boundary%type (integer) |
| rho_tor | coreneutrals%profiles(:)%neutraltype(:)%t0%boundary%rho_tor (float) |
| v0 | coreneutrals%profiles(:)%neutraltype(:)%v0 (corefieldneutralv0) |
| toroidal | coreneutrals%profiles(:)%neutraltype(:)%v0%toroidal (corefieldneutralv) |
| value | coreneutrals%profiles(:)%neutraltype(:)%v0%toroidal%value (vecflt_type) |
| boundary | coreneutrals%profiles(:)%neutraltype(:)%v0%toroidal%boundary (boundary_neutrals) |
| value | coreneutrals%profiles(:)%neutraltype(:)%v0%toroidal%boundary%value (vecflt_type) |
| type | coreneutrals%profiles(:)%neutraltype(:)%v0%toroidal%boundary%type (integer) |
| rho_tor | coreneutrals%profiles(:)%neutraltype(:)%v0%toroidal%boundary%rho_tor (float) |
| poloidal | coreneutrals%profiles(:)%neutraltype(:)%v0%poloidal (corefieldneutralv) |
| value | coreneutrals%profiles(:)%neutraltype(:)%v0%poloidal%value (vecflt_type) |
| boundary | coreneutrals%profiles(:)%neutraltype(:)%v0%poloidal%boundary (boundary_neutrals) |
| value | coreneutrals%profiles(:)%neutraltype(:)%v0%poloidal%boundary%value (vecflt_type) |
| type | coreneutrals%profiles(:)%neutraltype(:)%v0%poloidal%boundary%type (integer) |
| rho_tor | coreneutrals%profiles(:)%neutraltype(:)%v0%poloidal%boundary%rho_tor (float) |
| radial | coreneutrals%profiles(:)%neutraltype(:)%v0%radial (corefieldneutralv) |
| value | coreneutrals%profiles(:)%neutraltype(:)%v0%radial%value (vecflt_type) |
| boundary | coreneutrals%profiles(:)%neutraltype(:)%v0%radial%boundary (boundary_neutrals) |
| value | coreneutrals%profiles(:)%neutraltype(:)%v0%radial%boundary%value (vecflt_type) |
| type | coreneutrals%profiles(:)%neutraltype(:)%v0%radial%boundary%type (integer) |
| rho_tor | coreneutrals%profiles(:)%neutraltype(:)%v0%radial%boundary%rho_tor (float) |
| prad0 | coreneutrals%profiles(:)%prad0 (vecflt_type) |
| ioncoeff | coreneutrals%ioncoeff(:) (coefficients_neutrals) |
| recycling | coreneutrals%ioncoeff(:)%recycling (recycling_neutrals) |
| particles | coreneutrals%ioncoeff(:)%recycling%particles (vecflt_type) |
| energy | coreneutrals%ioncoeff(:)%recycling%energy (vecflt_type) |
| sputtering | coreneutrals%ioncoeff(:)%sputtering (sputtering_neutrals) |
| physical | coreneutrals%ioncoeff(:)%sputtering%physical (vecflt_type) |
| chemical | coreneutrals%ioncoeff(:)%sputtering%chemical (vecflt_type) |
| impcoeff | coreneutrals%impcoeff(:) (impcoeff) |
| chargestate | coreneutrals%impcoeff(:)%chargestate(:) (coefficients_neutrals) |
| recycling | coreneutrals%impcoeff(:)%chargestate(:)%recycling (recycling_neutrals) |
| particles | coreneutrals%impcoeff(:)%chargestate(:)%recycling%particles (vecflt_type) |
| energy | coreneutrals%impcoeff(:)%chargestate(:)%recycling%energy (vecflt_type) |
| sputtering | coreneutrals%impcoeff(:)%chargestate(:)%sputtering (sputtering_neutrals) |
| physical | coreneutrals%impcoeff(:)%chargestate(:)%sputtering%physical (vecflt_type) |
| chemical | coreneutrals%impcoeff(:)%chargestate(:)%sputtering%chemical (vecflt_type) |
| codeparam | coreneutrals%codeparam (codeparam) |
| codename | coreneutrals%codeparam%codename (string) |
| codeversion | coreneutrals%codeparam%codeversion (string) |
| parameters | coreneutrals%codeparam%parameters (string) |
| output_diag | coreneutrals%codeparam%output_diag (string) |
| output_flag | coreneutrals%codeparam%output_flag (integer) |
| time | coreneutrals%time (float) |
| datainfo | coreprof%datainfo (datainfo) |
| dataprovider | coreprof%datainfo%dataprovider (string) |
| putdate | coreprof%datainfo%putdate (string) |
| source | coreprof%datainfo%source (string) |
| comment | coreprof%datainfo%comment (string) |
| cocos | coreprof%datainfo%cocos (integer) |
| id | coreprof%datainfo%id (integer) |
| isref | coreprof%datainfo%isref (integer) |
| whatref | coreprof%datainfo%whatref (whatref) |
| user | coreprof%datainfo%whatref%user (string) |
| machine | coreprof%datainfo%whatref%machine (string) |
| shot | coreprof%datainfo%whatref%shot (integer) |
| run | coreprof%datainfo%whatref%run (integer) |
| occurrence | coreprof%datainfo%whatref%occurrence (integer) |
| putinfo | coreprof%datainfo%putinfo (putinfo) |
| putmethod | coreprof%datainfo%putinfo%putmethod (string) |
| putaccess | coreprof%datainfo%putinfo%putaccess (string) |
| putlocation | coreprof%datainfo%putinfo%putlocation (string) |
| rights | coreprof%datainfo%putinfo%rights (string) |
| rho_tor_norm | coreprof%rho_tor_norm (vecflt_type) |
| rho_tor | coreprof%rho_tor (vecflt_type) |
| drho_dt | coreprof%drho_dt (vecflt_type) |
| toroid_field | coreprof%toroid_field (toroid_field) |
| b0 | coreprof%toroid_field%b0 (float) |
| b0prime | coreprof%toroid_field%b0prime (float) |
| r0 | coreprof%toroid_field%r0 (float) |
| time | coreprof%toroid_field%time (float) |
| composition | coreprof%composition (composition) |
| amn | coreprof%composition%amn (vecflt_type) |
| zn | coreprof%composition%zn (vecflt_type) |
| zion | coreprof%composition%zion (vecflt_type) |
| imp_flag | coreprof%composition%imp_flag (vecint_type) |
| label | coreprof%composition%label (vecstring_type) |
| desc_impur | coreprof%desc_impur (desc_impur) |
| amn | coreprof%desc_impur%amn (vecflt_type) |
| zn | coreprof%desc_impur%zn (vecint_type) |
| i_ion | coreprof%desc_impur%i_ion (vecint_type) |
| nzimp | coreprof%desc_impur%nzimp (vecint_type) |
| zmin | coreprof%desc_impur%zmin (matint_type) |
| zmax | coreprof%desc_impur%zmax (matint_type) |
| label | coreprof%desc_impur%label (vecstring_type) |
| compositions | coreprof%compositions (compositions_type) |
| nuclei | coreprof%compositions%nuclei(:) (nuclei) |
| zn | coreprof%compositions%nuclei(:)%zn (float) |
| amn | coreprof%compositions%nuclei(:)%amn (float) |
| label | coreprof%compositions%nuclei(:)%label (string) |
| ions | coreprof%compositions%ions(:) (ions) |
| nucindex | coreprof%compositions%ions(:)%nucindex (integer) |
| zion | coreprof%compositions%ions(:)%zion (float) |
| imp_flag | coreprof%compositions%ions(:)%imp_flag (integer) |
| label | coreprof%compositions%ions(:)%label (string) |
| impurities | coreprof%compositions%impurities(:) (impurities) |
| nucindex | coreprof%compositions%impurities(:)%nucindex (integer) |
| i_ion | coreprof%compositions%impurities(:)%i_ion (integer) |
| nzimp | coreprof%compositions%impurities(:)%nzimp (integer) |
| zmin | coreprof%compositions%impurities(:)%zmin (vecflt_type) |
| zmax | coreprof%compositions%impurities(:)%zmax (vecflt_type) |
| label | coreprof%compositions%impurities(:)%label (vecstring_type) |
| neutralscomp | coreprof%compositions%neutralscomp(:) (composition_neutralscomp) |
| neutcomp | coreprof%compositions%neutralscomp(:)%neutcomp(:) (composition_neutrals_neutcomp) |
| nucindex | coreprof%compositions%neutralscomp(:)%neutcomp(:)%nucindex (integer) |
| multiplicity | coreprof%compositions%neutralscomp(:)%neutcomp(:)%multiplicity (integer) |
| type | coreprof%compositions%neutralscomp(:)%type(:) (identifier) |
| id | coreprof%compositions%neutralscomp(:)%type(:)%id (string) |
| flag | coreprof%compositions%neutralscomp(:)%type(:)%flag (integer) |
| description | coreprof%compositions%neutralscomp(:)%type(:)%description (string) |
| label | coreprof%compositions%neutralscomp(:)%label (string) |
| edgespecies | coreprof%compositions%edgespecies(:) (edgespecies) |
| nucindex | coreprof%compositions%edgespecies(:)%nucindex (integer) |
| zmin | coreprof%compositions%edgespecies(:)%zmin (float) |
| zmax | coreprof%compositions%edgespecies(:)%zmax (float) |
| label | coreprof%compositions%edgespecies(:)%label (string) |
| signature | coreprof%compositions%signature (identifier) |
| id | coreprof%compositions%signature%id (string) |
| flag | coreprof%compositions%signature%flag (integer) |
| description | coreprof%compositions%signature%description (string) |
| psi | coreprof%psi (psi) |
| value | coreprof%psi%value (vecflt_type) |
| ddrho | coreprof%psi%ddrho (vecflt_type) |
| d2drho2 | coreprof%psi%d2drho2 (vecflt_type) |
| ddt_rhotorn | coreprof%psi%ddt_rhotorn (vecflt_type) |
| ddt_phi | coreprof%psi%ddt_phi (vecflt_type) |
| source | coreprof%psi%source (string) |
| flag | coreprof%psi%flag (integer) |
| boundary | coreprof%psi%boundary (boundary) |
| value | coreprof%psi%boundary%value (vecflt_type) |
| source | coreprof%psi%boundary%source (string) |
| type | coreprof%psi%boundary%type (integer) |
| rho | coreprof%psi%boundary%rho (float) |
| codeparam | coreprof%psi%boundary%codeparam (codeparam) |
| codename | coreprof%psi%boundary%codeparam%codename (string) |
| codeversion | coreprof%psi%boundary%codeparam%codeversion (string) |
| parameters | coreprof%psi%boundary%codeparam%parameters (string) |
| output_diag | coreprof%psi%boundary%codeparam%output_diag (string) |
| output_flag | coreprof%psi%boundary%codeparam%output_flag (integer) |
| jni | coreprof%psi%jni (jni) |
| value | coreprof%psi%jni%value (vecflt_type) |
| integral | coreprof%psi%jni%integral (vecflt_type) |
| source | coreprof%psi%jni%source (string) |
| sigma_par | coreprof%psi%sigma_par (coreprofile) |
| value | coreprof%psi%sigma_par%value (vecflt_type) |
| source | coreprof%psi%sigma_par%source (string) |
| codeparam | coreprof%psi%codeparam (codeparam) |
| codename | coreprof%psi%codeparam%codename (string) |
| codeversion | coreprof%psi%codeparam%codeversion (string) |
| parameters | coreprof%psi%codeparam%parameters (string) |
| output_diag | coreprof%psi%codeparam%output_diag (string) |
| output_flag | coreprof%psi%codeparam%output_flag (integer) |
| te | coreprof%te (corefield) |
| value | coreprof%te%value (vecflt_type) |
| ddrho | coreprof%te%ddrho (vecflt_type) |
| d2drho2 | coreprof%te%d2drho2 (vecflt_type) |
| ddt | coreprof%te%ddt (vecflt_type) |
| source | coreprof%te%source (string) |
| flag | coreprof%te%flag (integer) |
| boundary | coreprof%te%boundary (boundaryel) |
| value | coreprof%te%boundary%value (vecflt_type) |
| source | coreprof%te%boundary%source (string) |
| type | coreprof%te%boundary%type (integer) |
| rho_tor | coreprof%te%boundary%rho_tor (float) |
| source_term | coreprof%te%source_term (sourceel) |
| value | coreprof%te%source_term%value (vecflt_type) |
| integral | coreprof%te%source_term%integral (vecflt_type) |
| source | coreprof%te%source_term%source (string) |
| transp_coef | coreprof%te%transp_coef (coretransel) |
| diff | coreprof%te%transp_coef%diff (vecflt_type) |
| vconv | coreprof%te%transp_coef%vconv (vecflt_type) |
| source | coreprof%te%transp_coef%source (string) |
| flux | coreprof%te%flux (fluxel) |
| flux_dv | coreprof%te%flux%flux_dv (vecflt_type) |
| flux_interp | coreprof%te%flux%flux_interp (vecflt_type) |
| flux_dv_surf | coreprof%te%flux_dv_surf (vecflt_type) |
| time_deriv | coreprof%te%time_deriv (vecflt_type) |
| codeparam | coreprof%te%codeparam (codeparam) |
| codename | coreprof%te%codeparam%codename (string) |
| codeversion | coreprof%te%codeparam%codeversion (string) |
| parameters | coreprof%te%codeparam%parameters (string) |
| output_diag | coreprof%te%codeparam%output_diag (string) |
| output_flag | coreprof%te%codeparam%output_flag (integer) |
| ti | coreprof%ti (corefieldion) |
| value | coreprof%ti%value (matflt_type) |
| ddrho | coreprof%ti%ddrho (matflt_type) |
| d2drho2 | coreprof%ti%d2drho2 (matflt_type) |
| ddt | coreprof%ti%ddt (matflt_type) |
| source | coreprof%ti%source (vecstring_type) |
| flag | coreprof%ti%flag (vecint_type) |
| boundary | coreprof%ti%boundary (boundaryion) |
| value | coreprof%ti%boundary%value (matflt_type) |
| source | coreprof%ti%boundary%source (vecstring_type) |
| type | coreprof%ti%boundary%type (vecint_type) |
| rho_tor | coreprof%ti%boundary%rho_tor (vecflt_type) |
| source_term | coreprof%ti%source_term (sourceion) |
| value | coreprof%ti%source_term%value (matflt_type) |
| integral | coreprof%ti%source_term%integral (matflt_type) |
| source | coreprof%ti%source_term%source (vecstring_type) |
| transp_coef | coreprof%ti%transp_coef (coretransion) |
| diff | coreprof%ti%transp_coef%diff (matflt_type) |
| vconv | coreprof%ti%transp_coef%vconv (matflt_type) |
| source | coreprof%ti%transp_coef%source (vecstring_type) |
| flux | coreprof%ti%flux (fluxion) |
| flux_dv | coreprof%ti%flux%flux_dv (matflt_type) |
| flux_interp | coreprof%ti%flux%flux_interp (matflt_type) |
| flux_dv_surf | coreprof%ti%flux_dv_surf (matflt_type) |
| time_deriv | coreprof%ti%time_deriv (matflt_type) |
| codeparam | coreprof%ti%codeparam (codeparam) |
| codename | coreprof%ti%codeparam%codename (string) |
| codeversion | coreprof%ti%codeparam%codeversion (string) |
| parameters | coreprof%ti%codeparam%parameters (string) |
| output_diag | coreprof%ti%codeparam%output_diag (string) |
| output_flag | coreprof%ti%codeparam%output_flag (integer) |
| ne | coreprof%ne (corefield) |
| value | coreprof%ne%value (vecflt_type) |
| ddrho | coreprof%ne%ddrho (vecflt_type) |
| d2drho2 | coreprof%ne%d2drho2 (vecflt_type) |
| ddt | coreprof%ne%ddt (vecflt_type) |
| source | coreprof%ne%source (string) |
| flag | coreprof%ne%flag (integer) |
| boundary | coreprof%ne%boundary (boundaryel) |
| value | coreprof%ne%boundary%value (vecflt_type) |
| source | coreprof%ne%boundary%source (string) |
| type | coreprof%ne%boundary%type (integer) |
| rho_tor | coreprof%ne%boundary%rho_tor (float) |
| source_term | coreprof%ne%source_term (sourceel) |
| value | coreprof%ne%source_term%value (vecflt_type) |
| integral | coreprof%ne%source_term%integral (vecflt_type) |
| source | coreprof%ne%source_term%source (string) |
| transp_coef | coreprof%ne%transp_coef (coretransel) |
| diff | coreprof%ne%transp_coef%diff (vecflt_type) |
| vconv | coreprof%ne%transp_coef%vconv (vecflt_type) |
| source | coreprof%ne%transp_coef%source (string) |
| flux | coreprof%ne%flux (fluxel) |
| flux_dv | coreprof%ne%flux%flux_dv (vecflt_type) |
| flux_interp | coreprof%ne%flux%flux_interp (vecflt_type) |
| flux_dv_surf | coreprof%ne%flux_dv_surf (vecflt_type) |
| time_deriv | coreprof%ne%time_deriv (vecflt_type) |
| codeparam | coreprof%ne%codeparam (codeparam) |
| codename | coreprof%ne%codeparam%codename (string) |
| codeversion | coreprof%ne%codeparam%codeversion (string) |
| parameters | coreprof%ne%codeparam%parameters (string) |
| output_diag | coreprof%ne%codeparam%output_diag (string) |
| output_flag | coreprof%ne%codeparam%output_flag (integer) |
| ni | coreprof%ni (corefieldion) |
| value | coreprof%ni%value (matflt_type) |
| ddrho | coreprof%ni%ddrho (matflt_type) |
| d2drho2 | coreprof%ni%d2drho2 (matflt_type) |
| ddt | coreprof%ni%ddt (matflt_type) |
| source | coreprof%ni%source (vecstring_type) |
| flag | coreprof%ni%flag (vecint_type) |
| boundary | coreprof%ni%boundary (boundaryion) |
| value | coreprof%ni%boundary%value (matflt_type) |
| source | coreprof%ni%boundary%source (vecstring_type) |
| type | coreprof%ni%boundary%type (vecint_type) |
| rho_tor | coreprof%ni%boundary%rho_tor (vecflt_type) |
| source_term | coreprof%ni%source_term (sourceion) |
| value | coreprof%ni%source_term%value (matflt_type) |
| integral | coreprof%ni%source_term%integral (matflt_type) |
| source | coreprof%ni%source_term%source (vecstring_type) |
| transp_coef | coreprof%ni%transp_coef (coretransion) |
| diff | coreprof%ni%transp_coef%diff (matflt_type) |
| vconv | coreprof%ni%transp_coef%vconv (matflt_type) |
| source | coreprof%ni%transp_coef%source (vecstring_type) |
| flux | coreprof%ni%flux (fluxion) |
| flux_dv | coreprof%ni%flux%flux_dv (matflt_type) |
| flux_interp | coreprof%ni%flux%flux_interp (matflt_type) |
| flux_dv_surf | coreprof%ni%flux_dv_surf (matflt_type) |
| time_deriv | coreprof%ni%time_deriv (matflt_type) |
| codeparam | coreprof%ni%codeparam (codeparam) |
| codename | coreprof%ni%codeparam%codename (string) |
| codeversion | coreprof%ni%codeparam%codeversion (string) |
| parameters | coreprof%ni%codeparam%parameters (string) |
| output_diag | coreprof%ni%codeparam%output_diag (string) |
| output_flag | coreprof%ni%codeparam%output_flag (integer) |
| vtor | coreprof%vtor (corefieldion) |
| value | coreprof%vtor%value (matflt_type) |
| ddrho | coreprof%vtor%ddrho (matflt_type) |
| d2drho2 | coreprof%vtor%d2drho2 (matflt_type) |
| ddt | coreprof%vtor%ddt (matflt_type) |
| source | coreprof%vtor%source (vecstring_type) |
| flag | coreprof%vtor%flag (vecint_type) |
| boundary | coreprof%vtor%boundary (boundaryion) |
| value | coreprof%vtor%boundary%value (matflt_type) |
| source | coreprof%vtor%boundary%source (vecstring_type) |
| type | coreprof%vtor%boundary%type (vecint_type) |
| rho_tor | coreprof%vtor%boundary%rho_tor (vecflt_type) |
| source_term | coreprof%vtor%source_term (sourceion) |
| value | coreprof%vtor%source_term%value (matflt_type) |
| integral | coreprof%vtor%source_term%integral (matflt_type) |
| source | coreprof%vtor%source_term%source (vecstring_type) |
| transp_coef | coreprof%vtor%transp_coef (coretransion) |
| diff | coreprof%vtor%transp_coef%diff (matflt_type) |
| vconv | coreprof%vtor%transp_coef%vconv (matflt_type) |
| source | coreprof%vtor%transp_coef%source (vecstring_type) |
| flux | coreprof%vtor%flux (fluxion) |
| flux_dv | coreprof%vtor%flux%flux_dv (matflt_type) |
| flux_interp | coreprof%vtor%flux%flux_interp (matflt_type) |
| flux_dv_surf | coreprof%vtor%flux_dv_surf (matflt_type) |
| time_deriv | coreprof%vtor%time_deriv (matflt_type) |
| codeparam | coreprof%vtor%codeparam (codeparam) |
| codename | coreprof%vtor%codeparam%codename (string) |
| codeversion | coreprof%vtor%codeparam%codeversion (string) |
| parameters | coreprof%vtor%codeparam%parameters (string) |
| output_diag | coreprof%vtor%codeparam%output_diag (string) |
| output_flag | coreprof%vtor%codeparam%output_flag (integer) |
| profiles1d | coreprof%profiles1d (profiles1d) |
| pe | coreprof%profiles1d%pe (coreprofile) |
| value | coreprof%profiles1d%pe%value (vecflt_type) |
| source | coreprof%profiles1d%pe%source (string) |
| dpedt | coreprof%profiles1d%dpedt (coreprofile) |
| value | coreprof%profiles1d%dpedt%value (vecflt_type) |
| source | coreprof%profiles1d%dpedt%source (string) |
| pi | coreprof%profiles1d%pi (coreprofion) |
| value | coreprof%profiles1d%pi%value (matflt_type) |
| source | coreprof%profiles1d%pi%source (vecstring_type) |
| pi_tot | coreprof%profiles1d%pi_tot (coreprofile) |
| value | coreprof%profiles1d%pi_tot%value (vecflt_type) |
| source | coreprof%profiles1d%pi_tot%source (string) |
| dpi_totdt | coreprof%profiles1d%dpi_totdt (coreprofile) |
| value | coreprof%profiles1d%dpi_totdt%value (vecflt_type) |
| source | coreprof%profiles1d%dpi_totdt%source (string) |
| pr_th | coreprof%profiles1d%pr_th (coreprofile) |
| value | coreprof%profiles1d%pr_th%value (vecflt_type) |
| source | coreprof%profiles1d%pr_th%source (string) |
| pr_perp | coreprof%profiles1d%pr_perp (coreprofile) |
| value | coreprof%profiles1d%pr_perp%value (vecflt_type) |
| source | coreprof%profiles1d%pr_perp%source (string) |
| pr_parallel | coreprof%profiles1d%pr_parallel (coreprofile) |
| value | coreprof%profiles1d%pr_parallel%value (vecflt_type) |
| source | coreprof%profiles1d%pr_parallel%source (string) |
| jtot | coreprof%profiles1d%jtot (coreprofile) |
| value | coreprof%profiles1d%jtot%value (vecflt_type) |
| source | coreprof%profiles1d%jtot%source (string) |
| jni | coreprof%profiles1d%jni (coreprofile) |
| value | coreprof%profiles1d%jni%value (vecflt_type) |
| source | coreprof%profiles1d%jni%source (string) |
| jphi | coreprof%profiles1d%jphi (coreprofile) |
| value | coreprof%profiles1d%jphi%value (vecflt_type) |
| source | coreprof%profiles1d%jphi%source (string) |
| joh | coreprof%profiles1d%joh (coreprofile) |
| value | coreprof%profiles1d%joh%value (vecflt_type) |
| source | coreprof%profiles1d%joh%source (string) |
| vloop | coreprof%profiles1d%vloop (coreprofile) |
| value | coreprof%profiles1d%vloop%value (vecflt_type) |
| source | coreprof%profiles1d%vloop%source (string) |
| sigmapar | coreprof%profiles1d%sigmapar (coreprofile) |
| value | coreprof%profiles1d%sigmapar%value (vecflt_type) |
| source | coreprof%profiles1d%sigmapar%source (string) |
| qoh | coreprof%profiles1d%qoh (sourceel) |
| value | coreprof%profiles1d%qoh%value (vecflt_type) |
| integral | coreprof%profiles1d%qoh%integral (vecflt_type) |
| source | coreprof%profiles1d%qoh%source (string) |
| qei | coreprof%profiles1d%qei (coreprofile) |
| value | coreprof%profiles1d%qei%value (vecflt_type) |
| source | coreprof%profiles1d%qei%source (string) |
| eparallel | coreprof%profiles1d%eparallel (coreprofile) |
| value | coreprof%profiles1d%eparallel%value (vecflt_type) |
| source | coreprof%profiles1d%eparallel%source (string) |
| e_b | coreprof%profiles1d%e_b (coreprofile) |
| value | coreprof%profiles1d%e_b%value (vecflt_type) |
| source | coreprof%profiles1d%e_b%source (string) |
| q | coreprof%profiles1d%q (coreprofile) |
| value | coreprof%profiles1d%q%value (vecflt_type) |
| source | coreprof%profiles1d%q%source (string) |
| shear | coreprof%profiles1d%shear (coreprofile) |
| value | coreprof%profiles1d%shear%value (vecflt_type) |
| source | coreprof%profiles1d%shear%source (string) |
| ns | coreprof%profiles1d%ns (coreprofion) |
| value | coreprof%profiles1d%ns%value (matflt_type) |
| source | coreprof%profiles1d%ns%source (vecstring_type) |
| mtor | coreprof%profiles1d%mtor (coreprofion) |
| value | coreprof%profiles1d%mtor%value (matflt_type) |
| source | coreprof%profiles1d%mtor%source (vecstring_type) |
| wtor | coreprof%profiles1d%wtor (coreprofion) |
| value | coreprof%profiles1d%wtor%value (matflt_type) |
| source | coreprof%profiles1d%wtor%source (vecstring_type) |
| zeff | coreprof%profiles1d%zeff (coreprofile) |
| value | coreprof%profiles1d%zeff%value (vecflt_type) |
| source | coreprof%profiles1d%zeff%source (string) |
| bpol | coreprof%profiles1d%bpol (coreprofile) |
| value | coreprof%profiles1d%bpol%value (vecflt_type) |
| source | coreprof%profiles1d%bpol%source (string) |
| dvprimedt | coreprof%profiles1d%dvprimedt (coreprofile) |
| value | coreprof%profiles1d%dvprimedt%value (vecflt_type) |
| source | coreprof%profiles1d%dvprimedt%source (string) |
| globalparam | coreprof%globalparam (globalparam) |
| current_tot | coreprof%globalparam%current_tot (float) |
| current_bnd | coreprof%globalparam%current_bnd (float) |
| current_ni | coreprof%globalparam%current_ni (float) |
| vloop | coreprof%globalparam%vloop (float) |
| li | coreprof%globalparam%li (float) |
| beta_tor | coreprof%globalparam%beta_tor (float) |
| beta_normal | coreprof%globalparam%beta_normal (float) |
| beta_pol | coreprof%globalparam%beta_pol (float) |
| w_dia | coreprof%globalparam%w_dia (float) |
| codeparam | coreprof%codeparam (codeparam) |
| codename | coreprof%codeparam%codename (string) |
| codeversion | coreprof%codeparam%codeversion (string) |
| parameters | coreprof%codeparam%parameters (string) |
| output_diag | coreprof%codeparam%output_diag (string) |
| output_flag | coreprof%codeparam%output_flag (integer) |
| time | coreprof%time (float) |
| datainfo | coresource%datainfo (datainfo) |
| dataprovider | coresource%datainfo%dataprovider (string) |
| putdate | coresource%datainfo%putdate (string) |
| source | coresource%datainfo%source (string) |
| comment | coresource%datainfo%comment (string) |
| cocos | coresource%datainfo%cocos (integer) |
| id | coresource%datainfo%id (integer) |
| isref | coresource%datainfo%isref (integer) |
| whatref | coresource%datainfo%whatref (whatref) |
| user | coresource%datainfo%whatref%user (string) |
| machine | coresource%datainfo%whatref%machine (string) |
| shot | coresource%datainfo%whatref%shot (integer) |
| run | coresource%datainfo%whatref%run (integer) |
| occurrence | coresource%datainfo%whatref%occurrence (integer) |
| putinfo | coresource%datainfo%putinfo (putinfo) |
| putmethod | coresource%datainfo%putinfo%putmethod (string) |
| putaccess | coresource%datainfo%putinfo%putaccess (string) |
| putlocation | coresource%datainfo%putinfo%putlocation (string) |
| rights | coresource%datainfo%putinfo%rights (string) |
| composition | coresource%composition (composition) |
| amn | coresource%composition%amn (vecflt_type) |
| zn | coresource%composition%zn (vecflt_type) |
| zion | coresource%composition%zion (vecflt_type) |
| imp_flag | coresource%composition%imp_flag (vecint_type) |
| label | coresource%composition%label (vecstring_type) |
| desc_impur | coresource%desc_impur (desc_impur) |
| amn | coresource%desc_impur%amn (vecflt_type) |
| zn | coresource%desc_impur%zn (vecint_type) |
| i_ion | coresource%desc_impur%i_ion (vecint_type) |
| nzimp | coresource%desc_impur%nzimp (vecint_type) |
| zmin | coresource%desc_impur%zmin (matint_type) |
| zmax | coresource%desc_impur%zmax (matint_type) |
| label | coresource%desc_impur%label (vecstring_type) |
| compositions | coresource%compositions (compositions_type) |
| nuclei | coresource%compositions%nuclei(:) (nuclei) |
| zn | coresource%compositions%nuclei(:)%zn (float) |
| amn | coresource%compositions%nuclei(:)%amn (float) |
| label | coresource%compositions%nuclei(:)%label (string) |
| ions | coresource%compositions%ions(:) (ions) |
| nucindex | coresource%compositions%ions(:)%nucindex (integer) |
| zion | coresource%compositions%ions(:)%zion (float) |
| imp_flag | coresource%compositions%ions(:)%imp_flag (integer) |
| label | coresource%compositions%ions(:)%label (string) |
| impurities | coresource%compositions%impurities(:) (impurities) |
| nucindex | coresource%compositions%impurities(:)%nucindex (integer) |
| i_ion | coresource%compositions%impurities(:)%i_ion (integer) |
| nzimp | coresource%compositions%impurities(:)%nzimp (integer) |
| zmin | coresource%compositions%impurities(:)%zmin (vecflt_type) |
| zmax | coresource%compositions%impurities(:)%zmax (vecflt_type) |
| label | coresource%compositions%impurities(:)%label (vecstring_type) |
| neutralscomp | coresource%compositions%neutralscomp(:) (composition_neutralscomp) |
| neutcomp | coresource%compositions%neutralscomp(:)%neutcomp(:) (composition_neutrals_neutcomp) |
| nucindex | coresource%compositions%neutralscomp(:)%neutcomp(:)%nucindex (integer) |
| multiplicity | coresource%compositions%neutralscomp(:)%neutcomp(:)%multiplicity (integer) |
| type | coresource%compositions%neutralscomp(:)%type(:) (identifier) |
| id | coresource%compositions%neutralscomp(:)%type(:)%id (string) |
| flag | coresource%compositions%neutralscomp(:)%type(:)%flag (integer) |
| description | coresource%compositions%neutralscomp(:)%type(:)%description (string) |
| label | coresource%compositions%neutralscomp(:)%label (string) |
| edgespecies | coresource%compositions%edgespecies(:) (edgespecies) |
| nucindex | coresource%compositions%edgespecies(:)%nucindex (integer) |
| zmin | coresource%compositions%edgespecies(:)%zmin (float) |
| zmax | coresource%compositions%edgespecies(:)%zmax (float) |
| label | coresource%compositions%edgespecies(:)%label (string) |
| signature | coresource%compositions%signature (identifier) |
| id | coresource%compositions%signature%id (string) |
| flag | coresource%compositions%signature%flag (integer) |
| description | coresource%compositions%signature%description (string) |
| toroid_field | coresource%toroid_field (b0r0) |
| r0 | coresource%toroid_field%r0 (float) |
| b0 | coresource%toroid_field%b0 (float) |
| values | coresource%values(:) (coresource_values) |
| sourceid | coresource%values(:)%sourceid (identifier) |
| id | coresource%values(:)%sourceid%id (string) |
| flag | coresource%values(:)%sourceid%flag (integer) |
| description | coresource%values(:)%sourceid%description (string) |
| rho_tor | coresource%values(:)%rho_tor (vecflt_type) |
| rho_tor_norm | coresource%values(:)%rho_tor_norm (vecflt_type) |
| psi | coresource%values(:)%psi (vecflt_type) |
| volume | coresource%values(:)%volume (vecflt_type) |
| area | coresource%values(:)%area (vecflt_type) |
| j | coresource%values(:)%j (vecflt_type) |
| sigma | coresource%values(:)%sigma (vecflt_type) |
| si | coresource%values(:)%si (source_ion) |
| exp | coresource%values(:)%si%exp (matflt_type) |
| imp | coresource%values(:)%si%imp (matflt_type) |
| se | coresource%values(:)%se (source_vec) |
| exp | coresource%values(:)%se%exp (vecflt_type) |
| imp | coresource%values(:)%se%imp (vecflt_type) |
| sz | coresource%values(:)%sz(:) (source_imp) |
| exp | coresource%values(:)%sz(:)%exp (matflt_type) |
| imp | coresource%values(:)%sz(:)%imp (matflt_type) |
| qi | coresource%values(:)%qi (source_ion) |
| exp | coresource%values(:)%qi%exp (matflt_type) |
| imp | coresource%values(:)%qi%imp (matflt_type) |
| qe | coresource%values(:)%qe (source_vec) |
| exp | coresource%values(:)%qe%exp (vecflt_type) |
| imp | coresource%values(:)%qe%imp (vecflt_type) |
| qz | coresource%values(:)%qz(:) (source_imp) |
| exp | coresource%values(:)%qz(:)%exp (matflt_type) |
| imp | coresource%values(:)%qz(:)%imp (matflt_type) |
| ui | coresource%values(:)%ui (source_ion) |
| exp | coresource%values(:)%ui%exp (matflt_type) |
| imp | coresource%values(:)%ui%imp (matflt_type) |
| ujxb | coresource%values(:)%ujxb (source_vec) |
| exp | coresource%values(:)%ujxb%exp (vecflt_type) |
| imp | coresource%values(:)%ujxb%imp (vecflt_type) |
| codeparam | coresource%values(:)%codeparam (codeparam) |
| codename | coresource%values(:)%codeparam%codename (string) |
| codeversion | coresource%values(:)%codeparam%codeversion (string) |
| parameters | coresource%values(:)%codeparam%parameters (string) |
| output_diag | coresource%values(:)%codeparam%output_diag (string) |
| output_flag | coresource%values(:)%codeparam%output_flag (integer) |
| codeparam | coresource%codeparam (codeparam) |
| codename | coresource%codeparam%codename (string) |
| codeversion | coresource%codeparam%codeversion (string) |
| parameters | coresource%codeparam%parameters (string) |
| output_diag | coresource%codeparam%output_diag (string) |
| output_flag | coresource%codeparam%output_flag (integer) |
| time | coresource%time (float) |
| datainfo | coretransp%datainfo (datainfo) |
| dataprovider | coretransp%datainfo%dataprovider (string) |
| putdate | coretransp%datainfo%putdate (string) |
| source | coretransp%datainfo%source (string) |
| comment | coretransp%datainfo%comment (string) |
| cocos | coretransp%datainfo%cocos (integer) |
| id | coretransp%datainfo%id (integer) |
| isref | coretransp%datainfo%isref (integer) |
| whatref | coretransp%datainfo%whatref (whatref) |
| user | coretransp%datainfo%whatref%user (string) |
| machine | coretransp%datainfo%whatref%machine (string) |
| shot | coretransp%datainfo%whatref%shot (integer) |
| run | coretransp%datainfo%whatref%run (integer) |
| occurrence | coretransp%datainfo%whatref%occurrence (integer) |
| putinfo | coretransp%datainfo%putinfo (putinfo) |
| putmethod | coretransp%datainfo%putinfo%putmethod (string) |
| putaccess | coretransp%datainfo%putinfo%putaccess (string) |
| putlocation | coretransp%datainfo%putinfo%putlocation (string) |
| rights | coretransp%datainfo%putinfo%rights (string) |
| composition | coretransp%composition (composition) |
| amn | coretransp%composition%amn (vecflt_type) |
| zn | coretransp%composition%zn (vecflt_type) |
| zion | coretransp%composition%zion (vecflt_type) |
| imp_flag | coretransp%composition%imp_flag (vecint_type) |
| label | coretransp%composition%label (vecstring_type) |
| desc_impur | coretransp%desc_impur (desc_impur) |
| amn | coretransp%desc_impur%amn (vecflt_type) |
| zn | coretransp%desc_impur%zn (vecint_type) |
| i_ion | coretransp%desc_impur%i_ion (vecint_type) |
| nzimp | coretransp%desc_impur%nzimp (vecint_type) |
| zmin | coretransp%desc_impur%zmin (matint_type) |
| zmax | coretransp%desc_impur%zmax (matint_type) |
| label | coretransp%desc_impur%label (vecstring_type) |
| compositions | coretransp%compositions (compositions_type) |
| nuclei | coretransp%compositions%nuclei(:) (nuclei) |
| zn | coretransp%compositions%nuclei(:)%zn (float) |
| amn | coretransp%compositions%nuclei(:)%amn (float) |
| label | coretransp%compositions%nuclei(:)%label (string) |
| ions | coretransp%compositions%ions(:) (ions) |
| nucindex | coretransp%compositions%ions(:)%nucindex (integer) |
| zion | coretransp%compositions%ions(:)%zion (float) |
| imp_flag | coretransp%compositions%ions(:)%imp_flag (integer) |
| label | coretransp%compositions%ions(:)%label (string) |
| impurities | coretransp%compositions%impurities(:) (impurities) |
| nucindex | coretransp%compositions%impurities(:)%nucindex (integer) |
| i_ion | coretransp%compositions%impurities(:)%i_ion (integer) |
| nzimp | coretransp%compositions%impurities(:)%nzimp (integer) |
| zmin | coretransp%compositions%impurities(:)%zmin (vecflt_type) |
| zmax | coretransp%compositions%impurities(:)%zmax (vecflt_type) |
| label | coretransp%compositions%impurities(:)%label (vecstring_type) |
| neutralscomp | coretransp%compositions%neutralscomp(:) (composition_neutralscomp) |
| neutcomp | coretransp%compositions%neutralscomp(:)%neutcomp(:) (composition_neutrals_neutcomp) |
| nucindex | coretransp%compositions%neutralscomp(:)%neutcomp(:)%nucindex (integer) |
| multiplicity | coretransp%compositions%neutralscomp(:)%neutcomp(:)%multiplicity (integer) |
| type | coretransp%compositions%neutralscomp(:)%type(:) (identifier) |
| id | coretransp%compositions%neutralscomp(:)%type(:)%id (string) |
| flag | coretransp%compositions%neutralscomp(:)%type(:)%flag (integer) |
| description | coretransp%compositions%neutralscomp(:)%type(:)%description (string) |
| label | coretransp%compositions%neutralscomp(:)%label (string) |
| edgespecies | coretransp%compositions%edgespecies(:) (edgespecies) |
| nucindex | coretransp%compositions%edgespecies(:)%nucindex (integer) |
| zmin | coretransp%compositions%edgespecies(:)%zmin (float) |
| zmax | coretransp%compositions%edgespecies(:)%zmax (float) |
| label | coretransp%compositions%edgespecies(:)%label (string) |
| signature | coretransp%compositions%signature (identifier) |
| id | coretransp%compositions%signature%id (string) |
| flag | coretransp%compositions%signature%flag (integer) |
| description | coretransp%compositions%signature%description (string) |
| values | coretransp%values(:) (coretransp_values) |
| transportid | coretransp%values(:)%transportid (identifier) |
| id | coretransp%values(:)%transportid%id (string) |
| flag | coretransp%values(:)%transportid%flag (integer) |
| description | coretransp%values(:)%transportid%description (string) |
| rho_tor_norm | coretransp%values(:)%rho_tor_norm (vecflt_type) |
| rho_tor | coretransp%values(:)%rho_tor (vecflt_type) |
| psi | coretransp%values(:)%psi (vecflt_type) |
| volume | coretransp%values(:)%volume (vecflt_type) |
| area | coretransp%values(:)%area (vecflt_type) |
| sigma | coretransp%values(:)%sigma (vecflt_type) |
| ni_transp | coretransp%values(:)%ni_transp (ni_transp) |
| diff_eff | coretransp%values(:)%ni_transp%diff_eff (array3dflt_type) |
| vconv_eff | coretransp%values(:)%ni_transp%vconv_eff (array3dflt_type) |
| flux | coretransp%values(:)%ni_transp%flux (matflt_type) |
| off_diagonal | coretransp%values(:)%ni_transp%off_diagonal (offdiagion) |
| d_ni | coretransp%values(:)%ni_transp%off_diagonal%d_ni (array3dflt_type) |
| d_ti | coretransp%values(:)%ni_transp%off_diagonal%d_ti (array3dflt_type) |
| d_ne | coretransp%values(:)%ni_transp%off_diagonal%d_ne (matflt_type) |
| d_te | coretransp%values(:)%ni_transp%off_diagonal%d_te (matflt_type) |
| d_epar | coretransp%values(:)%ni_transp%off_diagonal%d_epar (matflt_type) |
| d_mtor | coretransp%values(:)%ni_transp%off_diagonal%d_mtor (matflt_type) |
| flag | coretransp%values(:)%ni_transp%flag (integer) |
| ne_transp | coretransp%values(:)%ne_transp (ne_transp) |
| diff_eff | coretransp%values(:)%ne_transp%diff_eff (matflt_type) |
| vconv_eff | coretransp%values(:)%ne_transp%vconv_eff (matflt_type) |
| flux | coretransp%values(:)%ne_transp%flux (vecflt_type) |
| off_diagonal | coretransp%values(:)%ne_transp%off_diagonal (offdiagel) |
| d_ni | coretransp%values(:)%ne_transp%off_diagonal%d_ni (matflt_type) |
| d_ti | coretransp%values(:)%ne_transp%off_diagonal%d_ti (matflt_type) |
| d_ne | coretransp%values(:)%ne_transp%off_diagonal%d_ne (vecflt_type) |
| d_te | coretransp%values(:)%ne_transp%off_diagonal%d_te (vecflt_type) |
| d_epar | coretransp%values(:)%ne_transp%off_diagonal%d_epar (vecflt_type) |
| d_mtor | coretransp%values(:)%ne_transp%off_diagonal%d_mtor (vecflt_type) |
| flag | coretransp%values(:)%ne_transp%flag (integer) |
| nz_transp | coretransp%values(:)%nz_transp(:) (transcoefimp) |
| diff_eff | coretransp%values(:)%nz_transp(:)%diff_eff (matflt_type) |
| vconv_eff | coretransp%values(:)%nz_transp(:)%vconv_eff (matflt_type) |
| exchange | coretransp%values(:)%nz_transp(:)%exchange (matflt_type) |
| flux | coretransp%values(:)%nz_transp(:)%flux (matflt_type) |
| flag | coretransp%values(:)%nz_transp(:)%flag (integer) |
| ti_transp | coretransp%values(:)%ti_transp (transcoefion) |
| diff_eff | coretransp%values(:)%ti_transp%diff_eff (matflt_type) |
| vconv_eff | coretransp%values(:)%ti_transp%vconv_eff (matflt_type) |
| exchange | coretransp%values(:)%ti_transp%exchange (matflt_type) |
| qgi | coretransp%values(:)%ti_transp%qgi (matflt_type) |
| flux | coretransp%values(:)%ti_transp%flux (matflt_type) |
| off_diagonal | coretransp%values(:)%ti_transp%off_diagonal (offdiagion) |
| d_ni | coretransp%values(:)%ti_transp%off_diagonal%d_ni (array3dflt_type) |
| d_ti | coretransp%values(:)%ti_transp%off_diagonal%d_ti (array3dflt_type) |
| d_ne | coretransp%values(:)%ti_transp%off_diagonal%d_ne (matflt_type) |
| d_te | coretransp%values(:)%ti_transp%off_diagonal%d_te (matflt_type) |
| d_epar | coretransp%values(:)%ti_transp%off_diagonal%d_epar (matflt_type) |
| d_mtor | coretransp%values(:)%ti_transp%off_diagonal%d_mtor (matflt_type) |
| flag | coretransp%values(:)%ti_transp%flag (integer) |
| te_transp | coretransp%values(:)%te_transp (transcoefel) |
| diff_eff | coretransp%values(:)%te_transp%diff_eff (vecflt_type) |
| vconv_eff | coretransp%values(:)%te_transp%vconv_eff (vecflt_type) |
| flux | coretransp%values(:)%te_transp%flux (vecflt_type) |
| off_diagonal | coretransp%values(:)%te_transp%off_diagonal (offdiagel) |
| d_ni | coretransp%values(:)%te_transp%off_diagonal%d_ni (matflt_type) |
| d_ti | coretransp%values(:)%te_transp%off_diagonal%d_ti (matflt_type) |
| d_ne | coretransp%values(:)%te_transp%off_diagonal%d_ne (vecflt_type) |
| d_te | coretransp%values(:)%te_transp%off_diagonal%d_te (vecflt_type) |
| d_epar | coretransp%values(:)%te_transp%off_diagonal%d_epar (vecflt_type) |
| d_mtor | coretransp%values(:)%te_transp%off_diagonal%d_mtor (vecflt_type) |
| flag | coretransp%values(:)%te_transp%flag (integer) |
| tz_transp | coretransp%values(:)%tz_transp(:) (transcoefimp) |
| diff_eff | coretransp%values(:)%tz_transp(:)%diff_eff (matflt_type) |
| vconv_eff | coretransp%values(:)%tz_transp(:)%vconv_eff (matflt_type) |
| exchange | coretransp%values(:)%tz_transp(:)%exchange (matflt_type) |
| flux | coretransp%values(:)%tz_transp(:)%flux (matflt_type) |
| flag | coretransp%values(:)%tz_transp(:)%flag (integer) |
| vtor_transp | coretransp%values(:)%vtor_transp (transcoefvtor) |
| diff_eff | coretransp%values(:)%vtor_transp%diff_eff (matflt_type) |
| vconv_eff | coretransp%values(:)%vtor_transp%vconv_eff (matflt_type) |
| flux | coretransp%values(:)%vtor_transp%flux (matflt_type) |
| off_diagonal | coretransp%values(:)%vtor_transp%off_diagonal (offdiagion) |
| d_ni | coretransp%values(:)%vtor_transp%off_diagonal%d_ni (array3dflt_type) |
| d_ti | coretransp%values(:)%vtor_transp%off_diagonal%d_ti (array3dflt_type) |
| d_ne | coretransp%values(:)%vtor_transp%off_diagonal%d_ne (matflt_type) |
| d_te | coretransp%values(:)%vtor_transp%off_diagonal%d_te (matflt_type) |
| d_epar | coretransp%values(:)%vtor_transp%off_diagonal%d_epar (matflt_type) |
| d_mtor | coretransp%values(:)%vtor_transp%off_diagonal%d_mtor (matflt_type) |
| flag | coretransp%values(:)%vtor_transp%flag (integer) |
| codeparam | coretransp%values(:)%codeparam (codeparam) |
| codename | coretransp%values(:)%codeparam%codename (string) |
| codeversion | coretransp%values(:)%codeparam%codeversion (string) |
| parameters | coretransp%values(:)%codeparam%parameters (string) |
| output_diag | coretransp%values(:)%codeparam%output_diag (string) |
| output_flag | coretransp%values(:)%codeparam%output_flag (integer) |
| codeparam | coretransp%codeparam (codeparam) |
| codename | coretransp%codeparam%codename (string) |
| codeversion | coretransp%codeparam%codeversion (string) |
| parameters | coretransp%codeparam%parameters (string) |
| output_diag | coretransp%codeparam%output_diag (string) |
| output_flag | coretransp%codeparam%output_flag (integer) |
| time | coretransp%time (float) |
| datainfo | cxdiag%datainfo (datainfo) |
| dataprovider | cxdiag%datainfo%dataprovider (string) |
| putdate | cxdiag%datainfo%putdate (string) |
| source | cxdiag%datainfo%source (string) |
| comment | cxdiag%datainfo%comment (string) |
| cocos | cxdiag%datainfo%cocos (integer) |
| id | cxdiag%datainfo%id (integer) |
| isref | cxdiag%datainfo%isref (integer) |
| whatref | cxdiag%datainfo%whatref (whatref) |
| user | cxdiag%datainfo%whatref%user (string) |
| machine | cxdiag%datainfo%whatref%machine (string) |
| shot | cxdiag%datainfo%whatref%shot (integer) |
| run | cxdiag%datainfo%whatref%run (integer) |
| occurrence | cxdiag%datainfo%whatref%occurrence (integer) |
| putinfo | cxdiag%datainfo%putinfo (putinfo) |
| putmethod | cxdiag%datainfo%putinfo%putmethod (string) |
| putaccess | cxdiag%datainfo%putinfo%putaccess (string) |
| putlocation | cxdiag%datainfo%putinfo%putlocation (string) |
| rights | cxdiag%datainfo%putinfo%rights (string) |
| setup | cxdiag%setup (cxsetup) |
| amn | cxdiag%setup%amn (vecflt_type) |
| zn | cxdiag%setup%zn (vecflt_type) |
| position | cxdiag%setup%position (rzphi1Dexp) |
| r | cxdiag%setup%position%r (exp1D) |
| value | cxdiag%setup%position%r%value (vecflt_type) |
| abserror | cxdiag%setup%position%r%abserror (vecflt_type) |
| relerror | cxdiag%setup%position%r%relerror (vecflt_type) |
| z | cxdiag%setup%position%z (exp1D) |
| value | cxdiag%setup%position%z%value (vecflt_type) |
| abserror | cxdiag%setup%position%z%abserror (vecflt_type) |
| relerror | cxdiag%setup%position%z%relerror (vecflt_type) |
| phi | cxdiag%setup%position%phi (exp1D) |
| value | cxdiag%setup%position%phi%value (vecflt_type) |
| abserror | cxdiag%setup%position%phi%abserror (vecflt_type) |
| relerror | cxdiag%setup%position%phi%relerror (vecflt_type) |
| measure | cxdiag%measure (cxmeasure) |
| ti | cxdiag%measure%ti (exp1D) |
| value | cxdiag%measure%ti%value (vecflt_type) |
| abserror | cxdiag%measure%ti%abserror (vecflt_type) |
| relerror | cxdiag%measure%ti%relerror (vecflt_type) |
| vtor | cxdiag%measure%vtor (exp1D) |
| value | cxdiag%measure%vtor%value (vecflt_type) |
| abserror | cxdiag%measure%vtor%abserror (vecflt_type) |
| relerror | cxdiag%measure%vtor%relerror (vecflt_type) |
| vpol | cxdiag%measure%vpol (exp1D) |
| value | cxdiag%measure%vpol%value (vecflt_type) |
| abserror | cxdiag%measure%vpol%abserror (vecflt_type) |
| relerror | cxdiag%measure%vpol%relerror (vecflt_type) |
| codeparam | cxdiag%codeparam (codeparam) |
| codename | cxdiag%codeparam%codename (string) |
| codeversion | cxdiag%codeparam%codeversion (string) |
| parameters | cxdiag%codeparam%parameters (string) |
| output_diag | cxdiag%codeparam%output_diag (string) |
| output_flag | cxdiag%codeparam%output_flag (integer) |
| time | cxdiag%time (float) |
| datainfo | distribution%datainfo (datainfo) |
| dataprovider | distribution%datainfo%dataprovider (string) |
| putdate | distribution%datainfo%putdate (string) |
| source | distribution%datainfo%source (string) |
| comment | distribution%datainfo%comment (string) |
| cocos | distribution%datainfo%cocos (integer) |
| id | distribution%datainfo%id (integer) |
| isref | distribution%datainfo%isref (integer) |
| whatref | distribution%datainfo%whatref (whatref) |
| user | distribution%datainfo%whatref%user (string) |
| machine | distribution%datainfo%whatref%machine (string) |
| shot | distribution%datainfo%whatref%shot (integer) |
| run | distribution%datainfo%whatref%run (integer) |
| occurrence | distribution%datainfo%whatref%occurrence (integer) |
| putinfo | distribution%datainfo%putinfo (putinfo) |
| putmethod | distribution%datainfo%putinfo%putmethod (string) |
| putaccess | distribution%datainfo%putinfo%putaccess (string) |
| putlocation | distribution%datainfo%putinfo%putlocation (string) |
| rights | distribution%datainfo%putinfo%rights (string) |
| composition | distribution%composition (composition) |
| amn | distribution%composition%amn (vecflt_type) |
| zn | distribution%composition%zn (vecflt_type) |
| zion | distribution%composition%zion (vecflt_type) |
| imp_flag | distribution%composition%imp_flag (vecint_type) |
| label | distribution%composition%label (vecstring_type) |
| compositions | distribution%compositions (compositions_type) |
| nuclei | distribution%compositions%nuclei(:) (nuclei) |
| zn | distribution%compositions%nuclei(:)%zn (float) |
| amn | distribution%compositions%nuclei(:)%amn (float) |
| label | distribution%compositions%nuclei(:)%label (string) |
| ions | distribution%compositions%ions(:) (ions) |
| nucindex | distribution%compositions%ions(:)%nucindex (integer) |
| zion | distribution%compositions%ions(:)%zion (float) |
| imp_flag | distribution%compositions%ions(:)%imp_flag (integer) |
| label | distribution%compositions%ions(:)%label (string) |
| impurities | distribution%compositions%impurities(:) (impurities) |
| nucindex | distribution%compositions%impurities(:)%nucindex (integer) |
| i_ion | distribution%compositions%impurities(:)%i_ion (integer) |
| nzimp | distribution%compositions%impurities(:)%nzimp (integer) |
| zmin | distribution%compositions%impurities(:)%zmin (vecflt_type) |
| zmax | distribution%compositions%impurities(:)%zmax (vecflt_type) |
| label | distribution%compositions%impurities(:)%label (vecstring_type) |
| neutralscomp | distribution%compositions%neutralscomp(:) (composition_neutralscomp) |
| neutcomp | distribution%compositions%neutralscomp(:)%neutcomp(:) (composition_neutrals_neutcomp) |
| nucindex | distribution%compositions%neutralscomp(:)%neutcomp(:)%nucindex (integer) |
| multiplicity | distribution%compositions%neutralscomp(:)%neutcomp(:)%multiplicity (integer) |
| type | distribution%compositions%neutralscomp(:)%type(:) (identifier) |
| id | distribution%compositions%neutralscomp(:)%type(:)%id (string) |
| flag | distribution%compositions%neutralscomp(:)%type(:)%flag (integer) |
| description | distribution%compositions%neutralscomp(:)%type(:)%description (string) |
| label | distribution%compositions%neutralscomp(:)%label (string) |
| edgespecies | distribution%compositions%edgespecies(:) (edgespecies) |
| nucindex | distribution%compositions%edgespecies(:)%nucindex (integer) |
| zmin | distribution%compositions%edgespecies(:)%zmin (float) |
| zmax | distribution%compositions%edgespecies(:)%zmax (float) |
| label | distribution%compositions%edgespecies(:)%label (string) |
| signature | distribution%compositions%signature (identifier) |
| id | distribution%compositions%signature%id (string) |
| flag | distribution%compositions%signature%flag (integer) |
| description | distribution%compositions%signature%description (string) |
| distri_vec | distribution%distri_vec(:) (distri_vec) |
| wave_id | distribution%distri_vec(:)%wave_id(:) (enum_instance) |
| type | distribution%distri_vec(:)%wave_id(:)%type (identifier) |
| id | distribution%distri_vec(:)%wave_id(:)%type%id (string) |
| flag | distribution%distri_vec(:)%wave_id(:)%type%flag (integer) |
| description | distribution%distri_vec(:)%wave_id(:)%type%description (string) |
| name | distribution%distri_vec(:)%wave_id(:)%name (string) |
| index | distribution%distri_vec(:)%wave_id(:)%index (integer) |
| source_id | distribution%distri_vec(:)%source_id(:) (enum_instance) |
| type | distribution%distri_vec(:)%source_id(:)%type (identifier) |
| id | distribution%distri_vec(:)%source_id(:)%type%id (string) |
| flag | distribution%distri_vec(:)%source_id(:)%type%flag (integer) |
| description | distribution%distri_vec(:)%source_id(:)%type%description (string) |
| name | distribution%distri_vec(:)%source_id(:)%name (string) |
| index | distribution%distri_vec(:)%source_id(:)%index (integer) |
| species | distribution%distri_vec(:)%species (species_reference) |
| type | distribution%distri_vec(:)%species%type (identifier) |
| id | distribution%distri_vec(:)%species%type%id (string) |
| flag | distribution%distri_vec(:)%species%type%flag (integer) |
| description | distribution%distri_vec(:)%species%type%description (string) |
| index | distribution%distri_vec(:)%species%index (integer) |
| gyro_type | distribution%distri_vec(:)%gyro_type (integer) |
| fast_filter | distribution%distri_vec(:)%fast_filter (fast_thermal_separation_filter) |
| method | distribution%distri_vec(:)%fast_filter%method (identifier) |
| id | distribution%distri_vec(:)%fast_filter%method%id (string) |
| flag | distribution%distri_vec(:)%fast_filter%method%flag (integer) |
| description | distribution%distri_vec(:)%fast_filter%method%description (string) |
| energy_sep | distribution%distri_vec(:)%fast_filter%energy_sep (vecflt_type) |
| global_param | distribution%distri_vec(:)%global_param (dist_global_param) |
| geometry | distribution%distri_vec(:)%global_param%geometry (dist_geometry_0d) |
| mag_axis | distribution%distri_vec(:)%global_param%geometry%mag_axis (rz0D) |
| r | distribution%distri_vec(:)%global_param%geometry%mag_axis%r (float) |
| z | distribution%distri_vec(:)%global_param%geometry%mag_axis%z (float) |
| toroid_field | distribution%distri_vec(:)%global_param%geometry%toroid_field (b0r0) |
| r0 | distribution%distri_vec(:)%global_param%geometry%toroid_field%r0 (float) |
| b0 | distribution%distri_vec(:)%global_param%geometry%toroid_field%b0 (float) |
| state | distribution%distri_vec(:)%global_param%state (dist_state_0d) |
| n_particles | distribution%distri_vec(:)%global_param%state%n_particles (float) |
| n_part_fast | distribution%distri_vec(:)%global_param%state%n_part_fast (float) |
| enrg | distribution%distri_vec(:)%global_param%state%enrg (float) |
| enrg_fast | distribution%distri_vec(:)%global_param%state%enrg_fast (float) |
| enrg_fast_pa | distribution%distri_vec(:)%global_param%state%enrg_fast_pa (float) |
| momentm_fast | distribution%distri_vec(:)%global_param%state%momentm_fast (vecflt_type) |
| current_dr | distribution%distri_vec(:)%global_param%state%current_dr (float) |
| torque_jrxb | distribution%distri_vec(:)%global_param%state%torque_jrxb (float) |
| collisions_e | distribution%distri_vec(:)%global_param%collisions_e (dist_collisional_transfer_0d) |
| power_th | distribution%distri_vec(:)%global_param%collisions_e%power_th (float) |
| power_fast | distribution%distri_vec(:)%global_param%collisions_e%power_fast (float) |
| torque_th | distribution%distri_vec(:)%global_param%collisions_e%torque_th (float) |
| torque_fast | distribution%distri_vec(:)%global_param%collisions_e%torque_fast (float) |
| collisions_i | distribution%distri_vec(:)%global_param%collisions_i(:) (dist_collisional_transfer_0d) |
| power_th | distribution%distri_vec(:)%global_param%collisions_i(:)%power_th (float) |
| power_fast | distribution%distri_vec(:)%global_param%collisions_i(:)%power_fast (float) |
| torque_th | distribution%distri_vec(:)%global_param%collisions_i(:)%torque_th (float) |
| torque_fast | distribution%distri_vec(:)%global_param%collisions_i(:)%torque_fast (float) |
| collisions_z | distribution%distri_vec(:)%global_param%collisions_z(:) (dist_global_param_collisions_z) |
| charge_state | distribution%distri_vec(:)%global_param%collisions_z(:)%charge_state(:) (dist_collisional_transfer_0d) |
| power_th | distribution%distri_vec(:)%global_param%collisions_z(:)%charge_state(:)%power_th (float) |
| power_fast | distribution%distri_vec(:)%global_param%collisions_z(:)%charge_state(:)%power_fast (float) |
| torque_th | distribution%distri_vec(:)%global_param%collisions_z(:)%charge_state(:)%torque_th (float) |
| torque_fast | distribution%distri_vec(:)%global_param%collisions_z(:)%charge_state(:)%torque_fast (float) |
| sources | distribution%distri_vec(:)%global_param%sources(:) (dist_sources_0d) |
| source_ref | distribution%distri_vec(:)%global_param%sources(:)%source_ref (dist_sources_reference) |
| type | distribution%distri_vec(:)%global_param%sources(:)%source_ref%type (identifier) |
| id | distribution%distri_vec(:)%global_param%sources(:)%source_ref%type%id (string) |
| flag | distribution%distri_vec(:)%global_param%sources(:)%source_ref%type%flag (integer) |
| description | distribution%distri_vec(:)%global_param%sources(:)%source_ref%type%description (string) |
| index_waveid | distribution%distri_vec(:)%global_param%sources(:)%source_ref%index_waveid (vecint_type) |
| index_srcid | distribution%distri_vec(:)%global_param%sources(:)%source_ref%index_srcid (vecint_type) |
| particle | distribution%distri_vec(:)%global_param%sources(:)%particle (float) |
| momentum | distribution%distri_vec(:)%global_param%sources(:)%momentum (float) |
| energy | distribution%distri_vec(:)%global_param%sources(:)%energy (float) |
| profiles_1d | distribution%distri_vec(:)%profiles_1d (dist_profiles_1d) |
| geometry | distribution%distri_vec(:)%profiles_1d%geometry (dist_geometry_1d) |
| rho_tor | distribution%distri_vec(:)%profiles_1d%geometry%rho_tor (vecflt_type) |
| rho_tor_norm | distribution%distri_vec(:)%profiles_1d%geometry%rho_tor_norm (vecflt_type) |
| psi | distribution%distri_vec(:)%profiles_1d%geometry%psi (vecflt_type) |
| volume | distribution%distri_vec(:)%profiles_1d%geometry%volume (vecflt_type) |
| area | distribution%distri_vec(:)%profiles_1d%geometry%area (vecflt_type) |
| state | distribution%distri_vec(:)%profiles_1d%state (dist_state_1d) |
| dens | distribution%distri_vec(:)%profiles_1d%state%dens (vecflt_type) |
| dens_fast | distribution%distri_vec(:)%profiles_1d%state%dens_fast (vecflt_type) |
| pres | distribution%distri_vec(:)%profiles_1d%state%pres (vecflt_type) |
| pres_fast | distribution%distri_vec(:)%profiles_1d%state%pres_fast (vecflt_type) |
| pres_fast_pa | distribution%distri_vec(:)%profiles_1d%state%pres_fast_pa (vecflt_type) |
| momentm_fast | distribution%distri_vec(:)%profiles_1d%state%momentm_fast (vecflt_type) |
| current | distribution%distri_vec(:)%profiles_1d%state%current (vecflt_type) |
| current_fast | distribution%distri_vec(:)%profiles_1d%state%current_fast (vecflt_type) |
| torque_jrxb | distribution%distri_vec(:)%profiles_1d%state%torque_jrxb (vecflt_type) |
| collisions_e | distribution%distri_vec(:)%profiles_1d%collisions_e (dist_collisional_transfer_1d) |
| power_th | distribution%distri_vec(:)%profiles_1d%collisions_e%power_th (vecflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_1d%collisions_e%power_fast (vecflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_1d%collisions_e%torque_th (vecflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_1d%collisions_e%torque_fast (vecflt_type) |
| collisions_i | distribution%distri_vec(:)%profiles_1d%collisions_i(:) (dist_collisional_transfer_1d) |
| power_th | distribution%distri_vec(:)%profiles_1d%collisions_i(:)%power_th (vecflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_1d%collisions_i(:)%power_fast (vecflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_1d%collisions_i(:)%torque_th (vecflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_1d%collisions_i(:)%torque_fast (vecflt_type) |
| collisions_z | distribution%distri_vec(:)%profiles_1d%collisions_z(:) (dist_profiles_1d_collisions_z) |
| charge_state | distribution%distri_vec(:)%profiles_1d%collisions_z(:)%charge_state(:) (dist_collisional_transfer_1d) |
| power_th | distribution%distri_vec(:)%profiles_1d%collisions_z(:)%charge_state(:)%power_th (vecflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_1d%collisions_z(:)%charge_state(:)%power_fast (vecflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_1d%collisions_z(:)%charge_state(:)%torque_th (vecflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_1d%collisions_z(:)%charge_state(:)%torque_fast (vecflt_type) |
| sources | distribution%distri_vec(:)%profiles_1d%sources(:) (dist_sources_1d) |
| source_ref | distribution%distri_vec(:)%profiles_1d%sources(:)%source_ref (dist_sources_reference) |
| type | distribution%distri_vec(:)%profiles_1d%sources(:)%source_ref%type (identifier) |
| id | distribution%distri_vec(:)%profiles_1d%sources(:)%source_ref%type%id (string) |
| flag | distribution%distri_vec(:)%profiles_1d%sources(:)%source_ref%type%flag (integer) |
| description | distribution%distri_vec(:)%profiles_1d%sources(:)%source_ref%type%description (string) |
| index_waveid | distribution%distri_vec(:)%profiles_1d%sources(:)%source_ref%index_waveid (vecint_type) |
| index_srcid | distribution%distri_vec(:)%profiles_1d%sources(:)%source_ref%index_srcid (vecint_type) |
| particle | distribution%distri_vec(:)%profiles_1d%sources(:)%particle (vecflt_type) |
| momentum | distribution%distri_vec(:)%profiles_1d%sources(:)%momentum (vecflt_type) |
| energy | distribution%distri_vec(:)%profiles_1d%sources(:)%energy (vecflt_type) |
| trapped | distribution%distri_vec(:)%profiles_1d%trapped (dist_profile_values_1d) |
| state | distribution%distri_vec(:)%profiles_1d%trapped%state (dist_state_1d) |
| dens | distribution%distri_vec(:)%profiles_1d%trapped%state%dens (vecflt_type) |
| dens_fast | distribution%distri_vec(:)%profiles_1d%trapped%state%dens_fast (vecflt_type) |
| pres | distribution%distri_vec(:)%profiles_1d%trapped%state%pres (vecflt_type) |
| pres_fast | distribution%distri_vec(:)%profiles_1d%trapped%state%pres_fast (vecflt_type) |
| pres_fast_pa | distribution%distri_vec(:)%profiles_1d%trapped%state%pres_fast_pa (vecflt_type) |
| momentm_fast | distribution%distri_vec(:)%profiles_1d%trapped%state%momentm_fast (vecflt_type) |
| current | distribution%distri_vec(:)%profiles_1d%trapped%state%current (vecflt_type) |
| current_fast | distribution%distri_vec(:)%profiles_1d%trapped%state%current_fast (vecflt_type) |
| torque_jrxb | distribution%distri_vec(:)%profiles_1d%trapped%state%torque_jrxb (vecflt_type) |
| collisions_e | distribution%distri_vec(:)%profiles_1d%trapped%collisions_e (dist_collisional_transfer_1d) |
| power_th | distribution%distri_vec(:)%profiles_1d%trapped%collisions_e%power_th (vecflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_1d%trapped%collisions_e%power_fast (vecflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_1d%trapped%collisions_e%torque_th (vecflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_1d%trapped%collisions_e%torque_fast (vecflt_type) |
| collisions_i | distribution%distri_vec(:)%profiles_1d%trapped%collisions_i(:) (dist_collisional_transfer_1d) |
| power_th | distribution%distri_vec(:)%profiles_1d%trapped%collisions_i(:)%power_th (vecflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_1d%trapped%collisions_i(:)%power_fast (vecflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_1d%trapped%collisions_i(:)%torque_th (vecflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_1d%trapped%collisions_i(:)%torque_fast (vecflt_type) |
| collisions_z | distribution%distri_vec(:)%profiles_1d%trapped%collisions_z(:) (dist_profiles_1d_collisions_z) |
| charge_state | distribution%distri_vec(:)%profiles_1d%trapped%collisions_z(:)%charge_state(:) (dist_collisional_transfer_1d) |
| power_th | distribution%distri_vec(:)%profiles_1d%trapped%collisions_z(:)%charge_state(:)%power_th (vecflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_1d%trapped%collisions_z(:)%charge_state(:)%power_fast (vecflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_1d%trapped%collisions_z(:)%charge_state(:)%torque_th (vecflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_1d%trapped%collisions_z(:)%charge_state(:)%torque_fast (vecflt_type) |
| sources | distribution%distri_vec(:)%profiles_1d%trapped%sources(:) (dist_sources_1d) |
| source_ref | distribution%distri_vec(:)%profiles_1d%trapped%sources(:)%source_ref (dist_sources_reference) |
| type | distribution%distri_vec(:)%profiles_1d%trapped%sources(:)%source_ref%type (identifier) |
| id | distribution%distri_vec(:)%profiles_1d%trapped%sources(:)%source_ref%type%id (string) |
| flag | distribution%distri_vec(:)%profiles_1d%trapped%sources(:)%source_ref%type%flag (integer) |
| description | distribution%distri_vec(:)%profiles_1d%trapped%sources(:)%source_ref%type%description (string) |
| index_waveid | distribution%distri_vec(:)%profiles_1d%trapped%sources(:)%source_ref%index_waveid (vecint_type) |
| index_srcid | distribution%distri_vec(:)%profiles_1d%trapped%sources(:)%source_ref%index_srcid (vecint_type) |
| particle | distribution%distri_vec(:)%profiles_1d%trapped%sources(:)%particle (vecflt_type) |
| momentum | distribution%distri_vec(:)%profiles_1d%trapped%sources(:)%momentum (vecflt_type) |
| energy | distribution%distri_vec(:)%profiles_1d%trapped%sources(:)%energy (vecflt_type) |
| co_passing | distribution%distri_vec(:)%profiles_1d%co_passing (dist_profile_values_1d) |
| state | distribution%distri_vec(:)%profiles_1d%co_passing%state (dist_state_1d) |
| dens | distribution%distri_vec(:)%profiles_1d%co_passing%state%dens (vecflt_type) |
| dens_fast | distribution%distri_vec(:)%profiles_1d%co_passing%state%dens_fast (vecflt_type) |
| pres | distribution%distri_vec(:)%profiles_1d%co_passing%state%pres (vecflt_type) |
| pres_fast | distribution%distri_vec(:)%profiles_1d%co_passing%state%pres_fast (vecflt_type) |
| pres_fast_pa | distribution%distri_vec(:)%profiles_1d%co_passing%state%pres_fast_pa (vecflt_type) |
| momentm_fast | distribution%distri_vec(:)%profiles_1d%co_passing%state%momentm_fast (vecflt_type) |
| current | distribution%distri_vec(:)%profiles_1d%co_passing%state%current (vecflt_type) |
| current_fast | distribution%distri_vec(:)%profiles_1d%co_passing%state%current_fast (vecflt_type) |
| torque_jrxb | distribution%distri_vec(:)%profiles_1d%co_passing%state%torque_jrxb (vecflt_type) |
| collisions_e | distribution%distri_vec(:)%profiles_1d%co_passing%collisions_e (dist_collisional_transfer_1d) |
| power_th | distribution%distri_vec(:)%profiles_1d%co_passing%collisions_e%power_th (vecflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_1d%co_passing%collisions_e%power_fast (vecflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_1d%co_passing%collisions_e%torque_th (vecflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_1d%co_passing%collisions_e%torque_fast (vecflt_type) |
| collisions_i | distribution%distri_vec(:)%profiles_1d%co_passing%collisions_i(:) (dist_collisional_transfer_1d) |
| power_th | distribution%distri_vec(:)%profiles_1d%co_passing%collisions_i(:)%power_th (vecflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_1d%co_passing%collisions_i(:)%power_fast (vecflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_1d%co_passing%collisions_i(:)%torque_th (vecflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_1d%co_passing%collisions_i(:)%torque_fast (vecflt_type) |
| collisions_z | distribution%distri_vec(:)%profiles_1d%co_passing%collisions_z(:) (dist_profiles_1d_collisions_z) |
| charge_state | distribution%distri_vec(:)%profiles_1d%co_passing%collisions_z(:)%charge_state(:) (dist_collisional_transfer_1d) |
| power_th | distribution%distri_vec(:)%profiles_1d%co_passing%collisions_z(:)%charge_state(:)%power_th (vecflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_1d%co_passing%collisions_z(:)%charge_state(:)%power_fast (vecflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_1d%co_passing%collisions_z(:)%charge_state(:)%torque_th (vecflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_1d%co_passing%collisions_z(:)%charge_state(:)%torque_fast (vecflt_type) |
| sources | distribution%distri_vec(:)%profiles_1d%co_passing%sources(:) (dist_sources_1d) |
| source_ref | distribution%distri_vec(:)%profiles_1d%co_passing%sources(:)%source_ref (dist_sources_reference) |
| type | distribution%distri_vec(:)%profiles_1d%co_passing%sources(:)%source_ref%type (identifier) |
| id | distribution%distri_vec(:)%profiles_1d%co_passing%sources(:)%source_ref%type%id (string) |
| flag | distribution%distri_vec(:)%profiles_1d%co_passing%sources(:)%source_ref%type%flag (integer) |
| description | distribution%distri_vec(:)%profiles_1d%co_passing%sources(:)%source_ref%type%description (string) |
| index_waveid | distribution%distri_vec(:)%profiles_1d%co_passing%sources(:)%source_ref%index_waveid (vecint_type) |
| index_srcid | distribution%distri_vec(:)%profiles_1d%co_passing%sources(:)%source_ref%index_srcid (vecint_type) |
| particle | distribution%distri_vec(:)%profiles_1d%co_passing%sources(:)%particle (vecflt_type) |
| momentum | distribution%distri_vec(:)%profiles_1d%co_passing%sources(:)%momentum (vecflt_type) |
| energy | distribution%distri_vec(:)%profiles_1d%co_passing%sources(:)%energy (vecflt_type) |
| cntr_passing | distribution%distri_vec(:)%profiles_1d%cntr_passing (dist_profile_values_1d) |
| state | distribution%distri_vec(:)%profiles_1d%cntr_passing%state (dist_state_1d) |
| dens | distribution%distri_vec(:)%profiles_1d%cntr_passing%state%dens (vecflt_type) |
| dens_fast | distribution%distri_vec(:)%profiles_1d%cntr_passing%state%dens_fast (vecflt_type) |
| pres | distribution%distri_vec(:)%profiles_1d%cntr_passing%state%pres (vecflt_type) |
| pres_fast | distribution%distri_vec(:)%profiles_1d%cntr_passing%state%pres_fast (vecflt_type) |
| pres_fast_pa | distribution%distri_vec(:)%profiles_1d%cntr_passing%state%pres_fast_pa (vecflt_type) |
| momentm_fast | distribution%distri_vec(:)%profiles_1d%cntr_passing%state%momentm_fast (vecflt_type) |
| current | distribution%distri_vec(:)%profiles_1d%cntr_passing%state%current (vecflt_type) |
| current_fast | distribution%distri_vec(:)%profiles_1d%cntr_passing%state%current_fast (vecflt_type) |
| torque_jrxb | distribution%distri_vec(:)%profiles_1d%cntr_passing%state%torque_jrxb (vecflt_type) |
| collisions_e | distribution%distri_vec(:)%profiles_1d%cntr_passing%collisions_e (dist_collisional_transfer_1d) |
| power_th | distribution%distri_vec(:)%profiles_1d%cntr_passing%collisions_e%power_th (vecflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_1d%cntr_passing%collisions_e%power_fast (vecflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_1d%cntr_passing%collisions_e%torque_th (vecflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_1d%cntr_passing%collisions_e%torque_fast (vecflt_type) |
| collisions_i | distribution%distri_vec(:)%profiles_1d%cntr_passing%collisions_i(:) (dist_collisional_transfer_1d) |
| power_th | distribution%distri_vec(:)%profiles_1d%cntr_passing%collisions_i(:)%power_th (vecflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_1d%cntr_passing%collisions_i(:)%power_fast (vecflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_1d%cntr_passing%collisions_i(:)%torque_th (vecflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_1d%cntr_passing%collisions_i(:)%torque_fast (vecflt_type) |
| collisions_z | distribution%distri_vec(:)%profiles_1d%cntr_passing%collisions_z(:) (dist_profiles_1d_collisions_z) |
| charge_state | distribution%distri_vec(:)%profiles_1d%cntr_passing%collisions_z(:)%charge_state(:) (dist_collisional_transfer_1d) |
| power_th | distribution%distri_vec(:)%profiles_1d%cntr_passing%collisions_z(:)%charge_state(:)%power_th (vecflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_1d%cntr_passing%collisions_z(:)%charge_state(:)%power_fast (vecflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_1d%cntr_passing%collisions_z(:)%charge_state(:)%torque_th (vecflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_1d%cntr_passing%collisions_z(:)%charge_state(:)%torque_fast (vecflt_type) |
| sources | distribution%distri_vec(:)%profiles_1d%cntr_passing%sources(:) (dist_sources_1d) |
| source_ref | distribution%distri_vec(:)%profiles_1d%cntr_passing%sources(:)%source_ref (dist_sources_reference) |
| type | distribution%distri_vec(:)%profiles_1d%cntr_passing%sources(:)%source_ref%type (identifier) |
| id | distribution%distri_vec(:)%profiles_1d%cntr_passing%sources(:)%source_ref%type%id (string) |
| flag | distribution%distri_vec(:)%profiles_1d%cntr_passing%sources(:)%source_ref%type%flag (integer) |
| description | distribution%distri_vec(:)%profiles_1d%cntr_passing%sources(:)%source_ref%type%description (string) |
| index_waveid | distribution%distri_vec(:)%profiles_1d%cntr_passing%sources(:)%source_ref%index_waveid (vecint_type) |
| index_srcid | distribution%distri_vec(:)%profiles_1d%cntr_passing%sources(:)%source_ref%index_srcid (vecint_type) |
| particle | distribution%distri_vec(:)%profiles_1d%cntr_passing%sources(:)%particle (vecflt_type) |
| momentum | distribution%distri_vec(:)%profiles_1d%cntr_passing%sources(:)%momentum (vecflt_type) |
| energy | distribution%distri_vec(:)%profiles_1d%cntr_passing%sources(:)%energy (vecflt_type) |
| profiles_2d | distribution%distri_vec(:)%profiles_2d (dist_profiles_2d) |
| geometry | distribution%distri_vec(:)%profiles_2d%geometry (dist_geometry_2d) |
| coord_type | distribution%distri_vec(:)%profiles_2d%geometry%coord_type (integer) |
| r | distribution%distri_vec(:)%profiles_2d%geometry%r (matflt_type) |
| z | distribution%distri_vec(:)%profiles_2d%geometry%z (matflt_type) |
| rho_tor | distribution%distri_vec(:)%profiles_2d%geometry%rho_tor (matflt_type) |
| psi | distribution%distri_vec(:)%profiles_2d%geometry%psi (matflt_type) |
| theta_geom | distribution%distri_vec(:)%profiles_2d%geometry%theta_geom (matflt_type) |
| theta_strt | distribution%distri_vec(:)%profiles_2d%geometry%theta_strt (matflt_type) |
| state | distribution%distri_vec(:)%profiles_2d%state (dist_state_2d) |
| dens | distribution%distri_vec(:)%profiles_2d%state%dens (matflt_type) |
| dens_fast | distribution%distri_vec(:)%profiles_2d%state%dens_fast (matflt_type) |
| pres | distribution%distri_vec(:)%profiles_2d%state%pres (matflt_type) |
| pres_fast | distribution%distri_vec(:)%profiles_2d%state%pres_fast (matflt_type) |
| pres_fast_pa | distribution%distri_vec(:)%profiles_2d%state%pres_fast_pa (matflt_type) |
| momentm_fast | distribution%distri_vec(:)%profiles_2d%state%momentm_fast (matflt_type) |
| current | distribution%distri_vec(:)%profiles_2d%state%current (matflt_type) |
| current_fast | distribution%distri_vec(:)%profiles_2d%state%current_fast (matflt_type) |
| torque_jrxb | distribution%distri_vec(:)%profiles_2d%state%torque_jrxb (matflt_type) |
| collisions_e | distribution%distri_vec(:)%profiles_2d%collisions_e (dist_collisional_transfer_2d) |
| power_th | distribution%distri_vec(:)%profiles_2d%collisions_e%power_th (matflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_2d%collisions_e%power_fast (matflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_2d%collisions_e%torque_th (matflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_2d%collisions_e%torque_fast (matflt_type) |
| collisions_i | distribution%distri_vec(:)%profiles_2d%collisions_i(:) (dist_collisional_transfer_2d) |
| power_th | distribution%distri_vec(:)%profiles_2d%collisions_i(:)%power_th (matflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_2d%collisions_i(:)%power_fast (matflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_2d%collisions_i(:)%torque_th (matflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_2d%collisions_i(:)%torque_fast (matflt_type) |
| collisions_z | distribution%distri_vec(:)%profiles_2d%collisions_z(:) (dist_profiles2d_collisions_z) |
| charge_state | distribution%distri_vec(:)%profiles_2d%collisions_z(:)%charge_state(:) (dist_collisional_transfer_2d) |
| power_th | distribution%distri_vec(:)%profiles_2d%collisions_z(:)%charge_state(:)%power_th (matflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_2d%collisions_z(:)%charge_state(:)%power_fast (matflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_2d%collisions_z(:)%charge_state(:)%torque_th (matflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_2d%collisions_z(:)%charge_state(:)%torque_fast (matflt_type) |
| trapped | distribution%distri_vec(:)%profiles_2d%trapped (dist_profile_values_2d) |
| state | distribution%distri_vec(:)%profiles_2d%trapped%state (dist_state_2d) |
| dens | distribution%distri_vec(:)%profiles_2d%trapped%state%dens (matflt_type) |
| dens_fast | distribution%distri_vec(:)%profiles_2d%trapped%state%dens_fast (matflt_type) |
| pres | distribution%distri_vec(:)%profiles_2d%trapped%state%pres (matflt_type) |
| pres_fast | distribution%distri_vec(:)%profiles_2d%trapped%state%pres_fast (matflt_type) |
| pres_fast_pa | distribution%distri_vec(:)%profiles_2d%trapped%state%pres_fast_pa (matflt_type) |
| momentm_fast | distribution%distri_vec(:)%profiles_2d%trapped%state%momentm_fast (matflt_type) |
| current | distribution%distri_vec(:)%profiles_2d%trapped%state%current (matflt_type) |
| current_fast | distribution%distri_vec(:)%profiles_2d%trapped%state%current_fast (matflt_type) |
| torque_jrxb | distribution%distri_vec(:)%profiles_2d%trapped%state%torque_jrxb (matflt_type) |
| collisions_e | distribution%distri_vec(:)%profiles_2d%trapped%collisions_e (dist_collisional_transfer_2d) |
| power_th | distribution%distri_vec(:)%profiles_2d%trapped%collisions_e%power_th (matflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_2d%trapped%collisions_e%power_fast (matflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_2d%trapped%collisions_e%torque_th (matflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_2d%trapped%collisions_e%torque_fast (matflt_type) |
| collisions_i | distribution%distri_vec(:)%profiles_2d%trapped%collisions_i(:) (dist_collisional_transfer_2d) |
| power_th | distribution%distri_vec(:)%profiles_2d%trapped%collisions_i(:)%power_th (matflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_2d%trapped%collisions_i(:)%power_fast (matflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_2d%trapped%collisions_i(:)%torque_th (matflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_2d%trapped%collisions_i(:)%torque_fast (matflt_type) |
| collisions_z | distribution%distri_vec(:)%profiles_2d%trapped%collisions_z(:) (dist_profiles2d_collisions_z) |
| charge_state | distribution%distri_vec(:)%profiles_2d%trapped%collisions_z(:)%charge_state(:) (dist_collisional_transfer_2d) |
| power_th | distribution%distri_vec(:)%profiles_2d%trapped%collisions_z(:)%charge_state(:)%power_th (matflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_2d%trapped%collisions_z(:)%charge_state(:)%power_fast (matflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_2d%trapped%collisions_z(:)%charge_state(:)%torque_th (matflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_2d%trapped%collisions_z(:)%charge_state(:)%torque_fast (matflt_type) |
| co_passing | distribution%distri_vec(:)%profiles_2d%co_passing (dist_profile_values_2d) |
| state | distribution%distri_vec(:)%profiles_2d%co_passing%state (dist_state_2d) |
| dens | distribution%distri_vec(:)%profiles_2d%co_passing%state%dens (matflt_type) |
| dens_fast | distribution%distri_vec(:)%profiles_2d%co_passing%state%dens_fast (matflt_type) |
| pres | distribution%distri_vec(:)%profiles_2d%co_passing%state%pres (matflt_type) |
| pres_fast | distribution%distri_vec(:)%profiles_2d%co_passing%state%pres_fast (matflt_type) |
| pres_fast_pa | distribution%distri_vec(:)%profiles_2d%co_passing%state%pres_fast_pa (matflt_type) |
| momentm_fast | distribution%distri_vec(:)%profiles_2d%co_passing%state%momentm_fast (matflt_type) |
| current | distribution%distri_vec(:)%profiles_2d%co_passing%state%current (matflt_type) |
| current_fast | distribution%distri_vec(:)%profiles_2d%co_passing%state%current_fast (matflt_type) |
| torque_jrxb | distribution%distri_vec(:)%profiles_2d%co_passing%state%torque_jrxb (matflt_type) |
| collisions_e | distribution%distri_vec(:)%profiles_2d%co_passing%collisions_e (dist_collisional_transfer_2d) |
| power_th | distribution%distri_vec(:)%profiles_2d%co_passing%collisions_e%power_th (matflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_2d%co_passing%collisions_e%power_fast (matflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_2d%co_passing%collisions_e%torque_th (matflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_2d%co_passing%collisions_e%torque_fast (matflt_type) |
| collisions_i | distribution%distri_vec(:)%profiles_2d%co_passing%collisions_i(:) (dist_collisional_transfer_2d) |
| power_th | distribution%distri_vec(:)%profiles_2d%co_passing%collisions_i(:)%power_th (matflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_2d%co_passing%collisions_i(:)%power_fast (matflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_2d%co_passing%collisions_i(:)%torque_th (matflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_2d%co_passing%collisions_i(:)%torque_fast (matflt_type) |
| collisions_z | distribution%distri_vec(:)%profiles_2d%co_passing%collisions_z(:) (dist_profiles2d_collisions_z) |
| charge_state | distribution%distri_vec(:)%profiles_2d%co_passing%collisions_z(:)%charge_state(:) (dist_collisional_transfer_2d) |
| power_th | distribution%distri_vec(:)%profiles_2d%co_passing%collisions_z(:)%charge_state(:)%power_th (matflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_2d%co_passing%collisions_z(:)%charge_state(:)%power_fast (matflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_2d%co_passing%collisions_z(:)%charge_state(:)%torque_th (matflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_2d%co_passing%collisions_z(:)%charge_state(:)%torque_fast (matflt_type) |
| cntr_passing | distribution%distri_vec(:)%profiles_2d%cntr_passing (dist_profile_values_2d) |
| state | distribution%distri_vec(:)%profiles_2d%cntr_passing%state (dist_state_2d) |
| dens | distribution%distri_vec(:)%profiles_2d%cntr_passing%state%dens (matflt_type) |
| dens_fast | distribution%distri_vec(:)%profiles_2d%cntr_passing%state%dens_fast (matflt_type) |
| pres | distribution%distri_vec(:)%profiles_2d%cntr_passing%state%pres (matflt_type) |
| pres_fast | distribution%distri_vec(:)%profiles_2d%cntr_passing%state%pres_fast (matflt_type) |
| pres_fast_pa | distribution%distri_vec(:)%profiles_2d%cntr_passing%state%pres_fast_pa (matflt_type) |
| momentm_fast | distribution%distri_vec(:)%profiles_2d%cntr_passing%state%momentm_fast (matflt_type) |
| current | distribution%distri_vec(:)%profiles_2d%cntr_passing%state%current (matflt_type) |
| current_fast | distribution%distri_vec(:)%profiles_2d%cntr_passing%state%current_fast (matflt_type) |
| torque_jrxb | distribution%distri_vec(:)%profiles_2d%cntr_passing%state%torque_jrxb (matflt_type) |
| collisions_e | distribution%distri_vec(:)%profiles_2d%cntr_passing%collisions_e (dist_collisional_transfer_2d) |
| power_th | distribution%distri_vec(:)%profiles_2d%cntr_passing%collisions_e%power_th (matflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_2d%cntr_passing%collisions_e%power_fast (matflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_2d%cntr_passing%collisions_e%torque_th (matflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_2d%cntr_passing%collisions_e%torque_fast (matflt_type) |
| collisions_i | distribution%distri_vec(:)%profiles_2d%cntr_passing%collisions_i(:) (dist_collisional_transfer_2d) |
| power_th | distribution%distri_vec(:)%profiles_2d%cntr_passing%collisions_i(:)%power_th (matflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_2d%cntr_passing%collisions_i(:)%power_fast (matflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_2d%cntr_passing%collisions_i(:)%torque_th (matflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_2d%cntr_passing%collisions_i(:)%torque_fast (matflt_type) |
| collisions_z | distribution%distri_vec(:)%profiles_2d%cntr_passing%collisions_z(:) (dist_profiles2d_collisions_z) |
| charge_state | distribution%distri_vec(:)%profiles_2d%cntr_passing%collisions_z(:)%charge_state(:) (dist_collisional_transfer_2d) |
| power_th | distribution%distri_vec(:)%profiles_2d%cntr_passing%collisions_z(:)%charge_state(:)%power_th (matflt_type) |
| power_fast | distribution%distri_vec(:)%profiles_2d%cntr_passing%collisions_z(:)%charge_state(:)%power_fast (matflt_type) |
| torque_th | distribution%distri_vec(:)%profiles_2d%cntr_passing%collisions_z(:)%charge_state(:)%torque_th (matflt_type) |
| torque_fast | distribution%distri_vec(:)%profiles_2d%cntr_passing%collisions_z(:)%charge_state(:)%torque_fast (matflt_type) |
| dist_func | distribution%distri_vec(:)%dist_func (dist_func) |
| is_delta_f | distribution%distri_vec(:)%dist_func%is_delta_f (integer) |
| markers | distribution%distri_vec(:)%dist_func%markers (weighted_markers) |
| variable_ids | distribution%distri_vec(:)%dist_func%markers%variable_ids(:) (identifier) |
| id | distribution%distri_vec(:)%dist_func%markers%variable_ids(:)%id (string) |
| flag | distribution%distri_vec(:)%dist_func%markers%variable_ids(:)%flag (integer) |
| description | distribution%distri_vec(:)%dist_func%markers%variable_ids(:)%description (string) |
| coord | distribution%distri_vec(:)%dist_func%markers%coord (matflt_type) |
| weight | distribution%distri_vec(:)%dist_func%markers%weight (vecflt_type) |
| f_expan_topo | distribution%distri_vec(:)%dist_func%f_expan_topo(:) (dist_ff) |
| grid_info | distribution%distri_vec(:)%dist_func%f_expan_topo(:)%grid_info (dist_grid_info) |
| grid_type | distribution%distri_vec(:)%dist_func%f_expan_topo(:)%grid_info%grid_type (integer) |
| ngriddim | distribution%distri_vec(:)%dist_func%f_expan_topo(:)%grid_info%ngriddim (integer) |
| grid_coord | distribution%distri_vec(:)%dist_func%f_expan_topo(:)%grid_info%grid_coord (vecint_type) |
| thin_orbits | distribution%distri_vec(:)%dist_func%f_expan_topo(:)%grid_info%thin_orbits (integer) |
| topology | distribution%distri_vec(:)%dist_func%f_expan_topo(:)%grid_info%topology (string) |
| omnigen_surf | distribution%distri_vec(:)%dist_func%f_expan_topo(:)%grid_info%omnigen_surf(:) (omnigen_surf) |
| rz | distribution%distri_vec(:)%dist_func%f_expan_topo(:)%grid_info%omnigen_surf(:)%rz (rz1D) |
| r | distribution%distri_vec(:)%dist_func%f_expan_topo(:)%grid_info%omnigen_surf(:)%rz%r (vecflt_type) |
| z | distribution%distri_vec(:)%dist_func%f_expan_topo(:)%grid_info%omnigen_surf(:)%rz%z (vecflt_type) |
| s | distribution%distri_vec(:)%dist_func%f_expan_topo(:)%grid_info%omnigen_surf(:)%s (vecflt_type) |
| topo_regions | distribution%distri_vec(:)%dist_func%f_expan_topo(:)%topo_regions(:) (topo_regions) |
| ind_omnigen | distribution%distri_vec(:)%dist_func%f_expan_topo(:)%topo_regions(:)%ind_omnigen (integer) |
| dim1 | distribution%distri_vec(:)%dist_func%f_expan_topo(:)%topo_regions(:)%dim1 (array6dflt_type) |
| dim2 | distribution%distri_vec(:)%dist_func%f_expan_topo(:)%topo_regions(:)%dim2 (array6dflt_type) |
| dim3 | distribution%distri_vec(:)%dist_func%f_expan_topo(:)%topo_regions(:)%dim3 (array6dflt_type) |
| dim4 | distribution%distri_vec(:)%dist_func%f_expan_topo(:)%topo_regions(:)%dim4 (array6dflt_type) |
| dim5 | distribution%distri_vec(:)%dist_func%f_expan_topo(:)%topo_regions(:)%dim5 (array6dflt_type) |
| dim6 | distribution%distri_vec(:)%dist_func%f_expan_topo(:)%topo_regions(:)%dim6 (array6dflt_type) |
| jacobian | distribution%distri_vec(:)%dist_func%f_expan_topo(:)%topo_regions(:)%jacobian (array6dflt_type) |
| distfunc | distribution%distri_vec(:)%dist_func%f_expan_topo(:)%topo_regions(:)%distfunc (array6dflt_type) |
| f_expansion | distribution%distri_vec(:)%dist_func%f_expansion(:) (f_expansion) |
| grid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid (complexgrid) |
| uid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%uid (integer) |
| id | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%id (string) |
| spaces | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%spaces(:) (complexgrid_space) |
| geotype | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%spaces(:)%geotype (vecint_type) |
| geotypeid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%spaces(:)%geotypeid (vecstring_type) |
| coordtype | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%spaces(:)%coordtype (matint_type) |
| objects | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%spaces(:)%objects(:) (objects) |
| boundary | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%spaces(:)%objects(:)%boundary (matint_type) |
| neighbour | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%spaces(:)%objects(:)%neighbour (array3dint_type) |
| geo | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%spaces(:)%objects(:)%geo (array4dflt_type) |
| measure | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%spaces(:)%objects(:)%measure (matflt_type) |
| xpoints | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%spaces(:)%xpoints (vecint_type) |
| subgrids | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%subgrids(:) (complexgrid_subgrid) |
| id | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%subgrids(:)%id (string) |
| list | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%subgrids(:)%list(:) (complexgrid_objectlist) |
| cls | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%subgrids(:)%list(:)%cls (vecint_type) |
| indset | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%subgrids(:)%list(:)%indset(:) (complexgrid_indexlist) |
| range | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%subgrids(:)%list(:)%indset(:)%range (vecint_type) |
| ind | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%subgrids(:)%list(:)%indset(:)%ind (vecint_type) |
| ind | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%subgrids(:)%list(:)%ind (matint_type) |
| metric | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric (complexgrid_metric) |
| measure | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%measure(:) (complexgrid_scalar) |
| griduid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%measure(:)%griduid (integer) |
| subgrid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%measure(:)%subgrid (integer) |
| scalar | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%measure(:)%scalar (vecflt_type) |
| vector | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%measure(:)%vector (matflt_type) |
| matrix | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%measure(:)%matrix (array3dflt_type) |
| g11 | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g11(:) (complexgrid_scalar) |
| griduid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g11(:)%griduid (integer) |
| subgrid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g11(:)%subgrid (integer) |
| scalar | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g11(:)%scalar (vecflt_type) |
| vector | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g11(:)%vector (matflt_type) |
| matrix | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g11(:)%matrix (array3dflt_type) |
| g12 | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g12(:) (complexgrid_scalar) |
| griduid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g12(:)%griduid (integer) |
| subgrid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g12(:)%subgrid (integer) |
| scalar | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g12(:)%scalar (vecflt_type) |
| vector | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g12(:)%vector (matflt_type) |
| matrix | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g12(:)%matrix (array3dflt_type) |
| g13 | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g13(:) (complexgrid_scalar) |
| griduid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g13(:)%griduid (integer) |
| subgrid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g13(:)%subgrid (integer) |
| scalar | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g13(:)%scalar (vecflt_type) |
| vector | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g13(:)%vector (matflt_type) |
| matrix | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g13(:)%matrix (array3dflt_type) |
| g22 | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g22(:) (complexgrid_scalar) |
| griduid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g22(:)%griduid (integer) |
| subgrid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g22(:)%subgrid (integer) |
| scalar | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g22(:)%scalar (vecflt_type) |
| vector | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g22(:)%vector (matflt_type) |
| matrix | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g22(:)%matrix (array3dflt_type) |
| g23 | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g23(:) (complexgrid_scalar) |
| griduid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g23(:)%griduid (integer) |
| subgrid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g23(:)%subgrid (integer) |
| scalar | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g23(:)%scalar (vecflt_type) |
| vector | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g23(:)%vector (matflt_type) |
| matrix | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g23(:)%matrix (array3dflt_type) |
| g33 | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g33(:) (complexgrid_scalar) |
| griduid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g33(:)%griduid (integer) |
| subgrid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g33(:)%subgrid (integer) |
| scalar | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g33(:)%scalar (vecflt_type) |
| vector | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g33(:)%vector (matflt_type) |
| matrix | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%g33(:)%matrix (array3dflt_type) |
| jacobian | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%jacobian(:) (complexgrid_scalar) |
| griduid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%jacobian(:)%griduid (integer) |
| subgrid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%jacobian(:)%subgrid (integer) |
| scalar | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%jacobian(:)%scalar (vecflt_type) |
| vector | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%jacobian(:)%vector (matflt_type) |
| matrix | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%metric%jacobian(:)%matrix (array3dflt_type) |
| geo | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%geo(:) (complexgrid_geo_global) |
| geotype | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%geo(:)%geotype (integer) |
| geotypeid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%geo(:)%geotypeid (string) |
| coordtype | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%geo(:)%coordtype (vecint_type) |
| geo_matrix | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%geo(:)%geo_matrix(:) (complexgrid_scalar) |
| griduid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%geo(:)%geo_matrix(:)%griduid (integer) |
| subgrid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%geo(:)%geo_matrix(:)%subgrid (integer) |
| scalar | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%geo(:)%geo_matrix(:)%scalar (vecflt_type) |
| vector | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%geo(:)%geo_matrix(:)%vector (matflt_type) |
| matrix | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%geo(:)%geo_matrix(:)%matrix (array3dflt_type) |
| measure | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%geo(:)%measure(:) (complexgrid_scalar) |
| griduid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%geo(:)%measure(:)%griduid (integer) |
| subgrid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%geo(:)%measure(:)%subgrid (integer) |
| scalar | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%geo(:)%measure(:)%scalar (vecflt_type) |
| vector | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%geo(:)%measure(:)%vector (matflt_type) |
| matrix | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%geo(:)%measure(:)%matrix (array3dflt_type) |
| bases | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%bases(:) (complexgrid_vector) |
| griduid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%bases(:)%griduid (integer) |
| label | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%bases(:)%label (string) |
| comp | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%bases(:)%comp(:) (complexgrid_scalar) |
| griduid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%bases(:)%comp(:)%griduid (integer) |
| subgrid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%bases(:)%comp(:)%subgrid (integer) |
| scalar | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%bases(:)%comp(:)%scalar (vecflt_type) |
| vector | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%bases(:)%comp(:)%vector (matflt_type) |
| matrix | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%bases(:)%comp(:)%matrix (array3dflt_type) |
| align | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%bases(:)%align (vecint_type) |
| alignid | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%bases(:)%alignid (vecstring_type) |
| basis | distribution%distri_vec(:)%dist_func%f_expansion(:)%grid%bases(:)%basis (integer) |
| values | distribution%distri_vec(:)%dist_func%f_expansion(:)%values (complexgrid_scalar) |
| griduid | distribution%distri_vec(:)%dist_func%f_expansion(:)%values%griduid (integer) |
| subgrid | distribution%distri_vec(:)%dist_func%f_expansion(:)%values%subgrid (integer) |
| scalar | distribution%distri_vec(:)%dist_func%f_expansion(:)%values%scalar (vecflt_type) |
| vector | distribution%distri_vec(:)%dist_func%f_expansion(:)%values%vector (matflt_type) |
| matrix | distribution%distri_vec(:)%dist_func%f_expansion(:)%values%matrix (array3dflt_type) |
| parameters | distribution%distri_vec(:)%dist_func%f_expansion(:)%parameters (dist_distrivec_distfunc_fexp_param) |
| equatorial | distribution%distri_vec(:)%dist_func%f_expansion(:)%parameters%equatorial (equatorial_plane) |
| r | distribution%distri_vec(:)%dist_func%f_expansion(:)%parameters%equatorial%r (vecflt_type) |
| z | distribution%distri_vec(:)%dist_func%f_expansion(:)%parameters%equatorial%z (vecflt_type) |
| s | distribution%distri_vec(:)%dist_func%f_expansion(:)%parameters%equatorial%s (vecflt_type) |
| rho_tor | distribution%distri_vec(:)%dist_func%f_expansion(:)%parameters%equatorial%rho_tor (vecflt_type) |
| psi | distribution%distri_vec(:)%dist_func%f_expansion(:)%parameters%equatorial%psi (vecflt_type) |
| b_mod | distribution%distri_vec(:)%dist_func%f_expansion(:)%parameters%equatorial%b_mod (vecflt_type) |
| temperature | distribution%distri_vec(:)%dist_func%f_expansion(:)%parameters%temperature (vecflt_type) |
| codeparam | distribution%distri_vec(:)%codeparam (codeparam) |
| codename | distribution%distri_vec(:)%codeparam%codename (string) |
| codeversion | distribution%distri_vec(:)%codeparam%codeversion (string) |
| parameters | distribution%distri_vec(:)%codeparam%parameters (string) |
| output_diag | distribution%distri_vec(:)%codeparam%output_diag (string) |
| output_flag | distribution%distri_vec(:)%codeparam%output_flag (integer) |
| codeparam | distribution%codeparam (codeparam) |
| codename | distribution%codeparam%codename (string) |
| codeversion | distribution%codeparam%codeversion (string) |
| parameters | distribution%codeparam%parameters (string) |
| output_diag | distribution%codeparam%output_diag (string) |
| output_flag | distribution%codeparam%output_flag (integer) |
| time | distribution%time (float) |
| datainfo | distsource%datainfo (datainfo) |
| dataprovider | distsource%datainfo%dataprovider (string) |
| putdate | distsource%datainfo%putdate (string) |
| source | distsource%datainfo%source (string) |
| comment | distsource%datainfo%comment (string) |
| cocos | distsource%datainfo%cocos (integer) |
| id | distsource%datainfo%id (integer) |
| isref | distsource%datainfo%isref (integer) |
| whatref | distsource%datainfo%whatref (whatref) |
| user | distsource%datainfo%whatref%user (string) |
| machine | distsource%datainfo%whatref%machine (string) |
| shot | distsource%datainfo%whatref%shot (integer) |
| run | distsource%datainfo%whatref%run (integer) |
| occurrence | distsource%datainfo%whatref%occurrence (integer) |
| putinfo | distsource%datainfo%putinfo (putinfo) |
| putmethod | distsource%datainfo%putinfo%putmethod (string) |
| putaccess | distsource%datainfo%putinfo%putaccess (string) |
| putlocation | distsource%datainfo%putinfo%putlocation (string) |
| rights | distsource%datainfo%putinfo%rights (string) |
| composition | distsource%composition (composition) |
| amn | distsource%composition%amn (vecflt_type) |
| zn | distsource%composition%zn (vecflt_type) |
| zion | distsource%composition%zion (vecflt_type) |
| imp_flag | distsource%composition%imp_flag (vecint_type) |
| label | distsource%composition%label (vecstring_type) |
| compositions | distsource%compositions (compositions_type) |
| nuclei | distsource%compositions%nuclei(:) (nuclei) |
| zn | distsource%compositions%nuclei(:)%zn (float) |
| amn | distsource%compositions%nuclei(:)%amn (float) |
| label | distsource%compositions%nuclei(:)%label (string) |
| ions | distsource%compositions%ions(:) (ions) |
| nucindex | distsource%compositions%ions(:)%nucindex (integer) |
| zion | distsource%compositions%ions(:)%zion (float) |
| imp_flag | distsource%compositions%ions(:)%imp_flag (integer) |
| label | distsource%compositions%ions(:)%label (string) |
| impurities | distsource%compositions%impurities(:) (impurities) |
| nucindex | distsource%compositions%impurities(:)%nucindex (integer) |
| i_ion | distsource%compositions%impurities(:)%i_ion (integer) |
| nzimp | distsource%compositions%impurities(:)%nzimp (integer) |
| zmin | distsource%compositions%impurities(:)%zmin (vecflt_type) |
| zmax | distsource%compositions%impurities(:)%zmax (vecflt_type) |
| label | distsource%compositions%impurities(:)%label (vecstring_type) |
| neutralscomp | distsource%compositions%neutralscomp(:) (composition_neutralscomp) |
| neutcomp | distsource%compositions%neutralscomp(:)%neutcomp(:) (composition_neutrals_neutcomp) |
| nucindex | distsource%compositions%neutralscomp(:)%neutcomp(:)%nucindex (integer) |
| multiplicity | distsource%compositions%neutralscomp(:)%neutcomp(:)%multiplicity (integer) |
| type | distsource%compositions%neutralscomp(:)%type(:) (identifier) |
| id | distsource%compositions%neutralscomp(:)%type(:)%id (string) |
| flag | distsource%compositions%neutralscomp(:)%type(:)%flag (integer) |
| description | distsource%compositions%neutralscomp(:)%type(:)%description (string) |
| label | distsource%compositions%neutralscomp(:)%label (string) |
| edgespecies | distsource%compositions%edgespecies(:) (edgespecies) |
| nucindex | distsource%compositions%edgespecies(:)%nucindex (integer) |
| zmin | distsource%compositions%edgespecies(:)%zmin (float) |
| zmax | distsource%compositions%edgespecies(:)%zmax (float) |
| label | distsource%compositions%edgespecies(:)%label (string) |
| signature | distsource%compositions%signature (identifier) |
| id | distsource%compositions%signature%id (string) |
| flag | distsource%compositions%signature%flag (integer) |
| description | distsource%compositions%signature%description (string) |
| source | distsource%source(:) (distsource_source) |
| source_id | distsource%source(:)%source_id(:) (enum_instance) |
| type | distsource%source(:)%source_id(:)%type (identifier) |
| id | distsource%source(:)%source_id(:)%type%id (string) |
| flag | distsource%source(:)%source_id(:)%type%flag (integer) |
| description | distsource%source(:)%source_id(:)%type%description (string) |
| name | distsource%source(:)%source_id(:)%name (string) |
| index | distsource%source(:)%source_id(:)%index (integer) |
| species | distsource%source(:)%species (species_reference) |
| type | distsource%source(:)%species%type (identifier) |
| id | distsource%source(:)%species%type%id (string) |
| flag | distsource%source(:)%species%type%flag (integer) |
| description | distsource%source(:)%species%type%description (string) |
| index | distsource%source(:)%species%index (integer) |
| gyro_type | distsource%source(:)%gyro_type (integer) |
| global_param | distsource%source(:)%global_param (distsource_global_param) |
| src_pow | distsource%source(:)%global_param%src_pow (exp0D) |
| value | distsource%source(:)%global_param%src_pow%value (float) |
| abserror | distsource%source(:)%global_param%src_pow%abserror (float) |
| relerror | distsource%source(:)%global_param%src_pow%relerror (float) |
| src_rate | distsource%source(:)%global_param%src_rate (exp0D) |
| value | distsource%source(:)%global_param%src_rate%value (float) |
| abserror | distsource%source(:)%global_param%src_rate%abserror (float) |
| relerror | distsource%source(:)%global_param%src_rate%relerror (float) |
| mag_axis | distsource%source(:)%global_param%mag_axis (rz0D) |
| r | distsource%source(:)%global_param%mag_axis%r (float) |
| z | distsource%source(:)%global_param%mag_axis%z (float) |
| toroid_field | distsource%source(:)%global_param%toroid_field (b0r0) |
| r0 | distsource%source(:)%global_param%toroid_field%r0 (float) |
| b0 | distsource%source(:)%global_param%toroid_field%b0 (float) |
| profiles_1d | distsource%source(:)%profiles_1d (distsource_profiles_1d) |
| rho_tor | distsource%source(:)%profiles_1d%rho_tor (vecflt_type) |
| rho_tor_norm | distsource%source(:)%profiles_1d%rho_tor_norm (vecflt_type) |
| psi | distsource%source(:)%profiles_1d%psi (vecflt_type) |
| volume | distsource%source(:)%profiles_1d%volume (vecflt_type) |
| area | distsource%source(:)%profiles_1d%area (vecflt_type) |
| pow_den | distsource%source(:)%profiles_1d%pow_den (exp1D) |
| value | distsource%source(:)%profiles_1d%pow_den%value (vecflt_type) |
| abserror | distsource%source(:)%profiles_1d%pow_den%abserror (vecflt_type) |
| relerror | distsource%source(:)%profiles_1d%pow_den%relerror (vecflt_type) |
| trq_den | distsource%source(:)%profiles_1d%trq_den (exp1D) |
| value | distsource%source(:)%profiles_1d%trq_den%value (vecflt_type) |
| abserror | distsource%source(:)%profiles_1d%trq_den%abserror (vecflt_type) |
| relerror | distsource%source(:)%profiles_1d%trq_den%relerror (vecflt_type) |
| src_rate | distsource%source(:)%profiles_1d%src_rate (exp1D) |
| value | distsource%source(:)%profiles_1d%src_rate%value (vecflt_type) |
| abserror | distsource%source(:)%profiles_1d%src_rate%abserror (vecflt_type) |
| relerror | distsource%source(:)%profiles_1d%src_rate%relerror (vecflt_type) |
| profiles_2d | distsource%source(:)%profiles_2d (distsource_profiles_2d) |
| grid_coord | distsource%source(:)%profiles_2d%grid_coord (vecint_type) |
| dim1 | distsource%source(:)%profiles_2d%dim1 (matflt_type) |
| dim2 | distsource%source(:)%profiles_2d%dim2 (matflt_type) |
| g11 | distsource%source(:)%profiles_2d%g11 (matflt_type) |
| g12 | distsource%source(:)%profiles_2d%g12 (matflt_type) |
| g21 | distsource%source(:)%profiles_2d%g21 (matflt_type) |
| g22 | distsource%source(:)%profiles_2d%g22 (matflt_type) |
| pow_den | distsource%source(:)%profiles_2d%pow_den (exp2D) |
| value | distsource%source(:)%profiles_2d%pow_den%value (matflt_type) |
| abserror | distsource%source(:)%profiles_2d%pow_den%abserror (matflt_type) |
| relerror | distsource%source(:)%profiles_2d%pow_den%relerror (matflt_type) |
| src_rate | distsource%source(:)%profiles_2d%src_rate (exp2D) |
| value | distsource%source(:)%profiles_2d%src_rate%value (matflt_type) |
| abserror | distsource%source(:)%profiles_2d%src_rate%abserror (matflt_type) |
| relerror | distsource%source(:)%profiles_2d%src_rate%relerror (matflt_type) |
| line_srcprof | distsource%source(:)%line_srcprof(:) (distsource_line_src_prof) |
| rho_tor | distsource%source(:)%line_srcprof(:)%rho_tor (vecflt_type) |
| rho_tor_norm | distsource%source(:)%line_srcprof(:)%rho_tor_norm (vecflt_type) |
| psi | distsource%source(:)%line_srcprof(:)%psi (vecflt_type) |
| R | distsource%source(:)%line_srcprof(:)%R (vecflt_type) |
| Z | distsource%source(:)%line_srcprof(:)%Z (vecflt_type) |
| theta | distsource%source(:)%line_srcprof(:)%theta (vecflt_type) |
| theta_id | distsource%source(:)%line_srcprof(:)%theta_id (vecflt_type) |
| th2th_pol | distsource%source(:)%line_srcprof(:)%th2th_pol (matflt_type) |
| pitch | distsource%source(:)%line_srcprof(:)%pitch (vecflt_type) |
| energy | distsource%source(:)%line_srcprof(:)%energy (vecflt_type) |
| ang_momentum | distsource%source(:)%line_srcprof(:)%ang_momentum (vecflt_type) |
| src_rate | distsource%source(:)%line_srcprof(:)%src_rate (vecflt_type) |
| source_rate | distsource%source(:)%source_rate (source_rate) |
| grid | distsource%source(:)%source_rate%grid (complexgrid) |
| uid | distsource%source(:)%source_rate%grid%uid (integer) |
| id | distsource%source(:)%source_rate%grid%id (string) |
| spaces | distsource%source(:)%source_rate%grid%spaces(:) (complexgrid_space) |
| geotype | distsource%source(:)%source_rate%grid%spaces(:)%geotype (vecint_type) |
| geotypeid | distsource%source(:)%source_rate%grid%spaces(:)%geotypeid (vecstring_type) |
| coordtype | distsource%source(:)%source_rate%grid%spaces(:)%coordtype (matint_type) |
| objects | distsource%source(:)%source_rate%grid%spaces(:)%objects(:) (objects) |
| boundary | distsource%source(:)%source_rate%grid%spaces(:)%objects(:)%boundary (matint_type) |
| neighbour | distsource%source(:)%source_rate%grid%spaces(:)%objects(:)%neighbour (array3dint_type) |
| geo | distsource%source(:)%source_rate%grid%spaces(:)%objects(:)%geo (array4dflt_type) |
| measure | distsource%source(:)%source_rate%grid%spaces(:)%objects(:)%measure (matflt_type) |
| xpoints | distsource%source(:)%source_rate%grid%spaces(:)%xpoints (vecint_type) |
| subgrids | distsource%source(:)%source_rate%grid%subgrids(:) (complexgrid_subgrid) |
| id | distsource%source(:)%source_rate%grid%subgrids(:)%id (string) |
| list | distsource%source(:)%source_rate%grid%subgrids(:)%list(:) (complexgrid_objectlist) |
| cls | distsource%source(:)%source_rate%grid%subgrids(:)%list(:)%cls (vecint_type) |
| indset | distsource%source(:)%source_rate%grid%subgrids(:)%list(:)%indset(:) (complexgrid_indexlist) |
| range | distsource%source(:)%source_rate%grid%subgrids(:)%list(:)%indset(:)%range (vecint_type) |
| ind | distsource%source(:)%source_rate%grid%subgrids(:)%list(:)%indset(:)%ind (vecint_type) |
| ind | distsource%source(:)%source_rate%grid%subgrids(:)%list(:)%ind (matint_type) |
| metric | distsource%source(:)%source_rate%grid%metric (complexgrid_metric) |
| measure | distsource%source(:)%source_rate%grid%metric%measure(:) (complexgrid_scalar) |
| griduid | distsource%source(:)%source_rate%grid%metric%measure(:)%griduid (integer) |
| subgrid | distsource%source(:)%source_rate%grid%metric%measure(:)%subgrid (integer) |
| scalar | distsource%source(:)%source_rate%grid%metric%measure(:)%scalar (vecflt_type) |
| vector | distsource%source(:)%source_rate%grid%metric%measure(:)%vector (matflt_type) |
| matrix | distsource%source(:)%source_rate%grid%metric%measure(:)%matrix (array3dflt_type) |
| g11 | distsource%source(:)%source_rate%grid%metric%g11(:) (complexgrid_scalar) |
| griduid | distsource%source(:)%source_rate%grid%metric%g11(:)%griduid (integer) |
| subgrid | distsource%source(:)%source_rate%grid%metric%g11(:)%subgrid (integer) |
| scalar | distsource%source(:)%source_rate%grid%metric%g11(:)%scalar (vecflt_type) |
| vector | distsource%source(:)%source_rate%grid%metric%g11(:)%vector (matflt_type) |
| matrix | distsource%source(:)%source_rate%grid%metric%g11(:)%matrix (array3dflt_type) |
| g12 | distsource%source(:)%source_rate%grid%metric%g12(:) (complexgrid_scalar) |
| griduid | distsource%source(:)%source_rate%grid%metric%g12(:)%griduid (integer) |
| subgrid | distsource%source(:)%source_rate%grid%metric%g12(:)%subgrid (integer) |
| scalar | distsource%source(:)%source_rate%grid%metric%g12(:)%scalar (vecflt_type) |
| vector | distsource%source(:)%source_rate%grid%metric%g12(:)%vector (matflt_type) |
| matrix | distsource%source(:)%source_rate%grid%metric%g12(:)%matrix (array3dflt_type) |
| g13 | distsource%source(:)%source_rate%grid%metric%g13(:) (complexgrid_scalar) |
| griduid | distsource%source(:)%source_rate%grid%metric%g13(:)%griduid (integer) |
| subgrid | distsource%source(:)%source_rate%grid%metric%g13(:)%subgrid (integer) |
| scalar | distsource%source(:)%source_rate%grid%metric%g13(:)%scalar (vecflt_type) |
| vector | distsource%source(:)%source_rate%grid%metric%g13(:)%vector (matflt_type) |
| matrix | distsource%source(:)%source_rate%grid%metric%g13(:)%matrix (array3dflt_type) |
| g22 | distsource%source(:)%source_rate%grid%metric%g22(:) (complexgrid_scalar) |
| griduid | distsource%source(:)%source_rate%grid%metric%g22(:)%griduid (integer) |
| subgrid | distsource%source(:)%source_rate%grid%metric%g22(:)%subgrid (integer) |
| scalar | distsource%source(:)%source_rate%grid%metric%g22(:)%scalar (vecflt_type) |
| vector | distsource%source(:)%source_rate%grid%metric%g22(:)%vector (matflt_type) |
| matrix | distsource%source(:)%source_rate%grid%metric%g22(:)%matrix (array3dflt_type) |
| g23 | distsource%source(:)%source_rate%grid%metric%g23(:) (complexgrid_scalar) |
| griduid | distsource%source(:)%source_rate%grid%metric%g23(:)%griduid (integer) |
| subgrid | distsource%source(:)%source_rate%grid%metric%g23(:)%subgrid (integer) |
| scalar | distsource%source(:)%source_rate%grid%metric%g23(:)%scalar (vecflt_type) |
| vector | distsource%source(:)%source_rate%grid%metric%g23(:)%vector (matflt_type) |
| matrix | distsource%source(:)%source_rate%grid%metric%g23(:)%matrix (array3dflt_type) |
| g33 | distsource%source(:)%source_rate%grid%metric%g33(:) (complexgrid_scalar) |
| griduid | distsource%source(:)%source_rate%grid%metric%g33(:)%griduid (integer) |
| subgrid | distsource%source(:)%source_rate%grid%metric%g33(:)%subgrid (integer) |
| scalar | distsource%source(:)%source_rate%grid%metric%g33(:)%scalar (vecflt_type) |
| vector | distsource%source(:)%source_rate%grid%metric%g33(:)%vector (matflt_type) |
| matrix | distsource%source(:)%source_rate%grid%metric%g33(:)%matrix (array3dflt_type) |
| jacobian | distsource%source(:)%source_rate%grid%metric%jacobian(:) (complexgrid_scalar) |
| griduid | distsource%source(:)%source_rate%grid%metric%jacobian(:)%griduid (integer) |
| subgrid | distsource%source(:)%source_rate%grid%metric%jacobian(:)%subgrid (integer) |
| scalar | distsource%source(:)%source_rate%grid%metric%jacobian(:)%scalar (vecflt_type) |
| vector | distsource%source(:)%source_rate%grid%metric%jacobian(:)%vector (matflt_type) |
| matrix | distsource%source(:)%source_rate%grid%metric%jacobian(:)%matrix (array3dflt_type) |
| geo | distsource%source(:)%source_rate%grid%geo(:) (complexgrid_geo_global) |
| geotype | distsource%source(:)%source_rate%grid%geo(:)%geotype (integer) |
| geotypeid | distsource%source(:)%source_rate%grid%geo(:)%geotypeid (string) |
| coordtype | distsource%source(:)%source_rate%grid%geo(:)%coordtype (vecint_type) |
| geo_matrix | distsource%source(:)%source_rate%grid%geo(:)%geo_matrix(:) (complexgrid_scalar) |
| griduid | distsource%source(:)%source_rate%grid%geo(:)%geo_matrix(:)%griduid (integer) |
| subgrid | distsource%source(:)%source_rate%grid%geo(:)%geo_matrix(:)%subgrid (integer) |
| scalar | distsource%source(:)%source_rate%grid%geo(:)%geo_matrix(:)%scalar (vecflt_type) |
| vector | distsource%source(:)%source_rate%grid%geo(:)%geo_matrix(:)%vector (matflt_type) |
| matrix | distsource%source(:)%source_rate%grid%geo(:)%geo_matrix(:)%matrix (array3dflt_type) |
| measure | distsource%source(:)%source_rate%grid%geo(:)%measure(:) (complexgrid_scalar) |
| griduid | distsource%source(:)%source_rate%grid%geo(:)%measure(:)%griduid (integer) |
| subgrid | distsource%source(:)%source_rate%grid%geo(:)%measure(:)%subgrid (integer) |
| scalar | distsource%source(:)%source_rate%grid%geo(:)%measure(:)%scalar (vecflt_type) |
| vector | distsource%source(:)%source_rate%grid%geo(:)%measure(:)%vector (matflt_type) |
| matrix | distsource%source(:)%source_rate%grid%geo(:)%measure(:)%matrix (array3dflt_type) |
| bases | distsource%source(:)%source_rate%grid%bases(:) (complexgrid_vector) |
| griduid | distsource%source(:)%source_rate%grid%bases(:)%griduid (integer) |
| label | distsource%source(:)%source_rate%grid%bases(:)%label (string) |
| comp | distsource%source(:)%source_rate%grid%bases(:)%comp(:) (complexgrid_scalar) |
| griduid | distsource%source(:)%source_rate%grid%bases(:)%comp(:)%griduid (integer) |
| subgrid | distsource%source(:)%source_rate%grid%bases(:)%comp(:)%subgrid (integer) |
| scalar | distsource%source(:)%source_rate%grid%bases(:)%comp(:)%scalar (vecflt_type) |
| vector | distsource%source(:)%source_rate%grid%bases(:)%comp(:)%vector (matflt_type) |
| matrix | distsource%source(:)%source_rate%grid%bases(:)%comp(:)%matrix (array3dflt_type) |
| align | distsource%source(:)%source_rate%grid%bases(:)%align (vecint_type) |
| alignid | distsource%source(:)%source_rate%grid%bases(:)%alignid (vecstring_type) |
| basis | distsource%source(:)%source_rate%grid%bases(:)%basis (integer) |
| value | distsource%source(:)%source_rate%value (complexgrid_scalar) |
| griduid | distsource%source(:)%source_rate%value%griduid (integer) |
| subgrid | distsource%source(:)%source_rate%value%subgrid (integer) |
| scalar | distsource%source(:)%source_rate%value%scalar (vecflt_type) |
| vector | distsource%source(:)%source_rate%value%vector (matflt_type) |
| matrix | distsource%source(:)%source_rate%value%matrix (array3dflt_type) |
| discrete | distsource%source(:)%source_rate%discrete (vecint_type) |
| parameters | distsource%source(:)%source_rate%parameters (parameters) |
| equatorial | distsource%source(:)%source_rate%parameters%equatorial (equatorial_plane) |
| r | distsource%source(:)%source_rate%parameters%equatorial%r (vecflt_type) |
| z | distsource%source(:)%source_rate%parameters%equatorial%z (vecflt_type) |
| s | distsource%source(:)%source_rate%parameters%equatorial%s (vecflt_type) |
| rho_tor | distsource%source(:)%source_rate%parameters%equatorial%rho_tor (vecflt_type) |
| psi | distsource%source(:)%source_rate%parameters%equatorial%psi (vecflt_type) |
| b_mod | distsource%source(:)%source_rate%parameters%equatorial%b_mod (vecflt_type) |
| markers | distsource%source(:)%markers (weighted_markers) |
| variable_ids | distsource%source(:)%markers%variable_ids(:) (identifier) |
| id | distsource%source(:)%markers%variable_ids(:)%id (string) |
| flag | distsource%source(:)%markers%variable_ids(:)%flag (integer) |
| description | distsource%source(:)%markers%variable_ids(:)%description (string) |
| coord | distsource%source(:)%markers%coord (matflt_type) |
| weight | distsource%source(:)%markers%weight (vecflt_type) |
| codeparam | distsource%source(:)%codeparam (codeparam) |
| codename | distsource%source(:)%codeparam%codename (string) |
| codeversion | distsource%source(:)%codeparam%codeversion (string) |
| parameters | distsource%source(:)%codeparam%parameters (string) |
| output_diag | distsource%source(:)%codeparam%output_diag (string) |
| output_flag | distsource%source(:)%codeparam%output_flag (integer) |
| codeparam | distsource%codeparam (codeparam) |
| codename | distsource%codeparam%codename (string) |
| codeversion | distsource%codeparam%codeversion (string) |
| parameters | distsource%codeparam%parameters (string) |
| output_diag | distsource%codeparam%output_diag (string) |
| output_flag | distsource%codeparam%output_flag (integer) |
| time | distsource%time (float) |
| datainfo | ecediag%datainfo (datainfo) |
| dataprovider | ecediag%datainfo%dataprovider (string) |
| putdate | ecediag%datainfo%putdate (string) |
| source | ecediag%datainfo%source (string) |
| comment | ecediag%datainfo%comment (string) |
| cocos | ecediag%datainfo%cocos (integer) |
| id | ecediag%datainfo%id (integer) |
| isref | ecediag%datainfo%isref (integer) |
| whatref | ecediag%datainfo%whatref (whatref) |
| user | ecediag%datainfo%whatref%user (string) |
| machine | ecediag%datainfo%whatref%machine (string) |
| shot | ecediag%datainfo%whatref%shot (integer) |
| run | ecediag%datainfo%whatref%run (integer) |
| occurrence | ecediag%datainfo%whatref%occurrence (integer) |
| putinfo | ecediag%datainfo%putinfo (putinfo) |
| putmethod | ecediag%datainfo%putinfo%putmethod (string) |
| putaccess | ecediag%datainfo%putinfo%putaccess (string) |
| putlocation | ecediag%datainfo%putinfo%putlocation (string) |
| rights | ecediag%datainfo%putinfo%rights (string) |
| setup | ecediag%setup (ecesetup) |
| frequency | ecediag%setup%frequency (vecflt_type) |
| los | ecediag%setup%los (setup_line_exp) |
| pivot_point | ecediag%setup%los%pivot_point (rzphi1Dexperimental) |
| r | ecediag%setup%los%pivot_point%r (vecflt_type) |
| z | ecediag%setup%los%pivot_point%z (vecflt_type) |
| phi | ecediag%setup%los%pivot_point%phi (vecflt_type) |
| horchordang1 | ecediag%setup%los%horchordang1 (vecflt_type) |
| verchordang1 | ecediag%setup%los%verchordang1 (vecflt_type) |
| width | ecediag%setup%los%width (vecflt_type) |
| second_point | ecediag%setup%los%second_point (rzphi1Dexperimental) |
| r | ecediag%setup%los%second_point%r (vecflt_type) |
| z | ecediag%setup%los%second_point%z (vecflt_type) |
| phi | ecediag%setup%los%second_point%phi (vecflt_type) |
| horchordang2 | ecediag%setup%los%horchordang2 (vecflt_type) |
| verchordang2 | ecediag%setup%los%verchordang2 (vecflt_type) |
| third_point | ecediag%setup%los%third_point (rzphi1Dexperimental) |
| r | ecediag%setup%los%third_point%r (vecflt_type) |
| z | ecediag%setup%los%third_point%z (vecflt_type) |
| phi | ecediag%setup%los%third_point%phi (vecflt_type) |
| nchordpoints | ecediag%setup%los%nchordpoints (integer) |
| measure | ecediag%measure (ecemeasure) |
| harmonic | ecediag%measure%harmonic (integer) |
| position | ecediag%measure%position (rzphi1Dexp) |
| r | ecediag%measure%position%r (exp1D) |
| value | ecediag%measure%position%r%value (vecflt_type) |
| abserror | ecediag%measure%position%r%abserror (vecflt_type) |
| relerror | ecediag%measure%position%r%relerror (vecflt_type) |
| z | ecediag%measure%position%z (exp1D) |
| value | ecediag%measure%position%z%value (vecflt_type) |
| abserror | ecediag%measure%position%z%abserror (vecflt_type) |
| relerror | ecediag%measure%position%z%relerror (vecflt_type) |
| phi | ecediag%measure%position%phi (exp1D) |
| value | ecediag%measure%position%phi%value (vecflt_type) |
| abserror | ecediag%measure%position%phi%abserror (vecflt_type) |
| relerror | ecediag%measure%position%phi%relerror (vecflt_type) |
| te | ecediag%measure%te (exp1D) |
| value | ecediag%measure%te%value (vecflt_type) |
| abserror | ecediag%measure%te%abserror (vecflt_type) |
| relerror | ecediag%measure%te%relerror (vecflt_type) |
| codeparam | ecediag%codeparam (codeparam) |
| codename | ecediag%codeparam%codename (string) |
| codeversion | ecediag%codeparam%codeversion (string) |
| parameters | ecediag%codeparam%parameters (string) |
| output_diag | ecediag%codeparam%output_diag (string) |
| output_flag | ecediag%codeparam%output_flag (integer) |
| time | ecediag%time (float) |
| datainfo | edge%datainfo (datainfo) |
| dataprovider | edge%datainfo%dataprovider (string) |
| putdate | edge%datainfo%putdate (string) |
| source | edge%datainfo%source (string) |
| comment | edge%datainfo%comment (string) |
| cocos | edge%datainfo%cocos (integer) |
| id | edge%datainfo%id (integer) |
| isref | edge%datainfo%isref (integer) |
| whatref | edge%datainfo%whatref (whatref) |
| user | edge%datainfo%whatref%user (string) |
| machine | edge%datainfo%whatref%machine (string) |
| shot | edge%datainfo%whatref%shot (integer) |
| run | edge%datainfo%whatref%run (integer) |
| occurrence | edge%datainfo%whatref%occurrence (integer) |
| putinfo | edge%datainfo%putinfo (putinfo) |
| putmethod | edge%datainfo%putinfo%putmethod (string) |
| putaccess | edge%datainfo%putinfo%putaccess (string) |
| putlocation | edge%datainfo%putinfo%putlocation (string) |
| rights | edge%datainfo%putinfo%rights (string) |
| grid | edge%grid (complexgrid) |
| uid | edge%grid%uid (integer) |
| id | edge%grid%id (string) |
| spaces | edge%grid%spaces(:) (complexgrid_space) |
| geotype | edge%grid%spaces(:)%geotype (vecint_type) |
| geotypeid | edge%grid%spaces(:)%geotypeid (vecstring_type) |
| coordtype | edge%grid%spaces(:)%coordtype (matint_type) |
| objects | edge%grid%spaces(:)%objects(:) (objects) |
| boundary | edge%grid%spaces(:)%objects(:)%boundary (matint_type) |
| neighbour | edge%grid%spaces(:)%objects(:)%neighbour (array3dint_type) |
| geo | edge%grid%spaces(:)%objects(:)%geo (array4dflt_type) |
| measure | edge%grid%spaces(:)%objects(:)%measure (matflt_type) |
| xpoints | edge%grid%spaces(:)%xpoints (vecint_type) |
| subgrids | edge%grid%subgrids(:) (complexgrid_subgrid) |
| id | edge%grid%subgrids(:)%id (string) |
| list | edge%grid%subgrids(:)%list(:) (complexgrid_objectlist) |
| cls | edge%grid%subgrids(:)%list(:)%cls (vecint_type) |
| indset | edge%grid%subgrids(:)%list(:)%indset(:) (complexgrid_indexlist) |
| range | edge%grid%subgrids(:)%list(:)%indset(:)%range (vecint_type) |
| ind | edge%grid%subgrids(:)%list(:)%indset(:)%ind (vecint_type) |
| ind | edge%grid%subgrids(:)%list(:)%ind (matint_type) |
| metric | edge%grid%metric (complexgrid_metric) |
| measure | edge%grid%metric%measure(:) (complexgrid_scalar) |
| griduid | edge%grid%metric%measure(:)%griduid (integer) |
| subgrid | edge%grid%metric%measure(:)%subgrid (integer) |
| scalar | edge%grid%metric%measure(:)%scalar (vecflt_type) |
| vector | edge%grid%metric%measure(:)%vector (matflt_type) |
| matrix | edge%grid%metric%measure(:)%matrix (array3dflt_type) |
| g11 | edge%grid%metric%g11(:) (complexgrid_scalar) |
| griduid | edge%grid%metric%g11(:)%griduid (integer) |
| subgrid | edge%grid%metric%g11(:)%subgrid (integer) |
| scalar | edge%grid%metric%g11(:)%scalar (vecflt_type) |
| vector | edge%grid%metric%g11(:)%vector (matflt_type) |
| matrix | edge%grid%metric%g11(:)%matrix (array3dflt_type) |
| g12 | edge%grid%metric%g12(:) (complexgrid_scalar) |
| griduid | edge%grid%metric%g12(:)%griduid (integer) |
| subgrid | edge%grid%metric%g12(:)%subgrid (integer) |
| scalar | edge%grid%metric%g12(:)%scalar (vecflt_type) |
| vector | edge%grid%metric%g12(:)%vector (matflt_type) |
| matrix | edge%grid%metric%g12(:)%matrix (array3dflt_type) |
| g13 | edge%grid%metric%g13(:) (complexgrid_scalar) |
| griduid | edge%grid%metric%g13(:)%griduid (integer) |
| subgrid | edge%grid%metric%g13(:)%subgrid (integer) |
| scalar | edge%grid%metric%g13(:)%scalar (vecflt_type) |
| vector | edge%grid%metric%g13(:)%vector (matflt_type) |
| matrix | edge%grid%metric%g13(:)%matrix (array3dflt_type) |
| g22 | edge%grid%metric%g22(:) (complexgrid_scalar) |
| griduid | edge%grid%metric%g22(:)%griduid (integer) |
| subgrid | edge%grid%metric%g22(:)%subgrid (integer) |
| scalar | edge%grid%metric%g22(:)%scalar (vecflt_type) |
| vector | edge%grid%metric%g22(:)%vector (matflt_type) |
| matrix | edge%grid%metric%g22(:)%matrix (array3dflt_type) |
| g23 | edge%grid%metric%g23(:) (complexgrid_scalar) |
| griduid | edge%grid%metric%g23(:)%griduid (integer) |
| subgrid | edge%grid%metric%g23(:)%subgrid (integer) |
| scalar | edge%grid%metric%g23(:)%scalar (vecflt_type) |
| vector | edge%grid%metric%g23(:)%vector (matflt_type) |
| matrix | edge%grid%metric%g23(:)%matrix (array3dflt_type) |
| g33 | edge%grid%metric%g33(:) (complexgrid_scalar) |
| griduid | edge%grid%metric%g33(:)%griduid (integer) |
| subgrid | edge%grid%metric%g33(:)%subgrid (integer) |
| scalar | edge%grid%metric%g33(:)%scalar (vecflt_type) |
| vector | edge%grid%metric%g33(:)%vector (matflt_type) |
| matrix | edge%grid%metric%g33(:)%matrix (array3dflt_type) |
| jacobian | edge%grid%metric%jacobian(:) (complexgrid_scalar) |
| griduid | edge%grid%metric%jacobian(:)%griduid (integer) |
| subgrid | edge%grid%metric%jacobian(:)%subgrid (integer) |
| scalar | edge%grid%metric%jacobian(:)%scalar (vecflt_type) |
| vector | edge%grid%metric%jacobian(:)%vector (matflt_type) |
| matrix | edge%grid%metric%jacobian(:)%matrix (array3dflt_type) |
| geo | edge%grid%geo(:) (complexgrid_geo_global) |
| geotype | edge%grid%geo(:)%geotype (integer) |
| geotypeid | edge%grid%geo(:)%geotypeid (string) |
| coordtype | edge%grid%geo(:)%coordtype (vecint_type) |
| geo_matrix | edge%grid%geo(:)%geo_matrix(:) (complexgrid_scalar) |
| griduid | edge%grid%geo(:)%geo_matrix(:)%griduid (integer) |
| subgrid | edge%grid%geo(:)%geo_matrix(:)%subgrid (integer) |
| scalar | edge%grid%geo(:)%geo_matrix(:)%scalar (vecflt_type) |
| vector | edge%grid%geo(:)%geo_matrix(:)%vector (matflt_type) |
| matrix | edge%grid%geo(:)%geo_matrix(:)%matrix (array3dflt_type) |
| measure | edge%grid%geo(:)%measure(:) (complexgrid_scalar) |
| griduid | edge%grid%geo(:)%measure(:)%griduid (integer) |
| subgrid | edge%grid%geo(:)%measure(:)%subgrid (integer) |
| scalar | edge%grid%geo(:)%measure(:)%scalar (vecflt_type) |
| vector | edge%grid%geo(:)%measure(:)%vector (matflt_type) |
| matrix | edge%grid%geo(:)%measure(:)%matrix (array3dflt_type) |
| bases | edge%grid%bases(:) (complexgrid_vector) |
| griduid | edge%grid%bases(:)%griduid (integer) |
| label | edge%grid%bases(:)%label (string) |
| comp | edge%grid%bases(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%grid%bases(:)%comp(:)%griduid (integer) |
| subgrid | edge%grid%bases(:)%comp(:)%subgrid (integer) |
| scalar | edge%grid%bases(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%grid%bases(:)%comp(:)%vector (matflt_type) |
| matrix | edge%grid%bases(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%grid%bases(:)%align (vecint_type) |
| alignid | edge%grid%bases(:)%alignid (vecstring_type) |
| basis | edge%grid%bases(:)%basis (integer) |
| species | edge%species(:) (species_desc) |
| label | edge%species(:)%label (string) |
| amn | edge%species(:)%amn (float) |
| zn | edge%species(:)%zn (float) |
| zmin | edge%species(:)%zmin (float) |
| zmax | edge%species(:)%zmax (float) |
| compositions | edge%compositions (compositions_type) |
| nuclei | edge%compositions%nuclei(:) (nuclei) |
| zn | edge%compositions%nuclei(:)%zn (float) |
| amn | edge%compositions%nuclei(:)%amn (float) |
| label | edge%compositions%nuclei(:)%label (string) |
| ions | edge%compositions%ions(:) (ions) |
| nucindex | edge%compositions%ions(:)%nucindex (integer) |
| zion | edge%compositions%ions(:)%zion (float) |
| imp_flag | edge%compositions%ions(:)%imp_flag (integer) |
| label | edge%compositions%ions(:)%label (string) |
| impurities | edge%compositions%impurities(:) (impurities) |
| nucindex | edge%compositions%impurities(:)%nucindex (integer) |
| i_ion | edge%compositions%impurities(:)%i_ion (integer) |
| nzimp | edge%compositions%impurities(:)%nzimp (integer) |
| zmin | edge%compositions%impurities(:)%zmin (vecflt_type) |
| zmax | edge%compositions%impurities(:)%zmax (vecflt_type) |
| label | edge%compositions%impurities(:)%label (vecstring_type) |
| neutralscomp | edge%compositions%neutralscomp(:) (composition_neutralscomp) |
| neutcomp | edge%compositions%neutralscomp(:)%neutcomp(:) (composition_neutrals_neutcomp) |
| nucindex | edge%compositions%neutralscomp(:)%neutcomp(:)%nucindex (integer) |
| multiplicity | edge%compositions%neutralscomp(:)%neutcomp(:)%multiplicity (integer) |
| type | edge%compositions%neutralscomp(:)%type(:) (identifier) |
| id | edge%compositions%neutralscomp(:)%type(:)%id (string) |
| flag | edge%compositions%neutralscomp(:)%type(:)%flag (integer) |
| description | edge%compositions%neutralscomp(:)%type(:)%description (string) |
| label | edge%compositions%neutralscomp(:)%label (string) |
| edgespecies | edge%compositions%edgespecies(:) (edgespecies) |
| nucindex | edge%compositions%edgespecies(:)%nucindex (integer) |
| zmin | edge%compositions%edgespecies(:)%zmin (float) |
| zmax | edge%compositions%edgespecies(:)%zmax (float) |
| label | edge%compositions%edgespecies(:)%label (string) |
| signature | edge%compositions%signature (identifier) |
| id | edge%compositions%signature%id (string) |
| flag | edge%compositions%signature%flag (integer) |
| description | edge%compositions%signature%description (string) |
| fluid | edge%fluid (edge_fluid) |
| ne | edge%fluid%ne (edge_fluid_scalar_simplestruct) |
| value | edge%fluid%ne%value(:) (complexgrid_scalar) |
| griduid | edge%fluid%ne%value(:)%griduid (integer) |
| subgrid | edge%fluid%ne%value(:)%subgrid (integer) |
| scalar | edge%fluid%ne%value(:)%scalar (vecflt_type) |
| vector | edge%fluid%ne%value(:)%vector (matflt_type) |
| matrix | edge%fluid%ne%value(:)%matrix (array3dflt_type) |
| bndvalue | edge%fluid%ne%bndvalue(:) (complexgrid_scalar) |
| griduid | edge%fluid%ne%bndvalue(:)%griduid (integer) |
| subgrid | edge%fluid%ne%bndvalue(:)%subgrid (integer) |
| scalar | edge%fluid%ne%bndvalue(:)%scalar (vecflt_type) |
| vector | edge%fluid%ne%bndvalue(:)%vector (matflt_type) |
| matrix | edge%fluid%ne%bndvalue(:)%matrix (array3dflt_type) |
| flux | edge%fluid%ne%flux(:) (complexgrid_vector) |
| griduid | edge%fluid%ne%flux(:)%griduid (integer) |
| label | edge%fluid%ne%flux(:)%label (string) |
| comp | edge%fluid%ne%flux(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%ne%flux(:)%comp(:)%griduid (integer) |
| subgrid | edge%fluid%ne%flux(:)%comp(:)%subgrid (integer) |
| scalar | edge%fluid%ne%flux(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%ne%flux(:)%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%ne%flux(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%ne%flux(:)%align (vecint_type) |
| alignid | edge%fluid%ne%flux(:)%alignid (vecstring_type) |
| basis | edge%fluid%ne%flux(:)%basis (integer) |
| bndflux | edge%fluid%ne%bndflux(:) (complexgrid_vector) |
| griduid | edge%fluid%ne%bndflux(:)%griduid (integer) |
| label | edge%fluid%ne%bndflux(:)%label (string) |
| comp | edge%fluid%ne%bndflux(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%ne%bndflux(:)%comp(:)%griduid (integer) |
| subgrid | edge%fluid%ne%bndflux(:)%comp(:)%subgrid (integer) |
| scalar | edge%fluid%ne%bndflux(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%ne%bndflux(:)%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%ne%bndflux(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%ne%bndflux(:)%align (vecint_type) |
| alignid | edge%fluid%ne%bndflux(:)%alignid (vecstring_type) |
| basis | edge%fluid%ne%bndflux(:)%basis (integer) |
| transpcoeff | edge%fluid%ne%transpcoeff(:) (edge_fluid_scalar_transpcoeff) |
| d | edge%fluid%ne%transpcoeff(:)%d (complexgrid_vector_simplestruct) |
| label | edge%fluid%ne%transpcoeff(:)%d%label (string) |
| comp | edge%fluid%ne%transpcoeff(:)%d%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%ne%transpcoeff(:)%d%comp(:)%griduid (integer) |
| subgrid | edge%fluid%ne%transpcoeff(:)%d%comp(:)%subgrid (integer) |
| scalar | edge%fluid%ne%transpcoeff(:)%d%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%ne%transpcoeff(:)%d%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%ne%transpcoeff(:)%d%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%ne%transpcoeff(:)%d%align (vecint_type) |
| alignid | edge%fluid%ne%transpcoeff(:)%d%alignid (vecstring_type) |
| v | edge%fluid%ne%transpcoeff(:)%v (complexgrid_vector_simplestruct) |
| label | edge%fluid%ne%transpcoeff(:)%v%label (string) |
| comp | edge%fluid%ne%transpcoeff(:)%v%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%ne%transpcoeff(:)%v%comp(:)%griduid (integer) |
| subgrid | edge%fluid%ne%transpcoeff(:)%v%comp(:)%subgrid (integer) |
| scalar | edge%fluid%ne%transpcoeff(:)%v%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%ne%transpcoeff(:)%v%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%ne%transpcoeff(:)%v%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%ne%transpcoeff(:)%v%align (vecint_type) |
| alignid | edge%fluid%ne%transpcoeff(:)%v%alignid (vecstring_type) |
| source | edge%fluid%ne%source(:) (complexgrid_scalar) |
| griduid | edge%fluid%ne%source(:)%griduid (integer) |
| subgrid | edge%fluid%ne%source(:)%subgrid (integer) |
| scalar | edge%fluid%ne%source(:)%scalar (vecflt_type) |
| vector | edge%fluid%ne%source(:)%vector (matflt_type) |
| matrix | edge%fluid%ne%source(:)%matrix (array3dflt_type) |
| ni | edge%fluid%ni(:) (edge_fluid_scalar) |
| value | edge%fluid%ni(:)%value(:) (complexgrid_scalar) |
| griduid | edge%fluid%ni(:)%value(:)%griduid (integer) |
| subgrid | edge%fluid%ni(:)%value(:)%subgrid (integer) |
| scalar | edge%fluid%ni(:)%value(:)%scalar (vecflt_type) |
| vector | edge%fluid%ni(:)%value(:)%vector (matflt_type) |
| matrix | edge%fluid%ni(:)%value(:)%matrix (array3dflt_type) |
| bndvalue | edge%fluid%ni(:)%bndvalue(:) (complexgrid_scalar) |
| griduid | edge%fluid%ni(:)%bndvalue(:)%griduid (integer) |
| subgrid | edge%fluid%ni(:)%bndvalue(:)%subgrid (integer) |
| scalar | edge%fluid%ni(:)%bndvalue(:)%scalar (vecflt_type) |
| vector | edge%fluid%ni(:)%bndvalue(:)%vector (matflt_type) |
| matrix | edge%fluid%ni(:)%bndvalue(:)%matrix (array3dflt_type) |
| flux | edge%fluid%ni(:)%flux(:) (complexgrid_vector) |
| griduid | edge%fluid%ni(:)%flux(:)%griduid (integer) |
| label | edge%fluid%ni(:)%flux(:)%label (string) |
| comp | edge%fluid%ni(:)%flux(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%ni(:)%flux(:)%comp(:)%griduid (integer) |
| subgrid | edge%fluid%ni(:)%flux(:)%comp(:)%subgrid (integer) |
| scalar | edge%fluid%ni(:)%flux(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%ni(:)%flux(:)%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%ni(:)%flux(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%ni(:)%flux(:)%align (vecint_type) |
| alignid | edge%fluid%ni(:)%flux(:)%alignid (vecstring_type) |
| basis | edge%fluid%ni(:)%flux(:)%basis (integer) |
| bndflux | edge%fluid%ni(:)%bndflux(:) (complexgrid_vector) |
| griduid | edge%fluid%ni(:)%bndflux(:)%griduid (integer) |
| label | edge%fluid%ni(:)%bndflux(:)%label (string) |
| comp | edge%fluid%ni(:)%bndflux(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%ni(:)%bndflux(:)%comp(:)%griduid (integer) |
| subgrid | edge%fluid%ni(:)%bndflux(:)%comp(:)%subgrid (integer) |
| scalar | edge%fluid%ni(:)%bndflux(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%ni(:)%bndflux(:)%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%ni(:)%bndflux(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%ni(:)%bndflux(:)%align (vecint_type) |
| alignid | edge%fluid%ni(:)%bndflux(:)%alignid (vecstring_type) |
| basis | edge%fluid%ni(:)%bndflux(:)%basis (integer) |
| transpcoeff | edge%fluid%ni(:)%transpcoeff(:) (edge_fluid_scalar_transpcoeff) |
| d | edge%fluid%ni(:)%transpcoeff(:)%d (complexgrid_vector_simplestruct) |
| label | edge%fluid%ni(:)%transpcoeff(:)%d%label (string) |
| comp | edge%fluid%ni(:)%transpcoeff(:)%d%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%ni(:)%transpcoeff(:)%d%comp(:)%griduid (integer) |
| subgrid | edge%fluid%ni(:)%transpcoeff(:)%d%comp(:)%subgrid (integer) |
| scalar | edge%fluid%ni(:)%transpcoeff(:)%d%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%ni(:)%transpcoeff(:)%d%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%ni(:)%transpcoeff(:)%d%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%ni(:)%transpcoeff(:)%d%align (vecint_type) |
| alignid | edge%fluid%ni(:)%transpcoeff(:)%d%alignid (vecstring_type) |
| v | edge%fluid%ni(:)%transpcoeff(:)%v (complexgrid_vector_simplestruct) |
| label | edge%fluid%ni(:)%transpcoeff(:)%v%label (string) |
| comp | edge%fluid%ni(:)%transpcoeff(:)%v%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%ni(:)%transpcoeff(:)%v%comp(:)%griduid (integer) |
| subgrid | edge%fluid%ni(:)%transpcoeff(:)%v%comp(:)%subgrid (integer) |
| scalar | edge%fluid%ni(:)%transpcoeff(:)%v%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%ni(:)%transpcoeff(:)%v%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%ni(:)%transpcoeff(:)%v%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%ni(:)%transpcoeff(:)%v%align (vecint_type) |
| alignid | edge%fluid%ni(:)%transpcoeff(:)%v%alignid (vecstring_type) |
| source | edge%fluid%ni(:)%source(:) (complexgrid_scalar) |
| griduid | edge%fluid%ni(:)%source(:)%griduid (integer) |
| subgrid | edge%fluid%ni(:)%source(:)%subgrid (integer) |
| scalar | edge%fluid%ni(:)%source(:)%scalar (vecflt_type) |
| vector | edge%fluid%ni(:)%source(:)%vector (matflt_type) |
| matrix | edge%fluid%ni(:)%source(:)%matrix (array3dflt_type) |
| ve | edge%fluid%ve (edge_fluid_vector_simplestruct) |
| griduid | edge%fluid%ve%griduid (integer) |
| basis | edge%fluid%ve%basis (integer) |
| comps | edge%fluid%ve%comps(:) (edge_fluid_scalar) |
| value | edge%fluid%ve%comps(:)%value(:) (complexgrid_scalar) |
| griduid | edge%fluid%ve%comps(:)%value(:)%griduid (integer) |
| subgrid | edge%fluid%ve%comps(:)%value(:)%subgrid (integer) |
| scalar | edge%fluid%ve%comps(:)%value(:)%scalar (vecflt_type) |
| vector | edge%fluid%ve%comps(:)%value(:)%vector (matflt_type) |
| matrix | edge%fluid%ve%comps(:)%value(:)%matrix (array3dflt_type) |
| bndvalue | edge%fluid%ve%comps(:)%bndvalue(:) (complexgrid_scalar) |
| griduid | edge%fluid%ve%comps(:)%bndvalue(:)%griduid (integer) |
| subgrid | edge%fluid%ve%comps(:)%bndvalue(:)%subgrid (integer) |
| scalar | edge%fluid%ve%comps(:)%bndvalue(:)%scalar (vecflt_type) |
| vector | edge%fluid%ve%comps(:)%bndvalue(:)%vector (matflt_type) |
| matrix | edge%fluid%ve%comps(:)%bndvalue(:)%matrix (array3dflt_type) |
| flux | edge%fluid%ve%comps(:)%flux(:) (complexgrid_vector) |
| griduid | edge%fluid%ve%comps(:)%flux(:)%griduid (integer) |
| label | edge%fluid%ve%comps(:)%flux(:)%label (string) |
| comp | edge%fluid%ve%comps(:)%flux(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%ve%comps(:)%flux(:)%comp(:)%griduid (integer) |
| subgrid | edge%fluid%ve%comps(:)%flux(:)%comp(:)%subgrid (integer) |
| scalar | edge%fluid%ve%comps(:)%flux(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%ve%comps(:)%flux(:)%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%ve%comps(:)%flux(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%ve%comps(:)%flux(:)%align (vecint_type) |
| alignid | edge%fluid%ve%comps(:)%flux(:)%alignid (vecstring_type) |
| basis | edge%fluid%ve%comps(:)%flux(:)%basis (integer) |
| bndflux | edge%fluid%ve%comps(:)%bndflux(:) (complexgrid_vector) |
| griduid | edge%fluid%ve%comps(:)%bndflux(:)%griduid (integer) |
| label | edge%fluid%ve%comps(:)%bndflux(:)%label (string) |
| comp | edge%fluid%ve%comps(:)%bndflux(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%ve%comps(:)%bndflux(:)%comp(:)%griduid (integer) |
| subgrid | edge%fluid%ve%comps(:)%bndflux(:)%comp(:)%subgrid (integer) |
| scalar | edge%fluid%ve%comps(:)%bndflux(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%ve%comps(:)%bndflux(:)%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%ve%comps(:)%bndflux(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%ve%comps(:)%bndflux(:)%align (vecint_type) |
| alignid | edge%fluid%ve%comps(:)%bndflux(:)%alignid (vecstring_type) |
| basis | edge%fluid%ve%comps(:)%bndflux(:)%basis (integer) |
| transpcoeff | edge%fluid%ve%comps(:)%transpcoeff(:) (edge_fluid_scalar_transpcoeff) |
| d | edge%fluid%ve%comps(:)%transpcoeff(:)%d (complexgrid_vector_simplestruct) |
| label | edge%fluid%ve%comps(:)%transpcoeff(:)%d%label (string) |
| comp | edge%fluid%ve%comps(:)%transpcoeff(:)%d%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%ve%comps(:)%transpcoeff(:)%d%comp(:)%griduid (integer) |
| subgrid | edge%fluid%ve%comps(:)%transpcoeff(:)%d%comp(:)%subgrid (integer) |
| scalar | edge%fluid%ve%comps(:)%transpcoeff(:)%d%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%ve%comps(:)%transpcoeff(:)%d%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%ve%comps(:)%transpcoeff(:)%d%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%ve%comps(:)%transpcoeff(:)%d%align (vecint_type) |
| alignid | edge%fluid%ve%comps(:)%transpcoeff(:)%d%alignid (vecstring_type) |
| v | edge%fluid%ve%comps(:)%transpcoeff(:)%v (complexgrid_vector_simplestruct) |
| label | edge%fluid%ve%comps(:)%transpcoeff(:)%v%label (string) |
| comp | edge%fluid%ve%comps(:)%transpcoeff(:)%v%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%ve%comps(:)%transpcoeff(:)%v%comp(:)%griduid (integer) |
| subgrid | edge%fluid%ve%comps(:)%transpcoeff(:)%v%comp(:)%subgrid (integer) |
| scalar | edge%fluid%ve%comps(:)%transpcoeff(:)%v%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%ve%comps(:)%transpcoeff(:)%v%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%ve%comps(:)%transpcoeff(:)%v%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%ve%comps(:)%transpcoeff(:)%v%align (vecint_type) |
| alignid | edge%fluid%ve%comps(:)%transpcoeff(:)%v%alignid (vecstring_type) |
| source | edge%fluid%ve%comps(:)%source(:) (complexgrid_scalar) |
| griduid | edge%fluid%ve%comps(:)%source(:)%griduid (integer) |
| subgrid | edge%fluid%ve%comps(:)%source(:)%subgrid (integer) |
| scalar | edge%fluid%ve%comps(:)%source(:)%scalar (vecflt_type) |
| vector | edge%fluid%ve%comps(:)%source(:)%vector (matflt_type) |
| matrix | edge%fluid%ve%comps(:)%source(:)%matrix (array3dflt_type) |
| align | edge%fluid%ve%align (vecint_type) |
| alignid | edge%fluid%ve%alignid (vecstring_type) |
| vi | edge%fluid%vi(:) (edge_fluid_vector) |
| griduid | edge%fluid%vi(:)%griduid (integer) |
| basis | edge%fluid%vi(:)%basis (integer) |
| align | edge%fluid%vi(:)%align (vecint_type) |
| alignid | edge%fluid%vi(:)%alignid (vecstring_type) |
| comps | edge%fluid%vi(:)%comps(:) (edge_fluid_scalar) |
| value | edge%fluid%vi(:)%comps(:)%value(:) (complexgrid_scalar) |
| griduid | edge%fluid%vi(:)%comps(:)%value(:)%griduid (integer) |
| subgrid | edge%fluid%vi(:)%comps(:)%value(:)%subgrid (integer) |
| scalar | edge%fluid%vi(:)%comps(:)%value(:)%scalar (vecflt_type) |
| vector | edge%fluid%vi(:)%comps(:)%value(:)%vector (matflt_type) |
| matrix | edge%fluid%vi(:)%comps(:)%value(:)%matrix (array3dflt_type) |
| bndvalue | edge%fluid%vi(:)%comps(:)%bndvalue(:) (complexgrid_scalar) |
| griduid | edge%fluid%vi(:)%comps(:)%bndvalue(:)%griduid (integer) |
| subgrid | edge%fluid%vi(:)%comps(:)%bndvalue(:)%subgrid (integer) |
| scalar | edge%fluid%vi(:)%comps(:)%bndvalue(:)%scalar (vecflt_type) |
| vector | edge%fluid%vi(:)%comps(:)%bndvalue(:)%vector (matflt_type) |
| matrix | edge%fluid%vi(:)%comps(:)%bndvalue(:)%matrix (array3dflt_type) |
| flux | edge%fluid%vi(:)%comps(:)%flux(:) (complexgrid_vector) |
| griduid | edge%fluid%vi(:)%comps(:)%flux(:)%griduid (integer) |
| label | edge%fluid%vi(:)%comps(:)%flux(:)%label (string) |
| comp | edge%fluid%vi(:)%comps(:)%flux(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%vi(:)%comps(:)%flux(:)%comp(:)%griduid (integer) |
| subgrid | edge%fluid%vi(:)%comps(:)%flux(:)%comp(:)%subgrid (integer) |
| scalar | edge%fluid%vi(:)%comps(:)%flux(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%vi(:)%comps(:)%flux(:)%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%vi(:)%comps(:)%flux(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%vi(:)%comps(:)%flux(:)%align (vecint_type) |
| alignid | edge%fluid%vi(:)%comps(:)%flux(:)%alignid (vecstring_type) |
| basis | edge%fluid%vi(:)%comps(:)%flux(:)%basis (integer) |
| bndflux | edge%fluid%vi(:)%comps(:)%bndflux(:) (complexgrid_vector) |
| griduid | edge%fluid%vi(:)%comps(:)%bndflux(:)%griduid (integer) |
| label | edge%fluid%vi(:)%comps(:)%bndflux(:)%label (string) |
| comp | edge%fluid%vi(:)%comps(:)%bndflux(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%vi(:)%comps(:)%bndflux(:)%comp(:)%griduid (integer) |
| subgrid | edge%fluid%vi(:)%comps(:)%bndflux(:)%comp(:)%subgrid (integer) |
| scalar | edge%fluid%vi(:)%comps(:)%bndflux(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%vi(:)%comps(:)%bndflux(:)%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%vi(:)%comps(:)%bndflux(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%vi(:)%comps(:)%bndflux(:)%align (vecint_type) |
| alignid | edge%fluid%vi(:)%comps(:)%bndflux(:)%alignid (vecstring_type) |
| basis | edge%fluid%vi(:)%comps(:)%bndflux(:)%basis (integer) |
| transpcoeff | edge%fluid%vi(:)%comps(:)%transpcoeff(:) (edge_fluid_scalar_transpcoeff) |
| d | edge%fluid%vi(:)%comps(:)%transpcoeff(:)%d (complexgrid_vector_simplestruct) |
| label | edge%fluid%vi(:)%comps(:)%transpcoeff(:)%d%label (string) |
| comp | edge%fluid%vi(:)%comps(:)%transpcoeff(:)%d%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%vi(:)%comps(:)%transpcoeff(:)%d%comp(:)%griduid (integer) |
| subgrid | edge%fluid%vi(:)%comps(:)%transpcoeff(:)%d%comp(:)%subgrid (integer) |
| scalar | edge%fluid%vi(:)%comps(:)%transpcoeff(:)%d%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%vi(:)%comps(:)%transpcoeff(:)%d%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%vi(:)%comps(:)%transpcoeff(:)%d%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%vi(:)%comps(:)%transpcoeff(:)%d%align (vecint_type) |
| alignid | edge%fluid%vi(:)%comps(:)%transpcoeff(:)%d%alignid (vecstring_type) |
| v | edge%fluid%vi(:)%comps(:)%transpcoeff(:)%v (complexgrid_vector_simplestruct) |
| label | edge%fluid%vi(:)%comps(:)%transpcoeff(:)%v%label (string) |
| comp | edge%fluid%vi(:)%comps(:)%transpcoeff(:)%v%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%vi(:)%comps(:)%transpcoeff(:)%v%comp(:)%griduid (integer) |
| subgrid | edge%fluid%vi(:)%comps(:)%transpcoeff(:)%v%comp(:)%subgrid (integer) |
| scalar | edge%fluid%vi(:)%comps(:)%transpcoeff(:)%v%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%vi(:)%comps(:)%transpcoeff(:)%v%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%vi(:)%comps(:)%transpcoeff(:)%v%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%vi(:)%comps(:)%transpcoeff(:)%v%align (vecint_type) |
| alignid | edge%fluid%vi(:)%comps(:)%transpcoeff(:)%v%alignid (vecstring_type) |
| source | edge%fluid%vi(:)%comps(:)%source(:) (complexgrid_scalar) |
| griduid | edge%fluid%vi(:)%comps(:)%source(:)%griduid (integer) |
| subgrid | edge%fluid%vi(:)%comps(:)%source(:)%subgrid (integer) |
| scalar | edge%fluid%vi(:)%comps(:)%source(:)%scalar (vecflt_type) |
| vector | edge%fluid%vi(:)%comps(:)%source(:)%vector (matflt_type) |
| matrix | edge%fluid%vi(:)%comps(:)%source(:)%matrix (array3dflt_type) |
| te | edge%fluid%te (edge_fluid_scalar_simplestruct) |
| value | edge%fluid%te%value(:) (complexgrid_scalar) |
| griduid | edge%fluid%te%value(:)%griduid (integer) |
| subgrid | edge%fluid%te%value(:)%subgrid (integer) |
| scalar | edge%fluid%te%value(:)%scalar (vecflt_type) |
| vector | edge%fluid%te%value(:)%vector (matflt_type) |
| matrix | edge%fluid%te%value(:)%matrix (array3dflt_type) |
| bndvalue | edge%fluid%te%bndvalue(:) (complexgrid_scalar) |
| griduid | edge%fluid%te%bndvalue(:)%griduid (integer) |
| subgrid | edge%fluid%te%bndvalue(:)%subgrid (integer) |
| scalar | edge%fluid%te%bndvalue(:)%scalar (vecflt_type) |
| vector | edge%fluid%te%bndvalue(:)%vector (matflt_type) |
| matrix | edge%fluid%te%bndvalue(:)%matrix (array3dflt_type) |
| flux | edge%fluid%te%flux(:) (complexgrid_vector) |
| griduid | edge%fluid%te%flux(:)%griduid (integer) |
| label | edge%fluid%te%flux(:)%label (string) |
| comp | edge%fluid%te%flux(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%te%flux(:)%comp(:)%griduid (integer) |
| subgrid | edge%fluid%te%flux(:)%comp(:)%subgrid (integer) |
| scalar | edge%fluid%te%flux(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%te%flux(:)%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%te%flux(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%te%flux(:)%align (vecint_type) |
| alignid | edge%fluid%te%flux(:)%alignid (vecstring_type) |
| basis | edge%fluid%te%flux(:)%basis (integer) |
| bndflux | edge%fluid%te%bndflux(:) (complexgrid_vector) |
| griduid | edge%fluid%te%bndflux(:)%griduid (integer) |
| label | edge%fluid%te%bndflux(:)%label (string) |
| comp | edge%fluid%te%bndflux(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%te%bndflux(:)%comp(:)%griduid (integer) |
| subgrid | edge%fluid%te%bndflux(:)%comp(:)%subgrid (integer) |
| scalar | edge%fluid%te%bndflux(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%te%bndflux(:)%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%te%bndflux(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%te%bndflux(:)%align (vecint_type) |
| alignid | edge%fluid%te%bndflux(:)%alignid (vecstring_type) |
| basis | edge%fluid%te%bndflux(:)%basis (integer) |
| transpcoeff | edge%fluid%te%transpcoeff(:) (edge_fluid_scalar_transpcoeff) |
| d | edge%fluid%te%transpcoeff(:)%d (complexgrid_vector_simplestruct) |
| label | edge%fluid%te%transpcoeff(:)%d%label (string) |
| comp | edge%fluid%te%transpcoeff(:)%d%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%te%transpcoeff(:)%d%comp(:)%griduid (integer) |
| subgrid | edge%fluid%te%transpcoeff(:)%d%comp(:)%subgrid (integer) |
| scalar | edge%fluid%te%transpcoeff(:)%d%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%te%transpcoeff(:)%d%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%te%transpcoeff(:)%d%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%te%transpcoeff(:)%d%align (vecint_type) |
| alignid | edge%fluid%te%transpcoeff(:)%d%alignid (vecstring_type) |
| v | edge%fluid%te%transpcoeff(:)%v (complexgrid_vector_simplestruct) |
| label | edge%fluid%te%transpcoeff(:)%v%label (string) |
| comp | edge%fluid%te%transpcoeff(:)%v%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%te%transpcoeff(:)%v%comp(:)%griduid (integer) |
| subgrid | edge%fluid%te%transpcoeff(:)%v%comp(:)%subgrid (integer) |
| scalar | edge%fluid%te%transpcoeff(:)%v%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%te%transpcoeff(:)%v%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%te%transpcoeff(:)%v%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%te%transpcoeff(:)%v%align (vecint_type) |
| alignid | edge%fluid%te%transpcoeff(:)%v%alignid (vecstring_type) |
| source | edge%fluid%te%source(:) (complexgrid_scalar) |
| griduid | edge%fluid%te%source(:)%griduid (integer) |
| subgrid | edge%fluid%te%source(:)%subgrid (integer) |
| scalar | edge%fluid%te%source(:)%scalar (vecflt_type) |
| vector | edge%fluid%te%source(:)%vector (matflt_type) |
| matrix | edge%fluid%te%source(:)%matrix (array3dflt_type) |
| ti | edge%fluid%ti(:) (edge_fluid_scalar) |
| value | edge%fluid%ti(:)%value(:) (complexgrid_scalar) |
| griduid | edge%fluid%ti(:)%value(:)%griduid (integer) |
| subgrid | edge%fluid%ti(:)%value(:)%subgrid (integer) |
| scalar | edge%fluid%ti(:)%value(:)%scalar (vecflt_type) |
| vector | edge%fluid%ti(:)%value(:)%vector (matflt_type) |
| matrix | edge%fluid%ti(:)%value(:)%matrix (array3dflt_type) |
| bndvalue | edge%fluid%ti(:)%bndvalue(:) (complexgrid_scalar) |
| griduid | edge%fluid%ti(:)%bndvalue(:)%griduid (integer) |
| subgrid | edge%fluid%ti(:)%bndvalue(:)%subgrid (integer) |
| scalar | edge%fluid%ti(:)%bndvalue(:)%scalar (vecflt_type) |
| vector | edge%fluid%ti(:)%bndvalue(:)%vector (matflt_type) |
| matrix | edge%fluid%ti(:)%bndvalue(:)%matrix (array3dflt_type) |
| flux | edge%fluid%ti(:)%flux(:) (complexgrid_vector) |
| griduid | edge%fluid%ti(:)%flux(:)%griduid (integer) |
| label | edge%fluid%ti(:)%flux(:)%label (string) |
| comp | edge%fluid%ti(:)%flux(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%ti(:)%flux(:)%comp(:)%griduid (integer) |
| subgrid | edge%fluid%ti(:)%flux(:)%comp(:)%subgrid (integer) |
| scalar | edge%fluid%ti(:)%flux(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%ti(:)%flux(:)%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%ti(:)%flux(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%ti(:)%flux(:)%align (vecint_type) |
| alignid | edge%fluid%ti(:)%flux(:)%alignid (vecstring_type) |
| basis | edge%fluid%ti(:)%flux(:)%basis (integer) |
| bndflux | edge%fluid%ti(:)%bndflux(:) (complexgrid_vector) |
| griduid | edge%fluid%ti(:)%bndflux(:)%griduid (integer) |
| label | edge%fluid%ti(:)%bndflux(:)%label (string) |
| comp | edge%fluid%ti(:)%bndflux(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%ti(:)%bndflux(:)%comp(:)%griduid (integer) |
| subgrid | edge%fluid%ti(:)%bndflux(:)%comp(:)%subgrid (integer) |
| scalar | edge%fluid%ti(:)%bndflux(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%ti(:)%bndflux(:)%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%ti(:)%bndflux(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%ti(:)%bndflux(:)%align (vecint_type) |
| alignid | edge%fluid%ti(:)%bndflux(:)%alignid (vecstring_type) |
| basis | edge%fluid%ti(:)%bndflux(:)%basis (integer) |
| transpcoeff | edge%fluid%ti(:)%transpcoeff(:) (edge_fluid_scalar_transpcoeff) |
| d | edge%fluid%ti(:)%transpcoeff(:)%d (complexgrid_vector_simplestruct) |
| label | edge%fluid%ti(:)%transpcoeff(:)%d%label (string) |
| comp | edge%fluid%ti(:)%transpcoeff(:)%d%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%ti(:)%transpcoeff(:)%d%comp(:)%griduid (integer) |
| subgrid | edge%fluid%ti(:)%transpcoeff(:)%d%comp(:)%subgrid (integer) |
| scalar | edge%fluid%ti(:)%transpcoeff(:)%d%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%ti(:)%transpcoeff(:)%d%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%ti(:)%transpcoeff(:)%d%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%ti(:)%transpcoeff(:)%d%align (vecint_type) |
| alignid | edge%fluid%ti(:)%transpcoeff(:)%d%alignid (vecstring_type) |
| v | edge%fluid%ti(:)%transpcoeff(:)%v (complexgrid_vector_simplestruct) |
| label | edge%fluid%ti(:)%transpcoeff(:)%v%label (string) |
| comp | edge%fluid%ti(:)%transpcoeff(:)%v%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%ti(:)%transpcoeff(:)%v%comp(:)%griduid (integer) |
| subgrid | edge%fluid%ti(:)%transpcoeff(:)%v%comp(:)%subgrid (integer) |
| scalar | edge%fluid%ti(:)%transpcoeff(:)%v%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%ti(:)%transpcoeff(:)%v%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%ti(:)%transpcoeff(:)%v%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%ti(:)%transpcoeff(:)%v%align (vecint_type) |
| alignid | edge%fluid%ti(:)%transpcoeff(:)%v%alignid (vecstring_type) |
| source | edge%fluid%ti(:)%source(:) (complexgrid_scalar) |
| griduid | edge%fluid%ti(:)%source(:)%griduid (integer) |
| subgrid | edge%fluid%ti(:)%source(:)%subgrid (integer) |
| scalar | edge%fluid%ti(:)%source(:)%scalar (vecflt_type) |
| vector | edge%fluid%ti(:)%source(:)%vector (matflt_type) |
| matrix | edge%fluid%ti(:)%source(:)%matrix (array3dflt_type) |
| te_aniso | edge%fluid%te_aniso (edge_fluid_vector_simplestruct) |
| griduid | edge%fluid%te_aniso%griduid (integer) |
| basis | edge%fluid%te_aniso%basis (integer) |
| comps | edge%fluid%te_aniso%comps(:) (edge_fluid_scalar) |
| value | edge%fluid%te_aniso%comps(:)%value(:) (complexgrid_scalar) |
| griduid | edge%fluid%te_aniso%comps(:)%value(:)%griduid (integer) |
| subgrid | edge%fluid%te_aniso%comps(:)%value(:)%subgrid (integer) |
| scalar | edge%fluid%te_aniso%comps(:)%value(:)%scalar (vecflt_type) |
| vector | edge%fluid%te_aniso%comps(:)%value(:)%vector (matflt_type) |
| matrix | edge%fluid%te_aniso%comps(:)%value(:)%matrix (array3dflt_type) |
| bndvalue | edge%fluid%te_aniso%comps(:)%bndvalue(:) (complexgrid_scalar) |
| griduid | edge%fluid%te_aniso%comps(:)%bndvalue(:)%griduid (integer) |
| subgrid | edge%fluid%te_aniso%comps(:)%bndvalue(:)%subgrid (integer) |
| scalar | edge%fluid%te_aniso%comps(:)%bndvalue(:)%scalar (vecflt_type) |
| vector | edge%fluid%te_aniso%comps(:)%bndvalue(:)%vector (matflt_type) |
| matrix | edge%fluid%te_aniso%comps(:)%bndvalue(:)%matrix (array3dflt_type) |
| flux | edge%fluid%te_aniso%comps(:)%flux(:) (complexgrid_vector) |
| griduid | edge%fluid%te_aniso%comps(:)%flux(:)%griduid (integer) |
| label | edge%fluid%te_aniso%comps(:)%flux(:)%label (string) |
| comp | edge%fluid%te_aniso%comps(:)%flux(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%te_aniso%comps(:)%flux(:)%comp(:)%griduid (integer) |
| subgrid | edge%fluid%te_aniso%comps(:)%flux(:)%comp(:)%subgrid (integer) |
| scalar | edge%fluid%te_aniso%comps(:)%flux(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%te_aniso%comps(:)%flux(:)%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%te_aniso%comps(:)%flux(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%te_aniso%comps(:)%flux(:)%align (vecint_type) |
| alignid | edge%fluid%te_aniso%comps(:)%flux(:)%alignid (vecstring_type) |
| basis | edge%fluid%te_aniso%comps(:)%flux(:)%basis (integer) |
| bndflux | edge%fluid%te_aniso%comps(:)%bndflux(:) (complexgrid_vector) |
| griduid | edge%fluid%te_aniso%comps(:)%bndflux(:)%griduid (integer) |
| label | edge%fluid%te_aniso%comps(:)%bndflux(:)%label (string) |
| comp | edge%fluid%te_aniso%comps(:)%bndflux(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%te_aniso%comps(:)%bndflux(:)%comp(:)%griduid (integer) |
| subgrid | edge%fluid%te_aniso%comps(:)%bndflux(:)%comp(:)%subgrid (integer) |
| scalar | edge%fluid%te_aniso%comps(:)%bndflux(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%te_aniso%comps(:)%bndflux(:)%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%te_aniso%comps(:)%bndflux(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%te_aniso%comps(:)%bndflux(:)%align (vecint_type) |
| alignid | edge%fluid%te_aniso%comps(:)%bndflux(:)%alignid (vecstring_type) |
| basis | edge%fluid%te_aniso%comps(:)%bndflux(:)%basis (integer) |
| transpcoeff | edge%fluid%te_aniso%comps(:)%transpcoeff(:) (edge_fluid_scalar_transpcoeff) |
| d | edge%fluid%te_aniso%comps(:)%transpcoeff(:)%d (complexgrid_vector_simplestruct) |
| label | edge%fluid%te_aniso%comps(:)%transpcoeff(:)%d%label (string) |
| comp | edge%fluid%te_aniso%comps(:)%transpcoeff(:)%d%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%te_aniso%comps(:)%transpcoeff(:)%d%comp(:)%griduid (integer) |
| subgrid | edge%fluid%te_aniso%comps(:)%transpcoeff(:)%d%comp(:)%subgrid (integer) |
| scalar | edge%fluid%te_aniso%comps(:)%transpcoeff(:)%d%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%te_aniso%comps(:)%transpcoeff(:)%d%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%te_aniso%comps(:)%transpcoeff(:)%d%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%te_aniso%comps(:)%transpcoeff(:)%d%align (vecint_type) |
| alignid | edge%fluid%te_aniso%comps(:)%transpcoeff(:)%d%alignid (vecstring_type) |
| v | edge%fluid%te_aniso%comps(:)%transpcoeff(:)%v (complexgrid_vector_simplestruct) |
| label | edge%fluid%te_aniso%comps(:)%transpcoeff(:)%v%label (string) |
| comp | edge%fluid%te_aniso%comps(:)%transpcoeff(:)%v%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%te_aniso%comps(:)%transpcoeff(:)%v%comp(:)%griduid (integer) |
| subgrid | edge%fluid%te_aniso%comps(:)%transpcoeff(:)%v%comp(:)%subgrid (integer) |
| scalar | edge%fluid%te_aniso%comps(:)%transpcoeff(:)%v%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%te_aniso%comps(:)%transpcoeff(:)%v%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%te_aniso%comps(:)%transpcoeff(:)%v%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%te_aniso%comps(:)%transpcoeff(:)%v%align (vecint_type) |
| alignid | edge%fluid%te_aniso%comps(:)%transpcoeff(:)%v%alignid (vecstring_type) |
| source | edge%fluid%te_aniso%comps(:)%source(:) (complexgrid_scalar) |
| griduid | edge%fluid%te_aniso%comps(:)%source(:)%griduid (integer) |
| subgrid | edge%fluid%te_aniso%comps(:)%source(:)%subgrid (integer) |
| scalar | edge%fluid%te_aniso%comps(:)%source(:)%scalar (vecflt_type) |
| vector | edge%fluid%te_aniso%comps(:)%source(:)%vector (matflt_type) |
| matrix | edge%fluid%te_aniso%comps(:)%source(:)%matrix (array3dflt_type) |
| align | edge%fluid%te_aniso%align (vecint_type) |
| alignid | edge%fluid%te_aniso%alignid (vecstring_type) |
| ti_aniso | edge%fluid%ti_aniso(:) (edge_fluid_vector) |
| griduid | edge%fluid%ti_aniso(:)%griduid (integer) |
| basis | edge%fluid%ti_aniso(:)%basis (integer) |
| align | edge%fluid%ti_aniso(:)%align (vecint_type) |
| alignid | edge%fluid%ti_aniso(:)%alignid (vecstring_type) |
| comps | edge%fluid%ti_aniso(:)%comps(:) (edge_fluid_scalar) |
| value | edge%fluid%ti_aniso(:)%comps(:)%value(:) (complexgrid_scalar) |
| griduid | edge%fluid%ti_aniso(:)%comps(:)%value(:)%griduid (integer) |
| subgrid | edge%fluid%ti_aniso(:)%comps(:)%value(:)%subgrid (integer) |
| scalar | edge%fluid%ti_aniso(:)%comps(:)%value(:)%scalar (vecflt_type) |
| vector | edge%fluid%ti_aniso(:)%comps(:)%value(:)%vector (matflt_type) |
| matrix | edge%fluid%ti_aniso(:)%comps(:)%value(:)%matrix (array3dflt_type) |
| bndvalue | edge%fluid%ti_aniso(:)%comps(:)%bndvalue(:) (complexgrid_scalar) |
| griduid | edge%fluid%ti_aniso(:)%comps(:)%bndvalue(:)%griduid (integer) |
| subgrid | edge%fluid%ti_aniso(:)%comps(:)%bndvalue(:)%subgrid (integer) |
| scalar | edge%fluid%ti_aniso(:)%comps(:)%bndvalue(:)%scalar (vecflt_type) |
| vector | edge%fluid%ti_aniso(:)%comps(:)%bndvalue(:)%vector (matflt_type) |
| matrix | edge%fluid%ti_aniso(:)%comps(:)%bndvalue(:)%matrix (array3dflt_type) |
| flux | edge%fluid%ti_aniso(:)%comps(:)%flux(:) (complexgrid_vector) |
| griduid | edge%fluid%ti_aniso(:)%comps(:)%flux(:)%griduid (integer) |
| label | edge%fluid%ti_aniso(:)%comps(:)%flux(:)%label (string) |
| comp | edge%fluid%ti_aniso(:)%comps(:)%flux(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%ti_aniso(:)%comps(:)%flux(:)%comp(:)%griduid (integer) |
| subgrid | edge%fluid%ti_aniso(:)%comps(:)%flux(:)%comp(:)%subgrid (integer) |
| scalar | edge%fluid%ti_aniso(:)%comps(:)%flux(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%ti_aniso(:)%comps(:)%flux(:)%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%ti_aniso(:)%comps(:)%flux(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%ti_aniso(:)%comps(:)%flux(:)%align (vecint_type) |
| alignid | edge%fluid%ti_aniso(:)%comps(:)%flux(:)%alignid (vecstring_type) |
| basis | edge%fluid%ti_aniso(:)%comps(:)%flux(:)%basis (integer) |
| bndflux | edge%fluid%ti_aniso(:)%comps(:)%bndflux(:) (complexgrid_vector) |
| griduid | edge%fluid%ti_aniso(:)%comps(:)%bndflux(:)%griduid (integer) |
| label | edge%fluid%ti_aniso(:)%comps(:)%bndflux(:)%label (string) |
| comp | edge%fluid%ti_aniso(:)%comps(:)%bndflux(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%ti_aniso(:)%comps(:)%bndflux(:)%comp(:)%griduid (integer) |
| subgrid | edge%fluid%ti_aniso(:)%comps(:)%bndflux(:)%comp(:)%subgrid (integer) |
| scalar | edge%fluid%ti_aniso(:)%comps(:)%bndflux(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%ti_aniso(:)%comps(:)%bndflux(:)%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%ti_aniso(:)%comps(:)%bndflux(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%ti_aniso(:)%comps(:)%bndflux(:)%align (vecint_type) |
| alignid | edge%fluid%ti_aniso(:)%comps(:)%bndflux(:)%alignid (vecstring_type) |
| basis | edge%fluid%ti_aniso(:)%comps(:)%bndflux(:)%basis (integer) |
| transpcoeff | edge%fluid%ti_aniso(:)%comps(:)%transpcoeff(:) (edge_fluid_scalar_transpcoeff) |
| d | edge%fluid%ti_aniso(:)%comps(:)%transpcoeff(:)%d (complexgrid_vector_simplestruct) |
| label | edge%fluid%ti_aniso(:)%comps(:)%transpcoeff(:)%d%label (string) |
| comp | edge%fluid%ti_aniso(:)%comps(:)%transpcoeff(:)%d%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%ti_aniso(:)%comps(:)%transpcoeff(:)%d%comp(:)%griduid (integer) |
| subgrid | edge%fluid%ti_aniso(:)%comps(:)%transpcoeff(:)%d%comp(:)%subgrid (integer) |
| scalar | edge%fluid%ti_aniso(:)%comps(:)%transpcoeff(:)%d%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%ti_aniso(:)%comps(:)%transpcoeff(:)%d%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%ti_aniso(:)%comps(:)%transpcoeff(:)%d%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%ti_aniso(:)%comps(:)%transpcoeff(:)%d%align (vecint_type) |
| alignid | edge%fluid%ti_aniso(:)%comps(:)%transpcoeff(:)%d%alignid (vecstring_type) |
| v | edge%fluid%ti_aniso(:)%comps(:)%transpcoeff(:)%v (complexgrid_vector_simplestruct) |
| label | edge%fluid%ti_aniso(:)%comps(:)%transpcoeff(:)%v%label (string) |
| comp | edge%fluid%ti_aniso(:)%comps(:)%transpcoeff(:)%v%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%ti_aniso(:)%comps(:)%transpcoeff(:)%v%comp(:)%griduid (integer) |
| subgrid | edge%fluid%ti_aniso(:)%comps(:)%transpcoeff(:)%v%comp(:)%subgrid (integer) |
| scalar | edge%fluid%ti_aniso(:)%comps(:)%transpcoeff(:)%v%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%ti_aniso(:)%comps(:)%transpcoeff(:)%v%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%ti_aniso(:)%comps(:)%transpcoeff(:)%v%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%ti_aniso(:)%comps(:)%transpcoeff(:)%v%align (vecint_type) |
| alignid | edge%fluid%ti_aniso(:)%comps(:)%transpcoeff(:)%v%alignid (vecstring_type) |
| source | edge%fluid%ti_aniso(:)%comps(:)%source(:) (complexgrid_scalar) |
| griduid | edge%fluid%ti_aniso(:)%comps(:)%source(:)%griduid (integer) |
| subgrid | edge%fluid%ti_aniso(:)%comps(:)%source(:)%subgrid (integer) |
| scalar | edge%fluid%ti_aniso(:)%comps(:)%source(:)%scalar (vecflt_type) |
| vector | edge%fluid%ti_aniso(:)%comps(:)%source(:)%vector (matflt_type) |
| matrix | edge%fluid%ti_aniso(:)%comps(:)%source(:)%matrix (array3dflt_type) |
| po | edge%fluid%po (edge_fluid_scalar_simplestruct) |
| value | edge%fluid%po%value(:) (complexgrid_scalar) |
| griduid | edge%fluid%po%value(:)%griduid (integer) |
| subgrid | edge%fluid%po%value(:)%subgrid (integer) |
| scalar | edge%fluid%po%value(:)%scalar (vecflt_type) |
| vector | edge%fluid%po%value(:)%vector (matflt_type) |
| matrix | edge%fluid%po%value(:)%matrix (array3dflt_type) |
| bndvalue | edge%fluid%po%bndvalue(:) (complexgrid_scalar) |
| griduid | edge%fluid%po%bndvalue(:)%griduid (integer) |
| subgrid | edge%fluid%po%bndvalue(:)%subgrid (integer) |
| scalar | edge%fluid%po%bndvalue(:)%scalar (vecflt_type) |
| vector | edge%fluid%po%bndvalue(:)%vector (matflt_type) |
| matrix | edge%fluid%po%bndvalue(:)%matrix (array3dflt_type) |
| flux | edge%fluid%po%flux(:) (complexgrid_vector) |
| griduid | edge%fluid%po%flux(:)%griduid (integer) |
| label | edge%fluid%po%flux(:)%label (string) |
| comp | edge%fluid%po%flux(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%po%flux(:)%comp(:)%griduid (integer) |
| subgrid | edge%fluid%po%flux(:)%comp(:)%subgrid (integer) |
| scalar | edge%fluid%po%flux(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%po%flux(:)%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%po%flux(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%po%flux(:)%align (vecint_type) |
| alignid | edge%fluid%po%flux(:)%alignid (vecstring_type) |
| basis | edge%fluid%po%flux(:)%basis (integer) |
| bndflux | edge%fluid%po%bndflux(:) (complexgrid_vector) |
| griduid | edge%fluid%po%bndflux(:)%griduid (integer) |
| label | edge%fluid%po%bndflux(:)%label (string) |
| comp | edge%fluid%po%bndflux(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%po%bndflux(:)%comp(:)%griduid (integer) |
| subgrid | edge%fluid%po%bndflux(:)%comp(:)%subgrid (integer) |
| scalar | edge%fluid%po%bndflux(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%po%bndflux(:)%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%po%bndflux(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%po%bndflux(:)%align (vecint_type) |
| alignid | edge%fluid%po%bndflux(:)%alignid (vecstring_type) |
| basis | edge%fluid%po%bndflux(:)%basis (integer) |
| transpcoeff | edge%fluid%po%transpcoeff(:) (edge_fluid_scalar_transpcoeff) |
| d | edge%fluid%po%transpcoeff(:)%d (complexgrid_vector_simplestruct) |
| label | edge%fluid%po%transpcoeff(:)%d%label (string) |
| comp | edge%fluid%po%transpcoeff(:)%d%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%po%transpcoeff(:)%d%comp(:)%griduid (integer) |
| subgrid | edge%fluid%po%transpcoeff(:)%d%comp(:)%subgrid (integer) |
| scalar | edge%fluid%po%transpcoeff(:)%d%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%po%transpcoeff(:)%d%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%po%transpcoeff(:)%d%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%po%transpcoeff(:)%d%align (vecint_type) |
| alignid | edge%fluid%po%transpcoeff(:)%d%alignid (vecstring_type) |
| v | edge%fluid%po%transpcoeff(:)%v (complexgrid_vector_simplestruct) |
| label | edge%fluid%po%transpcoeff(:)%v%label (string) |
| comp | edge%fluid%po%transpcoeff(:)%v%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%po%transpcoeff(:)%v%comp(:)%griduid (integer) |
| subgrid | edge%fluid%po%transpcoeff(:)%v%comp(:)%subgrid (integer) |
| scalar | edge%fluid%po%transpcoeff(:)%v%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%po%transpcoeff(:)%v%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%po%transpcoeff(:)%v%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%po%transpcoeff(:)%v%align (vecint_type) |
| alignid | edge%fluid%po%transpcoeff(:)%v%alignid (vecstring_type) |
| source | edge%fluid%po%source(:) (complexgrid_scalar) |
| griduid | edge%fluid%po%source(:)%griduid (integer) |
| subgrid | edge%fluid%po%source(:)%subgrid (integer) |
| scalar | edge%fluid%po%source(:)%scalar (vecflt_type) |
| vector | edge%fluid%po%source(:)%vector (matflt_type) |
| matrix | edge%fluid%po%source(:)%matrix (array3dflt_type) |
| j | edge%fluid%j (edge_fluid_vector_simplestruct) |
| griduid | edge%fluid%j%griduid (integer) |
| basis | edge%fluid%j%basis (integer) |
| comps | edge%fluid%j%comps(:) (edge_fluid_scalar) |
| value | edge%fluid%j%comps(:)%value(:) (complexgrid_scalar) |
| griduid | edge%fluid%j%comps(:)%value(:)%griduid (integer) |
| subgrid | edge%fluid%j%comps(:)%value(:)%subgrid (integer) |
| scalar | edge%fluid%j%comps(:)%value(:)%scalar (vecflt_type) |
| vector | edge%fluid%j%comps(:)%value(:)%vector (matflt_type) |
| matrix | edge%fluid%j%comps(:)%value(:)%matrix (array3dflt_type) |
| bndvalue | edge%fluid%j%comps(:)%bndvalue(:) (complexgrid_scalar) |
| griduid | edge%fluid%j%comps(:)%bndvalue(:)%griduid (integer) |
| subgrid | edge%fluid%j%comps(:)%bndvalue(:)%subgrid (integer) |
| scalar | edge%fluid%j%comps(:)%bndvalue(:)%scalar (vecflt_type) |
| vector | edge%fluid%j%comps(:)%bndvalue(:)%vector (matflt_type) |
| matrix | edge%fluid%j%comps(:)%bndvalue(:)%matrix (array3dflt_type) |
| flux | edge%fluid%j%comps(:)%flux(:) (complexgrid_vector) |
| griduid | edge%fluid%j%comps(:)%flux(:)%griduid (integer) |
| label | edge%fluid%j%comps(:)%flux(:)%label (string) |
| comp | edge%fluid%j%comps(:)%flux(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%j%comps(:)%flux(:)%comp(:)%griduid (integer) |
| subgrid | edge%fluid%j%comps(:)%flux(:)%comp(:)%subgrid (integer) |
| scalar | edge%fluid%j%comps(:)%flux(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%j%comps(:)%flux(:)%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%j%comps(:)%flux(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%j%comps(:)%flux(:)%align (vecint_type) |
| alignid | edge%fluid%j%comps(:)%flux(:)%alignid (vecstring_type) |
| basis | edge%fluid%j%comps(:)%flux(:)%basis (integer) |
| bndflux | edge%fluid%j%comps(:)%bndflux(:) (complexgrid_vector) |
| griduid | edge%fluid%j%comps(:)%bndflux(:)%griduid (integer) |
| label | edge%fluid%j%comps(:)%bndflux(:)%label (string) |
| comp | edge%fluid%j%comps(:)%bndflux(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%j%comps(:)%bndflux(:)%comp(:)%griduid (integer) |
| subgrid | edge%fluid%j%comps(:)%bndflux(:)%comp(:)%subgrid (integer) |
| scalar | edge%fluid%j%comps(:)%bndflux(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%j%comps(:)%bndflux(:)%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%j%comps(:)%bndflux(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%j%comps(:)%bndflux(:)%align (vecint_type) |
| alignid | edge%fluid%j%comps(:)%bndflux(:)%alignid (vecstring_type) |
| basis | edge%fluid%j%comps(:)%bndflux(:)%basis (integer) |
| transpcoeff | edge%fluid%j%comps(:)%transpcoeff(:) (edge_fluid_scalar_transpcoeff) |
| d | edge%fluid%j%comps(:)%transpcoeff(:)%d (complexgrid_vector_simplestruct) |
| label | edge%fluid%j%comps(:)%transpcoeff(:)%d%label (string) |
| comp | edge%fluid%j%comps(:)%transpcoeff(:)%d%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%j%comps(:)%transpcoeff(:)%d%comp(:)%griduid (integer) |
| subgrid | edge%fluid%j%comps(:)%transpcoeff(:)%d%comp(:)%subgrid (integer) |
| scalar | edge%fluid%j%comps(:)%transpcoeff(:)%d%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%j%comps(:)%transpcoeff(:)%d%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%j%comps(:)%transpcoeff(:)%d%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%j%comps(:)%transpcoeff(:)%d%align (vecint_type) |
| alignid | edge%fluid%j%comps(:)%transpcoeff(:)%d%alignid (vecstring_type) |
| v | edge%fluid%j%comps(:)%transpcoeff(:)%v (complexgrid_vector_simplestruct) |
| label | edge%fluid%j%comps(:)%transpcoeff(:)%v%label (string) |
| comp | edge%fluid%j%comps(:)%transpcoeff(:)%v%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%j%comps(:)%transpcoeff(:)%v%comp(:)%griduid (integer) |
| subgrid | edge%fluid%j%comps(:)%transpcoeff(:)%v%comp(:)%subgrid (integer) |
| scalar | edge%fluid%j%comps(:)%transpcoeff(:)%v%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%j%comps(:)%transpcoeff(:)%v%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%j%comps(:)%transpcoeff(:)%v%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%j%comps(:)%transpcoeff(:)%v%align (vecint_type) |
| alignid | edge%fluid%j%comps(:)%transpcoeff(:)%v%alignid (vecstring_type) |
| source | edge%fluid%j%comps(:)%source(:) (complexgrid_scalar) |
| griduid | edge%fluid%j%comps(:)%source(:)%griduid (integer) |
| subgrid | edge%fluid%j%comps(:)%source(:)%subgrid (integer) |
| scalar | edge%fluid%j%comps(:)%source(:)%scalar (vecflt_type) |
| vector | edge%fluid%j%comps(:)%source(:)%vector (matflt_type) |
| matrix | edge%fluid%j%comps(:)%source(:)%matrix (array3dflt_type) |
| align | edge%fluid%j%align (vecint_type) |
| alignid | edge%fluid%j%alignid (vecstring_type) |
| b | edge%fluid%b(:) (complexgrid_vector) |
| griduid | edge%fluid%b(:)%griduid (integer) |
| label | edge%fluid%b(:)%label (string) |
| comp | edge%fluid%b(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%fluid%b(:)%comp(:)%griduid (integer) |
| subgrid | edge%fluid%b(:)%comp(:)%subgrid (integer) |
| scalar | edge%fluid%b(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%fluid%b(:)%comp(:)%vector (matflt_type) |
| matrix | edge%fluid%b(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%fluid%b(:)%align (vecint_type) |
| alignid | edge%fluid%b(:)%alignid (vecstring_type) |
| basis | edge%fluid%b(:)%basis (integer) |
| kinetic | edge%kinetic (edge_kinetic) |
| f | edge%kinetic%f(:) (edge_kinetic_distribution) |
| value | edge%kinetic%f(:)%value(:) (complexgrid_scalar) |
| griduid | edge%kinetic%f(:)%value(:)%griduid (integer) |
| subgrid | edge%kinetic%f(:)%value(:)%subgrid (integer) |
| scalar | edge%kinetic%f(:)%value(:)%scalar (vecflt_type) |
| vector | edge%kinetic%f(:)%value(:)%vector (matflt_type) |
| matrix | edge%kinetic%f(:)%value(:)%matrix (array3dflt_type) |
| bndvalue | edge%kinetic%f(:)%bndvalue(:) (complexgrid_scalar) |
| griduid | edge%kinetic%f(:)%bndvalue(:)%griduid (integer) |
| subgrid | edge%kinetic%f(:)%bndvalue(:)%subgrid (integer) |
| scalar | edge%kinetic%f(:)%bndvalue(:)%scalar (vecflt_type) |
| vector | edge%kinetic%f(:)%bndvalue(:)%vector (matflt_type) |
| matrix | edge%kinetic%f(:)%bndvalue(:)%matrix (array3dflt_type) |
| fluxes | edge%kinetic%f(:)%fluxes(:) (complexgrid_vector) |
| griduid | edge%kinetic%f(:)%fluxes(:)%griduid (integer) |
| label | edge%kinetic%f(:)%fluxes(:)%label (string) |
| comp | edge%kinetic%f(:)%fluxes(:)%comp(:) (complexgrid_scalar) |
| griduid | edge%kinetic%f(:)%fluxes(:)%comp(:)%griduid (integer) |
| subgrid | edge%kinetic%f(:)%fluxes(:)%comp(:)%subgrid (integer) |
| scalar | edge%kinetic%f(:)%fluxes(:)%comp(:)%scalar (vecflt_type) |
| vector | edge%kinetic%f(:)%fluxes(:)%comp(:)%vector (matflt_type) |
| matrix | edge%kinetic%f(:)%fluxes(:)%comp(:)%matrix (array3dflt_type) |
| align | edge%kinetic%f(:)%fluxes(:)%align (vecint_type) |
| alignid | edge%kinetic%f(:)%fluxes(:)%alignid (vecstring_type) |
| basis | edge%kinetic%f(:)%fluxes(:)%basis (integer) |
| source | edge%kinetic%f(:)%source(:) (complexgrid_scalar) |
| griduid | edge%kinetic%f(:)%source(:)%griduid (integer) |
| subgrid | edge%kinetic%f(:)%source(:)%subgrid (integer) |
| scalar | edge%kinetic%f(:)%source(:)%scalar (vecflt_type) |
| vector | edge%kinetic%f(:)%source(:)%vector (matflt_type) |
| matrix | edge%kinetic%f(:)%source(:)%matrix (array3dflt_type) |
| codeparam | edge%codeparam (codeparam) |
| codename | edge%codeparam%codename (string) |
| codeversion | edge%codeparam%codeversion (string) |
| parameters | edge%codeparam%parameters (string) |
| output_diag | edge%codeparam%output_diag (string) |
| output_flag | edge%codeparam%output_flag (integer) |
| time | edge%time (float) |
| datainfo | efcc%datainfo (datainfo) |
| dataprovider | efcc%datainfo%dataprovider (string) |
| putdate | efcc%datainfo%putdate (string) |
| source | efcc%datainfo%source (string) |
| comment | efcc%datainfo%comment (string) |
| cocos | efcc%datainfo%cocos (integer) |
| id | efcc%datainfo%id (integer) |
| isref | efcc%datainfo%isref (integer) |
| whatref | efcc%datainfo%whatref (whatref) |
| user | efcc%datainfo%whatref%user (string) |
| machine | efcc%datainfo%whatref%machine (string) |
| shot | efcc%datainfo%whatref%shot (integer) |
| run | efcc%datainfo%whatref%run (integer) |
| occurrence | efcc%datainfo%whatref%occurrence (integer) |
| putinfo | efcc%datainfo%putinfo (putinfo) |
| putmethod | efcc%datainfo%putinfo%putmethod (string) |
| putaccess | efcc%datainfo%putinfo%putaccess (string) |
| putlocation | efcc%datainfo%putinfo%putlocation (string) |
| rights | efcc%datainfo%putinfo%rights (string) |
| coil | efcc%coil(:) (coil) |
| desc_coils | efcc%coil(:)%desc_coils (desc_coils) |
| name | efcc%coil(:)%desc_coils%name (string) |
| res | efcc%coil(:)%desc_coils%res (float) |
| nturns | efcc%coil(:)%desc_coils%nturns (integer) |
| closed | efcc%coil(:)%desc_coils%closed (string) |
| edges | efcc%coil(:)%desc_coils%edges(:) (edges) |
| edge_rzphi | efcc%coil(:)%desc_coils%edges(:)%edge_rzphi (rzphi1D) |
| r | efcc%coil(:)%desc_coils%edges(:)%edge_rzphi%r (vecflt_type) |
| z | efcc%coil(:)%desc_coils%edges(:)%edge_rzphi%z (vecflt_type) |
| phi | efcc%coil(:)%desc_coils%edges(:)%edge_rzphi%phi (vecflt_type) |
| coilcurrent | efcc%coil(:)%coilcurrent (exp1D) |
| value | efcc%coil(:)%coilcurrent%value (vecflt_type) |
| abserror | efcc%coil(:)%coilcurrent%abserror (vecflt_type) |
| relerror | efcc%coil(:)%coilcurrent%relerror (vecflt_type) |
| coilvoltage | efcc%coil(:)%coilvoltage (exp1D) |
| value | efcc%coil(:)%coilvoltage%value (vecflt_type) |
| abserror | efcc%coil(:)%coilvoltage%abserror (vecflt_type) |
| relerror | efcc%coil(:)%coilvoltage%relerror (vecflt_type) |
| time | efcc%time (float) |
| codeparam | efcc%codeparam (codeparam) |
| codename | efcc%codeparam%codename (string) |
| codeversion | efcc%codeparam%codeversion (string) |
| parameters | efcc%codeparam%parameters (string) |
| output_diag | efcc%codeparam%output_diag (string) |
| output_flag | efcc%codeparam%output_flag (integer) |
| datainfo | equilibrium%datainfo (datainfo) |
| dataprovider | equilibrium%datainfo%dataprovider (string) |
| putdate | equilibrium%datainfo%putdate (string) |
| source | equilibrium%datainfo%source (string) |
| comment | equilibrium%datainfo%comment (string) |
| cocos | equilibrium%datainfo%cocos (integer) |
| id | equilibrium%datainfo%id (integer) |
| isref | equilibrium%datainfo%isref (integer) |
| whatref | equilibrium%datainfo%whatref (whatref) |
| user | equilibrium%datainfo%whatref%user (string) |
| machine | equilibrium%datainfo%whatref%machine (string) |
| shot | equilibrium%datainfo%whatref%shot (integer) |
| run | equilibrium%datainfo%whatref%run (integer) |
| occurrence | equilibrium%datainfo%whatref%occurrence (integer) |
| putinfo | equilibrium%datainfo%putinfo (putinfo) |
| putmethod | equilibrium%datainfo%putinfo%putmethod (string) |
| putaccess | equilibrium%datainfo%putinfo%putaccess (string) |
| putlocation | equilibrium%datainfo%putinfo%putlocation (string) |
| rights | equilibrium%datainfo%putinfo%rights (string) |
| eqconstraint | equilibrium%eqconstraint (eqconstraint) |
| bpol | equilibrium%eqconstraint%bpol (eqmes1D) |
| measured | equilibrium%eqconstraint%bpol%measured (vecflt_type) |
| source | equilibrium%eqconstraint%bpol%source (string) |
| time | equilibrium%eqconstraint%bpol%time (float) |
| exact | equilibrium%eqconstraint%bpol%exact (vecint_type) |
| weight | equilibrium%eqconstraint%bpol%weight (vecflt_type) |
| sigma | equilibrium%eqconstraint%bpol%sigma (vecflt_type) |
| calculated | equilibrium%eqconstraint%bpol%calculated (vecflt_type) |
| chi2 | equilibrium%eqconstraint%bpol%chi2 (vecflt_type) |
| bvac_r | equilibrium%eqconstraint%bvac_r (eqmes0D) |
| measured | equilibrium%eqconstraint%bvac_r%measured (float) |
| source | equilibrium%eqconstraint%bvac_r%source (string) |
| time | equilibrium%eqconstraint%bvac_r%time (float) |
| exact | equilibrium%eqconstraint%bvac_r%exact (integer) |
| weight | equilibrium%eqconstraint%bvac_r%weight (float) |
| sigma | equilibrium%eqconstraint%bvac_r%sigma (float) |
| calculated | equilibrium%eqconstraint%bvac_r%calculated (float) |
| chi2 | equilibrium%eqconstraint%bvac_r%chi2 (float) |
| diamagflux | equilibrium%eqconstraint%diamagflux (eqmes0D) |
| measured | equilibrium%eqconstraint%diamagflux%measured (float) |
| source | equilibrium%eqconstraint%diamagflux%source (string) |
| time | equilibrium%eqconstraint%diamagflux%time (float) |
| exact | equilibrium%eqconstraint%diamagflux%exact (integer) |
| weight | equilibrium%eqconstraint%diamagflux%weight (float) |
| sigma | equilibrium%eqconstraint%diamagflux%sigma (float) |
| calculated | equilibrium%eqconstraint%diamagflux%calculated (float) |
| chi2 | equilibrium%eqconstraint%diamagflux%chi2 (float) |
| faraday | equilibrium%eqconstraint%faraday (eqmes1D) |
| measured | equilibrium%eqconstraint%faraday%measured (vecflt_type) |
| source | equilibrium%eqconstraint%faraday%source (string) |
| time | equilibrium%eqconstraint%faraday%time (float) |
| exact | equilibrium%eqconstraint%faraday%exact (vecint_type) |
| weight | equilibrium%eqconstraint%faraday%weight (vecflt_type) |
| sigma | equilibrium%eqconstraint%faraday%sigma (vecflt_type) |
| calculated | equilibrium%eqconstraint%faraday%calculated (vecflt_type) |
| chi2 | equilibrium%eqconstraint%faraday%chi2 (vecflt_type) |
| flux | equilibrium%eqconstraint%flux (eqmes1D) |
| measured | equilibrium%eqconstraint%flux%measured (vecflt_type) |
| source | equilibrium%eqconstraint%flux%source (string) |
| time | equilibrium%eqconstraint%flux%time (float) |
| exact | equilibrium%eqconstraint%flux%exact (vecint_type) |
| weight | equilibrium%eqconstraint%flux%weight (vecflt_type) |
| sigma | equilibrium%eqconstraint%flux%sigma (vecflt_type) |
| calculated | equilibrium%eqconstraint%flux%calculated (vecflt_type) |
| chi2 | equilibrium%eqconstraint%flux%chi2 (vecflt_type) |
| i_plasma | equilibrium%eqconstraint%i_plasma (eqmes0D) |
| measured | equilibrium%eqconstraint%i_plasma%measured (float) |
| source | equilibrium%eqconstraint%i_plasma%source (string) |
| time | equilibrium%eqconstraint%i_plasma%time (float) |
| exact | equilibrium%eqconstraint%i_plasma%exact (integer) |
| weight | equilibrium%eqconstraint%i_plasma%weight (float) |
| sigma | equilibrium%eqconstraint%i_plasma%sigma (float) |
| calculated | equilibrium%eqconstraint%i_plasma%calculated (float) |
| chi2 | equilibrium%eqconstraint%i_plasma%chi2 (float) |
| isoflux | equilibrium%eqconstraint%isoflux (isoflux) |
| position | equilibrium%eqconstraint%isoflux%position (rz1D) |
| r | equilibrium%eqconstraint%isoflux%position%r (vecflt_type) |
| z | equilibrium%eqconstraint%isoflux%position%z (vecflt_type) |
| source | equilibrium%eqconstraint%isoflux%source (string) |
| weight | equilibrium%eqconstraint%isoflux%weight (vecflt_type) |
| sigma | equilibrium%eqconstraint%isoflux%sigma (vecflt_type) |
| calculated | equilibrium%eqconstraint%isoflux%calculated (vecflt_type) |
| chi2 | equilibrium%eqconstraint%isoflux%chi2 (vecflt_type) |
| jsurf | equilibrium%eqconstraint%jsurf (eqmes1D) |
| measured | equilibrium%eqconstraint%jsurf%measured (vecflt_type) |
| source | equilibrium%eqconstraint%jsurf%source (string) |
| time | equilibrium%eqconstraint%jsurf%time (float) |
| exact | equilibrium%eqconstraint%jsurf%exact (vecint_type) |
| weight | equilibrium%eqconstraint%jsurf%weight (vecflt_type) |
| sigma | equilibrium%eqconstraint%jsurf%sigma (vecflt_type) |
| calculated | equilibrium%eqconstraint%jsurf%calculated (vecflt_type) |
| chi2 | equilibrium%eqconstraint%jsurf%chi2 (vecflt_type) |
| magnet_iron | equilibrium%eqconstraint%magnet_iron (magnet_iron) |
| mr | equilibrium%eqconstraint%magnet_iron%mr (eqmes1D) |
| measured | equilibrium%eqconstraint%magnet_iron%mr%measured (vecflt_type) |
| source | equilibrium%eqconstraint%magnet_iron%mr%source (string) |
| time | equilibrium%eqconstraint%magnet_iron%mr%time (float) |
| exact | equilibrium%eqconstraint%magnet_iron%mr%exact (vecint_type) |
| weight | equilibrium%eqconstraint%magnet_iron%mr%weight (vecflt_type) |
| sigma | equilibrium%eqconstraint%magnet_iron%mr%sigma (vecflt_type) |
| calculated | equilibrium%eqconstraint%magnet_iron%mr%calculated (vecflt_type) |
| chi2 | equilibrium%eqconstraint%magnet_iron%mr%chi2 (vecflt_type) |
| mz | equilibrium%eqconstraint%magnet_iron%mz (eqmes1D) |
| measured | equilibrium%eqconstraint%magnet_iron%mz%measured (vecflt_type) |
| source | equilibrium%eqconstraint%magnet_iron%mz%source (string) |
| time | equilibrium%eqconstraint%magnet_iron%mz%time (float) |
| exact | equilibrium%eqconstraint%magnet_iron%mz%exact (vecint_type) |
| weight | equilibrium%eqconstraint%magnet_iron%mz%weight (vecflt_type) |
| sigma | equilibrium%eqconstraint%magnet_iron%mz%sigma (vecflt_type) |
| calculated | equilibrium%eqconstraint%magnet_iron%mz%calculated (vecflt_type) |
| chi2 | equilibrium%eqconstraint%magnet_iron%mz%chi2 (vecflt_type) |
| mse | equilibrium%eqconstraint%mse (eqmes1D) |
| measured | equilibrium%eqconstraint%mse%measured (vecflt_type) |
| source | equilibrium%eqconstraint%mse%source (string) |
| time | equilibrium%eqconstraint%mse%time (float) |
| exact | equilibrium%eqconstraint%mse%exact (vecint_type) |
| weight | equilibrium%eqconstraint%mse%weight (vecflt_type) |
| sigma | equilibrium%eqconstraint%mse%sigma (vecflt_type) |
| calculated | equilibrium%eqconstraint%mse%calculated (vecflt_type) |
| chi2 | equilibrium%eqconstraint%mse%chi2 (vecflt_type) |
| ne | equilibrium%eqconstraint%ne (eqmes1D) |
| measured | equilibrium%eqconstraint%ne%measured (vecflt_type) |
| source | equilibrium%eqconstraint%ne%source (string) |
| time | equilibrium%eqconstraint%ne%time (float) |
| exact | equilibrium%eqconstraint%ne%exact (vecint_type) |
| weight | equilibrium%eqconstraint%ne%weight (vecflt_type) |
| sigma | equilibrium%eqconstraint%ne%sigma (vecflt_type) |
| calculated | equilibrium%eqconstraint%ne%calculated (vecflt_type) |
| chi2 | equilibrium%eqconstraint%ne%chi2 (vecflt_type) |
| pfcurrent | equilibrium%eqconstraint%pfcurrent (eqmes1D) |
| measured | equilibrium%eqconstraint%pfcurrent%measured (vecflt_type) |
| source | equilibrium%eqconstraint%pfcurrent%source (string) |
| time | equilibrium%eqconstraint%pfcurrent%time (float) |
| exact | equilibrium%eqconstraint%pfcurrent%exact (vecint_type) |
| weight | equilibrium%eqconstraint%pfcurrent%weight (vecflt_type) |
| sigma | equilibrium%eqconstraint%pfcurrent%sigma (vecflt_type) |
| calculated | equilibrium%eqconstraint%pfcurrent%calculated (vecflt_type) |
| chi2 | equilibrium%eqconstraint%pfcurrent%chi2 (vecflt_type) |
| pressure | equilibrium%eqconstraint%pressure (eqmes1D) |
| measured | equilibrium%eqconstraint%pressure%measured (vecflt_type) |
| source | equilibrium%eqconstraint%pressure%source (string) |
| time | equilibrium%eqconstraint%pressure%time (float) |
| exact | equilibrium%eqconstraint%pressure%exact (vecint_type) |
| weight | equilibrium%eqconstraint%pressure%weight (vecflt_type) |
| sigma | equilibrium%eqconstraint%pressure%sigma (vecflt_type) |
| calculated | equilibrium%eqconstraint%pressure%calculated (vecflt_type) |
| chi2 | equilibrium%eqconstraint%pressure%chi2 (vecflt_type) |
| q | equilibrium%eqconstraint%q (q) |
| qvalue | equilibrium%eqconstraint%q%qvalue (vecflt_type) |
| position | equilibrium%eqconstraint%q%position (rz1D) |
| r | equilibrium%eqconstraint%q%position%r (vecflt_type) |
| z | equilibrium%eqconstraint%q%position%z (vecflt_type) |
| source | equilibrium%eqconstraint%q%source (string) |
| exact | equilibrium%eqconstraint%q%exact (integer) |
| weight | equilibrium%eqconstraint%q%weight (vecflt_type) |
| sigma | equilibrium%eqconstraint%q%sigma (vecflt_type) |
| calculated | equilibrium%eqconstraint%q%calculated (vecflt_type) |
| chi2 | equilibrium%eqconstraint%q%chi2 (vecflt_type) |
| xpts | equilibrium%eqconstraint%xpts (xpts) |
| position | equilibrium%eqconstraint%xpts%position (rz1D) |
| r | equilibrium%eqconstraint%xpts%position%r (vecflt_type) |
| z | equilibrium%eqconstraint%xpts%position%z (vecflt_type) |
| source | equilibrium%eqconstraint%xpts%source (string) |
| weight | equilibrium%eqconstraint%xpts%weight (vecflt_type) |
| sigma | equilibrium%eqconstraint%xpts%sigma (vecflt_type) |
| calculated | equilibrium%eqconstraint%xpts%calculated (vecflt_type) |
| chi2 | equilibrium%eqconstraint%xpts%chi2 (vecflt_type) |
| eqgeometry | equilibrium%eqgeometry (eqgeometry) |
| source | equilibrium%eqgeometry%source (string) |
| boundarytype | equilibrium%eqgeometry%boundarytype (integer) |
| boundary | equilibrium%eqgeometry%boundary(:) (rz1Dexp) |
| r | equilibrium%eqgeometry%boundary(:)%r (vecflt_type) |
| z | equilibrium%eqgeometry%boundary(:)%z (vecflt_type) |
| geom_axis | equilibrium%eqgeometry%geom_axis (rz0D) |
| r | equilibrium%eqgeometry%geom_axis%r (float) |
| z | equilibrium%eqgeometry%geom_axis%z (float) |
| a_minor | equilibrium%eqgeometry%a_minor (float) |
| elongation | equilibrium%eqgeometry%elongation (float) |
| elong_upper | equilibrium%eqgeometry%elong_upper (float) |
| elong_lower | equilibrium%eqgeometry%elong_lower (float) |
| tria_upper | equilibrium%eqgeometry%tria_upper (float) |
| tria_lower | equilibrium%eqgeometry%tria_lower (float) |
| xpts | equilibrium%eqgeometry%xpts(:) (rz1Dexp) |
| r | equilibrium%eqgeometry%xpts(:)%r (vecflt_type) |
| z | equilibrium%eqgeometry%xpts(:)%z (vecflt_type) |
| left_low_st | equilibrium%eqgeometry%left_low_st (rz0D) |
| r | equilibrium%eqgeometry%left_low_st%r (float) |
| z | equilibrium%eqgeometry%left_low_st%z (float) |
| right_low_st | equilibrium%eqgeometry%right_low_st (rz0D) |
| r | equilibrium%eqgeometry%right_low_st%r (float) |
| z | equilibrium%eqgeometry%right_low_st%z (float) |
| left_up_st | equilibrium%eqgeometry%left_up_st (rz0D) |
| r | equilibrium%eqgeometry%left_up_st%r (float) |
| z | equilibrium%eqgeometry%left_up_st%z (float) |
| right_up_st | equilibrium%eqgeometry%right_up_st (rz0D) |
| r | equilibrium%eqgeometry%right_up_st%r (float) |
| z | equilibrium%eqgeometry%right_up_st%z (float) |
| active_limit | equilibrium%eqgeometry%active_limit (rz0D) |
| r | equilibrium%eqgeometry%active_limit%r (float) |
| z | equilibrium%eqgeometry%active_limit%z (float) |
| ang_lcms_upo | equilibrium%eqgeometry%ang_lcms_upo (float) |
| ang_lcms_upi | equilibrium%eqgeometry%ang_lcms_upi (float) |
| ang_lcms_lwo | equilibrium%eqgeometry%ang_lcms_lwo (float) |
| ang_lcms_lwi | equilibrium%eqgeometry%ang_lcms_lwi (float) |
| flush | equilibrium%flush (flush) |
| datainfo | equilibrium%flush%datainfo (datainfo) |
| dataprovider | equilibrium%flush%datainfo%dataprovider (string) |
| putdate | equilibrium%flush%datainfo%putdate (string) |
| source | equilibrium%flush%datainfo%source (string) |
| comment | equilibrium%flush%datainfo%comment (string) |
| cocos | equilibrium%flush%datainfo%cocos (integer) |
| id | equilibrium%flush%datainfo%id (integer) |
| isref | equilibrium%flush%datainfo%isref (integer) |
| whatref | equilibrium%flush%datainfo%whatref (whatref) |
| user | equilibrium%flush%datainfo%whatref%user (string) |
| machine | equilibrium%flush%datainfo%whatref%machine (string) |
| shot | equilibrium%flush%datainfo%whatref%shot (integer) |
| run | equilibrium%flush%datainfo%whatref%run (integer) |
| occurrence | equilibrium%flush%datainfo%whatref%occurrence (integer) |
| putinfo | equilibrium%flush%datainfo%putinfo (putinfo) |
| putmethod | equilibrium%flush%datainfo%putinfo%putmethod (string) |
| putaccess | equilibrium%flush%datainfo%putinfo%putaccess (string) |
| putlocation | equilibrium%flush%datainfo%putinfo%putlocation (string) |
| rights | equilibrium%flush%datainfo%putinfo%rights (string) |
| position | equilibrium%flush%position (rz1D) |
| r | equilibrium%flush%position%r (vecflt_type) |
| z | equilibrium%flush%position%z (vecflt_type) |
| coef | equilibrium%flush%coef (matflt_type) |
| codeparam | equilibrium%flush%codeparam (codeparam) |
| codename | equilibrium%flush%codeparam%codename (string) |
| codeversion | equilibrium%flush%codeparam%codeversion (string) |
| parameters | equilibrium%flush%codeparam%parameters (string) |
| output_diag | equilibrium%flush%codeparam%output_diag (string) |
| output_flag | equilibrium%flush%codeparam%output_flag (integer) |
| global_param | equilibrium%global_param (global_param) |
| beta_pol | equilibrium%global_param%beta_pol (float) |
| beta_tor | equilibrium%global_param%beta_tor (float) |
| beta_normal | equilibrium%global_param%beta_normal (float) |
| i_plasma | equilibrium%global_param%i_plasma (float) |
| li | equilibrium%global_param%li (float) |
| volume | equilibrium%global_param%volume (float) |
| area | equilibrium%global_param%area (float) |
| psi_ax | equilibrium%global_param%psi_ax (float) |
| psi_bound | equilibrium%global_param%psi_bound (float) |
| mag_axis | equilibrium%global_param%mag_axis (mag_axis) |
| position | equilibrium%global_param%mag_axis%position (rz0D) |
| r | equilibrium%global_param%mag_axis%position%r (float) |
| z | equilibrium%global_param%mag_axis%position%z (float) |
| bphi | equilibrium%global_param%mag_axis%bphi (float) |
| q | equilibrium%global_param%mag_axis%q (float) |
| q_95 | equilibrium%global_param%q_95 (float) |
| q_min | equilibrium%global_param%q_min (float) |
| toroid_field | equilibrium%global_param%toroid_field (b0r0) |
| r0 | equilibrium%global_param%toroid_field%r0 (float) |
| b0 | equilibrium%global_param%toroid_field%b0 (float) |
| w_mhd | equilibrium%global_param%w_mhd (float) |
| gamma | equilibrium%global_param%gamma (float) |
| profiles_1d | equilibrium%profiles_1d (profiles_1d) |
| psi | equilibrium%profiles_1d%psi (vecflt_type) |
| phi | equilibrium%profiles_1d%phi (vecflt_type) |
| pressure | equilibrium%profiles_1d%pressure (vecflt_type) |
| F_dia | equilibrium%profiles_1d%F_dia (vecflt_type) |
| pprime | equilibrium%profiles_1d%pprime (vecflt_type) |
| ffprime | equilibrium%profiles_1d%ffprime (vecflt_type) |
| jphi | equilibrium%profiles_1d%jphi (vecflt_type) |
| jparallel | equilibrium%profiles_1d%jparallel (vecflt_type) |
| q | equilibrium%profiles_1d%q (vecflt_type) |
| shear | equilibrium%profiles_1d%shear (vecflt_type) |
| r_inboard | equilibrium%profiles_1d%r_inboard (vecflt_type) |
| r_outboard | equilibrium%profiles_1d%r_outboard (vecflt_type) |
| rho_tor | equilibrium%profiles_1d%rho_tor (vecflt_type) |
| dpsidrho_tor | equilibrium%profiles_1d%dpsidrho_tor (vecflt_type) |
| rho_vol | equilibrium%profiles_1d%rho_vol (vecflt_type) |
| beta_pol | equilibrium%profiles_1d%beta_pol (vecflt_type) |
| li | equilibrium%profiles_1d%li (vecflt_type) |
| elongation | equilibrium%profiles_1d%elongation (vecflt_type) |
| tria_upper | equilibrium%profiles_1d%tria_upper (vecflt_type) |
| tria_lower | equilibrium%profiles_1d%tria_lower (vecflt_type) |
| volume | equilibrium%profiles_1d%volume (vecflt_type) |
| vprime | equilibrium%profiles_1d%vprime (vecflt_type) |
| dvdrho | equilibrium%profiles_1d%dvdrho (vecflt_type) |
| area | equilibrium%profiles_1d%area (vecflt_type) |
| aprime | equilibrium%profiles_1d%aprime (vecflt_type) |
| surface | equilibrium%profiles_1d%surface (vecflt_type) |
| ftrap | equilibrium%profiles_1d%ftrap (vecflt_type) |
| gm1 | equilibrium%profiles_1d%gm1 (vecflt_type) |
| gm2 | equilibrium%profiles_1d%gm2 (vecflt_type) |
| gm3 | equilibrium%profiles_1d%gm3 (vecflt_type) |
| gm4 | equilibrium%profiles_1d%gm4 (vecflt_type) |
| gm5 | equilibrium%profiles_1d%gm5 (vecflt_type) |
| gm6 | equilibrium%profiles_1d%gm6 (vecflt_type) |
| gm7 | equilibrium%profiles_1d%gm7 (vecflt_type) |
| gm8 | equilibrium%profiles_1d%gm8 (vecflt_type) |
| gm9 | equilibrium%profiles_1d%gm9 (vecflt_type) |
| b_av | equilibrium%profiles_1d%b_av (vecflt_type) |
| b_min | equilibrium%profiles_1d%b_min (vecflt_type) |
| b_max | equilibrium%profiles_1d%b_max (vecflt_type) |
| omega | equilibrium%profiles_1d%omega (vecflt_type) |
| omegaprime | equilibrium%profiles_1d%omegaprime (vecflt_type) |
| mach_a | equilibrium%profiles_1d%mach_a (vecflt_type) |
| phi_flow | equilibrium%profiles_1d%phi_flow (vecflt_type) |
| s_flow | equilibrium%profiles_1d%s_flow (vecflt_type) |
| h_flow | equilibrium%profiles_1d%h_flow (vecflt_type) |
| rho_mass | equilibrium%profiles_1d%rho_mass (vecflt_type) |
| profiles_2d | equilibrium%profiles_2d(:) (equilibrium_profiles_2d) |
| grid_type | equilibrium%profiles_2d(:)%grid_type (vecstring_type) |
| grid | equilibrium%profiles_2d(:)%grid (equilibrium_profiles2d_grid) |
| dim1 | equilibrium%profiles_2d(:)%grid%dim1 (vecflt_type) |
| dim2 | equilibrium%profiles_2d(:)%grid%dim2 (vecflt_type) |
| connect | equilibrium%profiles_2d(:)%grid%connect (matint_type) |
| r | equilibrium%profiles_2d(:)%r (matflt_type) |
| z | equilibrium%profiles_2d(:)%z (matflt_type) |
| psi | equilibrium%profiles_2d(:)%psi (matflt_type) |
| theta | equilibrium%profiles_2d(:)%theta (matflt_type) |
| phi | equilibrium%profiles_2d(:)%phi (matflt_type) |
| jphi | equilibrium%profiles_2d(:)%jphi (matflt_type) |
| jpar | equilibrium%profiles_2d(:)%jpar (matflt_type) |
| br | equilibrium%profiles_2d(:)%br (matflt_type) |
| bz | equilibrium%profiles_2d(:)%bz (matflt_type) |
| bphi | equilibrium%profiles_2d(:)%bphi (matflt_type) |
| vphi | equilibrium%profiles_2d(:)%vphi (matflt_type) |
| vtheta | equilibrium%profiles_2d(:)%vtheta (matflt_type) |
| rho_mass | equilibrium%profiles_2d(:)%rho_mass (matflt_type) |
| pressure | equilibrium%profiles_2d(:)%pressure (matflt_type) |
| temperature | equilibrium%profiles_2d(:)%temperature (matflt_type) |
| coord_sys | equilibrium%coord_sys (coord_sys) |
| grid_type | equilibrium%coord_sys%grid_type (string) |
| grid | equilibrium%coord_sys%grid (reggrid) |
| dim1 | equilibrium%coord_sys%grid%dim1 (vecflt_type) |
| dim2 | equilibrium%coord_sys%grid%dim2 (vecflt_type) |
| jacobian | equilibrium%coord_sys%jacobian (matflt_type) |
| g_11 | equilibrium%coord_sys%g_11 (matflt_type) |
| g_12 | equilibrium%coord_sys%g_12 (matflt_type) |
| g_13 | equilibrium%coord_sys%g_13 (matflt_type) |
| g_22 | equilibrium%coord_sys%g_22 (matflt_type) |
| g_23 | equilibrium%coord_sys%g_23 (matflt_type) |
| g_33 | equilibrium%coord_sys%g_33 (matflt_type) |
| position | equilibrium%coord_sys%position (rz2D) |
| r | equilibrium%coord_sys%position%r (matflt_type) |
| z | equilibrium%coord_sys%position%z (matflt_type) |
| time | equilibrium%time (float) |
| codeparam | equilibrium%codeparam (codeparam) |
| codename | equilibrium%codeparam%codename (string) |
| codeversion | equilibrium%codeparam%codeversion (string) |
| parameters | equilibrium%codeparam%parameters (string) |
| output_diag | equilibrium%codeparam%output_diag (string) |
| output_flag | equilibrium%codeparam%output_flag (integer) |
| datainfo | fusiondiag%datainfo (datainfo) |
| dataprovider | fusiondiag%datainfo%dataprovider (string) |
| putdate | fusiondiag%datainfo%putdate (string) |
| source | fusiondiag%datainfo%source (string) |
| comment | fusiondiag%datainfo%comment (string) |
| cocos | fusiondiag%datainfo%cocos (integer) |
| id | fusiondiag%datainfo%id (integer) |
| isref | fusiondiag%datainfo%isref (integer) |
| whatref | fusiondiag%datainfo%whatref (whatref) |
| user | fusiondiag%datainfo%whatref%user (string) |
| machine | fusiondiag%datainfo%whatref%machine (string) |
| shot | fusiondiag%datainfo%whatref%shot (integer) |
| run | fusiondiag%datainfo%whatref%run (integer) |
| occurrence | fusiondiag%datainfo%whatref%occurrence (integer) |
| putinfo | fusiondiag%datainfo%putinfo (putinfo) |
| putmethod | fusiondiag%datainfo%putinfo%putmethod (string) |
| putaccess | fusiondiag%datainfo%putinfo%putaccess (string) |
| putlocation | fusiondiag%datainfo%putinfo%putlocation (string) |
| rights | fusiondiag%datainfo%putinfo%rights (string) |
| fus_product | fusiondiag%fus_product(:) (fusiondiag_fus_product) |
| product | fusiondiag%fus_product(:)%product (string) |
| reaction | fusiondiag%fus_product(:)%reaction (string) |
| collimator | fusiondiag%fus_product(:)%collimator (fusiondiag_collimator) |
| colli_circ | fusiondiag%fus_product(:)%collimator%colli_circ(:) (fusiondiag_colli_circ) |
| name | fusiondiag%fus_product(:)%collimator%colli_circ(:)%name (string) |
| setup_line | fusiondiag%fus_product(:)%collimator%colli_circ(:)%setup_line (setup_line) |
| pivot_point | fusiondiag%fus_product(:)%collimator%colli_circ(:)%setup_line%pivot_point (rzphi1D) |
| r | fusiondiag%fus_product(:)%collimator%colli_circ(:)%setup_line%pivot_point%r (vecflt_type) |
| z | fusiondiag%fus_product(:)%collimator%colli_circ(:)%setup_line%pivot_point%z (vecflt_type) |
| phi | fusiondiag%fus_product(:)%collimator%colli_circ(:)%setup_line%pivot_point%phi (vecflt_type) |
| horchordang1 | fusiondiag%fus_product(:)%collimator%colli_circ(:)%setup_line%horchordang1 (vecflt_type) |
| verchordang1 | fusiondiag%fus_product(:)%collimator%colli_circ(:)%setup_line%verchordang1 (vecflt_type) |
| width | fusiondiag%fus_product(:)%collimator%colli_circ(:)%setup_line%width (vecflt_type) |
| second_point | fusiondiag%fus_product(:)%collimator%colli_circ(:)%setup_line%second_point (rzphi1D) |
| r | fusiondiag%fus_product(:)%collimator%colli_circ(:)%setup_line%second_point%r (vecflt_type) |
| z | fusiondiag%fus_product(:)%collimator%colli_circ(:)%setup_line%second_point%z (vecflt_type) |
| phi | fusiondiag%fus_product(:)%collimator%colli_circ(:)%setup_line%second_point%phi (vecflt_type) |
| horchordang2 | fusiondiag%fus_product(:)%collimator%colli_circ(:)%setup_line%horchordang2 (vecflt_type) |
| verchordang2 | fusiondiag%fus_product(:)%collimator%colli_circ(:)%setup_line%verchordang2 (vecflt_type) |
| third_point | fusiondiag%fus_product(:)%collimator%colli_circ(:)%setup_line%third_point (rzphi1D) |
| r | fusiondiag%fus_product(:)%collimator%colli_circ(:)%setup_line%third_point%r (vecflt_type) |
| z | fusiondiag%fus_product(:)%collimator%colli_circ(:)%setup_line%third_point%z (vecflt_type) |
| phi | fusiondiag%fus_product(:)%collimator%colli_circ(:)%setup_line%third_point%phi (vecflt_type) |
| nchordpoints | fusiondiag%fus_product(:)%collimator%colli_circ(:)%setup_line%nchordpoints (integer) |
| colliunit | fusiondiag%fus_product(:)%collimator%colli_circ(:)%colliunit(:) (fusiondiag_colliunit_circ) |
| radius | fusiondiag%fus_product(:)%collimator%colli_circ(:)%colliunit(:)%radius (vecflt_type) |
| centre | fusiondiag%fus_product(:)%collimator%colli_circ(:)%colliunit(:)%centre (rzphi1D) |
| r | fusiondiag%fus_product(:)%collimator%colli_circ(:)%colliunit(:)%centre%r (vecflt_type) |
| z | fusiondiag%fus_product(:)%collimator%colli_circ(:)%colliunit(:)%centre%z (vecflt_type) |
| phi | fusiondiag%fus_product(:)%collimator%colli_circ(:)%colliunit(:)%centre%phi (vecflt_type) |
| colli_poly | fusiondiag%fus_product(:)%collimator%colli_poly(:) (fusiondiag_colli_poly) |
| name | fusiondiag%fus_product(:)%collimator%colli_poly(:)%name (string) |
| setup_line | fusiondiag%fus_product(:)%collimator%colli_poly(:)%setup_line (setup_line) |
| pivot_point | fusiondiag%fus_product(:)%collimator%colli_poly(:)%setup_line%pivot_point (rzphi1D) |
| r | fusiondiag%fus_product(:)%collimator%colli_poly(:)%setup_line%pivot_point%r (vecflt_type) |
| z | fusiondiag%fus_product(:)%collimator%colli_poly(:)%setup_line%pivot_point%z (vecflt_type) |
| phi | fusiondiag%fus_product(:)%collimator%colli_poly(:)%setup_line%pivot_point%phi (vecflt_type) |
| horchordang1 | fusiondiag%fus_product(:)%collimator%colli_poly(:)%setup_line%horchordang1 (vecflt_type) |
| verchordang1 | fusiondiag%fus_product(:)%collimator%colli_poly(:)%setup_line%verchordang1 (vecflt_type) |
| width | fusiondiag%fus_product(:)%collimator%colli_poly(:)%setup_line%width (vecflt_type) |
| second_point | fusiondiag%fus_product(:)%collimator%colli_poly(:)%setup_line%second_point (rzphi1D) |
| r | fusiondiag%fus_product(:)%collimator%colli_poly(:)%setup_line%second_point%r (vecflt_type) |
| z | fusiondiag%fus_product(:)%collimator%colli_poly(:)%setup_line%second_point%z (vecflt_type) |
| phi | fusiondiag%fus_product(:)%collimator%colli_poly(:)%setup_line%second_point%phi (vecflt_type) |
| horchordang2 | fusiondiag%fus_product(:)%collimator%colli_poly(:)%setup_line%horchordang2 (vecflt_type) |
| verchordang2 | fusiondiag%fus_product(:)%collimator%colli_poly(:)%setup_line%verchordang2 (vecflt_type) |
| third_point | fusiondiag%fus_product(:)%collimator%colli_poly(:)%setup_line%third_point (rzphi1D) |
| r | fusiondiag%fus_product(:)%collimator%colli_poly(:)%setup_line%third_point%r (vecflt_type) |
| z | fusiondiag%fus_product(:)%collimator%colli_poly(:)%setup_line%third_point%z (vecflt_type) |
| phi | fusiondiag%fus_product(:)%collimator%colli_poly(:)%setup_line%third_point%phi (vecflt_type) |
| nchordpoints | fusiondiag%fus_product(:)%collimator%colli_poly(:)%setup_line%nchordpoints (integer) |
| colliunit | fusiondiag%fus_product(:)%collimator%colli_poly(:)%colliunit(:) (fusiondiag_colliunit_poly) |
| dimension | fusiondiag%fus_product(:)%collimator%colli_poly(:)%colliunit(:)%dimension (float) |
| nodes | fusiondiag%fus_product(:)%collimator%colli_poly(:)%colliunit(:)%nodes (rzphi2D) |
| r | fusiondiag%fus_product(:)%collimator%colli_poly(:)%colliunit(:)%nodes%r (matflt_type) |
| z | fusiondiag%fus_product(:)%collimator%colli_poly(:)%colliunit(:)%nodes%z (matflt_type) |
| phi | fusiondiag%fus_product(:)%collimator%colli_poly(:)%colliunit(:)%nodes%phi (matflt_type) |
| colli_3d | fusiondiag%fus_product(:)%collimator%colli_3d(:) (fusiondiag_colli_3d) |
| name | fusiondiag%fus_product(:)%collimator%colli_3d(:)%name (string) |
| voxels | fusiondiag%fus_product(:)%collimator%colli_3d(:)%voxels(:) (fusiondiag_voxels) |
| centre | fusiondiag%fus_product(:)%collimator%colli_3d(:)%voxels(:)%centre (rzphi0D) |
| r | fusiondiag%fus_product(:)%collimator%colli_3d(:)%voxels(:)%centre%r (float) |
| z | fusiondiag%fus_product(:)%collimator%colli_3d(:)%voxels(:)%centre%z (float) |
| phi | fusiondiag%fus_product(:)%collimator%colli_3d(:)%voxels(:)%centre%phi (float) |
| direction | fusiondiag%fus_product(:)%collimator%colli_3d(:)%voxels(:)%direction (rzphi0D) |
| r | fusiondiag%fus_product(:)%collimator%colli_3d(:)%voxels(:)%direction%r (float) |
| z | fusiondiag%fus_product(:)%collimator%colli_3d(:)%voxels(:)%direction%z (float) |
| phi | fusiondiag%fus_product(:)%collimator%colli_3d(:)%voxels(:)%direction%phi (float) |
| volume | fusiondiag%fus_product(:)%collimator%colli_3d(:)%voxels(:)%volume (float) |
| solid_angle | fusiondiag%fus_product(:)%collimator%colli_3d(:)%voxels(:)%solid_angle (float) |
| counts | fusiondiag%fus_product(:)%counts (fusiondiag_counts) |
| units | fusiondiag%fus_product(:)%counts%units (string) |
| ct_chords | fusiondiag%fus_product(:)%counts%ct_chords(:) (fusiondiag_ct_chords) |
| name | fusiondiag%fus_product(:)%counts%ct_chords(:)%name (vecstring_type) |
| energy | fusiondiag%fus_product(:)%counts%ct_chords(:)%energy (exp0D) |
| value | fusiondiag%fus_product(:)%counts%ct_chords(:)%energy%value (float) |
| abserror | fusiondiag%fus_product(:)%counts%ct_chords(:)%energy%abserror (float) |
| relerror | fusiondiag%fus_product(:)%counts%ct_chords(:)%energy%relerror (float) |
| measure | fusiondiag%fus_product(:)%counts%ct_chords(:)%measure (exp1D) |
| value | fusiondiag%fus_product(:)%counts%ct_chords(:)%measure%value (vecflt_type) |
| abserror | fusiondiag%fus_product(:)%counts%ct_chords(:)%measure%abserror (vecflt_type) |
| relerror | fusiondiag%fus_product(:)%counts%ct_chords(:)%measure%relerror (vecflt_type) |
| ct_energy | fusiondiag%fus_product(:)%counts%ct_energy(:) (fusiondiag_ct_energy) |
| energy | fusiondiag%fus_product(:)%counts%ct_energy(:)%energy (exp1D) |
| value | fusiondiag%fus_product(:)%counts%ct_energy(:)%energy%value (vecflt_type) |
| abserror | fusiondiag%fus_product(:)%counts%ct_energy(:)%energy%abserror (vecflt_type) |
| relerror | fusiondiag%fus_product(:)%counts%ct_energy(:)%energy%relerror (vecflt_type) |
| measure | fusiondiag%fus_product(:)%counts%ct_energy(:)%measure (exp1D) |
| value | fusiondiag%fus_product(:)%counts%ct_energy(:)%measure%value (vecflt_type) |
| abserror | fusiondiag%fus_product(:)%counts%ct_energy(:)%measure%abserror (vecflt_type) |
| relerror | fusiondiag%fus_product(:)%counts%ct_energy(:)%measure%relerror (vecflt_type) |
| detect_ct | fusiondiag%fus_product(:)%counts%detect_ct(:) (fusiondiag_detect_ct_energy) |
| energy | fusiondiag%fus_product(:)%counts%detect_ct(:)%energy (exp1D) |
| value | fusiondiag%fus_product(:)%counts%detect_ct(:)%energy%value (vecflt_type) |
| abserror | fusiondiag%fus_product(:)%counts%detect_ct(:)%energy%abserror (vecflt_type) |
| relerror | fusiondiag%fus_product(:)%counts%detect_ct(:)%energy%relerror (vecflt_type) |
| measure | fusiondiag%fus_product(:)%counts%detect_ct(:)%measure (exp1D) |
| value | fusiondiag%fus_product(:)%counts%detect_ct(:)%measure%value (vecflt_type) |
| abserror | fusiondiag%fus_product(:)%counts%detect_ct(:)%measure%abserror (vecflt_type) |
| relerror | fusiondiag%fus_product(:)%counts%detect_ct(:)%measure%relerror (vecflt_type) |
| diag_func | fusiondiag%fus_product(:)%counts%detect_ct(:)%diag_func (diag_func) |
| description | fusiondiag%fus_product(:)%counts%detect_ct(:)%diag_func%description (string) |
| transf_mat | fusiondiag%fus_product(:)%counts%detect_ct(:)%diag_func%transf_mat (matflt_type) |
| emissivity1d | fusiondiag%fus_product(:)%emissivity1d (fusiondiag_emissivity1d) |
| units | fusiondiag%fus_product(:)%emissivity1d%units (string) |
| r | fusiondiag%fus_product(:)%emissivity1d%r (exp1D) |
| value | fusiondiag%fus_product(:)%emissivity1d%r%value (vecflt_type) |
| abserror | fusiondiag%fus_product(:)%emissivity1d%r%abserror (vecflt_type) |
| relerror | fusiondiag%fus_product(:)%emissivity1d%r%relerror (vecflt_type) |
| z | fusiondiag%fus_product(:)%emissivity1d%z (exp1D) |
| value | fusiondiag%fus_product(:)%emissivity1d%z%value (vecflt_type) |
| abserror | fusiondiag%fus_product(:)%emissivity1d%z%abserror (vecflt_type) |
| relerror | fusiondiag%fus_product(:)%emissivity1d%z%relerror (vecflt_type) |
| spec1d | fusiondiag%fus_product(:)%emissivity1d%spec1d(:) (fusiondiag_spec1d) |
| energy | fusiondiag%fus_product(:)%emissivity1d%spec1d(:)%energy (exp0D) |
| value | fusiondiag%fus_product(:)%emissivity1d%spec1d(:)%energy%value (float) |
| abserror | fusiondiag%fus_product(:)%emissivity1d%spec1d(:)%energy%abserror (float) |
| relerror | fusiondiag%fus_product(:)%emissivity1d%spec1d(:)%energy%relerror (float) |
| measure | fusiondiag%fus_product(:)%emissivity1d%spec1d(:)%measure (exp1D) |
| value | fusiondiag%fus_product(:)%emissivity1d%spec1d(:)%measure%value (vecflt_type) |
| abserror | fusiondiag%fus_product(:)%emissivity1d%spec1d(:)%measure%abserror (vecflt_type) |
| relerror | fusiondiag%fus_product(:)%emissivity1d%spec1d(:)%measure%relerror (vecflt_type) |
| emissivity2d | fusiondiag%fus_product(:)%emissivity2d (fusiondiag_emissivity2d) |
| units | fusiondiag%fus_product(:)%emissivity2d%units (string) |
| r | fusiondiag%fus_product(:)%emissivity2d%r (exp2D) |
| value | fusiondiag%fus_product(:)%emissivity2d%r%value (matflt_type) |
| abserror | fusiondiag%fus_product(:)%emissivity2d%r%abserror (matflt_type) |
| relerror | fusiondiag%fus_product(:)%emissivity2d%r%relerror (matflt_type) |
| z | fusiondiag%fus_product(:)%emissivity2d%z (exp2D) |
| value | fusiondiag%fus_product(:)%emissivity2d%z%value (matflt_type) |
| abserror | fusiondiag%fus_product(:)%emissivity2d%z%abserror (matflt_type) |
| relerror | fusiondiag%fus_product(:)%emissivity2d%z%relerror (matflt_type) |
| spec2d | fusiondiag%fus_product(:)%emissivity2d%spec2d(:) (fusiondiag_spec2d) |
| energy | fusiondiag%fus_product(:)%emissivity2d%spec2d(:)%energy (exp0D) |
| value | fusiondiag%fus_product(:)%emissivity2d%spec2d(:)%energy%value (float) |
| abserror | fusiondiag%fus_product(:)%emissivity2d%spec2d(:)%energy%abserror (float) |
| relerror | fusiondiag%fus_product(:)%emissivity2d%spec2d(:)%energy%relerror (float) |
| measure | fusiondiag%fus_product(:)%emissivity2d%spec2d(:)%measure (exp2D) |
| value | fusiondiag%fus_product(:)%emissivity2d%spec2d(:)%measure%value (matflt_type) |
| abserror | fusiondiag%fus_product(:)%emissivity2d%spec2d(:)%measure%abserror (matflt_type) |
| relerror | fusiondiag%fus_product(:)%emissivity2d%spec2d(:)%measure%relerror (matflt_type) |
| codeparam | fusiondiag%fus_product(:)%codeparam (codeparam) |
| codename | fusiondiag%fus_product(:)%codeparam%codename (string) |
| codeversion | fusiondiag%fus_product(:)%codeparam%codeversion (string) |
| parameters | fusiondiag%fus_product(:)%codeparam%parameters (string) |
| output_diag | fusiondiag%fus_product(:)%codeparam%output_diag (string) |
| output_flag | fusiondiag%fus_product(:)%codeparam%output_flag (integer) |
| codeparam | fusiondiag%codeparam (codeparam) |
| codename | fusiondiag%codeparam%codename (string) |
| codeversion | fusiondiag%codeparam%codeversion (string) |
| parameters | fusiondiag%codeparam%parameters (string) |
| output_diag | fusiondiag%codeparam%output_diag (string) |
| output_flag | fusiondiag%codeparam%output_flag (integer) |
| time | fusiondiag%time (float) |
| datainfo | halphadiag%datainfo (datainfo) |
| dataprovider | halphadiag%datainfo%dataprovider (string) |
| putdate | halphadiag%datainfo%putdate (string) |
| source | halphadiag%datainfo%source (string) |
| comment | halphadiag%datainfo%comment (string) |
| cocos | halphadiag%datainfo%cocos (integer) |
| id | halphadiag%datainfo%id (integer) |
| isref | halphadiag%datainfo%isref (integer) |
| whatref | halphadiag%datainfo%whatref (whatref) |
| user | halphadiag%datainfo%whatref%user (string) |
| machine | halphadiag%datainfo%whatref%machine (string) |
| shot | halphadiag%datainfo%whatref%shot (integer) |
| run | halphadiag%datainfo%whatref%run (integer) |
| occurrence | halphadiag%datainfo%whatref%occurrence (integer) |
| putinfo | halphadiag%datainfo%putinfo (putinfo) |
| putmethod | halphadiag%datainfo%putinfo%putmethod (string) |
| putaccess | halphadiag%datainfo%putinfo%putaccess (string) |
| putlocation | halphadiag%datainfo%putinfo%putlocation (string) |
| rights | halphadiag%datainfo%putinfo%rights (string) |
| setup | halphadiag%setup (halpha_setup) |
| name | halphadiag%setup%name (vecstring_type) |
| pivot_point | halphadiag%setup%pivot_point (rzphi1D) |
| r | halphadiag%setup%pivot_point%r (vecflt_type) |
| z | halphadiag%setup%pivot_point%z (vecflt_type) |
| phi | halphadiag%setup%pivot_point%phi (vecflt_type) |
| horchordang | halphadiag%setup%horchordang (vecflt_type) |
| verchordang | halphadiag%setup%verchordang (vecflt_type) |
| second_point | halphadiag%setup%second_point (rzphi1D) |
| r | halphadiag%setup%second_point%r (vecflt_type) |
| z | halphadiag%setup%second_point%z (vecflt_type) |
| phi | halphadiag%setup%second_point%phi (vecflt_type) |
| solidangle | halphadiag%setup%solidangle (exp1D) |
| value | halphadiag%setup%solidangle%value (vecflt_type) |
| abserror | halphadiag%setup%solidangle%abserror (vecflt_type) |
| relerror | halphadiag%setup%solidangle%relerror (vecflt_type) |
| intensity | halphadiag%intensity (exp1D) |
| value | halphadiag%intensity%value (vecflt_type) |
| abserror | halphadiag%intensity%abserror (vecflt_type) |
| relerror | halphadiag%intensity%relerror (vecflt_type) |
| codeparam | halphadiag%codeparam (codeparam) |
| codename | halphadiag%codeparam%codename (string) |
| codeversion | halphadiag%codeparam%codeversion (string) |
| parameters | halphadiag%codeparam%parameters (string) |
| output_diag | halphadiag%codeparam%output_diag (string) |
| output_flag | halphadiag%codeparam%output_flag (integer) |
| time | halphadiag%time (float) |
| datainfo | heat_sources%datainfo (datainfo) |
| dataprovider | heat_sources%datainfo%dataprovider (string) |
| putdate | heat_sources%datainfo%putdate (string) |
| source | heat_sources%datainfo%source (string) |
| comment | heat_sources%datainfo%comment (string) |
| cocos | heat_sources%datainfo%cocos (integer) |
| id | heat_sources%datainfo%id (integer) |
| isref | heat_sources%datainfo%isref (integer) |
| whatref | heat_sources%datainfo%whatref (whatref) |
| user | heat_sources%datainfo%whatref%user (string) |
| machine | heat_sources%datainfo%whatref%machine (string) |
| shot | heat_sources%datainfo%whatref%shot (integer) |
| run | heat_sources%datainfo%whatref%run (integer) |
| occurrence | heat_sources%datainfo%whatref%occurrence (integer) |
| putinfo | heat_sources%datainfo%putinfo (putinfo) |
| putmethod | heat_sources%datainfo%putinfo%putmethod (string) |
| putaccess | heat_sources%datainfo%putinfo%putaccess (string) |
| putlocation | heat_sources%datainfo%putinfo%putlocation (string) |
| rights | heat_sources%datainfo%putinfo%rights (string) |
| sources | heat_sources%sources(:) (calorimetry_heat_source) |
| name | heat_sources%sources(:)%name (string) |
| temp_in | heat_sources%sources(:)%temp_in (float) |
| temp_out | heat_sources%sources(:)%temp_out (float) |
| press_in | heat_sources%sources(:)%press_in (float) |
| press_out | heat_sources%sources(:)%press_out (float) |
| flow | heat_sources%sources(:)%flow (float) |
| power | heat_sources%sources(:)%power (float) |
| sinks | heat_sources%sinks(:) (calorimetry_heat_source) |
| name | heat_sources%sinks(:)%name (string) |
| temp_in | heat_sources%sinks(:)%temp_in (float) |
| temp_out | heat_sources%sinks(:)%temp_out (float) |
| press_in | heat_sources%sinks(:)%press_in (float) |
| press_out | heat_sources%sinks(:)%press_out (float) |
| flow | heat_sources%sinks(:)%flow (float) |
| power | heat_sources%sinks(:)%power (float) |
| codeparam | heat_sources%codeparam (codeparam) |
| codename | heat_sources%codeparam%codename (string) |
| codeversion | heat_sources%codeparam%codeversion (string) |
| parameters | heat_sources%codeparam%parameters (string) |
| output_diag | heat_sources%codeparam%output_diag (string) |
| output_flag | heat_sources%codeparam%output_flag (integer) |
| time | heat_sources%time (float) |
| datainfo | lineintegraldiag%datainfo (datainfo) |
| dataprovider | lineintegraldiag%datainfo%dataprovider (string) |
| putdate | lineintegraldiag%datainfo%putdate (string) |
| source | lineintegraldiag%datainfo%source (string) |
| comment | lineintegraldiag%datainfo%comment (string) |
| cocos | lineintegraldiag%datainfo%cocos (integer) |
| id | lineintegraldiag%datainfo%id (integer) |
| isref | lineintegraldiag%datainfo%isref (integer) |
| whatref | lineintegraldiag%datainfo%whatref (whatref) |
| user | lineintegraldiag%datainfo%whatref%user (string) |
| machine | lineintegraldiag%datainfo%whatref%machine (string) |
| shot | lineintegraldiag%datainfo%whatref%shot (integer) |
| run | lineintegraldiag%datainfo%whatref%run (integer) |
| occurrence | lineintegraldiag%datainfo%whatref%occurrence (integer) |
| putinfo | lineintegraldiag%datainfo%putinfo (putinfo) |
| putmethod | lineintegraldiag%datainfo%putinfo%putmethod (string) |
| putaccess | lineintegraldiag%datainfo%putinfo%putaccess (string) |
| putlocation | lineintegraldiag%datainfo%putinfo%putlocation (string) |
| rights | lineintegraldiag%datainfo%putinfo%rights (string) |
| expression | lineintegraldiag%expression (string) |
| setup_line | lineintegraldiag%setup_line (setup_line) |
| pivot_point | lineintegraldiag%setup_line%pivot_point (rzphi1D) |
| r | lineintegraldiag%setup_line%pivot_point%r (vecflt_type) |
| z | lineintegraldiag%setup_line%pivot_point%z (vecflt_type) |
| phi | lineintegraldiag%setup_line%pivot_point%phi (vecflt_type) |
| horchordang1 | lineintegraldiag%setup_line%horchordang1 (vecflt_type) |
| verchordang1 | lineintegraldiag%setup_line%verchordang1 (vecflt_type) |
| width | lineintegraldiag%setup_line%width (vecflt_type) |
| second_point | lineintegraldiag%setup_line%second_point (rzphi1D) |
| r | lineintegraldiag%setup_line%second_point%r (vecflt_type) |
| z | lineintegraldiag%setup_line%second_point%z (vecflt_type) |
| phi | lineintegraldiag%setup_line%second_point%phi (vecflt_type) |
| horchordang2 | lineintegraldiag%setup_line%horchordang2 (vecflt_type) |
| verchordang2 | lineintegraldiag%setup_line%verchordang2 (vecflt_type) |
| third_point | lineintegraldiag%setup_line%third_point (rzphi1D) |
| r | lineintegraldiag%setup_line%third_point%r (vecflt_type) |
| z | lineintegraldiag%setup_line%third_point%z (vecflt_type) |
| phi | lineintegraldiag%setup_line%third_point%phi (vecflt_type) |
| nchordpoints | lineintegraldiag%setup_line%nchordpoints (integer) |
| measure | lineintegraldiag%measure (exp1D) |
| value | lineintegraldiag%measure%value (vecflt_type) |
| abserror | lineintegraldiag%measure%abserror (vecflt_type) |
| relerror | lineintegraldiag%measure%relerror (vecflt_type) |
| codeparam | lineintegraldiag%codeparam (codeparam) |
| codename | lineintegraldiag%codeparam%codename (string) |
| codeversion | lineintegraldiag%codeparam%codeversion (string) |
| parameters | lineintegraldiag%codeparam%parameters (string) |
| output_diag | lineintegraldiag%codeparam%output_diag (string) |
| output_flag | lineintegraldiag%codeparam%output_flag (integer) |
| time | lineintegraldiag%time (float) |
| datainfo | ironmodel%datainfo (datainfo) |
| dataprovider | ironmodel%datainfo%dataprovider (string) |
| putdate | ironmodel%datainfo%putdate (string) |
| source | ironmodel%datainfo%source (string) |
| comment | ironmodel%datainfo%comment (string) |
| cocos | ironmodel%datainfo%cocos (integer) |
| id | ironmodel%datainfo%id (integer) |
| isref | ironmodel%datainfo%isref (integer) |
| whatref | ironmodel%datainfo%whatref (whatref) |
| user | ironmodel%datainfo%whatref%user (string) |
| machine | ironmodel%datainfo%whatref%machine (string) |
| shot | ironmodel%datainfo%whatref%shot (integer) |
| run | ironmodel%datainfo%whatref%run (integer) |
| occurrence | ironmodel%datainfo%whatref%occurrence (integer) |
| putinfo | ironmodel%datainfo%putinfo (putinfo) |
| putmethod | ironmodel%datainfo%putinfo%putmethod (string) |
| putaccess | ironmodel%datainfo%putinfo%putaccess (string) |
| putlocation | ironmodel%datainfo%putinfo%putlocation (string) |
| rights | ironmodel%datainfo%putinfo%rights (string) |
| desc_iron | ironmodel%desc_iron (desc_iron) |
| name | ironmodel%desc_iron%name (vecstring_type) |
| id | ironmodel%desc_iron%id (vecstring_type) |
| permeability | ironmodel%desc_iron%permeability (permeability) |
| b | ironmodel%desc_iron%permeability%b (matflt_type) |
| mur | ironmodel%desc_iron%permeability%mur (matflt_type) |
| geom_iron | ironmodel%desc_iron%geom_iron (geom_iron) |
| npoints | ironmodel%desc_iron%geom_iron%npoints (vecint_type) |
| rzcoordinate | ironmodel%desc_iron%geom_iron%rzcoordinate (rz2D) |
| r | ironmodel%desc_iron%geom_iron%rzcoordinate%r (matflt_type) |
| z | ironmodel%desc_iron%geom_iron%rzcoordinate%z (matflt_type) |
| magnetise | ironmodel%magnetise (magnetise) |
| mr | ironmodel%magnetise%mr (exp1D) |
| value | ironmodel%magnetise%mr%value (vecflt_type) |
| abserror | ironmodel%magnetise%mr%abserror (vecflt_type) |
| relerror | ironmodel%magnetise%mr%relerror (vecflt_type) |
| mz | ironmodel%magnetise%mz (exp1D) |
| value | ironmodel%magnetise%mz%value (vecflt_type) |
| abserror | ironmodel%magnetise%mz%abserror (vecflt_type) |
| relerror | ironmodel%magnetise%mz%relerror (vecflt_type) |
| codeparam | ironmodel%codeparam (codeparam) |
| codename | ironmodel%codeparam%codename (string) |
| codeversion | ironmodel%codeparam%codeversion (string) |
| parameters | ironmodel%codeparam%parameters (string) |
| output_diag | ironmodel%codeparam%output_diag (string) |
| output_flag | ironmodel%codeparam%output_flag (integer) |
| time | ironmodel%time (float) |
| datainfo | langmuirdiag%datainfo (datainfo) |
| dataprovider | langmuirdiag%datainfo%dataprovider (string) |
| putdate | langmuirdiag%datainfo%putdate (string) |
| source | langmuirdiag%datainfo%source (string) |
| comment | langmuirdiag%datainfo%comment (string) |
| cocos | langmuirdiag%datainfo%cocos (integer) |
| id | langmuirdiag%datainfo%id (integer) |
| isref | langmuirdiag%datainfo%isref (integer) |
| whatref | langmuirdiag%datainfo%whatref (whatref) |
| user | langmuirdiag%datainfo%whatref%user (string) |
| machine | langmuirdiag%datainfo%whatref%machine (string) |
| shot | langmuirdiag%datainfo%whatref%shot (integer) |
| run | langmuirdiag%datainfo%whatref%run (integer) |
| occurrence | langmuirdiag%datainfo%whatref%occurrence (integer) |
| putinfo | langmuirdiag%datainfo%putinfo (putinfo) |
| putmethod | langmuirdiag%datainfo%putinfo%putmethod (string) |
| putaccess | langmuirdiag%datainfo%putinfo%putaccess (string) |
| putlocation | langmuirdiag%datainfo%putinfo%putlocation (string) |
| rights | langmuirdiag%datainfo%putinfo%rights (string) |
| potential | langmuirdiag%potential (lang_measure) |
| name | langmuirdiag%potential%name (vecstring_type) |
| direction | langmuirdiag%potential%direction (vecstring_type) |
| area | langmuirdiag%potential%area (exp1D) |
| value | langmuirdiag%potential%area%value (vecflt_type) |
| abserror | langmuirdiag%potential%area%abserror (vecflt_type) |
| relerror | langmuirdiag%potential%area%relerror (vecflt_type) |
| position | langmuirdiag%potential%position (rzphi1Dexp) |
| r | langmuirdiag%potential%position%r (exp1D) |
| value | langmuirdiag%potential%position%r%value (vecflt_type) |
| abserror | langmuirdiag%potential%position%r%abserror (vecflt_type) |
| relerror | langmuirdiag%potential%position%r%relerror (vecflt_type) |
| z | langmuirdiag%potential%position%z (exp1D) |
| value | langmuirdiag%potential%position%z%value (vecflt_type) |
| abserror | langmuirdiag%potential%position%z%abserror (vecflt_type) |
| relerror | langmuirdiag%potential%position%z%relerror (vecflt_type) |
| phi | langmuirdiag%potential%position%phi (exp1D) |
| value | langmuirdiag%potential%position%phi%value (vecflt_type) |
| abserror | langmuirdiag%potential%position%phi%abserror (vecflt_type) |
| relerror | langmuirdiag%potential%position%phi%relerror (vecflt_type) |
| measure | langmuirdiag%potential%measure (exp1D) |
| value | langmuirdiag%potential%measure%value (vecflt_type) |
| abserror | langmuirdiag%potential%measure%abserror (vecflt_type) |
| relerror | langmuirdiag%potential%measure%relerror (vecflt_type) |
| bias | langmuirdiag%bias (lang_measure) |
| name | langmuirdiag%bias%name (vecstring_type) |
| direction | langmuirdiag%bias%direction (vecstring_type) |
| area | langmuirdiag%bias%area (exp1D) |
| value | langmuirdiag%bias%area%value (vecflt_type) |
| abserror | langmuirdiag%bias%area%abserror (vecflt_type) |
| relerror | langmuirdiag%bias%area%relerror (vecflt_type) |
| position | langmuirdiag%bias%position (rzphi1Dexp) |
| r | langmuirdiag%bias%position%r (exp1D) |
| value | langmuirdiag%bias%position%r%value (vecflt_type) |
| abserror | langmuirdiag%bias%position%r%abserror (vecflt_type) |
| relerror | langmuirdiag%bias%position%r%relerror (vecflt_type) |
| z | langmuirdiag%bias%position%z (exp1D) |
| value | langmuirdiag%bias%position%z%value (vecflt_type) |
| abserror | langmuirdiag%bias%position%z%abserror (vecflt_type) |
| relerror | langmuirdiag%bias%position%z%relerror (vecflt_type) |
| phi | langmuirdiag%bias%position%phi (exp1D) |
| value | langmuirdiag%bias%position%phi%value (vecflt_type) |
| abserror | langmuirdiag%bias%position%phi%abserror (vecflt_type) |
| relerror | langmuirdiag%bias%position%phi%relerror (vecflt_type) |
| measure | langmuirdiag%bias%measure (exp1D) |
| value | langmuirdiag%bias%measure%value (vecflt_type) |
| abserror | langmuirdiag%bias%measure%abserror (vecflt_type) |
| relerror | langmuirdiag%bias%measure%relerror (vecflt_type) |
| jsat | langmuirdiag%jsat (lang_measure) |
| name | langmuirdiag%jsat%name (vecstring_type) |
| direction | langmuirdiag%jsat%direction (vecstring_type) |
| area | langmuirdiag%jsat%area (exp1D) |
| value | langmuirdiag%jsat%area%value (vecflt_type) |
| abserror | langmuirdiag%jsat%area%abserror (vecflt_type) |
| relerror | langmuirdiag%jsat%area%relerror (vecflt_type) |
| position | langmuirdiag%jsat%position (rzphi1Dexp) |
| r | langmuirdiag%jsat%position%r (exp1D) |
| value | langmuirdiag%jsat%position%r%value (vecflt_type) |
| abserror | langmuirdiag%jsat%position%r%abserror (vecflt_type) |
| relerror | langmuirdiag%jsat%position%r%relerror (vecflt_type) |
| z | langmuirdiag%jsat%position%z (exp1D) |
| value | langmuirdiag%jsat%position%z%value (vecflt_type) |
| abserror | langmuirdiag%jsat%position%z%abserror (vecflt_type) |
| relerror | langmuirdiag%jsat%position%z%relerror (vecflt_type) |
| phi | langmuirdiag%jsat%position%phi (exp1D) |
| value | langmuirdiag%jsat%position%phi%value (vecflt_type) |
| abserror | langmuirdiag%jsat%position%phi%abserror (vecflt_type) |
| relerror | langmuirdiag%jsat%position%phi%relerror (vecflt_type) |
| measure | langmuirdiag%jsat%measure (exp1D) |
| value | langmuirdiag%jsat%measure%value (vecflt_type) |
| abserror | langmuirdiag%jsat%measure%abserror (vecflt_type) |
| relerror | langmuirdiag%jsat%measure%relerror (vecflt_type) |
| ne | langmuirdiag%ne (lang_derived) |
| source | langmuirdiag%ne%source (vecstring_type) |
| position | langmuirdiag%ne%position (rzphi1Dexp) |
| r | langmuirdiag%ne%position%r (exp1D) |
| value | langmuirdiag%ne%position%r%value (vecflt_type) |
| abserror | langmuirdiag%ne%position%r%abserror (vecflt_type) |
| relerror | langmuirdiag%ne%position%r%relerror (vecflt_type) |
| z | langmuirdiag%ne%position%z (exp1D) |
| value | langmuirdiag%ne%position%z%value (vecflt_type) |
| abserror | langmuirdiag%ne%position%z%abserror (vecflt_type) |
| relerror | langmuirdiag%ne%position%z%relerror (vecflt_type) |
| phi | langmuirdiag%ne%position%phi (exp1D) |
| value | langmuirdiag%ne%position%phi%value (vecflt_type) |
| abserror | langmuirdiag%ne%position%phi%abserror (vecflt_type) |
| relerror | langmuirdiag%ne%position%phi%relerror (vecflt_type) |
| measure | langmuirdiag%ne%measure (exp1D) |
| value | langmuirdiag%ne%measure%value (vecflt_type) |
| abserror | langmuirdiag%ne%measure%abserror (vecflt_type) |
| relerror | langmuirdiag%ne%measure%relerror (vecflt_type) |
| te | langmuirdiag%te (lang_derived) |
| source | langmuirdiag%te%source (vecstring_type) |
| position | langmuirdiag%te%position (rzphi1Dexp) |
| r | langmuirdiag%te%position%r (exp1D) |
| value | langmuirdiag%te%position%r%value (vecflt_type) |
| abserror | langmuirdiag%te%position%r%abserror (vecflt_type) |
| relerror | langmuirdiag%te%position%r%relerror (vecflt_type) |
| z | langmuirdiag%te%position%z (exp1D) |
| value | langmuirdiag%te%position%z%value (vecflt_type) |
| abserror | langmuirdiag%te%position%z%abserror (vecflt_type) |
| relerror | langmuirdiag%te%position%z%relerror (vecflt_type) |
| phi | langmuirdiag%te%position%phi (exp1D) |
| value | langmuirdiag%te%position%phi%value (vecflt_type) |
| abserror | langmuirdiag%te%position%phi%abserror (vecflt_type) |
| relerror | langmuirdiag%te%position%phi%relerror (vecflt_type) |
| measure | langmuirdiag%te%measure (exp1D) |
| value | langmuirdiag%te%measure%value (vecflt_type) |
| abserror | langmuirdiag%te%measure%abserror (vecflt_type) |
| relerror | langmuirdiag%te%measure%relerror (vecflt_type) |
| machpar | langmuirdiag%machpar (lang_derived) |
| source | langmuirdiag%machpar%source (vecstring_type) |
| position | langmuirdiag%machpar%position (rzphi1Dexp) |
| r | langmuirdiag%machpar%position%r (exp1D) |
| value | langmuirdiag%machpar%position%r%value (vecflt_type) |
| abserror | langmuirdiag%machpar%position%r%abserror (vecflt_type) |
| relerror | langmuirdiag%machpar%position%r%relerror (vecflt_type) |
| z | langmuirdiag%machpar%position%z (exp1D) |
| value | langmuirdiag%machpar%position%z%value (vecflt_type) |
| abserror | langmuirdiag%machpar%position%z%abserror (vecflt_type) |
| relerror | langmuirdiag%machpar%position%z%relerror (vecflt_type) |
| phi | langmuirdiag%machpar%position%phi (exp1D) |
| value | langmuirdiag%machpar%position%phi%value (vecflt_type) |
| abserror | langmuirdiag%machpar%position%phi%abserror (vecflt_type) |
| relerror | langmuirdiag%machpar%position%phi%relerror (vecflt_type) |
| measure | langmuirdiag%machpar%measure (exp1D) |
| value | langmuirdiag%machpar%measure%value (vecflt_type) |
| abserror | langmuirdiag%machpar%measure%abserror (vecflt_type) |
| relerror | langmuirdiag%machpar%measure%relerror (vecflt_type) |
| codeparam | langmuirdiag%codeparam (codeparam) |
| codename | langmuirdiag%codeparam%codename (string) |
| codeversion | langmuirdiag%codeparam%codeversion (string) |
| parameters | langmuirdiag%codeparam%parameters (string) |
| output_diag | langmuirdiag%codeparam%output_diag (string) |
| output_flag | langmuirdiag%codeparam%output_flag (integer) |
| time | langmuirdiag%time (float) |
| datainfo | launchs%datainfo (datainfo) |
| dataprovider | launchs%datainfo%dataprovider (string) |
| putdate | launchs%datainfo%putdate (string) |
| source | launchs%datainfo%source (string) |
| comment | launchs%datainfo%comment (string) |
| cocos | launchs%datainfo%cocos (integer) |
| id | launchs%datainfo%id (integer) |
| isref | launchs%datainfo%isref (integer) |
| whatref | launchs%datainfo%whatref (whatref) |
| user | launchs%datainfo%whatref%user (string) |
| machine | launchs%datainfo%whatref%machine (string) |
| shot | launchs%datainfo%whatref%shot (integer) |
| run | launchs%datainfo%whatref%run (integer) |
| occurrence | launchs%datainfo%whatref%occurrence (integer) |
| putinfo | launchs%datainfo%putinfo (putinfo) |
| putmethod | launchs%datainfo%putinfo%putmethod (string) |
| putaccess | launchs%datainfo%putinfo%putaccess (string) |
| putlocation | launchs%datainfo%putinfo%putlocation (string) |
| rights | launchs%datainfo%putinfo%rights (string) |
| name | launchs%name (vecstring_type) |
| type | launchs%type (vecstring_type) |
| frequency | launchs%frequency (vecflt_type) |
| mode | launchs%mode (vecint_type) |
| position | launchs%position (rzphi1D) |
| r | launchs%position%r (vecflt_type) |
| z | launchs%position%z (vecflt_type) |
| phi | launchs%position%phi (vecflt_type) |
| spectrum | launchs%spectrum (spectrum) |
| phi_theta | launchs%spectrum%phi_theta (launchs_phi_theta) |
| nn_phi | launchs%spectrum%phi_theta%nn_phi (vecint_type) |
| nn_theta | launchs%spectrum%phi_theta%nn_theta (vecint_type) |
| n_phi | launchs%spectrum%phi_theta%n_phi (matflt_type) |
| n_theta | launchs%spectrum%phi_theta%n_theta (matflt_type) |
| power | launchs%spectrum%phi_theta%power (array3dflt_type) |
| parallel | launchs%spectrum%parallel (launchs_parallel) |
| nn_par | launchs%spectrum%parallel%nn_par (vecint_type) |
| n_par | launchs%spectrum%parallel%n_par (matflt_type) |
| power | launchs%spectrum%parallel%power (vecflt_type) |
| beam | launchs%beam (launchs_rfbeam) |
| spot | launchs%beam%spot (launchs_rfbeam_spot) |
| waist | launchs%beam%spot%waist (matflt_type) |
| angle | launchs%beam%spot%angle (vecflt_type) |
| phaseellipse | launchs%beam%phaseellipse (launchs_rfbeam_phaseellipse) |
| invcurvrad | launchs%beam%phaseellipse%invcurvrad (matflt_type) |
| angle | launchs%beam%phaseellipse%angle (vecflt_type) |
| codeparam | launchs%codeparam (codeparam) |
| codename | launchs%codeparam%codename (string) |
| codeversion | launchs%codeparam%codeversion (string) |
| parameters | launchs%codeparam%parameters (string) |
| output_diag | launchs%codeparam%output_diag (string) |
| output_flag | launchs%codeparam%output_flag (integer) |
| time | launchs%time (float) |
| datainfo | lithiumdiag%datainfo (datainfo) |
| dataprovider | lithiumdiag%datainfo%dataprovider (string) |
| putdate | lithiumdiag%datainfo%putdate (string) |
| source | lithiumdiag%datainfo%source (string) |
| comment | lithiumdiag%datainfo%comment (string) |
| cocos | lithiumdiag%datainfo%cocos (integer) |
| id | lithiumdiag%datainfo%id (integer) |
| isref | lithiumdiag%datainfo%isref (integer) |
| whatref | lithiumdiag%datainfo%whatref (whatref) |
| user | lithiumdiag%datainfo%whatref%user (string) |
| machine | lithiumdiag%datainfo%whatref%machine (string) |
| shot | lithiumdiag%datainfo%whatref%shot (integer) |
| run | lithiumdiag%datainfo%whatref%run (integer) |
| occurrence | lithiumdiag%datainfo%whatref%occurrence (integer) |
| putinfo | lithiumdiag%datainfo%putinfo (putinfo) |
| putmethod | lithiumdiag%datainfo%putinfo%putmethod (string) |
| putaccess | lithiumdiag%datainfo%putinfo%putaccess (string) |
| putlocation | lithiumdiag%datainfo%putinfo%putlocation (string) |
| rights | lithiumdiag%datainfo%putinfo%rights (string) |
| setup | lithiumdiag%setup (lithsetup) |
| position | lithiumdiag%setup%position (rzphi1D) |
| r | lithiumdiag%setup%position%r (vecflt_type) |
| z | lithiumdiag%setup%position%z (vecflt_type) |
| phi | lithiumdiag%setup%position%phi (vecflt_type) |
| measure | lithiumdiag%measure (lithmeasure) |
| ne | lithiumdiag%measure%ne (exp1D) |
| value | lithiumdiag%measure%ne%value (vecflt_type) |
| abserror | lithiumdiag%measure%ne%abserror (vecflt_type) |
| relerror | lithiumdiag%measure%ne%relerror (vecflt_type) |
| codeparam | lithiumdiag%codeparam (codeparam) |
| codename | lithiumdiag%codeparam%codename (string) |
| codeversion | lithiumdiag%codeparam%codeversion (string) |
| parameters | lithiumdiag%codeparam%parameters (string) |
| output_diag | lithiumdiag%codeparam%output_diag (string) |
| output_flag | lithiumdiag%codeparam%output_flag (integer) |
| time | lithiumdiag%time (float) |
| datainfo | magdiag%datainfo (datainfo) |
| dataprovider | magdiag%datainfo%dataprovider (string) |
| putdate | magdiag%datainfo%putdate (string) |
| source | magdiag%datainfo%source (string) |
| comment | magdiag%datainfo%comment (string) |
| cocos | magdiag%datainfo%cocos (integer) |
| id | magdiag%datainfo%id (integer) |
| isref | magdiag%datainfo%isref (integer) |
| whatref | magdiag%datainfo%whatref (whatref) |
| user | magdiag%datainfo%whatref%user (string) |
| machine | magdiag%datainfo%whatref%machine (string) |
| shot | magdiag%datainfo%whatref%shot (integer) |
| run | magdiag%datainfo%whatref%run (integer) |
| occurrence | magdiag%datainfo%whatref%occurrence (integer) |
| putinfo | magdiag%datainfo%putinfo (putinfo) |
| putmethod | magdiag%datainfo%putinfo%putmethod (string) |
| putaccess | magdiag%datainfo%putinfo%putaccess (string) |
| putlocation | magdiag%datainfo%putinfo%putlocation (string) |
| rights | magdiag%datainfo%putinfo%rights (string) |
| ip | magdiag%ip (exp0D) |
| value | magdiag%ip%value (float) |
| abserror | magdiag%ip%abserror (float) |
| relerror | magdiag%ip%relerror (float) |
| diamagflux | magdiag%diamagflux (exp0D) |
| value | magdiag%diamagflux%value (float) |
| abserror | magdiag%diamagflux%abserror (float) |
| relerror | magdiag%diamagflux%relerror (float) |
| diamagener | magdiag%diamagener (exp0D) |
| value | magdiag%diamagener%value (float) |
| abserror | magdiag%diamagener%abserror (float) |
| relerror | magdiag%diamagener%relerror (float) |
| flux_loops | magdiag%flux_loops (flux_loops) |
| setup_floops | magdiag%flux_loops%setup_floops (setup_floops) |
| name | magdiag%flux_loops%setup_floops%name (vecstring_type) |
| id | magdiag%flux_loops%setup_floops%id (vecstring_type) |
| position | magdiag%flux_loops%setup_floops%position (rzphi2D) |
| r | magdiag%flux_loops%setup_floops%position%r (matflt_type) |
| z | magdiag%flux_loops%setup_floops%position%z (matflt_type) |
| phi | magdiag%flux_loops%setup_floops%position%phi (matflt_type) |
| npoints | magdiag%flux_loops%setup_floops%npoints (vecint_type) |
| measure | magdiag%flux_loops%measure (exp1D) |
| value | magdiag%flux_loops%measure%value (vecflt_type) |
| abserror | magdiag%flux_loops%measure%abserror (vecflt_type) |
| relerror | magdiag%flux_loops%measure%relerror (vecflt_type) |
| bpol_probes | magdiag%bpol_probes (bpol_probes) |
| setup_bprobe | magdiag%bpol_probes%setup_bprobe (setup_bprobe) |
| name | magdiag%bpol_probes%setup_bprobe%name (vecstring_type) |
| id | magdiag%bpol_probes%setup_bprobe%id (vecstring_type) |
| position | magdiag%bpol_probes%setup_bprobe%position (rz1D) |
| r | magdiag%bpol_probes%setup_bprobe%position%r (vecflt_type) |
| z | magdiag%bpol_probes%setup_bprobe%position%z (vecflt_type) |
| polangle | magdiag%bpol_probes%setup_bprobe%polangle (vecflt_type) |
| torangle | magdiag%bpol_probes%setup_bprobe%torangle (vecflt_type) |
| area | magdiag%bpol_probes%setup_bprobe%area (vecflt_type) |
| length | magdiag%bpol_probes%setup_bprobe%length (vecflt_type) |
| turns | magdiag%bpol_probes%setup_bprobe%turns (vecint_type) |
| measure | magdiag%bpol_probes%measure (exp1D) |
| value | magdiag%bpol_probes%measure%value (vecflt_type) |
| abserror | magdiag%bpol_probes%measure%abserror (vecflt_type) |
| relerror | magdiag%bpol_probes%measure%relerror (vecflt_type) |
| codeparam | magdiag%codeparam (codeparam) |
| codename | magdiag%codeparam%codename (string) |
| codeversion | magdiag%codeparam%codeversion (string) |
| parameters | magdiag%codeparam%parameters (string) |
| output_diag | magdiag%codeparam%output_diag (string) |
| output_flag | magdiag%codeparam%output_flag (integer) |
| time | magdiag%time (float) |
| datainfo | mhd%datainfo (datainfo) |
| dataprovider | mhd%datainfo%dataprovider (string) |
| putdate | mhd%datainfo%putdate (string) |
| source | mhd%datainfo%source (string) |
| comment | mhd%datainfo%comment (string) |
| cocos | mhd%datainfo%cocos (integer) |
| id | mhd%datainfo%id (integer) |
| isref | mhd%datainfo%isref (integer) |
| whatref | mhd%datainfo%whatref (whatref) |
| user | mhd%datainfo%whatref%user (string) |
| machine | mhd%datainfo%whatref%machine (string) |
| shot | mhd%datainfo%whatref%shot (integer) |
| run | mhd%datainfo%whatref%run (integer) |
| occurrence | mhd%datainfo%whatref%occurrence (integer) |
| putinfo | mhd%datainfo%putinfo (putinfo) |
| putmethod | mhd%datainfo%putinfo%putmethod (string) |
| putaccess | mhd%datainfo%putinfo%putaccess (string) |
| putlocation | mhd%datainfo%putinfo%putlocation (string) |
| rights | mhd%datainfo%putinfo%rights (string) |
| toroid_field | mhd%toroid_field (b0r0) |
| r0 | mhd%toroid_field%r0 (float) |
| b0 | mhd%toroid_field%b0 (float) |
| n | mhd%n(:) (mhd_mode) |
| modenum | mhd%n(:)%modenum (integer) |
| growthrate | mhd%n(:)%growthrate (float) |
| frequency | mhd%n(:)%frequency (float) |
| plasma | mhd%n(:)%plasma (mhd_plasma) |
| psi | mhd%n(:)%plasma%psi (vecflt_type) |
| rho_tor_norm | mhd%n(:)%plasma%rho_tor_norm (vecflt_type) |
| rho_tor | mhd%n(:)%plasma%rho_tor (vecflt_type) |
| m | mhd%n(:)%plasma%m (matflt_type) |
| disp_perp | mhd%n(:)%plasma%disp_perp (matcplx_type) |
| disp_par | mhd%n(:)%plasma%disp_par (matcplx_type) |
| tau_alfven | mhd%n(:)%plasma%tau_alfven (vecflt_type) |
| tau_res | mhd%n(:)%plasma%tau_res (vecflt_type) |
| coord_sys | mhd%n(:)%plasma%coord_sys (coord_sys) |
| grid_type | mhd%n(:)%plasma%coord_sys%grid_type (string) |
| grid | mhd%n(:)%plasma%coord_sys%grid (reggrid) |
| dim1 | mhd%n(:)%plasma%coord_sys%grid%dim1 (vecflt_type) |
| dim2 | mhd%n(:)%plasma%coord_sys%grid%dim2 (vecflt_type) |
| jacobian | mhd%n(:)%plasma%coord_sys%jacobian (matflt_type) |
| g_11 | mhd%n(:)%plasma%coord_sys%g_11 (matflt_type) |
| g_12 | mhd%n(:)%plasma%coord_sys%g_12 (matflt_type) |
| g_13 | mhd%n(:)%plasma%coord_sys%g_13 (matflt_type) |
| g_22 | mhd%n(:)%plasma%coord_sys%g_22 (matflt_type) |
| g_23 | mhd%n(:)%plasma%coord_sys%g_23 (matflt_type) |
| g_33 | mhd%n(:)%plasma%coord_sys%g_33 (matflt_type) |
| position | mhd%n(:)%plasma%coord_sys%position (rz2D) |
| r | mhd%n(:)%plasma%coord_sys%position%r (matflt_type) |
| z | mhd%n(:)%plasma%coord_sys%position%z (matflt_type) |
| a_pert | mhd%n(:)%plasma%a_pert (mhd_vector) |
| coord1 | mhd%n(:)%plasma%a_pert%coord1 (matcplx_type) |
| coord2 | mhd%n(:)%plasma%a_pert%coord2 (matcplx_type) |
| coord3 | mhd%n(:)%plasma%a_pert%coord3 (matcplx_type) |
| b_pert | mhd%n(:)%plasma%b_pert (mhd_vector) |
| coord1 | mhd%n(:)%plasma%b_pert%coord1 (matcplx_type) |
| coord2 | mhd%n(:)%plasma%b_pert%coord2 (matcplx_type) |
| coord3 | mhd%n(:)%plasma%b_pert%coord3 (matcplx_type) |
| v_pert | mhd%n(:)%plasma%v_pert (mhd_vector) |
| coord1 | mhd%n(:)%plasma%v_pert%coord1 (matcplx_type) |
| coord2 | mhd%n(:)%plasma%v_pert%coord2 (matcplx_type) |
| coord3 | mhd%n(:)%plasma%v_pert%coord3 (matcplx_type) |
| p_pert | mhd%n(:)%plasma%p_pert (matcplx_type) |
| rho_mass_per | mhd%n(:)%plasma%rho_mass_per (matcplx_type) |
| temp_per | mhd%n(:)%plasma%temp_per (matcplx_type) |
| vacuum | mhd%n(:)%vacuum (mhd_vacuum) |
| m | mhd%n(:)%vacuum%m (array3dflt_type) |
| coord_sys | mhd%n(:)%vacuum%coord_sys (coord_sys) |
| grid_type | mhd%n(:)%vacuum%coord_sys%grid_type (string) |
| grid | mhd%n(:)%vacuum%coord_sys%grid (reggrid) |
| dim1 | mhd%n(:)%vacuum%coord_sys%grid%dim1 (vecflt_type) |
| dim2 | mhd%n(:)%vacuum%coord_sys%grid%dim2 (vecflt_type) |
| jacobian | mhd%n(:)%vacuum%coord_sys%jacobian (matflt_type) |
| g_11 | mhd%n(:)%vacuum%coord_sys%g_11 (matflt_type) |
| g_12 | mhd%n(:)%vacuum%coord_sys%g_12 (matflt_type) |
| g_13 | mhd%n(:)%vacuum%coord_sys%g_13 (matflt_type) |
| g_22 | mhd%n(:)%vacuum%coord_sys%g_22 (matflt_type) |
| g_23 | mhd%n(:)%vacuum%coord_sys%g_23 (matflt_type) |
| g_33 | mhd%n(:)%vacuum%coord_sys%g_33 (matflt_type) |
| position | mhd%n(:)%vacuum%coord_sys%position (rz2D) |
| r | mhd%n(:)%vacuum%coord_sys%position%r (matflt_type) |
| z | mhd%n(:)%vacuum%coord_sys%position%z (matflt_type) |
| a_pert | mhd%n(:)%vacuum%a_pert (mhd_vector) |
| coord1 | mhd%n(:)%vacuum%a_pert%coord1 (matcplx_type) |
| coord2 | mhd%n(:)%vacuum%a_pert%coord2 (matcplx_type) |
| coord3 | mhd%n(:)%vacuum%a_pert%coord3 (matcplx_type) |
| b_pert | mhd%n(:)%vacuum%b_pert (mhd_vector) |
| coord1 | mhd%n(:)%vacuum%b_pert%coord1 (matcplx_type) |
| coord2 | mhd%n(:)%vacuum%b_pert%coord2 (matcplx_type) |
| coord3 | mhd%n(:)%vacuum%b_pert%coord3 (matcplx_type) |
| time | mhd%time (float) |
| codeparam | mhd%codeparam (codeparam) |
| codename | mhd%codeparam%codename (string) |
| codeversion | mhd%codeparam%codeversion (string) |
| parameters | mhd%codeparam%parameters (string) |
| output_diag | mhd%codeparam%output_diag (string) |
| output_flag | mhd%codeparam%output_flag (integer) |
| datainfo | msediag%datainfo (datainfo) |
| dataprovider | msediag%datainfo%dataprovider (string) |
| putdate | msediag%datainfo%putdate (string) |
| source | msediag%datainfo%source (string) |
| comment | msediag%datainfo%comment (string) |
| cocos | msediag%datainfo%cocos (integer) |
| id | msediag%datainfo%id (integer) |
| isref | msediag%datainfo%isref (integer) |
| whatref | msediag%datainfo%whatref (whatref) |
| user | msediag%datainfo%whatref%user (string) |
| machine | msediag%datainfo%whatref%machine (string) |
| shot | msediag%datainfo%whatref%shot (integer) |
| run | msediag%datainfo%whatref%run (integer) |
| occurrence | msediag%datainfo%whatref%occurrence (integer) |
| putinfo | msediag%datainfo%putinfo (putinfo) |
| putmethod | msediag%datainfo%putinfo%putmethod (string) |
| putaccess | msediag%datainfo%putinfo%putaccess (string) |
| putlocation | msediag%datainfo%putinfo%putlocation (string) |
| rights | msediag%datainfo%putinfo%rights (string) |
| polarimetry | msediag%polarimetry (polarimetry) |
| setup | msediag%polarimetry%setup (msediag_setup_polarimetry) |
| rzgamma | msediag%polarimetry%setup%rzgamma (rzphidrdzdphi1D) |
| r | msediag%polarimetry%setup%rzgamma%r (vecflt_type) |
| z | msediag%polarimetry%setup%rzgamma%z (vecflt_type) |
| phi | msediag%polarimetry%setup%rzgamma%phi (vecflt_type) |
| dr | msediag%polarimetry%setup%rzgamma%dr (vecflt_type) |
| dz | msediag%polarimetry%setup%rzgamma%dz (vecflt_type) |
| dphi | msediag%polarimetry%setup%rzgamma%dphi (vecflt_type) |
| geom_coef | msediag%polarimetry%setup%geom_coef (matflt_type) |
| measure | msediag%polarimetry%measure (exp1D) |
| value | msediag%polarimetry%measure%value (vecflt_type) |
| abserror | msediag%polarimetry%measure%abserror (vecflt_type) |
| relerror | msediag%polarimetry%measure%relerror (vecflt_type) |
| spectral | msediag%spectral (spectral) |
| emissivity | msediag%spectral%emissivity (msediag_emissivity) |
| wavelength | msediag%spectral%emissivity%wavelength (vecflt_type) |
| emiss_chord | msediag%spectral%emissivity%emiss_chord(:) (msediag_emiss_chord) |
| volume | msediag%spectral%emissivity%emiss_chord(:)%volume (float) |
| setup | msediag%spectral%emissivity%emiss_chord(:)%setup (rzphi1D) |
| r | msediag%spectral%emissivity%emiss_chord(:)%setup%r (vecflt_type) |
| z | msediag%spectral%emissivity%emiss_chord(:)%setup%z (vecflt_type) |
| phi | msediag%spectral%emissivity%emiss_chord(:)%setup%phi (vecflt_type) |
| polarization | msediag%spectral%emissivity%emiss_chord(:)%polarization(:) (msediag_polarization) |
| type | msediag%spectral%emissivity%emiss_chord(:)%polarization(:)%type (identifier) |
| id | msediag%spectral%emissivity%emiss_chord(:)%polarization(:)%type%id (string) |
| flag | msediag%spectral%emissivity%emiss_chord(:)%polarization(:)%type%flag (integer) |
| description | msediag%spectral%emissivity%emiss_chord(:)%polarization(:)%type%description (string) |
| spec_emiss | msediag%spectral%emissivity%emiss_chord(:)%polarization(:)%spec_emiss (matflt_type) |
| quantiaxis | msediag%spectral%emissivity%emiss_chord(:)%quantiaxis (vecflt_type) |
| radiance | msediag%spectral%radiance (msediag_radiance) |
| wavelength | msediag%spectral%radiance%wavelength (exp1D) |
| value | msediag%spectral%radiance%wavelength%value (vecflt_type) |
| abserror | msediag%spectral%radiance%wavelength%abserror (vecflt_type) |
| relerror | msediag%spectral%radiance%wavelength%relerror (vecflt_type) |
| radia_chord | msediag%spectral%radiance%radia_chord(:) (msediag_radia_chord) |
| setup | msediag%spectral%radiance%radia_chord(:)%setup (msediag_setup) |
| pivot_point | msediag%spectral%radiance%radia_chord(:)%setup%pivot_point (rzphi0D) |
| r | msediag%spectral%radiance%radia_chord(:)%setup%pivot_point%r (float) |
| z | msediag%spectral%radiance%radia_chord(:)%setup%pivot_point%z (float) |
| phi | msediag%spectral%radiance%radia_chord(:)%setup%pivot_point%phi (float) |
| horchordang | msediag%spectral%radiance%radia_chord(:)%setup%horchordang (float) |
| verchordang | msediag%spectral%radiance%radia_chord(:)%setup%verchordang (float) |
| second_point | msediag%spectral%radiance%radia_chord(:)%setup%second_point (rzphi0D) |
| r | msediag%spectral%radiance%radia_chord(:)%setup%second_point%r (float) |
| z | msediag%spectral%radiance%radia_chord(:)%setup%second_point%z (float) |
| phi | msediag%spectral%radiance%radia_chord(:)%setup%second_point%phi (float) |
| stokes | msediag%spectral%radiance%radia_chord(:)%stokes(:) (msediag_stokes) |
| type | msediag%spectral%radiance%radia_chord(:)%stokes(:)%type (identifier) |
| id | msediag%spectral%radiance%radia_chord(:)%stokes(:)%type%id (string) |
| flag | msediag%spectral%radiance%radia_chord(:)%stokes(:)%type%flag (integer) |
| description | msediag%spectral%radiance%radia_chord(:)%stokes(:)%type%description (string) |
| vector | msediag%spectral%radiance%radia_chord(:)%stokes(:)%vector (matflt_type) |
| totradiance | msediag%spectral%radiance%radia_chord(:)%totradiance (exp1D) |
| value | msediag%spectral%radiance%radia_chord(:)%totradiance%value (vecflt_type) |
| abserror | msediag%spectral%radiance%radia_chord(:)%totradiance%abserror (vecflt_type) |
| relerror | msediag%spectral%radiance%radia_chord(:)%totradiance%relerror (vecflt_type) |
| codeparam | msediag%spectral%codeparam (codeparam) |
| codename | msediag%spectral%codeparam%codename (string) |
| codeversion | msediag%spectral%codeparam%codeversion (string) |
| parameters | msediag%spectral%codeparam%parameters (string) |
| output_diag | msediag%spectral%codeparam%output_diag (string) |
| output_flag | msediag%spectral%codeparam%output_flag (integer) |
| codeparam | msediag%codeparam (codeparam) |
| codename | msediag%codeparam%codename (string) |
| codeversion | msediag%codeparam%codeversion (string) |
| parameters | msediag%codeparam%parameters (string) |
| output_diag | msediag%codeparam%output_diag (string) |
| output_flag | msediag%codeparam%output_flag (integer) |
| time | msediag%time (float) |
| datainfo | nbi%datainfo (datainfo) |
| dataprovider | nbi%datainfo%dataprovider (string) |
| putdate | nbi%datainfo%putdate (string) |
| source | nbi%datainfo%source (string) |
| comment | nbi%datainfo%comment (string) |
| cocos | nbi%datainfo%cocos (integer) |
| id | nbi%datainfo%id (integer) |
| isref | nbi%datainfo%isref (integer) |
| whatref | nbi%datainfo%whatref (whatref) |
| user | nbi%datainfo%whatref%user (string) |
| machine | nbi%datainfo%whatref%machine (string) |
| shot | nbi%datainfo%whatref%shot (integer) |
| run | nbi%datainfo%whatref%run (integer) |
| occurrence | nbi%datainfo%whatref%occurrence (integer) |
| putinfo | nbi%datainfo%putinfo (putinfo) |
| putmethod | nbi%datainfo%putinfo%putmethod (string) |
| putaccess | nbi%datainfo%putinfo%putaccess (string) |
| putlocation | nbi%datainfo%putinfo%putlocation (string) |
| rights | nbi%datainfo%putinfo%rights (string) |
| nbi_unit | nbi%nbi_unit(:) (nbi_unit) |
| name | nbi%nbi_unit(:)%name (string) |
| inj_spec | nbi%nbi_unit(:)%inj_spec (inj_spec) |
| amn | nbi%nbi_unit(:)%inj_spec%amn (float) |
| zn | nbi%nbi_unit(:)%inj_spec%zn (float) |
| pow_unit | nbi%nbi_unit(:)%pow_unit (exp0D) |
| value | nbi%nbi_unit(:)%pow_unit%value (float) |
| abserror | nbi%nbi_unit(:)%pow_unit%abserror (float) |
| relerror | nbi%nbi_unit(:)%pow_unit%relerror (float) |
| inj_eng_unit | nbi%nbi_unit(:)%inj_eng_unit (exp0D) |
| value | nbi%nbi_unit(:)%inj_eng_unit%value (float) |
| abserror | nbi%nbi_unit(:)%inj_eng_unit%abserror (float) |
| relerror | nbi%nbi_unit(:)%inj_eng_unit%relerror (float) |
| beamcurrfrac | nbi%nbi_unit(:)%beamcurrfrac (exp1D) |
| value | nbi%nbi_unit(:)%beamcurrfrac%value (vecflt_type) |
| abserror | nbi%nbi_unit(:)%beamcurrfrac%abserror (vecflt_type) |
| relerror | nbi%nbi_unit(:)%beamcurrfrac%relerror (vecflt_type) |
| beampowrfrac | nbi%nbi_unit(:)%beampowrfrac (exp1D) |
| value | nbi%nbi_unit(:)%beampowrfrac%value (vecflt_type) |
| abserror | nbi%nbi_unit(:)%beampowrfrac%abserror (vecflt_type) |
| relerror | nbi%nbi_unit(:)%beampowrfrac%relerror (vecflt_type) |
| beamletgroup | nbi%nbi_unit(:)%beamletgroup(:) (beamletgroup) |
| position | nbi%nbi_unit(:)%beamletgroup(:)%position (rzphi0D) |
| r | nbi%nbi_unit(:)%beamletgroup(:)%position%r (float) |
| z | nbi%nbi_unit(:)%beamletgroup(:)%position%z (float) |
| phi | nbi%nbi_unit(:)%beamletgroup(:)%position%phi (float) |
| tang_rad | nbi%nbi_unit(:)%beamletgroup(:)%tang_rad (float) |
| angle | nbi%nbi_unit(:)%beamletgroup(:)%angle (float) |
| direction | nbi%nbi_unit(:)%beamletgroup(:)%direction (integer) |
| width_horiz | nbi%nbi_unit(:)%beamletgroup(:)%width_horiz (float) |
| width_vert | nbi%nbi_unit(:)%beamletgroup(:)%width_vert (float) |
| focussing | nbi%nbi_unit(:)%beamletgroup(:)%focussing (focussing) |
| focal_len_hz | nbi%nbi_unit(:)%beamletgroup(:)%focussing%focal_len_hz (float) |
| focal_len_vc | nbi%nbi_unit(:)%beamletgroup(:)%focussing%focal_len_vc (float) |
| width_min_hz | nbi%nbi_unit(:)%beamletgroup(:)%focussing%width_min_hz (float) |
| width_min_vc | nbi%nbi_unit(:)%beamletgroup(:)%focussing%width_min_vc (float) |
| divergence | nbi%nbi_unit(:)%beamletgroup(:)%divergence (divergence) |
| frac_divcomp | nbi%nbi_unit(:)%beamletgroup(:)%divergence%frac_divcomp (vecflt_type) |
| div_vert | nbi%nbi_unit(:)%beamletgroup(:)%divergence%div_vert (vecflt_type) |
| div_horiz | nbi%nbi_unit(:)%beamletgroup(:)%divergence%div_horiz (vecflt_type) |
| beamlets | nbi%nbi_unit(:)%beamletgroup(:)%beamlets (beamlets) |
| position | nbi%nbi_unit(:)%beamletgroup(:)%beamlets%position (rzphi1D) |
| r | nbi%nbi_unit(:)%beamletgroup(:)%beamlets%position%r (vecflt_type) |
| z | nbi%nbi_unit(:)%beamletgroup(:)%beamlets%position%z (vecflt_type) |
| phi | nbi%nbi_unit(:)%beamletgroup(:)%beamlets%position%phi (vecflt_type) |
| tang_rad_blt | nbi%nbi_unit(:)%beamletgroup(:)%beamlets%tang_rad_blt (vecflt_type) |
| angle_blt | nbi%nbi_unit(:)%beamletgroup(:)%beamlets%angle_blt (vecflt_type) |
| pow_frc_blt | nbi%nbi_unit(:)%beamletgroup(:)%beamlets%pow_frc_blt (vecflt_type) |
| wall | nbi%nbi_unit(:)%wall (nbi_nbi_unit_wall) |
| surface | nbi%nbi_unit(:)%wall%surface (nbi_nbi_unit_wall_surface) |
| triangle | nbi%nbi_unit(:)%wall%surface%triangle(:) (trianglexyz) |
| point1 | nbi%nbi_unit(:)%wall%surface%triangle(:)%point1 (xyz0D) |
| x | nbi%nbi_unit(:)%wall%surface%triangle(:)%point1%x (float) |
| y | nbi%nbi_unit(:)%wall%surface%triangle(:)%point1%y (float) |
| z | nbi%nbi_unit(:)%wall%surface%triangle(:)%point1%z (float) |
| point2 | nbi%nbi_unit(:)%wall%surface%triangle(:)%point2 (xyz0D) |
| x | nbi%nbi_unit(:)%wall%surface%triangle(:)%point2%x (float) |
| y | nbi%nbi_unit(:)%wall%surface%triangle(:)%point2%y (float) |
| z | nbi%nbi_unit(:)%wall%surface%triangle(:)%point2%z (float) |
| point3 | nbi%nbi_unit(:)%wall%surface%triangle(:)%point3 (xyz0D) |
| x | nbi%nbi_unit(:)%wall%surface%triangle(:)%point3%x (float) |
| y | nbi%nbi_unit(:)%wall%surface%triangle(:)%point3%y (float) |
| z | nbi%nbi_unit(:)%wall%surface%triangle(:)%point3%z (float) |
| rectangle | nbi%nbi_unit(:)%wall%surface%rectangle(:) (rectanglexyz) |
| point01 | nbi%nbi_unit(:)%wall%surface%rectangle(:)%point01 (xyz0D) |
| x | nbi%nbi_unit(:)%wall%surface%rectangle(:)%point01%x (float) |
| y | nbi%nbi_unit(:)%wall%surface%rectangle(:)%point01%y (float) |
| z | nbi%nbi_unit(:)%wall%surface%rectangle(:)%point01%z (float) |
| point11 | nbi%nbi_unit(:)%wall%surface%rectangle(:)%point11 (xyz0D) |
| x | nbi%nbi_unit(:)%wall%surface%rectangle(:)%point11%x (float) |
| y | nbi%nbi_unit(:)%wall%surface%rectangle(:)%point11%y (float) |
| z | nbi%nbi_unit(:)%wall%surface%rectangle(:)%point11%z (float) |
| point10 | nbi%nbi_unit(:)%wall%surface%rectangle(:)%point10 (xyz0D) |
| x | nbi%nbi_unit(:)%wall%surface%rectangle(:)%point10%x (float) |
| y | nbi%nbi_unit(:)%wall%surface%rectangle(:)%point10%y (float) |
| z | nbi%nbi_unit(:)%wall%surface%rectangle(:)%point10%z (float) |
| collimator | nbi%nbi_unit(:)%wall%collimator(:) (flat_polygon) |
| origin | nbi%nbi_unit(:)%wall%collimator(:)%origin (xyz0D) |
| x | nbi%nbi_unit(:)%wall%collimator(:)%origin%x (float) |
| y | nbi%nbi_unit(:)%wall%collimator(:)%origin%y (float) |
| z | nbi%nbi_unit(:)%wall%collimator(:)%origin%z (float) |
| basis1 | nbi%nbi_unit(:)%wall%collimator(:)%basis1 (xyz0D) |
| x | nbi%nbi_unit(:)%wall%collimator(:)%basis1%x (float) |
| y | nbi%nbi_unit(:)%wall%collimator(:)%basis1%y (float) |
| z | nbi%nbi_unit(:)%wall%collimator(:)%basis1%z (float) |
| basis2 | nbi%nbi_unit(:)%wall%collimator(:)%basis2 (xyz0D) |
| x | nbi%nbi_unit(:)%wall%collimator(:)%basis2%x (float) |
| y | nbi%nbi_unit(:)%wall%collimator(:)%basis2%y (float) |
| z | nbi%nbi_unit(:)%wall%collimator(:)%basis2%z (float) |
| coord1 | nbi%nbi_unit(:)%wall%collimator(:)%coord1 (vecflt_type) |
| coord2 | nbi%nbi_unit(:)%wall%collimator(:)%coord2 (vecflt_type) |
| codeparam | nbi%nbi_unit(:)%codeparam (codeparam) |
| codename | nbi%nbi_unit(:)%codeparam%codename (string) |
| codeversion | nbi%nbi_unit(:)%codeparam%codeversion (string) |
| parameters | nbi%nbi_unit(:)%codeparam%parameters (string) |
| output_diag | nbi%nbi_unit(:)%codeparam%output_diag (string) |
| output_flag | nbi%nbi_unit(:)%codeparam%output_flag (integer) |
| codeparam | nbi%codeparam (codeparam) |
| codename | nbi%codeparam%codename (string) |
| codeversion | nbi%codeparam%codeversion (string) |
| parameters | nbi%codeparam%parameters (string) |
| output_diag | nbi%codeparam%output_diag (string) |
| output_flag | nbi%codeparam%output_flag (integer) |
| time | nbi%time (float) |
| datainfo | neoclassic%datainfo (datainfo) |
| dataprovider | neoclassic%datainfo%dataprovider (string) |
| putdate | neoclassic%datainfo%putdate (string) |
| source | neoclassic%datainfo%source (string) |
| comment | neoclassic%datainfo%comment (string) |
| cocos | neoclassic%datainfo%cocos (integer) |
| id | neoclassic%datainfo%id (integer) |
| isref | neoclassic%datainfo%isref (integer) |
| whatref | neoclassic%datainfo%whatref (whatref) |
| user | neoclassic%datainfo%whatref%user (string) |
| machine | neoclassic%datainfo%whatref%machine (string) |
| shot | neoclassic%datainfo%whatref%shot (integer) |
| run | neoclassic%datainfo%whatref%run (integer) |
| occurrence | neoclassic%datainfo%whatref%occurrence (integer) |
| putinfo | neoclassic%datainfo%putinfo (putinfo) |
| putmethod | neoclassic%datainfo%putinfo%putmethod (string) |
| putaccess | neoclassic%datainfo%putinfo%putaccess (string) |
| putlocation | neoclassic%datainfo%putinfo%putlocation (string) |
| rights | neoclassic%datainfo%putinfo%rights (string) |
| rho_tor_norm | neoclassic%rho_tor_norm (vecflt_type) |
| rho_tor | neoclassic%rho_tor (vecflt_type) |
| composition | neoclassic%composition (composition) |
| amn | neoclassic%composition%amn (vecflt_type) |
| zn | neoclassic%composition%zn (vecflt_type) |
| zion | neoclassic%composition%zion (vecflt_type) |
| imp_flag | neoclassic%composition%imp_flag (vecint_type) |
| label | neoclassic%composition%label (vecstring_type) |
| desc_impur | neoclassic%desc_impur (desc_impur) |
| amn | neoclassic%desc_impur%amn (vecflt_type) |
| zn | neoclassic%desc_impur%zn (vecint_type) |
| i_ion | neoclassic%desc_impur%i_ion (vecint_type) |
| nzimp | neoclassic%desc_impur%nzimp (vecint_type) |
| zmin | neoclassic%desc_impur%zmin (matint_type) |
| zmax | neoclassic%desc_impur%zmax (matint_type) |
| label | neoclassic%desc_impur%label (vecstring_type) |
| compositions | neoclassic%compositions (compositions_type) |
| nuclei | neoclassic%compositions%nuclei(:) (nuclei) |
| zn | neoclassic%compositions%nuclei(:)%zn (float) |
| amn | neoclassic%compositions%nuclei(:)%amn (float) |
| label | neoclassic%compositions%nuclei(:)%label (string) |
| ions | neoclassic%compositions%ions(:) (ions) |
| nucindex | neoclassic%compositions%ions(:)%nucindex (integer) |
| zion | neoclassic%compositions%ions(:)%zion (float) |
| imp_flag | neoclassic%compositions%ions(:)%imp_flag (integer) |
| label | neoclassic%compositions%ions(:)%label (string) |
| impurities | neoclassic%compositions%impurities(:) (impurities) |
| nucindex | neoclassic%compositions%impurities(:)%nucindex (integer) |
| i_ion | neoclassic%compositions%impurities(:)%i_ion (integer) |
| nzimp | neoclassic%compositions%impurities(:)%nzimp (integer) |
| zmin | neoclassic%compositions%impurities(:)%zmin (vecflt_type) |
| zmax | neoclassic%compositions%impurities(:)%zmax (vecflt_type) |
| label | neoclassic%compositions%impurities(:)%label (vecstring_type) |
| neutralscomp | neoclassic%compositions%neutralscomp(:) (composition_neutralscomp) |
| neutcomp | neoclassic%compositions%neutralscomp(:)%neutcomp(:) (composition_neutrals_neutcomp) |
| nucindex | neoclassic%compositions%neutralscomp(:)%neutcomp(:)%nucindex (integer) |
| multiplicity | neoclassic%compositions%neutralscomp(:)%neutcomp(:)%multiplicity (integer) |
| type | neoclassic%compositions%neutralscomp(:)%type(:) (identifier) |
| id | neoclassic%compositions%neutralscomp(:)%type(:)%id (string) |
| flag | neoclassic%compositions%neutralscomp(:)%type(:)%flag (integer) |
| description | neoclassic%compositions%neutralscomp(:)%type(:)%description (string) |
| label | neoclassic%compositions%neutralscomp(:)%label (string) |
| edgespecies | neoclassic%compositions%edgespecies(:) (edgespecies) |
| nucindex | neoclassic%compositions%edgespecies(:)%nucindex (integer) |
| zmin | neoclassic%compositions%edgespecies(:)%zmin (float) |
| zmax | neoclassic%compositions%edgespecies(:)%zmax (float) |
| label | neoclassic%compositions%edgespecies(:)%label (string) |
| signature | neoclassic%compositions%signature (identifier) |
| id | neoclassic%compositions%signature%id (string) |
| flag | neoclassic%compositions%signature%flag (integer) |
| description | neoclassic%compositions%signature%description (string) |
| ni_neo | neoclassic%ni_neo (transcoefion) |
| diff_eff | neoclassic%ni_neo%diff_eff (matflt_type) |
| vconv_eff | neoclassic%ni_neo%vconv_eff (matflt_type) |
| exchange | neoclassic%ni_neo%exchange (matflt_type) |
| qgi | neoclassic%ni_neo%qgi (matflt_type) |
| flux | neoclassic%ni_neo%flux (matflt_type) |
| off_diagonal | neoclassic%ni_neo%off_diagonal (offdiagion) |
| d_ni | neoclassic%ni_neo%off_diagonal%d_ni (array3dflt_type) |
| d_ti | neoclassic%ni_neo%off_diagonal%d_ti (array3dflt_type) |
| d_ne | neoclassic%ni_neo%off_diagonal%d_ne (matflt_type) |
| d_te | neoclassic%ni_neo%off_diagonal%d_te (matflt_type) |
| d_epar | neoclassic%ni_neo%off_diagonal%d_epar (matflt_type) |
| d_mtor | neoclassic%ni_neo%off_diagonal%d_mtor (matflt_type) |
| flag | neoclassic%ni_neo%flag (integer) |
| ne_neo | neoclassic%ne_neo (transcoefel) |
| diff_eff | neoclassic%ne_neo%diff_eff (vecflt_type) |
| vconv_eff | neoclassic%ne_neo%vconv_eff (vecflt_type) |
| flux | neoclassic%ne_neo%flux (vecflt_type) |
| off_diagonal | neoclassic%ne_neo%off_diagonal (offdiagel) |
| d_ni | neoclassic%ne_neo%off_diagonal%d_ni (matflt_type) |
| d_ti | neoclassic%ne_neo%off_diagonal%d_ti (matflt_type) |
| d_ne | neoclassic%ne_neo%off_diagonal%d_ne (vecflt_type) |
| d_te | neoclassic%ne_neo%off_diagonal%d_te (vecflt_type) |
| d_epar | neoclassic%ne_neo%off_diagonal%d_epar (vecflt_type) |
| d_mtor | neoclassic%ne_neo%off_diagonal%d_mtor (vecflt_type) |
| flag | neoclassic%ne_neo%flag (integer) |
| nz_neo | neoclassic%nz_neo(:) (transcoefimp) |
| diff_eff | neoclassic%nz_neo(:)%diff_eff (matflt_type) |
| vconv_eff | neoclassic%nz_neo(:)%vconv_eff (matflt_type) |
| exchange | neoclassic%nz_neo(:)%exchange (matflt_type) |
| flux | neoclassic%nz_neo(:)%flux (matflt_type) |
| flag | neoclassic%nz_neo(:)%flag (integer) |
| ti_neo | neoclassic%ti_neo (transcoefion) |
| diff_eff | neoclassic%ti_neo%diff_eff (matflt_type) |
| vconv_eff | neoclassic%ti_neo%vconv_eff (matflt_type) |
| exchange | neoclassic%ti_neo%exchange (matflt_type) |
| qgi | neoclassic%ti_neo%qgi (matflt_type) |
| flux | neoclassic%ti_neo%flux (matflt_type) |
| off_diagonal | neoclassic%ti_neo%off_diagonal (offdiagion) |
| d_ni | neoclassic%ti_neo%off_diagonal%d_ni (array3dflt_type) |
| d_ti | neoclassic%ti_neo%off_diagonal%d_ti (array3dflt_type) |
| d_ne | neoclassic%ti_neo%off_diagonal%d_ne (matflt_type) |
| d_te | neoclassic%ti_neo%off_diagonal%d_te (matflt_type) |
| d_epar | neoclassic%ti_neo%off_diagonal%d_epar (matflt_type) |
| d_mtor | neoclassic%ti_neo%off_diagonal%d_mtor (matflt_type) |
| flag | neoclassic%ti_neo%flag (integer) |
| te_neo | neoclassic%te_neo (transcoefel) |
| diff_eff | neoclassic%te_neo%diff_eff (vecflt_type) |
| vconv_eff | neoclassic%te_neo%vconv_eff (vecflt_type) |
| flux | neoclassic%te_neo%flux (vecflt_type) |
| off_diagonal | neoclassic%te_neo%off_diagonal (offdiagel) |
| d_ni | neoclassic%te_neo%off_diagonal%d_ni (matflt_type) |
| d_ti | neoclassic%te_neo%off_diagonal%d_ti (matflt_type) |
| d_ne | neoclassic%te_neo%off_diagonal%d_ne (vecflt_type) |
| d_te | neoclassic%te_neo%off_diagonal%d_te (vecflt_type) |
| d_epar | neoclassic%te_neo%off_diagonal%d_epar (vecflt_type) |
| d_mtor | neoclassic%te_neo%off_diagonal%d_mtor (vecflt_type) |
| flag | neoclassic%te_neo%flag (integer) |
| tz_neo | neoclassic%tz_neo(:) (transcoefimp) |
| diff_eff | neoclassic%tz_neo(:)%diff_eff (matflt_type) |
| vconv_eff | neoclassic%tz_neo(:)%vconv_eff (matflt_type) |
| exchange | neoclassic%tz_neo(:)%exchange (matflt_type) |
| flux | neoclassic%tz_neo(:)%flux (matflt_type) |
| flag | neoclassic%tz_neo(:)%flag (integer) |
| mtor_neo | neoclassic%mtor_neo (transcoefel) |
| diff_eff | neoclassic%mtor_neo%diff_eff (vecflt_type) |
| vconv_eff | neoclassic%mtor_neo%vconv_eff (vecflt_type) |
| flux | neoclassic%mtor_neo%flux (vecflt_type) |
| off_diagonal | neoclassic%mtor_neo%off_diagonal (offdiagel) |
| d_ni | neoclassic%mtor_neo%off_diagonal%d_ni (matflt_type) |
| d_ti | neoclassic%mtor_neo%off_diagonal%d_ti (matflt_type) |
| d_ne | neoclassic%mtor_neo%off_diagonal%d_ne (vecflt_type) |
| d_te | neoclassic%mtor_neo%off_diagonal%d_te (vecflt_type) |
| d_epar | neoclassic%mtor_neo%off_diagonal%d_epar (vecflt_type) |
| d_mtor | neoclassic%mtor_neo%off_diagonal%d_mtor (vecflt_type) |
| flag | neoclassic%mtor_neo%flag (integer) |
| sigma | neoclassic%sigma (vecflt_type) |
| jboot | neoclassic%jboot (vecflt_type) |
| er | neoclassic%er (vecflt_type) |
| vpol | neoclassic%vpol (matflt_type) |
| vtor | neoclassic%vtor (matflt_type) |
| mach | neoclassic%mach (matflt_type) |
| utheta_e | neoclassic%utheta_e (vecflt_type) |
| utheta_i | neoclassic%utheta_i (matflt_type) |
| fext | neoclassic%fext (array3dflt_type) |
| jext | neoclassic%jext (vecflt_type) |
| time | neoclassic%time (float) |
| codeparam | neoclassic%codeparam (codeparam) |
| codename | neoclassic%codeparam%codename (string) |
| codeversion | neoclassic%codeparam%codeversion (string) |
| parameters | neoclassic%codeparam%parameters (string) |
| output_diag | neoclassic%codeparam%output_diag (string) |
| output_flag | neoclassic%codeparam%output_flag (integer) |
| datainfo | ntm%datainfo (datainfo) |
| dataprovider | ntm%datainfo%dataprovider (string) |
| putdate | ntm%datainfo%putdate (string) |
| source | ntm%datainfo%source (string) |
| comment | ntm%datainfo%comment (string) |
| cocos | ntm%datainfo%cocos (integer) |
| id | ntm%datainfo%id (integer) |
| isref | ntm%datainfo%isref (integer) |
| whatref | ntm%datainfo%whatref (whatref) |
| user | ntm%datainfo%whatref%user (string) |
| machine | ntm%datainfo%whatref%machine (string) |
| shot | ntm%datainfo%whatref%shot (integer) |
| run | ntm%datainfo%whatref%run (integer) |
| occurrence | ntm%datainfo%whatref%occurrence (integer) |
| putinfo | ntm%datainfo%putinfo (putinfo) |
| putmethod | ntm%datainfo%putinfo%putmethod (string) |
| putaccess | ntm%datainfo%putinfo%putaccess (string) |
| putlocation | ntm%datainfo%putinfo%putlocation (string) |
| rights | ntm%datainfo%putinfo%rights (string) |
| mode | ntm%mode(:) (ntm_mode) |
| onset | ntm%mode(:)%onset (ntm_mode_onset) |
| w | ntm%mode(:)%onset%w (float) |
| time_onset | ntm%mode(:)%onset%time_onset (float) |
| time_offset | ntm%mode(:)%onset%time_offset (float) |
| phase | ntm%mode(:)%onset%phase (float) |
| n | ntm%mode(:)%onset%n (integer) |
| m | ntm%mode(:)%onset%m (integer) |
| description | ntm%mode(:)%onset%description (string) |
| full_evol | ntm%mode(:)%full_evol (ntm_mode_full_evol) |
| time_evol | ntm%mode(:)%full_evol%time_evol (vecflt_type) |
| w | ntm%mode(:)%full_evol%w (vecflt_type) |
| dwdt | ntm%mode(:)%full_evol%dwdt (vecflt_type) |
| phase | ntm%mode(:)%full_evol%phase (vecflt_type) |
| dphasedt | ntm%mode(:)%full_evol%dphasedt (vecflt_type) |
| frequency | ntm%mode(:)%full_evol%frequency (vecflt_type) |
| dfrequencydt | ntm%mode(:)%full_evol%dfrequencydt (vecflt_type) |
| island | ntm%mode(:)%full_evol%island (ntm_mode_full_evol_island) |
| geometry | ntm%mode(:)%full_evol%island%geometry (matflt_type) |
| coord_values | ntm%mode(:)%full_evol%island%coord_values (matflt_type) |
| coord_desc | ntm%mode(:)%full_evol%island%coord_desc (string) |
| n | ntm%mode(:)%full_evol%n (integer) |
| m | ntm%mode(:)%full_evol%m (integer) |
| deltaw_value | ntm%mode(:)%full_evol%deltaw_value (matflt_type) |
| deltaw_name | ntm%mode(:)%full_evol%deltaw_name (vecstring_type) |
| torque_value | ntm%mode(:)%full_evol%torque_value (matflt_type) |
| torque_name | ntm%mode(:)%full_evol%torque_name (vecstring_type) |
| delta_diff | ntm%mode(:)%full_evol%delta_diff (matflt_type) |
| description | ntm%mode(:)%full_evol%description (string) |
| rho_tor | ntm%mode(:)%full_evol%rho_tor (vecflt_type) |
| evolution | ntm%mode(:)%evolution (ntm_mode_evolution) |
| w | ntm%mode(:)%evolution%w (float) |
| dwdt | ntm%mode(:)%evolution%dwdt (float) |
| phase | ntm%mode(:)%evolution%phase (float) |
| dphasedt | ntm%mode(:)%evolution%dphasedt (float) |
| frequency | ntm%mode(:)%evolution%frequency (float) |
| dfrequencydt | ntm%mode(:)%evolution%dfrequencydt (float) |
| island | ntm%mode(:)%evolution%island (ntm_mode_evolution_island) |
| geometry | ntm%mode(:)%evolution%island%geometry (vecflt_type) |
| coord_values | ntm%mode(:)%evolution%island%coord_values (vecflt_type) |
| coord_desc | ntm%mode(:)%evolution%island%coord_desc (string) |
| n | ntm%mode(:)%evolution%n (integer) |
| m | ntm%mode(:)%evolution%m (integer) |
| deltaw_value | ntm%mode(:)%evolution%deltaw_value (vecflt_type) |
| deltaw_name | ntm%mode(:)%evolution%deltaw_name (vecstring_type) |
| torque_value | ntm%mode(:)%evolution%torque_value (vecflt_type) |
| torque_name | ntm%mode(:)%evolution%torque_name (vecstring_type) |
| delta_diff | ntm%mode(:)%evolution%delta_diff (vecflt_type) |
| description | ntm%mode(:)%evolution%description (string) |
| rho_tor | ntm%mode(:)%evolution%rho_tor (float) |
| time | ntm%time (float) |
| codeparam | ntm%codeparam (codeparam) |
| codename | ntm%codeparam%codename (string) |
| codeversion | ntm%codeparam%codeversion (string) |
| parameters | ntm%codeparam%parameters (string) |
| output_diag | ntm%codeparam%output_diag (string) |
| output_flag | ntm%codeparam%output_flag (integer) |
| datainfo | orbit%datainfo (datainfo) |
| dataprovider | orbit%datainfo%dataprovider (string) |
| putdate | orbit%datainfo%putdate (string) |
| source | orbit%datainfo%source (string) |
| comment | orbit%datainfo%comment (string) |
| cocos | orbit%datainfo%cocos (integer) |
| id | orbit%datainfo%id (integer) |
| isref | orbit%datainfo%isref (integer) |
| whatref | orbit%datainfo%whatref (whatref) |
| user | orbit%datainfo%whatref%user (string) |
| machine | orbit%datainfo%whatref%machine (string) |
| shot | orbit%datainfo%whatref%shot (integer) |
| run | orbit%datainfo%whatref%run (integer) |
| occurrence | orbit%datainfo%whatref%occurrence (integer) |
| putinfo | orbit%datainfo%putinfo (putinfo) |
| putmethod | orbit%datainfo%putinfo%putmethod (string) |
| putaccess | orbit%datainfo%putinfo%putaccess (string) |
| putlocation | orbit%datainfo%putinfo%putlocation (string) |
| rights | orbit%datainfo%putinfo%rights (string) |
| com | orbit%com (com) |
| amn | orbit%com%amn (float) |
| zion | orbit%com%zion (float) |
| energy | orbit%com%energy (vecflt_type) |
| magn_mom | orbit%com%magn_mom (vecflt_type) |
| p_phi | orbit%com%p_phi (vecflt_type) |
| sigma | orbit%com%sigma (vecint_type) |
| trace | orbit%trace (trace) |
| time_orb | orbit%trace%time_orb (matflt_type) |
| ntorb | orbit%trace%ntorb (vecint_type) |
| r | orbit%trace%r (matflt_type) |
| z | orbit%trace%z (matflt_type) |
| phi | orbit%trace%phi (matflt_type) |
| psi | orbit%trace%psi (matflt_type) |
| theta_b | orbit%trace%theta_b (matflt_type) |
| v_parallel | orbit%trace%v_parallel (matflt_type) |
| v_perp | orbit%trace%v_perp (matflt_type) |
| global_param | orbit%global_param (orbit_global_param) |
| orbit_type | orbit%global_param%orbit_type (vecint_type) |
| omega_b | orbit%global_param%omega_b (vecflt_type) |
| omega_phi | orbit%global_param%omega_phi (vecflt_type) |
| omega_c_av | orbit%global_param%omega_c_av (vecflt_type) |
| special_pos | orbit%global_param%special_pos (orbit_special_pos) |
| midplane | orbit%global_param%special_pos%midplane (orbit_midplane) |
| outer | orbit%global_param%special_pos%midplane%outer (orbit_pos) |
| r | orbit%global_param%special_pos%midplane%outer%r (vecflt_type) |
| z | orbit%global_param%special_pos%midplane%outer%z (vecflt_type) |
| phi | orbit%global_param%special_pos%midplane%outer%phi (vecflt_type) |
| psi | orbit%global_param%special_pos%midplane%outer%psi (vecflt_type) |
| theta_b | orbit%global_param%special_pos%midplane%outer%theta_b (vecflt_type) |
| inner | orbit%global_param%special_pos%midplane%inner (orbit_pos) |
| r | orbit%global_param%special_pos%midplane%inner%r (vecflt_type) |
| z | orbit%global_param%special_pos%midplane%inner%z (vecflt_type) |
| phi | orbit%global_param%special_pos%midplane%inner%phi (vecflt_type) |
| psi | orbit%global_param%special_pos%midplane%inner%psi (vecflt_type) |
| theta_b | orbit%global_param%special_pos%midplane%inner%theta_b (vecflt_type) |
| turning_pts | orbit%global_param%special_pos%turning_pts (orbit_turning_pts) |
| upper | orbit%global_param%special_pos%turning_pts%upper (orbit_pos) |
| r | orbit%global_param%special_pos%turning_pts%upper%r (vecflt_type) |
| z | orbit%global_param%special_pos%turning_pts%upper%z (vecflt_type) |
| phi | orbit%global_param%special_pos%turning_pts%upper%phi (vecflt_type) |
| psi | orbit%global_param%special_pos%turning_pts%upper%psi (vecflt_type) |
| theta_b | orbit%global_param%special_pos%turning_pts%upper%theta_b (vecflt_type) |
| lower | orbit%global_param%special_pos%turning_pts%lower (orbit_pos) |
| r | orbit%global_param%special_pos%turning_pts%lower%r (vecflt_type) |
| z | orbit%global_param%special_pos%turning_pts%lower%z (vecflt_type) |
| phi | orbit%global_param%special_pos%turning_pts%lower%phi (vecflt_type) |
| psi | orbit%global_param%special_pos%turning_pts%lower%psi (vecflt_type) |
| theta_b | orbit%global_param%special_pos%turning_pts%lower%theta_b (vecflt_type) |
| codeparam | orbit%codeparam (codeparam) |
| codename | orbit%codeparam%codename (string) |
| codeversion | orbit%codeparam%codeversion (string) |
| parameters | orbit%codeparam%parameters (string) |
| output_diag | orbit%codeparam%output_diag (string) |
| output_flag | orbit%codeparam%output_flag (integer) |
| time | orbit%time (float) |
| datainfo | pellets%datainfo (datainfo) |
| dataprovider | pellets%datainfo%dataprovider (string) |
| putdate | pellets%datainfo%putdate (string) |
| source | pellets%datainfo%source (string) |
| comment | pellets%datainfo%comment (string) |
| cocos | pellets%datainfo%cocos (integer) |
| id | pellets%datainfo%id (integer) |
| isref | pellets%datainfo%isref (integer) |
| whatref | pellets%datainfo%whatref (whatref) |
| user | pellets%datainfo%whatref%user (string) |
| machine | pellets%datainfo%whatref%machine (string) |
| shot | pellets%datainfo%whatref%shot (integer) |
| run | pellets%datainfo%whatref%run (integer) |
| occurrence | pellets%datainfo%whatref%occurrence (integer) |
| putinfo | pellets%datainfo%putinfo (putinfo) |
| putmethod | pellets%datainfo%putinfo%putmethod (string) |
| putaccess | pellets%datainfo%putinfo%putaccess (string) |
| putlocation | pellets%datainfo%putinfo%putlocation (string) |
| rights | pellets%datainfo%putinfo%rights (string) |
| compositions | pellets%compositions (compositions_type) |
| nuclei | pellets%compositions%nuclei(:) (nuclei) |
| zn | pellets%compositions%nuclei(:)%zn (float) |
| amn | pellets%compositions%nuclei(:)%amn (float) |
| label | pellets%compositions%nuclei(:)%label (string) |
| ions | pellets%compositions%ions(:) (ions) |
| nucindex | pellets%compositions%ions(:)%nucindex (integer) |
| zion | pellets%compositions%ions(:)%zion (float) |
| imp_flag | pellets%compositions%ions(:)%imp_flag (integer) |
| label | pellets%compositions%ions(:)%label (string) |
| impurities | pellets%compositions%impurities(:) (impurities) |
| nucindex | pellets%compositions%impurities(:)%nucindex (integer) |
| i_ion | pellets%compositions%impurities(:)%i_ion (integer) |
| nzimp | pellets%compositions%impurities(:)%nzimp (integer) |
| zmin | pellets%compositions%impurities(:)%zmin (vecflt_type) |
| zmax | pellets%compositions%impurities(:)%zmax (vecflt_type) |
| label | pellets%compositions%impurities(:)%label (vecstring_type) |
| neutralscomp | pellets%compositions%neutralscomp(:) (composition_neutralscomp) |
| neutcomp | pellets%compositions%neutralscomp(:)%neutcomp(:) (composition_neutrals_neutcomp) |
| nucindex | pellets%compositions%neutralscomp(:)%neutcomp(:)%nucindex (integer) |
| multiplicity | pellets%compositions%neutralscomp(:)%neutcomp(:)%multiplicity (integer) |
| type | pellets%compositions%neutralscomp(:)%type(:) (identifier) |
| id | pellets%compositions%neutralscomp(:)%type(:)%id (string) |
| flag | pellets%compositions%neutralscomp(:)%type(:)%flag (integer) |
| description | pellets%compositions%neutralscomp(:)%type(:)%description (string) |
| label | pellets%compositions%neutralscomp(:)%label (string) |
| edgespecies | pellets%compositions%edgespecies(:) (edgespecies) |
| nucindex | pellets%compositions%edgespecies(:)%nucindex (integer) |
| zmin | pellets%compositions%edgespecies(:)%zmin (float) |
| zmax | pellets%compositions%edgespecies(:)%zmax (float) |
| label | pellets%compositions%edgespecies(:)%label (string) |
| signature | pellets%compositions%signature (identifier) |
| id | pellets%compositions%signature%id (string) |
| flag | pellets%compositions%signature%flag (integer) |
| description | pellets%compositions%signature%description (string) |
| pellet | pellets%pellet(:) (pellet) |
| shape | pellets%pellet(:)%shape (pellet_shape) |
| type | pellets%pellet(:)%shape%type (identifier) |
| id | pellets%pellet(:)%shape%type%id (string) |
| flag | pellets%pellet(:)%shape%type%flag (integer) |
| description | pellets%pellet(:)%shape%type%description (string) |
| dimensions | pellets%pellet(:)%shape%dimensions (vecflt_type) |
| elements | pellets%pellet(:)%elements (pellet_elements) |
| nucindex | pellets%pellet(:)%elements%nucindex (vecint_type) |
| density | pellets%pellet(:)%elements%density (vecflt_type) |
| fraction | pellets%pellet(:)%elements%fraction (vecflt_type) |
| subl_energy | pellets%pellet(:)%elements%subl_energy (vecflt_type) |
| geometry | pellets%pellet(:)%geometry (pellet_geometry) |
| pivot_point | pellets%pellet(:)%geometry%pivot_point (rzphi0D) |
| r | pellets%pellet(:)%geometry%pivot_point%r (float) |
| z | pellets%pellet(:)%geometry%pivot_point%z (float) |
| phi | pellets%pellet(:)%geometry%pivot_point%phi (float) |
| second_point | pellets%pellet(:)%geometry%second_point (rzphi0D) |
| r | pellets%pellet(:)%geometry%second_point%r (float) |
| z | pellets%pellet(:)%geometry%second_point%z (float) |
| phi | pellets%pellet(:)%geometry%second_point%phi (float) |
| velocity | pellets%pellet(:)%geometry%velocity (float) |
| angles | pellets%pellet(:)%geometry%angles (pellet_angles) |
| horizontal | pellets%pellet(:)%geometry%angles%horizontal (float) |
| vertical | pellets%pellet(:)%geometry%angles%vertical (float) |
| pathprofiles | pellets%pellet(:)%pathprofiles (pellet_pathprofiles) |
| distance | pellets%pellet(:)%pathprofiles%distance (vecflt_type) |
| rho_tor | pellets%pellet(:)%pathprofiles%rho_tor (vecflt_type) |
| rho_pol | pellets%pellet(:)%pathprofiles%rho_pol (vecflt_type) |
| velocity | pellets%pellet(:)%pathprofiles%velocity (vecflt_type) |
| ne | pellets%pellet(:)%pathprofiles%ne (vecflt_type) |
| te | pellets%pellet(:)%pathprofiles%te (vecflt_type) |
| abl_rate | pellets%pellet(:)%pathprofiles%abl_rate (vecflt_type) |
| abl_particles | pellets%pellet(:)%pathprofiles%abl_particles (vecflt_type) |
| delta_drift | pellets%pellet(:)%pathprofiles%delta_drift (vecflt_type) |
| position | pellets%pellet(:)%pathprofiles%position (rzphi1D) |
| r | pellets%pellet(:)%pathprofiles%position%r (vecflt_type) |
| z | pellets%pellet(:)%pathprofiles%position%z (vecflt_type) |
| phi | pellets%pellet(:)%pathprofiles%position%phi (vecflt_type) |
| deposition | pellets%pellet(:)%deposition (pellet_deposition) |
| rho_tor | pellets%pellet(:)%deposition%rho_tor (vecflt_type) |
| rho_pol | pellets%pellet(:)%deposition%rho_pol (vecflt_type) |
| delta_ne | pellets%pellet(:)%deposition%delta_ne (vecflt_type) |
| delta_te | pellets%pellet(:)%deposition%delta_te (vecflt_type) |
| delta_ni | pellets%pellet(:)%deposition%delta_ni (matflt_type) |
| delta_ti | pellets%pellet(:)%deposition%delta_ti (matflt_type) |
| delta_vtor | pellets%pellet(:)%deposition%delta_vtor (matflt_type) |
| impurity | pellets%pellet(:)%deposition%impurity(:) (pellet_impurity) |
| delta_nz | pellets%pellet(:)%deposition%impurity(:)%delta_nz (matflt_type) |
| codeparam | pellets%codeparam (codeparam) |
| codename | pellets%codeparam%codename (string) |
| codeversion | pellets%codeparam%codeversion (string) |
| parameters | pellets%codeparam%parameters (string) |
| output_diag | pellets%codeparam%output_diag (string) |
| output_flag | pellets%codeparam%output_flag (integer) |
| time | pellets%time (float) |
| datainfo | pfsystems%datainfo (datainfo) |
| dataprovider | pfsystems%datainfo%dataprovider (string) |
| putdate | pfsystems%datainfo%putdate (string) |
| source | pfsystems%datainfo%source (string) |
| comment | pfsystems%datainfo%comment (string) |
| cocos | pfsystems%datainfo%cocos (integer) |
| id | pfsystems%datainfo%id (integer) |
| isref | pfsystems%datainfo%isref (integer) |
| whatref | pfsystems%datainfo%whatref (whatref) |
| user | pfsystems%datainfo%whatref%user (string) |
| machine | pfsystems%datainfo%whatref%machine (string) |
| shot | pfsystems%datainfo%whatref%shot (integer) |
| run | pfsystems%datainfo%whatref%run (integer) |
| occurrence | pfsystems%datainfo%whatref%occurrence (integer) |
| putinfo | pfsystems%datainfo%putinfo (putinfo) |
| putmethod | pfsystems%datainfo%putinfo%putmethod (string) |
| putaccess | pfsystems%datainfo%putinfo%putaccess (string) |
| putlocation | pfsystems%datainfo%putinfo%putlocation (string) |
| rights | pfsystems%datainfo%putinfo%rights (string) |
| pfcoils | pfsystems%pfcoils (pfcoils) |
| desc_pfcoils | pfsystems%pfcoils%desc_pfcoils (desc_pfcoils) |
| name | pfsystems%pfcoils%desc_pfcoils%name (vecstring_type) |
| id | pfsystems%pfcoils%desc_pfcoils%id (vecstring_type) |
| res | pfsystems%pfcoils%desc_pfcoils%res (vecflt_type) |
| emax | pfsystems%pfcoils%desc_pfcoils%emax (vecflt_type) |
| structure_cs | pfsystems%pfcoils%desc_pfcoils%structure_cs (structure_cs) |
| gaptf | pfsystems%pfcoils%desc_pfcoils%structure_cs%gaptf (float) |
| ri | pfsystems%pfcoils%desc_pfcoils%structure_cs%ri (float) |
| re | pfsystems%pfcoils%desc_pfcoils%structure_cs%re (float) |
| jcable | pfsystems%pfcoils%desc_pfcoils%structure_cs%jcable (float) |
| current_nom | pfsystems%pfcoils%desc_pfcoils%structure_cs%current_nom (float) |
| sigma | pfsystems%pfcoils%desc_pfcoils%structure_cs%sigma (float) |
| tiso | pfsystems%pfcoils%desc_pfcoils%structure_cs%tiso (float) |
| nlay | pfsystems%pfcoils%desc_pfcoils%structure_cs%nlay (float) |
| pol_flux_cs | pfsystems%pfcoils%desc_pfcoils%pol_flux_cs (float) |
| nelement | pfsystems%pfcoils%desc_pfcoils%nelement (vecint_type) |
| pfelement | pfsystems%pfcoils%desc_pfcoils%pfelement (pfelement) |
| name | pfsystems%pfcoils%desc_pfcoils%pfelement%name (vecstring_type) |
| id | pfsystems%pfcoils%desc_pfcoils%pfelement%id (vecstring_type) |
| turnsign | pfsystems%pfcoils%desc_pfcoils%pfelement%turnsign (matflt_type) |
| area | pfsystems%pfcoils%desc_pfcoils%pfelement%area (matflt_type) |
| pfgeometry | pfsystems%pfcoils%desc_pfcoils%pfelement%pfgeometry (pfgeometry) |
| type | pfsystems%pfcoils%desc_pfcoils%pfelement%pfgeometry%type (matint_type) |
| npoints | pfsystems%pfcoils%desc_pfcoils%pfelement%pfgeometry%npoints (matint_type) |
| rzcoordinate | pfsystems%pfcoils%desc_pfcoils%pfelement%pfgeometry%rzcoordinate (rz3D) |
| r | pfsystems%pfcoils%desc_pfcoils%pfelement%pfgeometry%rzcoordinate%r (array3dflt_type) |
| z | pfsystems%pfcoils%desc_pfcoils%pfelement%pfgeometry%rzcoordinate%z (array3dflt_type) |
| rzdrdz | pfsystems%pfcoils%desc_pfcoils%pfelement%pfgeometry%rzdrdz (array3dflt_type) |
| coilcurrent | pfsystems%pfcoils%coilcurrent (exp1D) |
| value | pfsystems%pfcoils%coilcurrent%value (vecflt_type) |
| abserror | pfsystems%pfcoils%coilcurrent%abserror (vecflt_type) |
| relerror | pfsystems%pfcoils%coilcurrent%relerror (vecflt_type) |
| coilvoltage | pfsystems%pfcoils%coilvoltage (exp1D) |
| value | pfsystems%pfcoils%coilvoltage%value (vecflt_type) |
| abserror | pfsystems%pfcoils%coilvoltage%abserror (vecflt_type) |
| relerror | pfsystems%pfcoils%coilvoltage%relerror (vecflt_type) |
| p_cryo | pfsystems%pfcoils%p_cryo (float) |
| p_nh | pfsystems%pfcoils%p_nh (vecflt_type) |
| pfpassive | pfsystems%pfpassive (pfpassive) |
| name | pfsystems%pfpassive%name (vecstring_type) |
| area | pfsystems%pfpassive%area (vecflt_type) |
| res | pfsystems%pfpassive%res (vecflt_type) |
| eta | pfsystems%pfpassive%eta (vecflt_type) |
| current | pfsystems%pfpassive%current (pfpassive_current) |
| toroidal | pfsystems%pfpassive%current%toroidal (exp1D) |
| value | pfsystems%pfpassive%current%toroidal%value (vecflt_type) |
| abserror | pfsystems%pfpassive%current%toroidal%abserror (vecflt_type) |
| relerror | pfsystems%pfpassive%current%toroidal%relerror (vecflt_type) |
| poloidal | pfsystems%pfpassive%current%poloidal (exp1D) |
| value | pfsystems%pfpassive%current%poloidal%value (vecflt_type) |
| abserror | pfsystems%pfpassive%current%poloidal%abserror (vecflt_type) |
| relerror | pfsystems%pfpassive%current%poloidal%relerror (vecflt_type) |
| pfpageometry | pfsystems%pfpassive%pfpageometry (pfpageometry) |
| type | pfsystems%pfpassive%pfpageometry%type (vecint_type) |
| npoints | pfsystems%pfpassive%pfpageometry%npoints (vecint_type) |
| rzcoordinate | pfsystems%pfpassive%pfpageometry%rzcoordinate (rz2D) |
| r | pfsystems%pfpassive%pfpageometry%rzcoordinate%r (matflt_type) |
| z | pfsystems%pfpassive%pfpageometry%rzcoordinate%z (matflt_type) |
| rzdrdz | pfsystems%pfpassive%pfpageometry%rzdrdz (matflt_type) |
| pfcircuits | pfsystems%pfcircuits (pfcircuits) |
| name | pfsystems%pfcircuits%name (vecstring_type) |
| id | pfsystems%pfcircuits%id (vecstring_type) |
| type | pfsystems%pfcircuits%type (vecstring_type) |
| nnodes | pfsystems%pfcircuits%nnodes (vecint_type) |
| connections | pfsystems%pfcircuits%connections (array3dint_type) |
| pfsupplies | pfsystems%pfsupplies (pfsupplies) |
| desc_supply | pfsystems%pfsupplies%desc_supply (desc_supply) |
| name | pfsystems%pfsupplies%desc_supply%name (vecstring_type) |
| id | pfsystems%pfsupplies%desc_supply%id (vecstring_type) |
| type | pfsystems%pfsupplies%desc_supply%type (vecstring_type) |
| delay | pfsystems%pfsupplies%desc_supply%delay (vecflt_type) |
| filter | pfsystems%pfsupplies%desc_supply%filter (filter) |
| num | pfsystems%pfsupplies%desc_supply%filter%num (matflt_type) |
| den | pfsystems%pfsupplies%desc_supply%filter%den (matflt_type) |
| imin | pfsystems%pfsupplies%desc_supply%imin (vecflt_type) |
| imax | pfsystems%pfsupplies%desc_supply%imax (vecflt_type) |
| res | pfsystems%pfsupplies%desc_supply%res (vecflt_type) |
| umin | pfsystems%pfsupplies%desc_supply%umin (vecflt_type) |
| umax | pfsystems%pfsupplies%desc_supply%umax (vecflt_type) |
| emax | pfsystems%pfsupplies%desc_supply%emax (vecflt_type) |
| voltage | pfsystems%pfsupplies%voltage (exp1D) |
| value | pfsystems%pfsupplies%voltage%value (vecflt_type) |
| abserror | pfsystems%pfsupplies%voltage%abserror (vecflt_type) |
| relerror | pfsystems%pfsupplies%voltage%relerror (vecflt_type) |
| current | pfsystems%pfsupplies%current (exp1D) |
| value | pfsystems%pfsupplies%current%value (vecflt_type) |
| abserror | pfsystems%pfsupplies%current%abserror (vecflt_type) |
| relerror | pfsystems%pfsupplies%current%relerror (vecflt_type) |
| codeparam | pfsystems%codeparam (codeparam) |
| codename | pfsystems%codeparam%codename (string) |
| codeversion | pfsystems%codeparam%codeversion (string) |
| parameters | pfsystems%codeparam%parameters (string) |
| output_diag | pfsystems%codeparam%output_diag (string) |
| output_flag | pfsystems%codeparam%output_flag (integer) |
| time | pfsystems%time (float) |
| datainfo | lineintegraldiag%datainfo (datainfo) |
| dataprovider | lineintegraldiag%datainfo%dataprovider (string) |
| putdate | lineintegraldiag%datainfo%putdate (string) |
| source | lineintegraldiag%datainfo%source (string) |
| comment | lineintegraldiag%datainfo%comment (string) |
| cocos | lineintegraldiag%datainfo%cocos (integer) |
| id | lineintegraldiag%datainfo%id (integer) |
| isref | lineintegraldiag%datainfo%isref (integer) |
| whatref | lineintegraldiag%datainfo%whatref (whatref) |
| user | lineintegraldiag%datainfo%whatref%user (string) |
| machine | lineintegraldiag%datainfo%whatref%machine (string) |
| shot | lineintegraldiag%datainfo%whatref%shot (integer) |
| run | lineintegraldiag%datainfo%whatref%run (integer) |
| occurrence | lineintegraldiag%datainfo%whatref%occurrence (integer) |
| putinfo | lineintegraldiag%datainfo%putinfo (putinfo) |
| putmethod | lineintegraldiag%datainfo%putinfo%putmethod (string) |
| putaccess | lineintegraldiag%datainfo%putinfo%putaccess (string) |
| putlocation | lineintegraldiag%datainfo%putinfo%putlocation (string) |
| rights | lineintegraldiag%datainfo%putinfo%rights (string) |
| expression | lineintegraldiag%expression (string) |
| setup_line | lineintegraldiag%setup_line (setup_line) |
| pivot_point | lineintegraldiag%setup_line%pivot_point (rzphi1D) |
| r | lineintegraldiag%setup_line%pivot_point%r (vecflt_type) |
| z | lineintegraldiag%setup_line%pivot_point%z (vecflt_type) |
| phi | lineintegraldiag%setup_line%pivot_point%phi (vecflt_type) |
| horchordang1 | lineintegraldiag%setup_line%horchordang1 (vecflt_type) |
| verchordang1 | lineintegraldiag%setup_line%verchordang1 (vecflt_type) |
| width | lineintegraldiag%setup_line%width (vecflt_type) |
| second_point | lineintegraldiag%setup_line%second_point (rzphi1D) |
| r | lineintegraldiag%setup_line%second_point%r (vecflt_type) |
| z | lineintegraldiag%setup_line%second_point%z (vecflt_type) |
| phi | lineintegraldiag%setup_line%second_point%phi (vecflt_type) |
| horchordang2 | lineintegraldiag%setup_line%horchordang2 (vecflt_type) |
| verchordang2 | lineintegraldiag%setup_line%verchordang2 (vecflt_type) |
| third_point | lineintegraldiag%setup_line%third_point (rzphi1D) |
| r | lineintegraldiag%setup_line%third_point%r (vecflt_type) |
| z | lineintegraldiag%setup_line%third_point%z (vecflt_type) |
| phi | lineintegraldiag%setup_line%third_point%phi (vecflt_type) |
| nchordpoints | lineintegraldiag%setup_line%nchordpoints (integer) |
| measure | lineintegraldiag%measure (exp1D) |
| value | lineintegraldiag%measure%value (vecflt_type) |
| abserror | lineintegraldiag%measure%abserror (vecflt_type) |
| relerror | lineintegraldiag%measure%relerror (vecflt_type) |
| codeparam | lineintegraldiag%codeparam (codeparam) |
| codename | lineintegraldiag%codeparam%codename (string) |
| codeversion | lineintegraldiag%codeparam%codeversion (string) |
| parameters | lineintegraldiag%codeparam%parameters (string) |
| output_diag | lineintegraldiag%codeparam%output_diag (string) |
| output_flag | lineintegraldiag%codeparam%output_flag (integer) |
| time | lineintegraldiag%time (float) |
| datainfo | power_conv%datainfo (datainfo) |
| dataprovider | power_conv%datainfo%dataprovider (string) |
| putdate | power_conv%datainfo%putdate (string) |
| source | power_conv%datainfo%source (string) |
| comment | power_conv%datainfo%comment (string) |
| cocos | power_conv%datainfo%cocos (integer) |
| id | power_conv%datainfo%id (integer) |
| isref | power_conv%datainfo%isref (integer) |
| whatref | power_conv%datainfo%whatref (whatref) |
| user | power_conv%datainfo%whatref%user (string) |
| machine | power_conv%datainfo%whatref%machine (string) |
| shot | power_conv%datainfo%whatref%shot (integer) |
| run | power_conv%datainfo%whatref%run (integer) |
| occurrence | power_conv%datainfo%whatref%occurrence (integer) |
| putinfo | power_conv%datainfo%putinfo (putinfo) |
| putmethod | power_conv%datainfo%putinfo%putmethod (string) |
| putaccess | power_conv%datainfo%putinfo%putaccess (string) |
| putlocation | power_conv%datainfo%putinfo%putlocation (string) |
| rights | power_conv%datainfo%putinfo%rights (string) |
| cycle_type | power_conv%cycle_type (string) |
| circuits | power_conv%circuits(:) (circuits) |
| component | power_conv%circuits(:)%component(:) (power_conv_component) |
| name | power_conv%circuits(:)%component(:)%name (string) |
| temp_in | power_conv%circuits(:)%component(:)%temp_in (float) |
| temp_out | power_conv%circuits(:)%component(:)%temp_out (float) |
| press_in | power_conv%circuits(:)%component(:)%press_in (float) |
| press_out | power_conv%circuits(:)%component(:)%press_out (float) |
| power | power_conv%circuits(:)%component(:)%power (float) |
| flow | power_conv%circuits(:)%component(:)%flow (float) |
| power_net | power_conv%circuits(:)%power_net (float) |
| power_int | power_conv%circuits(:)%power_int (float) |
| efficiency | power_conv%circuits(:)%efficiency (float) |
| power_recirc | power_conv%power_recirc (float) |
| power_net | power_conv%power_net (float) |
| power_int | power_conv%power_int (float) |
| efficiency | power_conv%efficiency (float) |
| codeparam | power_conv%codeparam (codeparam) |
| codename | power_conv%codeparam%codename (string) |
| codeversion | power_conv%codeparam%codeversion (string) |
| parameters | power_conv%codeparam%parameters (string) |
| output_diag | power_conv%codeparam%output_diag (string) |
| output_flag | power_conv%codeparam%output_flag (integer) |
| time | power_conv%time (float) |
| datainfo | reflectomet%datainfo (datainfo) |
| dataprovider | reflectomet%datainfo%dataprovider (string) |
| putdate | reflectomet%datainfo%putdate (string) |
| source | reflectomet%datainfo%source (string) |
| comment | reflectomet%datainfo%comment (string) |
| cocos | reflectomet%datainfo%cocos (integer) |
| id | reflectomet%datainfo%id (integer) |
| isref | reflectomet%datainfo%isref (integer) |
| whatref | reflectomet%datainfo%whatref (whatref) |
| user | reflectomet%datainfo%whatref%user (string) |
| machine | reflectomet%datainfo%whatref%machine (string) |
| shot | reflectomet%datainfo%whatref%shot (integer) |
| run | reflectomet%datainfo%whatref%run (integer) |
| occurrence | reflectomet%datainfo%whatref%occurrence (integer) |
| putinfo | reflectomet%datainfo%putinfo (putinfo) |
| putmethod | reflectomet%datainfo%putinfo%putmethod (string) |
| putaccess | reflectomet%datainfo%putinfo%putaccess (string) |
| putlocation | reflectomet%datainfo%putinfo%putlocation (string) |
| rights | reflectomet%datainfo%putinfo%rights (string) |
| refl_receive | reflectomet%refl_receive(:) (refl_receive) |
| name | reflectomet%refl_receive(:)%name (string) |
| raw_signal | reflectomet%refl_receive(:)%raw_signal (t_series_real) |
| time_wind | reflectomet%refl_receive(:)%raw_signal%time_wind (vecflt_type) |
| values | reflectomet%refl_receive(:)%raw_signal%values (vecflt_type) |
| io_signal | reflectomet%refl_receive(:)%io_signal (t_series_real) |
| time_wind | reflectomet%refl_receive(:)%io_signal%time_wind (vecflt_type) |
| values | reflectomet%refl_receive(:)%io_signal%values (vecflt_type) |
| iq_receiver | reflectomet%refl_receive(:)%iq_receiver (t_series_cplx) |
| time_wind | reflectomet%refl_receive(:)%iq_receiver%time_wind (vecflt_type) |
| values_re | reflectomet%refl_receive(:)%iq_receiver%values_re (vecflt_type) |
| values_im | reflectomet%refl_receive(:)%iq_receiver%values_im (vecflt_type) |
| antenna_ind | reflectomet%refl_receive(:)%antenna_ind (integer) |
| antennas | reflectomet%antennas(:) (reflectometry_antennas) |
| name | reflectomet%antennas(:)%name (string) |
| type | reflectomet%antennas(:)%type (identifier) |
| id | reflectomet%antennas(:)%type%id (string) |
| flag | reflectomet%antennas(:)%type%flag (integer) |
| description | reflectomet%antennas(:)%type%description (string) |
| origin | reflectomet%antennas(:)%origin (origin) |
| refpos | reflectomet%antennas(:)%origin%refpos (rzphi0D) |
| r | reflectomet%antennas(:)%origin%refpos%r (float) |
| z | reflectomet%antennas(:)%origin%refpos%z (float) |
| phi | reflectomet%antennas(:)%origin%refpos%phi (float) |
| alpha | reflectomet%antennas(:)%origin%alpha (float) |
| beta | reflectomet%antennas(:)%origin%beta (float) |
| gamma | reflectomet%antennas(:)%origin%gamma (float) |
| radfield | reflectomet%antennas(:)%radfield (reflectometry_radfield) |
| type | reflectomet%antennas(:)%radfield%type (identifier) |
| id | reflectomet%antennas(:)%radfield%type%id (string) |
| flag | reflectomet%antennas(:)%radfield%type%flag (integer) |
| description | reflectomet%antennas(:)%radfield%type%description (string) |
| position | reflectomet%antennas(:)%radfield%position (vecflt_type) |
| gaussian | reflectomet%antennas(:)%radfield%gaussian(:) (reflectometry_radfield_gaussian) |
| aperture | reflectomet%antennas(:)%radfield%gaussian(:)%aperture (simp_apert) |
| type | reflectomet%antennas(:)%radfield%gaussian(:)%aperture%type (identifier) |
| id | reflectomet%antennas(:)%radfield%gaussian(:)%aperture%type%id (string) |
| flag | reflectomet%antennas(:)%radfield%gaussian(:)%aperture%type%flag (integer) |
| description | reflectomet%antennas(:)%radfield%gaussian(:)%aperture%type%description (string) |
| sizes | reflectomet%antennas(:)%radfield%gaussian(:)%aperture%sizes (vecflt_type) |
| angle | reflectomet%antennas(:)%radfield%gaussian(:)%aperture%angle (float) |
| waistsize | reflectomet%antennas(:)%radfield%gaussian(:)%waistsize (vecflt_type) |
| waistzpos | reflectomet%antennas(:)%radfield%gaussian(:)%waistzpos (vecflt_type) |
| tiltangle | reflectomet%antennas(:)%radfield%gaussian(:)%tiltangle (vecflt_type) |
| polar_angle | reflectomet%antennas(:)%radfield%gaussian(:)%polar_angle (vecflt_type) |
| frequency | reflectomet%antennas(:)%radfield%gaussian(:)%frequency (float) |
| efield | reflectomet%antennas(:)%radfield%efield(:) (reflectometry_radifield_efield) |
| grid2d | reflectomet%antennas(:)%radfield%efield(:)%grid2d (reggrid) |
| dim1 | reflectomet%antennas(:)%radfield%efield(:)%grid2d%dim1 (vecflt_type) |
| dim2 | reflectomet%antennas(:)%radfield%efield(:)%grid2d%dim2 (vecflt_type) |
| e1 | reflectomet%antennas(:)%radfield%efield(:)%e1 (matcplx_type) |
| e2 | reflectomet%antennas(:)%radfield%efield(:)%e2 (matcplx_type) |
| frequency | reflectomet%antennas(:)%radfield%efield(:)%frequency (float) |
| geometry | reflectomet%antennas(:)%geometry (float) |
| launchsignal | reflectomet%antennas(:)%launchsignal (launchsignal) |
| time_launch | reflectomet%antennas(:)%launchsignal%time_launch (vecflt_type) |
| freq | reflectomet%antennas(:)%launchsignal%freq (vecflt_type) |
| amplitude | reflectomet%antennas(:)%launchsignal%amplitude (vecflt_type) |
| phase | reflectomet%antennas(:)%launchsignal%phase (vecflt_type) |
| codeparam | reflectomet%codeparam (codeparam) |
| codename | reflectomet%codeparam%codename (string) |
| codeversion | reflectomet%codeparam%codeversion (string) |
| parameters | reflectomet%codeparam%parameters (string) |
| output_diag | reflectomet%codeparam%output_diag (string) |
| output_flag | reflectomet%codeparam%output_flag (integer) |
| time | reflectomet%time (float) |
| datainfo | rfadiag%datainfo (datainfo) |
| dataprovider | rfadiag%datainfo%dataprovider (string) |
| putdate | rfadiag%datainfo%putdate (string) |
| source | rfadiag%datainfo%source (string) |
| comment | rfadiag%datainfo%comment (string) |
| cocos | rfadiag%datainfo%cocos (integer) |
| id | rfadiag%datainfo%id (integer) |
| isref | rfadiag%datainfo%isref (integer) |
| whatref | rfadiag%datainfo%whatref (whatref) |
| user | rfadiag%datainfo%whatref%user (string) |
| machine | rfadiag%datainfo%whatref%machine (string) |
| shot | rfadiag%datainfo%whatref%shot (integer) |
| run | rfadiag%datainfo%whatref%run (integer) |
| occurrence | rfadiag%datainfo%whatref%occurrence (integer) |
| putinfo | rfadiag%datainfo%putinfo (putinfo) |
| putmethod | rfadiag%datainfo%putinfo%putmethod (string) |
| putaccess | rfadiag%datainfo%putinfo%putaccess (string) |
| putlocation | rfadiag%datainfo%putinfo%putlocation (string) |
| rights | rfadiag%datainfo%putinfo%rights (string) |
| setup | rfadiag%setup (rfasetup) |
| position | rfadiag%setup%position (rzphi1Dexp) |
| r | rfadiag%setup%position%r (exp1D) |
| value | rfadiag%setup%position%r%value (vecflt_type) |
| abserror | rfadiag%setup%position%r%abserror (vecflt_type) |
| relerror | rfadiag%setup%position%r%relerror (vecflt_type) |
| z | rfadiag%setup%position%z (exp1D) |
| value | rfadiag%setup%position%z%value (vecflt_type) |
| abserror | rfadiag%setup%position%z%abserror (vecflt_type) |
| relerror | rfadiag%setup%position%z%relerror (vecflt_type) |
| phi | rfadiag%setup%position%phi (exp1D) |
| value | rfadiag%setup%position%phi%value (vecflt_type) |
| abserror | rfadiag%setup%position%phi%abserror (vecflt_type) |
| relerror | rfadiag%setup%position%phi%relerror (vecflt_type) |
| measure | rfadiag%measure (rfameasure) |
| ti | rfadiag%measure%ti (exp1D) |
| value | rfadiag%measure%ti%value (vecflt_type) |
| abserror | rfadiag%measure%ti%abserror (vecflt_type) |
| relerror | rfadiag%measure%ti%relerror (vecflt_type) |
| codeparam | rfadiag%codeparam (codeparam) |
| codename | rfadiag%codeparam%codename (string) |
| codeversion | rfadiag%codeparam%codeversion (string) |
| parameters | rfadiag%codeparam%parameters (string) |
| output_diag | rfadiag%codeparam%output_diag (string) |
| output_flag | rfadiag%codeparam%output_flag (integer) |
| time | rfadiag%time (float) |
| datainfo | sawteeth%datainfo (datainfo) |
| dataprovider | sawteeth%datainfo%dataprovider (string) |
| putdate | sawteeth%datainfo%putdate (string) |
| source | sawteeth%datainfo%source (string) |
| comment | sawteeth%datainfo%comment (string) |
| cocos | sawteeth%datainfo%cocos (integer) |
| id | sawteeth%datainfo%id (integer) |
| isref | sawteeth%datainfo%isref (integer) |
| whatref | sawteeth%datainfo%whatref (whatref) |
| user | sawteeth%datainfo%whatref%user (string) |
| machine | sawteeth%datainfo%whatref%machine (string) |
| shot | sawteeth%datainfo%whatref%shot (integer) |
| run | sawteeth%datainfo%whatref%run (integer) |
| occurrence | sawteeth%datainfo%whatref%occurrence (integer) |
| putinfo | sawteeth%datainfo%putinfo (putinfo) |
| putmethod | sawteeth%datainfo%putinfo%putmethod (string) |
| putaccess | sawteeth%datainfo%putinfo%putaccess (string) |
| putlocation | sawteeth%datainfo%putinfo%putlocation (string) |
| rights | sawteeth%datainfo%putinfo%rights (string) |
| crash_trig | sawteeth%crash_trig (integer) |
| composition | sawteeth%composition (composition) |
| amn | sawteeth%composition%amn (vecflt_type) |
| zn | sawteeth%composition%zn (vecflt_type) |
| zion | sawteeth%composition%zion (vecflt_type) |
| imp_flag | sawteeth%composition%imp_flag (vecint_type) |
| label | sawteeth%composition%label (vecstring_type) |
| rho_tor_norm | sawteeth%rho_tor_norm (vecflt_type) |
| rho_tor | sawteeth%rho_tor (vecflt_type) |
| profiles1d | sawteeth%profiles1d (sawteeth_profiles1d) |
| ne | sawteeth%profiles1d%ne (vecflt_type) |
| ni | sawteeth%profiles1d%ni (matflt_type) |
| te | sawteeth%profiles1d%te (vecflt_type) |
| ti | sawteeth%profiles1d%ti (matflt_type) |
| psi | sawteeth%profiles1d%psi (vecflt_type) |
| phi | sawteeth%profiles1d%phi (vecflt_type) |
| psistar | sawteeth%profiles1d%psistar (vecflt_type) |
| volume | sawteeth%profiles1d%volume (vecflt_type) |
| q | sawteeth%profiles1d%q (vecflt_type) |
| diags | sawteeth%diags (sawteeth_diags) |
| shear1 | sawteeth%diags%shear1 (float) |
| rhotorn_q1 | sawteeth%diags%rhotorn_q1 (float) |
| rhotorn_inv | sawteeth%diags%rhotorn_inv (float) |
| rhotorn_mix | sawteeth%diags%rhotorn_mix (float) |
| codeparam | sawteeth%codeparam (codeparam) |
| codename | sawteeth%codeparam%codename (string) |
| codeversion | sawteeth%codeparam%codeversion (string) |
| parameters | sawteeth%codeparam%parameters (string) |
| output_diag | sawteeth%codeparam%output_diag (string) |
| output_flag | sawteeth%codeparam%output_flag (integer) |
| time | sawteeth%time (float) |
| datainfo | scenario%datainfo (datainfo) |
| dataprovider | scenario%datainfo%dataprovider (string) |
| putdate | scenario%datainfo%putdate (string) |
| source | scenario%datainfo%source (string) |
| comment | scenario%datainfo%comment (string) |
| cocos | scenario%datainfo%cocos (integer) |
| id | scenario%datainfo%id (integer) |
| isref | scenario%datainfo%isref (integer) |
| whatref | scenario%datainfo%whatref (whatref) |
| user | scenario%datainfo%whatref%user (string) |
| machine | scenario%datainfo%whatref%machine (string) |
| shot | scenario%datainfo%whatref%shot (integer) |
| run | scenario%datainfo%whatref%run (integer) |
| occurrence | scenario%datainfo%whatref%occurrence (integer) |
| putinfo | scenario%datainfo%putinfo (putinfo) |
| putmethod | scenario%datainfo%putinfo%putmethod (string) |
| putaccess | scenario%datainfo%putinfo%putaccess (string) |
| putlocation | scenario%datainfo%putinfo%putlocation (string) |
| rights | scenario%datainfo%putinfo%rights (string) |
| centre | scenario%centre (scenario_centre) |
| te0 | scenario%centre%te0 (scenario_ref) |
| value | scenario%centre%te0%value (float) |
| source | scenario%centre%te0%source (string) |
| ti0 | scenario%centre%ti0 (scenario_ref) |
| value | scenario%centre%ti0%value (float) |
| source | scenario%centre%ti0%source (string) |
| ne0 | scenario%centre%ne0 (scenario_ref) |
| value | scenario%centre%ne0%value (float) |
| source | scenario%centre%ne0%source (string) |
| ni0 | scenario%centre%ni0 (scenario_ref) |
| value | scenario%centre%ni0%value (float) |
| source | scenario%centre%ni0%source (string) |
| shift0 | scenario%centre%shift0 (scenario_ref) |
| value | scenario%centre%shift0%value (float) |
| source | scenario%centre%shift0%source (string) |
| psi0 | scenario%centre%psi0 (scenario_ref) |
| value | scenario%centre%psi0%value (float) |
| source | scenario%centre%psi0%source (string) |
| phi0 | scenario%centre%phi0 (scenario_ref) |
| value | scenario%centre%phi0%value (float) |
| source | scenario%centre%phi0%source (string) |
| q0 | scenario%centre%q0 (scenario_ref) |
| value | scenario%centre%q0%value (float) |
| source | scenario%centre%q0%source (string) |
| Rmag | scenario%centre%Rmag (scenario_ref) |
| value | scenario%centre%Rmag%value (float) |
| source | scenario%centre%Rmag%source (string) |
| Zmag | scenario%centre%Zmag (scenario_ref) |
| value | scenario%centre%Zmag%value (float) |
| source | scenario%centre%Zmag%source (string) |
| vtor_0 | scenario%centre%vtor_0 (scenario_ref) |
| value | scenario%centre%vtor_0%value (float) |
| source | scenario%centre%vtor_0%source (string) |
| composition | scenario%composition (scenario_composition) |
| amn | scenario%composition%amn (vecflt_type) |
| zn | scenario%composition%zn (vecflt_type) |
| zion | scenario%composition%zion (vecflt_type) |
| imp_flag | scenario%composition%imp_flag (vecint_type) |
| rot_imp_flag | scenario%composition%rot_imp_flag (vecint_type) |
| pellet_amn | scenario%composition%pellet_amn (vecflt_type) |
| pellet_zn | scenario%composition%pellet_zn (vecflt_type) |
| nbi_amn | scenario%composition%nbi_amn (vecflt_type) |
| nbi_zn | scenario%composition%nbi_zn (vecflt_type) |
| configs | scenario%configs (scenario_configuration) |
| config | scenario%configs%config (scenario_int) |
| value | scenario%configs%config%value (integer) |
| source | scenario%configs%config%source (string) |
| lmode_sc | scenario%configs%lmode_sc (string) |
| hmode_sc | scenario%configs%hmode_sc (string) |
| core_sc | scenario%configs%core_sc (string) |
| pedestal_sc | scenario%configs%pedestal_sc (string) |
| helium_sc | scenario%configs%helium_sc (string) |
| impurity_sc | scenario%configs%impurity_sc (string) |
| l2h_sc | scenario%configs%l2h_sc (string) |
| tor_rot_sc | scenario%configs%tor_rot_sc (string) |
| wall_mat | scenario%configs%wall_mat (string) |
| evap_mat | scenario%configs%evap_mat (string) |
| lim_mat | scenario%configs%lim_mat (string) |
| div_mat | scenario%configs%div_mat (string) |
| coordinate | scenario%configs%coordinate (string) |
| ecrh_freq | scenario%configs%ecrh_freq (scenario_ref) |
| value | scenario%configs%ecrh_freq%value (float) |
| source | scenario%configs%ecrh_freq%source (string) |
| ecrh_loc | scenario%configs%ecrh_loc (scenario_ref) |
| value | scenario%configs%ecrh_loc%value (float) |
| source | scenario%configs%ecrh_loc%source (string) |
| ecrh_mode | scenario%configs%ecrh_mode (scenario_int) |
| value | scenario%configs%ecrh_mode%value (integer) |
| source | scenario%configs%ecrh_mode%source (string) |
| ecrh_tor_ang | scenario%configs%ecrh_tor_ang (scenario_ref) |
| value | scenario%configs%ecrh_tor_ang%value (float) |
| source | scenario%configs%ecrh_tor_ang%source (string) |
| ecrh_pol_ang | scenario%configs%ecrh_pol_ang (scenario_ref) |
| value | scenario%configs%ecrh_pol_ang%value (float) |
| source | scenario%configs%ecrh_pol_ang%source (string) |
| ecrh_harm | scenario%configs%ecrh_harm (scenario_int) |
| value | scenario%configs%ecrh_harm%value (integer) |
| source | scenario%configs%ecrh_harm%source (string) |
| enbi | scenario%configs%enbi (scenario_ref) |
| value | scenario%configs%enbi%value (float) |
| source | scenario%configs%enbi%source (string) |
| r_nbi | scenario%configs%r_nbi (scenario_ref) |
| value | scenario%configs%r_nbi%value (float) |
| source | scenario%configs%r_nbi%source (string) |
| grad_b_drift | scenario%configs%grad_b_drift (scenario_int) |
| value | scenario%configs%grad_b_drift%value (integer) |
| source | scenario%configs%grad_b_drift%source (string) |
| icrh_freq | scenario%configs%icrh_freq (scenario_ref) |
| value | scenario%configs%icrh_freq%value (float) |
| source | scenario%configs%icrh_freq%source (string) |
| icrh_scheme | scenario%configs%icrh_scheme (string) |
| icrh_phase | scenario%configs%icrh_phase (scenario_ref) |
| value | scenario%configs%icrh_phase%value (float) |
| source | scenario%configs%icrh_phase%source (string) |
| LH_freq | scenario%configs%LH_freq (scenario_ref) |
| value | scenario%configs%LH_freq%value (float) |
| source | scenario%configs%LH_freq%source (string) |
| LH_npar | scenario%configs%LH_npar (scenario_ref) |
| value | scenario%configs%LH_npar%value (float) |
| source | scenario%configs%LH_npar%source (string) |
| pellet_ang | scenario%configs%pellet_ang (scenario_ref) |
| value | scenario%configs%pellet_ang%value (float) |
| source | scenario%configs%pellet_ang%source (string) |
| pellet_v | scenario%configs%pellet_v (scenario_ref) |
| value | scenario%configs%pellet_v%value (float) |
| source | scenario%configs%pellet_v%source (string) |
| pellet_nba | scenario%configs%pellet_nba (scenario_ref) |
| value | scenario%configs%pellet_nba%value (float) |
| source | scenario%configs%pellet_nba%source (string) |
| confinement | scenario%confinement (scenario_confinement) |
| tau_e | scenario%confinement%tau_e (scenario_ref) |
| value | scenario%confinement%tau_e%value (float) |
| source | scenario%confinement%tau_e%source (string) |
| tau_l_sc | scenario%confinement%tau_l_sc (scenario_ref) |
| value | scenario%confinement%tau_l_sc%value (float) |
| source | scenario%confinement%tau_l_sc%source (string) |
| tau_h_sc | scenario%confinement%tau_h_sc (scenario_ref) |
| value | scenario%confinement%tau_h_sc%value (float) |
| source | scenario%confinement%tau_h_sc%source (string) |
| tau_he | scenario%confinement%tau_he (scenario_ref) |
| value | scenario%confinement%tau_he%value (float) |
| source | scenario%confinement%tau_he%source (string) |
| tau_e_ee | scenario%confinement%tau_e_ee (scenario_ref) |
| value | scenario%confinement%tau_e_ee%value (float) |
| source | scenario%confinement%tau_e_ee%source (string) |
| tau_e_ii | scenario%confinement%tau_e_ii (scenario_ref) |
| value | scenario%confinement%tau_e_ii%value (float) |
| source | scenario%confinement%tau_e_ii%source (string) |
| tau_e_ei | scenario%confinement%tau_e_ei (scenario_ref) |
| value | scenario%confinement%tau_e_ei%value (float) |
| source | scenario%confinement%tau_e_ei%source (string) |
| tau_cur_diff | scenario%confinement%tau_cur_diff (scenario_ref) |
| value | scenario%confinement%tau_cur_diff%value (float) |
| source | scenario%confinement%tau_cur_diff%source (string) |
| tau_i_rol | scenario%confinement%tau_i_rol (scenario_ref) |
| value | scenario%confinement%tau_i_rol%value (float) |
| source | scenario%confinement%tau_i_rol%source (string) |
| currents | scenario%currents (scenario_currents) |
| RR | scenario%currents%RR (scenario_ref) |
| value | scenario%currents%RR%value (float) |
| source | scenario%currents%RR%source (string) |
| i_align | scenario%currents%i_align (scenario_ref) |
| value | scenario%currents%i_align%value (float) |
| source | scenario%currents%i_align%source (string) |
| i_boot | scenario%currents%i_boot (scenario_ref) |
| value | scenario%currents%i_boot%value (float) |
| source | scenario%currents%i_boot%source (string) |
| i_cd_tot | scenario%currents%i_cd_tot (scenario_ref) |
| value | scenario%currents%i_cd_tot%value (float) |
| source | scenario%currents%i_cd_tot%source (string) |
| i_eccd | scenario%currents%i_eccd (scenario_ref) |
| value | scenario%currents%i_eccd%value (float) |
| source | scenario%currents%i_eccd%source (string) |
| i_fast_ion | scenario%currents%i_fast_ion (scenario_ref) |
| value | scenario%currents%i_fast_ion%value (float) |
| source | scenario%currents%i_fast_ion%source (string) |
| i_fwcd | scenario%currents%i_fwcd (scenario_ref) |
| value | scenario%currents%i_fwcd%value (float) |
| source | scenario%currents%i_fwcd%source (string) |
| i_lhcd | scenario%currents%i_lhcd (scenario_ref) |
| value | scenario%currents%i_lhcd%value (float) |
| source | scenario%currents%i_lhcd%source (string) |
| i_nbicd | scenario%currents%i_nbicd (scenario_ref) |
| value | scenario%currents%i_nbicd%value (float) |
| source | scenario%currents%i_nbicd%source (string) |
| i_ni_tot | scenario%currents%i_ni_tot (scenario_ref) |
| value | scenario%currents%i_ni_tot%value (float) |
| source | scenario%currents%i_ni_tot%source (string) |
| i_ohm | scenario%currents%i_ohm (scenario_ref) |
| value | scenario%currents%i_ohm%value (float) |
| source | scenario%currents%i_ohm%source (string) |
| i_par | scenario%currents%i_par (scenario_ref) |
| value | scenario%currents%i_par%value (float) |
| source | scenario%currents%i_par%source (string) |
| i_runaway | scenario%currents%i_runaway (scenario_ref) |
| value | scenario%currents%i_runaway%value (float) |
| source | scenario%currents%i_runaway%source (string) |
| v_loop | scenario%currents%v_loop (scenario_ref) |
| value | scenario%currents%v_loop%value (float) |
| source | scenario%currents%v_loop%source (string) |
| v_meas | scenario%currents%v_meas (scenario_ref) |
| value | scenario%currents%v_meas%value (float) |
| source | scenario%currents%v_meas%source (string) |
| edge | scenario%edge (scenario_edge) |
| te_edge | scenario%edge%te_edge (scenario_ref) |
| value | scenario%edge%te_edge%value (float) |
| source | scenario%edge%te_edge%source (string) |
| ti_edge | scenario%edge%ti_edge (scenario_ref) |
| value | scenario%edge%ti_edge%value (float) |
| source | scenario%edge%ti_edge%source (string) |
| ne_edge | scenario%edge%ne_edge (scenario_ref) |
| value | scenario%edge%ne_edge%value (float) |
| source | scenario%edge%ne_edge%source (string) |
| ni_edge | scenario%edge%ni_edge (scenario_ref) |
| value | scenario%edge%ni_edge%value (float) |
| source | scenario%edge%ni_edge%source (string) |
| psi_edge | scenario%edge%psi_edge (scenario_ref) |
| value | scenario%edge%psi_edge%value (float) |
| source | scenario%edge%psi_edge%source (string) |
| phi_edge | scenario%edge%phi_edge (scenario_ref) |
| value | scenario%edge%phi_edge%value (float) |
| source | scenario%edge%phi_edge%source (string) |
| rho_edge | scenario%edge%rho_edge (scenario_ref) |
| value | scenario%edge%rho_edge%value (float) |
| source | scenario%edge%rho_edge%source (string) |
| drho_edge_dt | scenario%edge%drho_edge_dt (scenario_ref) |
| value | scenario%edge%drho_edge_dt%value (float) |
| source | scenario%edge%drho_edge_dt%source (string) |
| q_edge | scenario%edge%q_edge (scenario_ref) |
| value | scenario%edge%q_edge%value (float) |
| source | scenario%edge%q_edge%source (string) |
| neutral_flux | scenario%edge%neutral_flux (scenario_ref) |
| value | scenario%edge%neutral_flux%value (float) |
| source | scenario%edge%neutral_flux%source (string) |
| phi_plasma | scenario%edge%phi_plasma (scenario_ref) |
| value | scenario%edge%phi_plasma%value (float) |
| source | scenario%edge%phi_plasma%source (string) |
| vtor_edge | scenario%edge%vtor_edge (scenario_ref) |
| value | scenario%edge%vtor_edge%value (float) |
| source | scenario%edge%vtor_edge%source (string) |
| energy | scenario%energy (scenario_energy) |
| w_tot | scenario%energy%w_tot (scenario_ref) |
| value | scenario%energy%w_tot%value (float) |
| source | scenario%energy%w_tot%source (string) |
| w_b_pol | scenario%energy%w_b_pol (scenario_ref) |
| value | scenario%energy%w_b_pol%value (float) |
| source | scenario%energy%w_b_pol%source (string) |
| w_dia | scenario%energy%w_dia (scenario_ref) |
| value | scenario%energy%w_dia%value (float) |
| source | scenario%energy%w_dia%source (string) |
| dwdia_dt | scenario%energy%dwdia_dt (scenario_ref) |
| value | scenario%energy%dwdia_dt%value (float) |
| source | scenario%energy%dwdia_dt%source (string) |
| w_b_tor_pla | scenario%energy%w_b_tor_pla (scenario_ref) |
| value | scenario%energy%w_b_tor_pla%value (float) |
| source | scenario%energy%w_b_tor_pla%source (string) |
| w_th | scenario%energy%w_th (scenario_ref) |
| value | scenario%energy%w_th%value (float) |
| source | scenario%energy%w_th%source (string) |
| dwtot_dt | scenario%energy%dwtot_dt (scenario_ref) |
| value | scenario%energy%dwtot_dt%value (float) |
| source | scenario%energy%dwtot_dt%source (string) |
| dwbpol_dt | scenario%energy%dwbpol_dt (scenario_ref) |
| value | scenario%energy%dwbpol_dt%value (float) |
| source | scenario%energy%dwbpol_dt%source (string) |
| dwbtorpla_dt | scenario%energy%dwbtorpla_dt (scenario_ref) |
| value | scenario%energy%dwbtorpla_dt%value (float) |
| source | scenario%energy%dwbtorpla_dt%source (string) |
| dwth_dt | scenario%energy%dwth_dt (scenario_ref) |
| value | scenario%energy%dwth_dt%value (float) |
| source | scenario%energy%dwth_dt%source (string) |
| esup_icrhtot | scenario%energy%esup_icrhtot (scenario_ref) |
| value | scenario%energy%esup_icrhtot%value (float) |
| source | scenario%energy%esup_icrhtot%source (string) |
| esup_icrhper | scenario%energy%esup_icrhper (scenario_ref) |
| value | scenario%energy%esup_icrhper%value (float) |
| source | scenario%energy%esup_icrhper%source (string) |
| esup_nbitot | scenario%energy%esup_nbitot (scenario_ref) |
| value | scenario%energy%esup_nbitot%value (float) |
| source | scenario%energy%esup_nbitot%source (string) |
| esup_nbiperp | scenario%energy%esup_nbiperp (scenario_ref) |
| value | scenario%energy%esup_nbiperp%value (float) |
| source | scenario%energy%esup_nbiperp%source (string) |
| esup_lhcd | scenario%energy%esup_lhcd (scenario_ref) |
| value | scenario%energy%esup_lhcd%value (float) |
| source | scenario%energy%esup_lhcd%source (string) |
| esup_alpha | scenario%energy%esup_alpha (scenario_ref) |
| value | scenario%energy%esup_alpha%value (float) |
| source | scenario%energy%esup_alpha%source (string) |
| eqgeometry | scenario%eqgeometry (eqgeometry) |
| source | scenario%eqgeometry%source (string) |
| boundarytype | scenario%eqgeometry%boundarytype (integer) |
| boundary | scenario%eqgeometry%boundary(:) (rz1Dexp) |
| r | scenario%eqgeometry%boundary(:)%r (vecflt_type) |
| z | scenario%eqgeometry%boundary(:)%z (vecflt_type) |
| geom_axis | scenario%eqgeometry%geom_axis (rz0D) |
| r | scenario%eqgeometry%geom_axis%r (float) |
| z | scenario%eqgeometry%geom_axis%z (float) |
| a_minor | scenario%eqgeometry%a_minor (float) |
| elongation | scenario%eqgeometry%elongation (float) |
| elong_upper | scenario%eqgeometry%elong_upper (float) |
| elong_lower | scenario%eqgeometry%elong_lower (float) |
| tria_upper | scenario%eqgeometry%tria_upper (float) |
| tria_lower | scenario%eqgeometry%tria_lower (float) |
| xpts | scenario%eqgeometry%xpts(:) (rz1Dexp) |
| r | scenario%eqgeometry%xpts(:)%r (vecflt_type) |
| z | scenario%eqgeometry%xpts(:)%z (vecflt_type) |
| left_low_st | scenario%eqgeometry%left_low_st (rz0D) |
| r | scenario%eqgeometry%left_low_st%r (float) |
| z | scenario%eqgeometry%left_low_st%z (float) |
| right_low_st | scenario%eqgeometry%right_low_st (rz0D) |
| r | scenario%eqgeometry%right_low_st%r (float) |
| z | scenario%eqgeometry%right_low_st%z (float) |
| left_up_st | scenario%eqgeometry%left_up_st (rz0D) |
| r | scenario%eqgeometry%left_up_st%r (float) |
| z | scenario%eqgeometry%left_up_st%z (float) |
| right_up_st | scenario%eqgeometry%right_up_st (rz0D) |
| r | scenario%eqgeometry%right_up_st%r (float) |
| z | scenario%eqgeometry%right_up_st%z (float) |
| active_limit | scenario%eqgeometry%active_limit (rz0D) |
| r | scenario%eqgeometry%active_limit%r (float) |
| z | scenario%eqgeometry%active_limit%z (float) |
| ang_lcms_upo | scenario%eqgeometry%ang_lcms_upo (float) |
| ang_lcms_upi | scenario%eqgeometry%ang_lcms_upi (float) |
| ang_lcms_lwo | scenario%eqgeometry%ang_lcms_lwo (float) |
| ang_lcms_lwi | scenario%eqgeometry%ang_lcms_lwi (float) |
| global_param | scenario%global_param (scenario_global) |
| ip | scenario%global_param%ip (scenario_ref) |
| value | scenario%global_param%ip%value (float) |
| source | scenario%global_param%ip%source (string) |
| dip_dt | scenario%global_param%dip_dt (scenario_ref) |
| value | scenario%global_param%dip_dt%value (float) |
| source | scenario%global_param%dip_dt%source (string) |
| beta_pol | scenario%global_param%beta_pol (scenario_ref) |
| value | scenario%global_param%beta_pol%value (float) |
| source | scenario%global_param%beta_pol%source (string) |
| beta_tor | scenario%global_param%beta_tor (scenario_ref) |
| value | scenario%global_param%beta_tor%value (float) |
| source | scenario%global_param%beta_tor%source (string) |
| beta_normal | scenario%global_param%beta_normal (scenario_ref) |
| value | scenario%global_param%beta_normal%value (float) |
| source | scenario%global_param%beta_normal%source (string) |
| li | scenario%global_param%li (scenario_ref) |
| value | scenario%global_param%li%value (float) |
| source | scenario%global_param%li%source (string) |
| volume | scenario%global_param%volume (scenario_ref) |
| value | scenario%global_param%volume%value (float) |
| source | scenario%global_param%volume%source (string) |
| area_pol | scenario%global_param%area_pol (scenario_ref) |
| value | scenario%global_param%area_pol%value (float) |
| source | scenario%global_param%area_pol%source (string) |
| area_ext | scenario%global_param%area_ext (scenario_ref) |
| value | scenario%global_param%area_ext%value (float) |
| source | scenario%global_param%area_ext%source (string) |
| len_sepa | scenario%global_param%len_sepa (scenario_ref) |
| value | scenario%global_param%len_sepa%value (float) |
| source | scenario%global_param%len_sepa%source (string) |
| beta_pol_th | scenario%global_param%beta_pol_th (scenario_ref) |
| value | scenario%global_param%beta_pol_th%value (float) |
| source | scenario%global_param%beta_pol_th%source (string) |
| beta_tor_th | scenario%global_param%beta_tor_th (scenario_ref) |
| value | scenario%global_param%beta_tor_th%value (float) |
| source | scenario%global_param%beta_tor_th%source (string) |
| beta_n_th | scenario%global_param%beta_n_th (scenario_ref) |
| value | scenario%global_param%beta_n_th%value (float) |
| source | scenario%global_param%beta_n_th%source (string) |
| disruption | scenario%global_param%disruption (scenario_ref) |
| value | scenario%global_param%disruption%value (float) |
| source | scenario%global_param%disruption%source (string) |
| mode_h | scenario%global_param%mode_h (scenario_ref) |
| value | scenario%global_param%mode_h%value (float) |
| source | scenario%global_param%mode_h%source (string) |
| s_alpha | scenario%global_param%s_alpha (scenario_ref) |
| value | scenario%global_param%s_alpha%value (float) |
| source | scenario%global_param%s_alpha%source (string) |
| heat_power | scenario%heat_power (scenario_heat_power) |
| plh | scenario%heat_power%plh (scenario_ref) |
| value | scenario%heat_power%plh%value (float) |
| source | scenario%heat_power%plh%source (string) |
| pohmic | scenario%heat_power%pohmic (scenario_ref) |
| value | scenario%heat_power%pohmic%value (float) |
| source | scenario%heat_power%pohmic%source (string) |
| picrh | scenario%heat_power%picrh (scenario_ref) |
| value | scenario%heat_power%picrh%value (float) |
| source | scenario%heat_power%picrh%source (string) |
| pecrh | scenario%heat_power%pecrh (scenario_ref) |
| value | scenario%heat_power%pecrh%value (float) |
| source | scenario%heat_power%pecrh%source (string) |
| pnbi | scenario%heat_power%pnbi (scenario_ref) |
| value | scenario%heat_power%pnbi%value (float) |
| source | scenario%heat_power%pnbi%source (string) |
| pnbi_co_cur | scenario%heat_power%pnbi_co_cur (scenario_ref) |
| value | scenario%heat_power%pnbi_co_cur%value (float) |
| source | scenario%heat_power%pnbi_co_cur%source (string) |
| pnbi_counter | scenario%heat_power%pnbi_counter (scenario_ref) |
| value | scenario%heat_power%pnbi_counter%value (float) |
| source | scenario%heat_power%pnbi_counter%source (string) |
| plh_th | scenario%heat_power%plh_th (scenario_ref) |
| value | scenario%heat_power%plh_th%value (float) |
| source | scenario%heat_power%plh_th%source (string) |
| picrh_th | scenario%heat_power%picrh_th (scenario_ref) |
| value | scenario%heat_power%picrh_th%value (float) |
| source | scenario%heat_power%picrh_th%source (string) |
| pecrh_th | scenario%heat_power%pecrh_th (scenario_ref) |
| value | scenario%heat_power%pecrh_th%value (float) |
| source | scenario%heat_power%pecrh_th%source (string) |
| pnbi_th | scenario%heat_power%pnbi_th (scenario_ref) |
| value | scenario%heat_power%pnbi_th%value (float) |
| source | scenario%heat_power%pnbi_th%source (string) |
| ploss_icrh | scenario%heat_power%ploss_icrh (scenario_ref) |
| value | scenario%heat_power%ploss_icrh%value (float) |
| source | scenario%heat_power%ploss_icrh%source (string) |
| ploss_nbi | scenario%heat_power%ploss_nbi (scenario_ref) |
| value | scenario%heat_power%ploss_nbi%value (float) |
| source | scenario%heat_power%ploss_nbi%source (string) |
| pbrem | scenario%heat_power%pbrem (scenario_ref) |
| value | scenario%heat_power%pbrem%value (float) |
| source | scenario%heat_power%pbrem%source (string) |
| pcyclo | scenario%heat_power%pcyclo (scenario_ref) |
| value | scenario%heat_power%pcyclo%value (float) |
| source | scenario%heat_power%pcyclo%source (string) |
| prad | scenario%heat_power%prad (scenario_ref) |
| value | scenario%heat_power%prad%value (float) |
| source | scenario%heat_power%prad%source (string) |
| pdd_fus | scenario%heat_power%pdd_fus (scenario_ref) |
| value | scenario%heat_power%pdd_fus%value (float) |
| source | scenario%heat_power%pdd_fus%source (string) |
| pei | scenario%heat_power%pei (scenario_ref) |
| value | scenario%heat_power%pei%value (float) |
| source | scenario%heat_power%pei%source (string) |
| pel_tot | scenario%heat_power%pel_tot (scenario_ref) |
| value | scenario%heat_power%pel_tot%value (float) |
| source | scenario%heat_power%pel_tot%source (string) |
| pel_fus | scenario%heat_power%pel_fus (scenario_ref) |
| value | scenario%heat_power%pel_fus%value (float) |
| source | scenario%heat_power%pel_fus%source (string) |
| pel_icrh | scenario%heat_power%pel_icrh (scenario_ref) |
| value | scenario%heat_power%pel_icrh%value (float) |
| source | scenario%heat_power%pel_icrh%source (string) |
| pel_nbi | scenario%heat_power%pel_nbi (scenario_ref) |
| value | scenario%heat_power%pel_nbi%value (float) |
| source | scenario%heat_power%pel_nbi%source (string) |
| pfus_dt | scenario%heat_power%pfus_dt (scenario_ref) |
| value | scenario%heat_power%pfus_dt%value (float) |
| source | scenario%heat_power%pfus_dt%source (string) |
| ploss_fus | scenario%heat_power%ploss_fus (scenario_ref) |
| value | scenario%heat_power%ploss_fus%value (float) |
| source | scenario%heat_power%ploss_fus%source (string) |
| pfus_nbi | scenario%heat_power%pfus_nbi (scenario_ref) |
| value | scenario%heat_power%pfus_nbi%value (float) |
| source | scenario%heat_power%pfus_nbi%source (string) |
| pfus_th | scenario%heat_power%pfus_th (scenario_ref) |
| value | scenario%heat_power%pfus_th%value (float) |
| source | scenario%heat_power%pfus_th%source (string) |
| padd_tot | scenario%heat_power%padd_tot (scenario_ref) |
| value | scenario%heat_power%padd_tot%value (float) |
| source | scenario%heat_power%padd_tot%source (string) |
| pion_tot | scenario%heat_power%pion_tot (scenario_ref) |
| value | scenario%heat_power%pion_tot%value (float) |
| source | scenario%heat_power%pion_tot%source (string) |
| pion_fus | scenario%heat_power%pion_fus (scenario_ref) |
| value | scenario%heat_power%pion_fus%value (float) |
| source | scenario%heat_power%pion_fus%source (string) |
| pion_icrh | scenario%heat_power%pion_icrh (scenario_ref) |
| value | scenario%heat_power%pion_icrh%value (float) |
| source | scenario%heat_power%pion_icrh%source (string) |
| pion_nbi | scenario%heat_power%pion_nbi (scenario_ref) |
| value | scenario%heat_power%pion_nbi%value (float) |
| source | scenario%heat_power%pion_nbi%source (string) |
| pioniz | scenario%heat_power%pioniz (scenario_ref) |
| value | scenario%heat_power%pioniz%value (float) |
| source | scenario%heat_power%pioniz%source (string) |
| ploss | scenario%heat_power%ploss (scenario_ref) |
| value | scenario%heat_power%ploss%value (float) |
| source | scenario%heat_power%ploss%source (string) |
| p_wth | scenario%heat_power%p_wth (scenario_ref) |
| value | scenario%heat_power%p_wth%value (float) |
| source | scenario%heat_power%p_wth%source (string) |
| p_w | scenario%heat_power%p_w (scenario_ref) |
| value | scenario%heat_power%p_w%value (float) |
| source | scenario%heat_power%p_w%source (string) |
| p_l2h_thr | scenario%heat_power%p_l2h_thr (scenario_ref) |
| value | scenario%heat_power%p_l2h_thr%value (float) |
| source | scenario%heat_power%p_l2h_thr%source (string) |
| p_l2h_sc | scenario%heat_power%p_l2h_sc (scenario_ref) |
| value | scenario%heat_power%p_l2h_sc%value (float) |
| source | scenario%heat_power%p_l2h_sc%source (string) |
| p_nbi_icrh | scenario%heat_power%p_nbi_icrh (scenario_ref) |
| value | scenario%heat_power%p_nbi_icrh%value (float) |
| source | scenario%heat_power%p_nbi_icrh%source (string) |
| itb | scenario%itb (scenario_itb) |
| q_min | scenario%itb%q_min (scenario_ref) |
| value | scenario%itb%q_min%value (float) |
| source | scenario%itb%q_min%source (string) |
| te_itb | scenario%itb%te_itb (scenario_ref) |
| value | scenario%itb%te_itb%value (float) |
| source | scenario%itb%te_itb%source (string) |
| ti_itb | scenario%itb%ti_itb (scenario_ref) |
| value | scenario%itb%ti_itb%value (float) |
| source | scenario%itb%ti_itb%source (string) |
| ne_itb | scenario%itb%ne_itb (scenario_ref) |
| value | scenario%itb%ne_itb%value (float) |
| source | scenario%itb%ne_itb%source (string) |
| ni_itb | scenario%itb%ni_itb (scenario_ref) |
| value | scenario%itb%ni_itb%value (float) |
| source | scenario%itb%ni_itb%source (string) |
| psi_itb | scenario%itb%psi_itb (scenario_ref) |
| value | scenario%itb%psi_itb%value (float) |
| source | scenario%itb%psi_itb%source (string) |
| phi_itb | scenario%itb%phi_itb (scenario_ref) |
| value | scenario%itb%phi_itb%value (float) |
| source | scenario%itb%phi_itb%source (string) |
| rho_itb | scenario%itb%rho_itb (scenario_ref) |
| value | scenario%itb%rho_itb%value (float) |
| source | scenario%itb%rho_itb%source (string) |
| h_itb | scenario%itb%h_itb (scenario_ref) |
| value | scenario%itb%h_itb%value (float) |
| source | scenario%itb%h_itb%source (string) |
| width_itb | scenario%itb%width_itb (scenario_ref) |
| value | scenario%itb%width_itb%value (float) |
| source | scenario%itb%width_itb%source (string) |
| vtor_itb | scenario%itb%vtor_itb (scenario_ref) |
| value | scenario%itb%vtor_itb%value (float) |
| source | scenario%itb%vtor_itb%source (string) |
| itb_type | scenario%itb%itb_type (scenario_int) |
| value | scenario%itb%itb_type%value (integer) |
| source | scenario%itb%itb_type%source (string) |
| lim_div_wall | scenario%lim_div_wall (scenario_lim_div_wall) |
| te_lim_div | scenario%lim_div_wall%te_lim_div (scenario_ref) |
| value | scenario%lim_div_wall%te_lim_div%value (float) |
| source | scenario%lim_div_wall%te_lim_div%source (string) |
| ti_lim_div | scenario%lim_div_wall%ti_lim_div (scenario_ref) |
| value | scenario%lim_div_wall%ti_lim_div%value (float) |
| source | scenario%lim_div_wall%ti_lim_div%source (string) |
| ne_lim_div | scenario%lim_div_wall%ne_lim_div (scenario_ref) |
| value | scenario%lim_div_wall%ne_lim_div%value (float) |
| source | scenario%lim_div_wall%ne_lim_div%source (string) |
| ni_lim_div | scenario%lim_div_wall%ni_lim_div (scenario_ref) |
| value | scenario%lim_div_wall%ni_lim_div%value (float) |
| source | scenario%lim_div_wall%ni_lim_div%source (string) |
| q_peak_div | scenario%lim_div_wall%q_peak_div (scenario_ref) |
| value | scenario%lim_div_wall%q_peak_div%value (float) |
| source | scenario%lim_div_wall%q_peak_div%source (string) |
| q_peak_wall | scenario%lim_div_wall%q_peak_wall (scenario_ref) |
| value | scenario%lim_div_wall%q_peak_wall%value (float) |
| source | scenario%lim_div_wall%q_peak_wall%source (string) |
| surf_temp | scenario%lim_div_wall%surf_temp (scenario_ref) |
| value | scenario%lim_div_wall%surf_temp%value (float) |
| source | scenario%lim_div_wall%surf_temp%source (string) |
| p_lim_div | scenario%lim_div_wall%p_lim_div (scenario_ref) |
| value | scenario%lim_div_wall%p_lim_div%value (float) |
| source | scenario%lim_div_wall%p_lim_div%source (string) |
| p_rad_div | scenario%lim_div_wall%p_rad_div (scenario_ref) |
| value | scenario%lim_div_wall%p_rad_div%value (float) |
| source | scenario%lim_div_wall%p_rad_div%source (string) |
| p_neut_div | scenario%lim_div_wall%p_neut_div (scenario_ref) |
| value | scenario%lim_div_wall%p_neut_div%value (float) |
| source | scenario%lim_div_wall%p_neut_div%source (string) |
| p_wall | scenario%lim_div_wall%p_wall (scenario_ref) |
| value | scenario%lim_div_wall%p_wall%value (float) |
| source | scenario%lim_div_wall%p_wall%source (string) |
| wall_temp | scenario%lim_div_wall%wall_temp (scenario_ref) |
| value | scenario%lim_div_wall%wall_temp%value (float) |
| source | scenario%lim_div_wall%wall_temp%source (string) |
| wall_state | scenario%lim_div_wall%wall_state (scenario_ref) |
| value | scenario%lim_div_wall%wall_state%value (float) |
| source | scenario%lim_div_wall%wall_state%source (string) |
| detach_state | scenario%lim_div_wall%detach_state (scenario_ref) |
| value | scenario%lim_div_wall%detach_state%value (float) |
| source | scenario%lim_div_wall%detach_state%source (string) |
| pump_flux | scenario%lim_div_wall%pump_flux (scenario_ref) |
| value | scenario%lim_div_wall%pump_flux%value (float) |
| source | scenario%lim_div_wall%pump_flux%source (string) |
| p_rad_fw | scenario%lim_div_wall%p_rad_fw (scenario_ref) |
| value | scenario%lim_div_wall%p_rad_fw%value (float) |
| source | scenario%lim_div_wall%p_rad_fw%source (string) |
| p_cond_fw | scenario%lim_div_wall%p_cond_fw (scenario_ref) |
| value | scenario%lim_div_wall%p_cond_fw%value (float) |
| source | scenario%lim_div_wall%p_cond_fw%source (string) |
| div_wetted | scenario%lim_div_wall%div_wetted (scenario_ref) |
| value | scenario%lim_div_wall%div_wetted%value (float) |
| source | scenario%lim_div_wall%div_wetted%source (string) |
| gas_puff | scenario%lim_div_wall%gas_puff (scenario_ref) |
| value | scenario%lim_div_wall%gas_puff%value (float) |
| source | scenario%lim_div_wall%gas_puff%source (string) |
| ar_concentr | scenario%lim_div_wall%ar_concentr (scenario_ref) |
| value | scenario%lim_div_wall%ar_concentr%value (float) |
| source | scenario%lim_div_wall%ar_concentr%source (string) |
| part_exhaust | scenario%lim_div_wall%part_exhaust (scenario_ref) |
| value | scenario%lim_div_wall%part_exhaust%value (float) |
| source | scenario%lim_div_wall%part_exhaust%source (string) |
| f_inner | scenario%lim_div_wall%f_inner (scenario_ref) |
| value | scenario%lim_div_wall%f_inner%value (float) |
| source | scenario%lim_div_wall%f_inner%source (string) |
| f_outer | scenario%lim_div_wall%f_outer (scenario_ref) |
| value | scenario%lim_div_wall%f_outer%value (float) |
| source | scenario%lim_div_wall%f_outer%source (string) |
| f_pfr | scenario%lim_div_wall%f_pfr (scenario_ref) |
| value | scenario%lim_div_wall%f_pfr%value (float) |
| source | scenario%lim_div_wall%f_pfr%source (string) |
| f_rad_fw | scenario%lim_div_wall%f_rad_fw (scenario_ref) |
| value | scenario%lim_div_wall%f_rad_fw%value (float) |
| source | scenario%lim_div_wall%f_rad_fw%source (string) |
| q_div | scenario%lim_div_wall%q_div (vecflt_type) |
| p_cond_div | scenario%lim_div_wall%p_cond_div (scenario_ref) |
| value | scenario%lim_div_wall%p_cond_div%value (float) |
| source | scenario%lim_div_wall%p_cond_div%source (string) |
| pol_ext | scenario%lim_div_wall%pol_ext (float) |
| flux_exp | scenario%lim_div_wall%flux_exp (float) |
| tilt_angle | scenario%lim_div_wall%tilt_angle (float) |
| n_div | scenario%lim_div_wall%n_div (float) |
| div_dz | scenario%lim_div_wall%div_dz (float) |
| div_dro | scenario%lim_div_wall%div_dro (float) |
| div_dri | scenario%lim_div_wall%div_dri (float) |
| p_nh_div | scenario%lim_div_wall%p_nh_div (scenario_ref) |
| value | scenario%lim_div_wall%p_nh_div%value (float) |
| source | scenario%lim_div_wall%p_nh_div%source (string) |
| line_ave | scenario%line_ave (scenario_line_ave) |
| ne_line | scenario%line_ave%ne_line (scenario_ref) |
| value | scenario%line_ave%ne_line%value (float) |
| source | scenario%line_ave%ne_line%source (string) |
| zeff_line | scenario%line_ave%zeff_line (scenario_ref) |
| value | scenario%line_ave%zeff_line%value (float) |
| source | scenario%line_ave%zeff_line%source (string) |
| ne_zeff_line | scenario%line_ave%ne_zeff_line (scenario_ref) |
| value | scenario%line_ave%ne_zeff_line%value (float) |
| source | scenario%line_ave%ne_zeff_line%source (string) |
| dne_line_dt | scenario%line_ave%dne_line_dt (scenario_ref) |
| value | scenario%line_ave%dne_line_dt%value (float) |
| source | scenario%line_ave%dne_line_dt%source (string) |
| neutron | scenario%neutron (scenario_neutron) |
| ndd_tot | scenario%neutron%ndd_tot (scenario_ref) |
| value | scenario%neutron%ndd_tot%value (float) |
| source | scenario%neutron%ndd_tot%source (string) |
| ndd_th | scenario%neutron%ndd_th (scenario_ref) |
| value | scenario%neutron%ndd_th%value (float) |
| source | scenario%neutron%ndd_th%source (string) |
| ndd_nbi_th | scenario%neutron%ndd_nbi_th (scenario_ref) |
| value | scenario%neutron%ndd_nbi_th%value (float) |
| source | scenario%neutron%ndd_nbi_th%source (string) |
| ndd_nbi_nbi | scenario%neutron%ndd_nbi_nbi (scenario_ref) |
| value | scenario%neutron%ndd_nbi_nbi%value (float) |
| source | scenario%neutron%ndd_nbi_nbi%source (string) |
| ndt_tot | scenario%neutron%ndt_tot (scenario_ref) |
| value | scenario%neutron%ndt_tot%value (float) |
| source | scenario%neutron%ndt_tot%source (string) |
| ndt_th | scenario%neutron%ndt_th (scenario_ref) |
| value | scenario%neutron%ndt_th%value (float) |
| source | scenario%neutron%ndt_th%source (string) |
| ninety_five | scenario%ninety_five (scenario_ninety_five) |
| q_95 | scenario%ninety_five%q_95 (scenario_ref) |
| value | scenario%ninety_five%q_95%value (float) |
| source | scenario%ninety_five%q_95%source (string) |
| elong_95 | scenario%ninety_five%elong_95 (scenario_ref) |
| value | scenario%ninety_five%elong_95%value (float) |
| source | scenario%ninety_five%elong_95%source (string) |
| tria_95 | scenario%ninety_five%tria_95 (scenario_ref) |
| value | scenario%ninety_five%tria_95%value (float) |
| source | scenario%ninety_five%tria_95%source (string) |
| tria_up_95 | scenario%ninety_five%tria_up_95 (scenario_ref) |
| value | scenario%ninety_five%tria_up_95%value (float) |
| source | scenario%ninety_five%tria_up_95%source (string) |
| tria_lo_95 | scenario%ninety_five%tria_lo_95 (scenario_ref) |
| value | scenario%ninety_five%tria_lo_95%value (float) |
| source | scenario%ninety_five%tria_lo_95%source (string) |
| te_95 | scenario%ninety_five%te_95 (scenario_ref) |
| value | scenario%ninety_five%te_95%value (float) |
| source | scenario%ninety_five%te_95%source (string) |
| ti_95 | scenario%ninety_five%ti_95 (scenario_ref) |
| value | scenario%ninety_five%ti_95%value (float) |
| source | scenario%ninety_five%ti_95%source (string) |
| ne_95 | scenario%ninety_five%ne_95 (scenario_ref) |
| value | scenario%ninety_five%ne_95%value (float) |
| source | scenario%ninety_five%ne_95%source (string) |
| ni_95 | scenario%ninety_five%ni_95 (scenario_ref) |
| value | scenario%ninety_five%ni_95%value (float) |
| source | scenario%ninety_five%ni_95%source (string) |
| phi_95 | scenario%ninety_five%phi_95 (scenario_ref) |
| value | scenario%ninety_five%phi_95%value (float) |
| source | scenario%ninety_five%phi_95%source (string) |
| rho_95 | scenario%ninety_five%rho_95 (scenario_ref) |
| value | scenario%ninety_five%rho_95%value (float) |
| source | scenario%ninety_five%rho_95%source (string) |
| vtor_95 | scenario%ninety_five%vtor_95 (scenario_ref) |
| value | scenario%ninety_five%vtor_95%value (float) |
| source | scenario%ninety_five%vtor_95%source (string) |
| pedestal | scenario%pedestal (scenario_pedestal) |
| te_ped | scenario%pedestal%te_ped (scenario_ref) |
| value | scenario%pedestal%te_ped%value (float) |
| source | scenario%pedestal%te_ped%source (string) |
| ti_ped | scenario%pedestal%ti_ped (scenario_ref) |
| value | scenario%pedestal%ti_ped%value (float) |
| source | scenario%pedestal%ti_ped%source (string) |
| ne_ped | scenario%pedestal%ne_ped (scenario_ref) |
| value | scenario%pedestal%ne_ped%value (float) |
| source | scenario%pedestal%ne_ped%source (string) |
| ni_ped | scenario%pedestal%ni_ped (scenario_ref) |
| value | scenario%pedestal%ni_ped%value (float) |
| source | scenario%pedestal%ni_ped%source (string) |
| psi_ped | scenario%pedestal%psi_ped (scenario_ref) |
| value | scenario%pedestal%psi_ped%value (float) |
| source | scenario%pedestal%psi_ped%source (string) |
| phi_ped | scenario%pedestal%phi_ped (scenario_ref) |
| value | scenario%pedestal%phi_ped%value (float) |
| source | scenario%pedestal%phi_ped%source (string) |
| rho_ped | scenario%pedestal%rho_ped (scenario_ref) |
| value | scenario%pedestal%rho_ped%value (float) |
| source | scenario%pedestal%rho_ped%source (string) |
| q_ped | scenario%pedestal%q_ped (scenario_ref) |
| value | scenario%pedestal%q_ped%value (float) |
| source | scenario%pedestal%q_ped%source (string) |
| pressure_ped | scenario%pedestal%pressure_ped (scenario_ref) |
| value | scenario%pedestal%pressure_ped%value (float) |
| source | scenario%pedestal%pressure_ped%source (string) |
| vtor_ped | scenario%pedestal%vtor_ped (scenario_ref) |
| value | scenario%pedestal%vtor_ped%value (float) |
| source | scenario%pedestal%vtor_ped%source (string) |
| references | scenario%references (scenario_references) |
| plh | scenario%references%plh (scenario_ref) |
| value | scenario%references%plh%value (float) |
| source | scenario%references%plh%source (string) |
| picrh | scenario%references%picrh (scenario_ref) |
| value | scenario%references%picrh%value (float) |
| source | scenario%references%picrh%source (string) |
| pecrh | scenario%references%pecrh (scenario_ref) |
| value | scenario%references%pecrh%value (float) |
| source | scenario%references%pecrh%source (string) |
| pnbi | scenario%references%pnbi (scenario_ref) |
| value | scenario%references%pnbi%value (float) |
| source | scenario%references%pnbi%source (string) |
| ip | scenario%references%ip (scenario_ref) |
| value | scenario%references%ip%value (float) |
| source | scenario%references%ip%source (string) |
| bvac_r | scenario%references%bvac_r (scenario_ref) |
| value | scenario%references%bvac_r%value (float) |
| source | scenario%references%bvac_r%source (string) |
| zeffl | scenario%references%zeffl (scenario_ref) |
| value | scenario%references%zeffl%value (float) |
| source | scenario%references%zeffl%source (string) |
| nbar | scenario%references%nbar (scenario_ref) |
| value | scenario%references%nbar%value (float) |
| source | scenario%references%nbar%source (string) |
| xecrh | scenario%references%xecrh (scenario_ref) |
| value | scenario%references%xecrh%value (float) |
| source | scenario%references%xecrh%source (string) |
| pol_flux | scenario%references%pol_flux (scenario_ref) |
| value | scenario%references%pol_flux%value (float) |
| source | scenario%references%pol_flux%source (string) |
| enhancement | scenario%references%enhancement (scenario_ref) |
| value | scenario%references%enhancement%value (float) |
| source | scenario%references%enhancement%source (string) |
| isotopic | scenario%references%isotopic (scenario_ref) |
| value | scenario%references%isotopic%value (float) |
| source | scenario%references%isotopic%source (string) |
| nbi_td_ratio | scenario%references%nbi_td_ratio (scenario_ref) |
| value | scenario%references%nbi_td_ratio%value (float) |
| source | scenario%references%nbi_td_ratio%source (string) |
| gas_puff | scenario%references%gas_puff (scenario_ref) |
| value | scenario%references%gas_puff%value (float) |
| source | scenario%references%gas_puff%source (string) |
| reactor | scenario%reactor (scenario_reactor) |
| pnetwork | scenario%reactor%pnetwork (float) |
| sol | scenario%sol (scenario_sol) |
| l_te_sol | scenario%sol%l_te_sol (scenario_ref) |
| value | scenario%sol%l_te_sol%value (float) |
| source | scenario%sol%l_te_sol%source (string) |
| l_ti_sol | scenario%sol%l_ti_sol (scenario_ref) |
| value | scenario%sol%l_ti_sol%value (float) |
| source | scenario%sol%l_ti_sol%source (string) |
| l_ne_sol | scenario%sol%l_ne_sol (scenario_ref) |
| value | scenario%sol%l_ne_sol%value (float) |
| source | scenario%sol%l_ne_sol%source (string) |
| l_ni_sol | scenario%sol%l_ni_sol (scenario_ref) |
| value | scenario%sol%l_ni_sol%value (float) |
| source | scenario%sol%l_ni_sol%source (string) |
| l_qe_sol | scenario%sol%l_qe_sol (scenario_ref) |
| value | scenario%sol%l_qe_sol%value (float) |
| source | scenario%sol%l_qe_sol%source (string) |
| l_qi_sol | scenario%sol%l_qi_sol (scenario_ref) |
| value | scenario%sol%l_qi_sol%value (float) |
| source | scenario%sol%l_qi_sol%source (string) |
| p_rad_sol | scenario%sol%p_rad_sol (scenario_ref) |
| value | scenario%sol%p_rad_sol%value (float) |
| source | scenario%sol%p_rad_sol%source (string) |
| p_neut | scenario%sol%p_neut (float) |
| gas_puff | scenario%sol%gas_puff (scenario_ref) |
| value | scenario%sol%gas_puff%value (float) |
| source | scenario%sol%gas_puff%source (string) |
| delta_r_in | scenario%sol%delta_r_in (float) |
| delta_r_out | scenario%sol%delta_r_out (float) |
| r_in | scenario%sol%r_in (float) |
| r_out | scenario%sol%r_out (float) |
| sol_width | scenario%sol%sol_width (float) |
| vol_ave | scenario%vol_ave (scenario_vol_ave) |
| te_ave | scenario%vol_ave%te_ave (scenario_ref) |
| value | scenario%vol_ave%te_ave%value (float) |
| source | scenario%vol_ave%te_ave%source (string) |
| ti_ave | scenario%vol_ave%ti_ave (scenario_ref) |
| value | scenario%vol_ave%ti_ave%value (float) |
| source | scenario%vol_ave%ti_ave%source (string) |
| ne_ave | scenario%vol_ave%ne_ave (scenario_ref) |
| value | scenario%vol_ave%ne_ave%value (float) |
| source | scenario%vol_ave%ne_ave%source (string) |
| dne_ave_dt | scenario%vol_ave%dne_ave_dt (scenario_ref) |
| value | scenario%vol_ave%dne_ave_dt%value (float) |
| source | scenario%vol_ave%dne_ave_dt%source (string) |
| ni_ave | scenario%vol_ave%ni_ave (scenario_ref) |
| value | scenario%vol_ave%ni_ave%value (float) |
| source | scenario%vol_ave%ni_ave%source (string) |
| zeff_ave | scenario%vol_ave%zeff_ave (scenario_ref) |
| value | scenario%vol_ave%zeff_ave%value (float) |
| source | scenario%vol_ave%zeff_ave%source (string) |
| ti_o_te_ave | scenario%vol_ave%ti_o_te_ave (scenario_ref) |
| value | scenario%vol_ave%ti_o_te_ave%value (float) |
| source | scenario%vol_ave%ti_o_te_ave%source (string) |
| meff_ave | scenario%vol_ave%meff_ave (scenario_ref) |
| value | scenario%vol_ave%meff_ave%value (float) |
| source | scenario%vol_ave%meff_ave%source (string) |
| pellet_flux | scenario%vol_ave%pellet_flux (scenario_ref) |
| value | scenario%vol_ave%pellet_flux%value (float) |
| source | scenario%vol_ave%pellet_flux%source (string) |
| nions_ave | scenario%vol_ave%nions_ave (vecflt_type) |
| omega_ave | scenario%vol_ave%omega_ave (scenario_ref) |
| value | scenario%vol_ave%omega_ave%value (float) |
| source | scenario%vol_ave%omega_ave%source (string) |
| codeparam | scenario%codeparam (codeparam) |
| codename | scenario%codeparam%codename (string) |
| codeversion | scenario%codeparam%codeversion (string) |
| parameters | scenario%codeparam%parameters (string) |
| output_diag | scenario%codeparam%output_diag (string) |
| output_flag | scenario%codeparam%output_flag (integer) |
| time | scenario%time (float) |
| datainfo | solcurdiag%datainfo (datainfo) |
| dataprovider | solcurdiag%datainfo%dataprovider (string) |
| putdate | solcurdiag%datainfo%putdate (string) |
| source | solcurdiag%datainfo%source (string) |
| comment | solcurdiag%datainfo%comment (string) |
| cocos | solcurdiag%datainfo%cocos (integer) |
| id | solcurdiag%datainfo%id (integer) |
| isref | solcurdiag%datainfo%isref (integer) |
| whatref | solcurdiag%datainfo%whatref (whatref) |
| user | solcurdiag%datainfo%whatref%user (string) |
| machine | solcurdiag%datainfo%whatref%machine (string) |
| shot | solcurdiag%datainfo%whatref%shot (integer) |
| run | solcurdiag%datainfo%whatref%run (integer) |
| occurrence | solcurdiag%datainfo%whatref%occurrence (integer) |
| putinfo | solcurdiag%datainfo%putinfo (putinfo) |
| putmethod | solcurdiag%datainfo%putinfo%putmethod (string) |
| putaccess | solcurdiag%datainfo%putinfo%putaccess (string) |
| putlocation | solcurdiag%datainfo%putinfo%putlocation (string) |
| rights | solcurdiag%datainfo%putinfo%rights (string) |
| sol_current | solcurdiag%sol_current(:) (solcurdiag_sol_current) |
| setup | solcurdiag%sol_current(:)%setup (solcurdiag_sol_current_setup) |
| name | solcurdiag%sol_current(:)%setup%name (string) |
| id | solcurdiag%sol_current(:)%setup%id (integer) |
| position | solcurdiag%sol_current(:)%setup%position (rz1D) |
| r | solcurdiag%sol_current(:)%setup%position%r (vecflt_type) |
| z | solcurdiag%sol_current(:)%setup%position%z (vecflt_type) |
| tiles_turn | solcurdiag%sol_current(:)%setup%tiles_turn (integer) |
| measure | solcurdiag%sol_current(:)%measure (exp0D) |
| value | solcurdiag%sol_current(:)%measure%value (float) |
| abserror | solcurdiag%sol_current(:)%measure%abserror (float) |
| relerror | solcurdiag%sol_current(:)%measure%relerror (float) |
| clusters | solcurdiag%clusters(:) (clusters) |
| name | solcurdiag%clusters(:)%name (string) |
| start | solcurdiag%clusters(:)%start (integer) |
| finish | solcurdiag%clusters(:)%finish (integer) |
| time | solcurdiag%time (float) |
| codeparam | solcurdiag%codeparam (codeparam) |
| codename | solcurdiag%codeparam%codename (string) |
| codeversion | solcurdiag%codeparam%codeversion (string) |
| parameters | solcurdiag%codeparam%parameters (string) |
| output_diag | solcurdiag%codeparam%output_diag (string) |
| output_flag | solcurdiag%codeparam%output_flag (integer) |
| datainfo | temporary%datainfo (datainfo) |
| dataprovider | temporary%datainfo%dataprovider (string) |
| putdate | temporary%datainfo%putdate (string) |
| source | temporary%datainfo%source (string) |
| comment | temporary%datainfo%comment (string) |
| cocos | temporary%datainfo%cocos (integer) |
| id | temporary%datainfo%id (integer) |
| isref | temporary%datainfo%isref (integer) |
| whatref | temporary%datainfo%whatref (whatref) |
| user | temporary%datainfo%whatref%user (string) |
| machine | temporary%datainfo%whatref%machine (string) |
| shot | temporary%datainfo%whatref%shot (integer) |
| run | temporary%datainfo%whatref%run (integer) |
| occurrence | temporary%datainfo%whatref%occurrence (integer) |
| putinfo | temporary%datainfo%putinfo (putinfo) |
| putmethod | temporary%datainfo%putinfo%putmethod (string) |
| putaccess | temporary%datainfo%putinfo%putaccess (string) |
| putlocation | temporary%datainfo%putinfo%putlocation (string) |
| rights | temporary%datainfo%putinfo%rights (string) |
| non_timed | temporary%non_timed (temporary_nt) |
| float0d | temporary%non_timed%float0d(:) (temporary_nt_0dr) |
| identifier | temporary%non_timed%float0d(:)%identifier (identifier) |
| id | temporary%non_timed%float0d(:)%identifier%id (string) |
| flag | temporary%non_timed%float0d(:)%identifier%flag (integer) |
| description | temporary%non_timed%float0d(:)%identifier%description (string) |
| value | temporary%non_timed%float0d(:)%value (float) |
| integer0d | temporary%non_timed%integer0d(:) (temporary_nt_0di) |
| identifier | temporary%non_timed%integer0d(:)%identifier (identifier) |
| id | temporary%non_timed%integer0d(:)%identifier%id (string) |
| flag | temporary%non_timed%integer0d(:)%identifier%flag (integer) |
| description | temporary%non_timed%integer0d(:)%identifier%description (string) |
| value | temporary%non_timed%integer0d(:)%value (integer) |
| complex0d | temporary%non_timed%complex0d(:) (temporary_nt_0dc) |
| identifier | temporary%non_timed%complex0d(:)%identifier (identifier) |
| id | temporary%non_timed%complex0d(:)%identifier%id (string) |
| flag | temporary%non_timed%complex0d(:)%identifier%flag (integer) |
| description | temporary%non_timed%complex0d(:)%identifier%description (string) |
| value | temporary%non_timed%complex0d(:)%value (cplx_type) |
| string0d | temporary%non_timed%string0d(:) (temporary_nt_0ds) |
| identifier | temporary%non_timed%string0d(:)%identifier (identifier) |
| id | temporary%non_timed%string0d(:)%identifier%id (string) |
| flag | temporary%non_timed%string0d(:)%identifier%flag (integer) |
| description | temporary%non_timed%string0d(:)%identifier%description (string) |
| value | temporary%non_timed%string0d(:)%value (string) |
| float1d | temporary%non_timed%float1d(:) (temporary_nt_1dr) |
| identifier | temporary%non_timed%float1d(:)%identifier (identifier) |
| id | temporary%non_timed%float1d(:)%identifier%id (string) |
| flag | temporary%non_timed%float1d(:)%identifier%flag (integer) |
| description | temporary%non_timed%float1d(:)%identifier%description (string) |
| value | temporary%non_timed%float1d(:)%value (vecflt_type) |
| integer1d | temporary%non_timed%integer1d(:) (temporary_nt_1di) |
| identifier | temporary%non_timed%integer1d(:)%identifier (identifier) |
| id | temporary%non_timed%integer1d(:)%identifier%id (string) |
| flag | temporary%non_timed%integer1d(:)%identifier%flag (integer) |
| description | temporary%non_timed%integer1d(:)%identifier%description (string) |
| value | temporary%non_timed%integer1d(:)%value (vecint_type) |
| string1d | temporary%non_timed%string1d(:) (temporary_nt_1dr) |
| identifier | temporary%non_timed%string1d(:)%identifier (identifier) |
| id | temporary%non_timed%string1d(:)%identifier%id (string) |
| flag | temporary%non_timed%string1d(:)%identifier%flag (integer) |
| description | temporary%non_timed%string1d(:)%identifier%description (string) |
| value | temporary%non_timed%string1d(:)%value (vecflt_type) |
| complex1d | temporary%non_timed%complex1d(:) (temporary_nt_1dc) |
| identifier | temporary%non_timed%complex1d(:)%identifier (identifier) |
| id | temporary%non_timed%complex1d(:)%identifier%id (string) |
| flag | temporary%non_timed%complex1d(:)%identifier%flag (integer) |
| description | temporary%non_timed%complex1d(:)%identifier%description (string) |
| value | temporary%non_timed%complex1d(:)%value (veccplx_type) |
| float2d | temporary%non_timed%float2d(:) (temporary_nt_2dr) |
| identifier | temporary%non_timed%float2d(:)%identifier (identifier) |
| id | temporary%non_timed%float2d(:)%identifier%id (string) |
| flag | temporary%non_timed%float2d(:)%identifier%flag (integer) |
| description | temporary%non_timed%float2d(:)%identifier%description (string) |
| value | temporary%non_timed%float2d(:)%value (matflt_type) |
| integer2d | temporary%non_timed%integer2d(:) (temporary_nt_2di) |
| identifier | temporary%non_timed%integer2d(:)%identifier (identifier) |
| id | temporary%non_timed%integer2d(:)%identifier%id (string) |
| flag | temporary%non_timed%integer2d(:)%identifier%flag (integer) |
| description | temporary%non_timed%integer2d(:)%identifier%description (string) |
| value | temporary%non_timed%integer2d(:)%value (matint_type) |
| complex2d | temporary%non_timed%complex2d(:) (temporary_nt_2dc) |
| identifier | temporary%non_timed%complex2d(:)%identifier (identifier) |
| id | temporary%non_timed%complex2d(:)%identifier%id (string) |
| flag | temporary%non_timed%complex2d(:)%identifier%flag (integer) |
| description | temporary%non_timed%complex2d(:)%identifier%description (string) |
| value | temporary%non_timed%complex2d(:)%value (matcplx_type) |
| float3d | temporary%non_timed%float3d(:) (temporary_nt_3dr) |
| identifier | temporary%non_timed%float3d(:)%identifier (identifier) |
| id | temporary%non_timed%float3d(:)%identifier%id (string) |
| flag | temporary%non_timed%float3d(:)%identifier%flag (integer) |
| description | temporary%non_timed%float3d(:)%identifier%description (string) |
| value | temporary%non_timed%float3d(:)%value (array3dflt_type) |
| integer3d | temporary%non_timed%integer3d(:) (temporary_nt_3di) |
| identifier | temporary%non_timed%integer3d(:)%identifier (identifier) |
| id | temporary%non_timed%integer3d(:)%identifier%id (string) |
| flag | temporary%non_timed%integer3d(:)%identifier%flag (integer) |
| description | temporary%non_timed%integer3d(:)%identifier%description (string) |
| value | temporary%non_timed%integer3d(:)%value (array3dint_type) |
| complex3d | temporary%non_timed%complex3d(:) (temporary_nt_3dc) |
| identifier | temporary%non_timed%complex3d(:)%identifier (identifier) |
| id | temporary%non_timed%complex3d(:)%identifier%id (string) |
| flag | temporary%non_timed%complex3d(:)%identifier%flag (integer) |
| description | temporary%non_timed%complex3d(:)%identifier%description (string) |
| value | temporary%non_timed%complex3d(:)%value (array3dcplx_type) |
| float4d | temporary%non_timed%float4d(:) (temporary_nt_4dr) |
| identifier | temporary%non_timed%float4d(:)%identifier (identifier) |
| id | temporary%non_timed%float4d(:)%identifier%id (string) |
| flag | temporary%non_timed%float4d(:)%identifier%flag (integer) |
| description | temporary%non_timed%float4d(:)%identifier%description (string) |
| value | temporary%non_timed%float4d(:)%value (array4dflt_type) |
| timed | temporary%timed (temporary_t) |
| float0d | temporary%timed%float0d(:) (temporary_t_0dr) |
| identifier | temporary%timed%float0d(:)%identifier (identifier) |
| id | temporary%timed%float0d(:)%identifier%id (string) |
| flag | temporary%timed%float0d(:)%identifier%flag (integer) |
| description | temporary%timed%float0d(:)%identifier%description (string) |
| value | temporary%timed%float0d(:)%value (float) |
| integer0d | temporary%timed%integer0d(:) (temporary_t_0di) |
| identifier | temporary%timed%integer0d(:)%identifier (identifier) |
| id | temporary%timed%integer0d(:)%identifier%id (string) |
| flag | temporary%timed%integer0d(:)%identifier%flag (integer) |
| description | temporary%timed%integer0d(:)%identifier%description (string) |
| value | temporary%timed%integer0d(:)%value (integer) |
| complex0d | temporary%timed%complex0d(:) (temporary_t_0dc) |
| identifier | temporary%timed%complex0d(:)%identifier (identifier) |
| id | temporary%timed%complex0d(:)%identifier%id (string) |
| flag | temporary%timed%complex0d(:)%identifier%flag (integer) |
| description | temporary%timed%complex0d(:)%identifier%description (string) |
| value | temporary%timed%complex0d(:)%value (cplx_type) |
| string0d | temporary%timed%string0d(:) (temporary_t_0ds) |
| identifier | temporary%timed%string0d(:)%identifier (identifier) |
| id | temporary%timed%string0d(:)%identifier%id (string) |
| flag | temporary%timed%string0d(:)%identifier%flag (integer) |
| description | temporary%timed%string0d(:)%identifier%description (string) |
| value | temporary%timed%string0d(:)%value (string) |
| float1d | temporary%timed%float1d(:) (temporary_t_1dr) |
| identifier | temporary%timed%float1d(:)%identifier (identifier) |
| id | temporary%timed%float1d(:)%identifier%id (string) |
| flag | temporary%timed%float1d(:)%identifier%flag (integer) |
| description | temporary%timed%float1d(:)%identifier%description (string) |
| value | temporary%timed%float1d(:)%value (vecflt_type) |
| integer1d | temporary%timed%integer1d(:) (temporary_t_1di) |
| identifier | temporary%timed%integer1d(:)%identifier (identifier) |
| id | temporary%timed%integer1d(:)%identifier%id (string) |
| flag | temporary%timed%integer1d(:)%identifier%flag (integer) |
| description | temporary%timed%integer1d(:)%identifier%description (string) |
| value | temporary%timed%integer1d(:)%value (vecint_type) |
| complex1d | temporary%timed%complex1d(:) (temporary_t_1dc) |
| identifier | temporary%timed%complex1d(:)%identifier (identifier) |
| id | temporary%timed%complex1d(:)%identifier%id (string) |
| flag | temporary%timed%complex1d(:)%identifier%flag (integer) |
| description | temporary%timed%complex1d(:)%identifier%description (string) |
| value | temporary%timed%complex1d(:)%value (veccplx_type) |
| float2d | temporary%timed%float2d(:) (temporary_t_2dr) |
| identifier | temporary%timed%float2d(:)%identifier (identifier) |
| id | temporary%timed%float2d(:)%identifier%id (string) |
| flag | temporary%timed%float2d(:)%identifier%flag (integer) |
| description | temporary%timed%float2d(:)%identifier%description (string) |
| value | temporary%timed%float2d(:)%value (matflt_type) |
| integer2d | temporary%timed%integer2d(:) (temporary_t_2di) |
| identifier | temporary%timed%integer2d(:)%identifier (identifier) |
| id | temporary%timed%integer2d(:)%identifier%id (string) |
| flag | temporary%timed%integer2d(:)%identifier%flag (integer) |
| description | temporary%timed%integer2d(:)%identifier%description (string) |
| value | temporary%timed%integer2d(:)%value (matint_type) |
| complex2d | temporary%timed%complex2d(:) (temporary_t_2dc) |
| identifier | temporary%timed%complex2d(:)%identifier (identifier) |
| id | temporary%timed%complex2d(:)%identifier%id (string) |
| flag | temporary%timed%complex2d(:)%identifier%flag (integer) |
| description | temporary%timed%complex2d(:)%identifier%description (string) |
| value | temporary%timed%complex2d(:)%value (matcplx_type) |
| float3d | temporary%timed%float3d(:) (temporary_t_3dr) |
| identifier | temporary%timed%float3d(:)%identifier (identifier) |
| id | temporary%timed%float3d(:)%identifier%id (string) |
| flag | temporary%timed%float3d(:)%identifier%flag (integer) |
| description | temporary%timed%float3d(:)%identifier%description (string) |
| value | temporary%timed%float3d(:)%value (array3dflt_type) |
| integer3d | temporary%timed%integer3d(:) (temporary_t_3di) |
| identifier | temporary%timed%integer3d(:)%identifier (identifier) |
| id | temporary%timed%integer3d(:)%identifier%id (string) |
| flag | temporary%timed%integer3d(:)%identifier%flag (integer) |
| description | temporary%timed%integer3d(:)%identifier%description (string) |
| value | temporary%timed%integer3d(:)%value (array3dint_type) |
| complex3d | temporary%timed%complex3d(:) (temporary_t_3dc) |
| identifier | temporary%timed%complex3d(:)%identifier (identifier) |
| id | temporary%timed%complex3d(:)%identifier%id (string) |
| flag | temporary%timed%complex3d(:)%identifier%flag (integer) |
| description | temporary%timed%complex3d(:)%identifier%description (string) |
| value | temporary%timed%complex3d(:)%value (array3dcplx_type) |
| float4d | temporary%timed%float4d(:) (temporary_t_4dr) |
| identifier | temporary%timed%float4d(:)%identifier (identifier) |
| id | temporary%timed%float4d(:)%identifier%id (string) |
| flag | temporary%timed%float4d(:)%identifier%flag (integer) |
| description | temporary%timed%float4d(:)%identifier%description (string) |
| value | temporary%timed%float4d(:)%value (array4dflt_type) |
| codeparam | temporary%codeparam (codeparam) |
| codename | temporary%codeparam%codename (string) |
| codeversion | temporary%codeparam%codeversion (string) |
| parameters | temporary%codeparam%parameters (string) |
| output_diag | temporary%codeparam%output_diag (string) |
| output_flag | temporary%codeparam%output_flag (integer) |
| time | temporary%time (float) |
| dataprovider | topinfo%dataprovider (string) |
| description | topinfo%description (string) |
| firstputdate | topinfo%firstputdate (string) |
| lastupdate | topinfo%lastupdate (string) |
| source | topinfo%source (string) |
| comment | topinfo%comment (string) |
| dataversion | topinfo%dataversion (string) |
| workflow | topinfo%workflow (string) |
| entry | topinfo%entry (entry_def) |
| user | topinfo%entry%user (string) |
| machine | topinfo%entry%machine (string) |
| shot | topinfo%entry%shot (integer) |
| run | topinfo%entry%run (integer) |
| parent_entry | topinfo%parent_entry (entry_def) |
| user | topinfo%parent_entry%user (string) |
| machine | topinfo%parent_entry%machine (string) |
| shot | topinfo%parent_entry%shot (integer) |
| run | topinfo%parent_entry%run (integer) |
| mdinfo | topinfo%mdinfo (mdinfo) |
| shot_min | topinfo%mdinfo%shot_min (integer) |
| shot_max | topinfo%mdinfo%shot_max (integer) |
| md_entry | topinfo%mdinfo%md_entry (entry_def) |
| user | topinfo%mdinfo%md_entry%user (string) |
| machine | topinfo%mdinfo%md_entry%machine (string) |
| shot | topinfo%mdinfo%md_entry%shot (integer) |
| run | topinfo%mdinfo%md_entry%run (integer) |
| datainfo | toroidfield%datainfo (datainfo) |
| dataprovider | toroidfield%datainfo%dataprovider (string) |
| putdate | toroidfield%datainfo%putdate (string) |
| source | toroidfield%datainfo%source (string) |
| comment | toroidfield%datainfo%comment (string) |
| cocos | toroidfield%datainfo%cocos (integer) |
| id | toroidfield%datainfo%id (integer) |
| isref | toroidfield%datainfo%isref (integer) |
| whatref | toroidfield%datainfo%whatref (whatref) |
| user | toroidfield%datainfo%whatref%user (string) |
| machine | toroidfield%datainfo%whatref%machine (string) |
| shot | toroidfield%datainfo%whatref%shot (integer) |
| run | toroidfield%datainfo%whatref%run (integer) |
| occurrence | toroidfield%datainfo%whatref%occurrence (integer) |
| putinfo | toroidfield%datainfo%putinfo (putinfo) |
| putmethod | toroidfield%datainfo%putinfo%putmethod (string) |
| putaccess | toroidfield%datainfo%putinfo%putaccess (string) |
| putlocation | toroidfield%datainfo%putinfo%putlocation (string) |
| rights | toroidfield%datainfo%putinfo%rights (string) |
| desc_tfcoils | toroidfield%desc_tfcoils (tf_desc_tfcoils) |
| type | toroidfield%desc_tfcoils%type (integer) |
| phi | toroidfield%desc_tfcoils%phi (float) |
| circularcoil | toroidfield%desc_tfcoils%circularcoil (circularcoil) |
| centre | toroidfield%desc_tfcoils%circularcoil%centre (rz0D) |
| r | toroidfield%desc_tfcoils%circularcoil%centre%r (float) |
| z | toroidfield%desc_tfcoils%circularcoil%centre%z (float) |
| hlength | toroidfield%desc_tfcoils%circularcoil%hlength (float) |
| radialhwidth | toroidfield%desc_tfcoils%circularcoil%radialhwidth (float) |
| planecoil | toroidfield%desc_tfcoils%planecoil (planecoil) |
| coordinates | toroidfield%desc_tfcoils%planecoil%coordinates (rz1D) |
| r | toroidfield%desc_tfcoils%planecoil%coordinates%r (vecflt_type) |
| z | toroidfield%desc_tfcoils%planecoil%coordinates%z (vecflt_type) |
| hlength | toroidfield%desc_tfcoils%planecoil%hlength (vecflt_type) |
| radialhwidth | toroidfield%desc_tfcoils%planecoil%radialhwidth (vecflt_type) |
| inboard | toroidfield%desc_tfcoils%inboard (tf_structure) |
| jcable | toroidfield%desc_tfcoils%inboard%jcable (float) |
| tisotf | toroidfield%desc_tfcoils%inboard%tisotf (float) |
| efcasing | toroidfield%desc_tfcoils%inboard%efcasing (float) |
| escasing | toroidfield%desc_tfcoils%inboard%escasing (float) |
| sigjackettf | toroidfield%desc_tfcoils%inboard%sigjackettf (float) |
| sigvaulttf | toroidfield%desc_tfcoils%inboard%sigvaulttf (float) |
| ktf | toroidfield%desc_tfcoils%inboard%ktf (float) |
| ritf | toroidfield%desc_tfcoils%inboard%ritf (float) |
| riitf | toroidfield%desc_tfcoils%inboard%riitf (float) |
| retf | toroidfield%desc_tfcoils%inboard%retf (float) |
| he_fraction | toroidfield%desc_tfcoils%inboard%he_fraction (float) |
| ss_fraction | toroidfield%desc_tfcoils%inboard%ss_fraction (float) |
| pow_dens_wp | toroidfield%desc_tfcoils%inboard%pow_dens_wp (float) |
| outboard | toroidfield%desc_tfcoils%outboard (tf_structure) |
| jcable | toroidfield%desc_tfcoils%outboard%jcable (float) |
| tisotf | toroidfield%desc_tfcoils%outboard%tisotf (float) |
| efcasing | toroidfield%desc_tfcoils%outboard%efcasing (float) |
| escasing | toroidfield%desc_tfcoils%outboard%escasing (float) |
| sigjackettf | toroidfield%desc_tfcoils%outboard%sigjackettf (float) |
| sigvaulttf | toroidfield%desc_tfcoils%outboard%sigvaulttf (float) |
| ktf | toroidfield%desc_tfcoils%outboard%ktf (float) |
| ritf | toroidfield%desc_tfcoils%outboard%ritf (float) |
| riitf | toroidfield%desc_tfcoils%outboard%riitf (float) |
| retf | toroidfield%desc_tfcoils%outboard%retf (float) |
| he_fraction | toroidfield%desc_tfcoils%outboard%he_fraction (float) |
| ss_fraction | toroidfield%desc_tfcoils%outboard%ss_fraction (float) |
| pow_dens_wp | toroidfield%desc_tfcoils%outboard%pow_dens_wp (float) |
| nturns | toroidfield%nturns (integer) |
| ncoils | toroidfield%ncoils (integer) |
| current | toroidfield%current (exp0D) |
| value | toroidfield%current%value (float) |
| abserror | toroidfield%current%abserror (float) |
| relerror | toroidfield%current%relerror (float) |
| bvac_r | toroidfield%bvac_r (exp0D) |
| value | toroidfield%bvac_r%value (float) |
| abserror | toroidfield%bvac_r%abserror (float) |
| relerror | toroidfield%bvac_r%relerror (float) |
| r0 | toroidfield%r0 (float) |
| p_cryo | toroidfield%p_cryo (float) |
| wp_nh_max | toroidfield%wp_nh_max (float) |
| tfc_nh | toroidfield%tfc_nh (float) |
| neut_flux_inb | toroidfield%neut_flux_inb (float) |
| neut_flux_outb | toroidfield%neut_flux_outb (float) |
| codeparam | toroidfield%codeparam (codeparam) |
| codename | toroidfield%codeparam%codename (string) |
| codeversion | toroidfield%codeparam%codeversion (string) |
| parameters | toroidfield%codeparam%parameters (string) |
| output_diag | toroidfield%codeparam%output_diag (string) |
| output_flag | toroidfield%codeparam%output_flag (integer) |
| time | toroidfield%time (float) |
| datainfo | tsdiag%datainfo (datainfo) |
| dataprovider | tsdiag%datainfo%dataprovider (string) |
| putdate | tsdiag%datainfo%putdate (string) |
| source | tsdiag%datainfo%source (string) |
| comment | tsdiag%datainfo%comment (string) |
| cocos | tsdiag%datainfo%cocos (integer) |
| id | tsdiag%datainfo%id (integer) |
| isref | tsdiag%datainfo%isref (integer) |
| whatref | tsdiag%datainfo%whatref (whatref) |
| user | tsdiag%datainfo%whatref%user (string) |
| machine | tsdiag%datainfo%whatref%machine (string) |
| shot | tsdiag%datainfo%whatref%shot (integer) |
| run | tsdiag%datainfo%whatref%run (integer) |
| occurrence | tsdiag%datainfo%whatref%occurrence (integer) |
| putinfo | tsdiag%datainfo%putinfo (putinfo) |
| putmethod | tsdiag%datainfo%putinfo%putmethod (string) |
| putaccess | tsdiag%datainfo%putinfo%putaccess (string) |
| putlocation | tsdiag%datainfo%putinfo%putlocation (string) |
| rights | tsdiag%datainfo%putinfo%rights (string) |
| setup | tsdiag%setup (tssetup) |
| position | tsdiag%setup%position (rzphi1D) |
| r | tsdiag%setup%position%r (vecflt_type) |
| z | tsdiag%setup%position%z (vecflt_type) |
| phi | tsdiag%setup%position%phi (vecflt_type) |
| measure | tsdiag%measure (tsmeasure) |
| te | tsdiag%measure%te (exp1D) |
| value | tsdiag%measure%te%value (vecflt_type) |
| abserror | tsdiag%measure%te%abserror (vecflt_type) |
| relerror | tsdiag%measure%te%relerror (vecflt_type) |
| ne | tsdiag%measure%ne (exp1D) |
| value | tsdiag%measure%ne%value (vecflt_type) |
| abserror | tsdiag%measure%ne%abserror (vecflt_type) |
| relerror | tsdiag%measure%ne%relerror (vecflt_type) |
| codeparam | tsdiag%codeparam (codeparam) |
| codename | tsdiag%codeparam%codename (string) |
| codeversion | tsdiag%codeparam%codeversion (string) |
| parameters | tsdiag%codeparam%parameters (string) |
| output_diag | tsdiag%codeparam%output_diag (string) |
| output_flag | tsdiag%codeparam%output_flag (integer) |
| time | tsdiag%time (float) |
| datainfo | turbulence%datainfo (datainfo) |
| dataprovider | turbulence%datainfo%dataprovider (string) |
| putdate | turbulence%datainfo%putdate (string) |
| source | turbulence%datainfo%source (string) |
| comment | turbulence%datainfo%comment (string) |
| cocos | turbulence%datainfo%cocos (integer) |
| id | turbulence%datainfo%id (integer) |
| isref | turbulence%datainfo%isref (integer) |
| whatref | turbulence%datainfo%whatref (whatref) |
| user | turbulence%datainfo%whatref%user (string) |
| machine | turbulence%datainfo%whatref%machine (string) |
| shot | turbulence%datainfo%whatref%shot (integer) |
| run | turbulence%datainfo%whatref%run (integer) |
| occurrence | turbulence%datainfo%whatref%occurrence (integer) |
| putinfo | turbulence%datainfo%putinfo (putinfo) |
| putmethod | turbulence%datainfo%putinfo%putmethod (string) |
| putaccess | turbulence%datainfo%putinfo%putaccess (string) |
| putlocation | turbulence%datainfo%putinfo%putlocation (string) |
| rights | turbulence%datainfo%putinfo%rights (string) |
| composition | turbulence%composition (turbcomposition) |
| amn | turbulence%composition%amn (vecflt_type) |
| zn | turbulence%composition%zn (vecflt_type) |
| zion | turbulence%composition%zion (vecflt_type) |
| ie_mass | turbulence%composition%ie_mass (vecflt_type) |
| coordsys | turbulence%coordsys (turbcoordsys) |
| grid_type | turbulence%coordsys%grid_type (string) |
| turbgrid | turbulence%coordsys%turbgrid (turbgrid) |
| dim1 | turbulence%coordsys%turbgrid%dim1 (vecflt_type) |
| dim2 | turbulence%coordsys%turbgrid%dim2 (vecflt_type) |
| dim3 | turbulence%coordsys%turbgrid%dim3 (vecflt_type) |
| dim_v1 | turbulence%coordsys%turbgrid%dim_v1 (vecflt_type) |
| dim_v2 | turbulence%coordsys%turbgrid%dim_v2 (vecflt_type) |
| jacobian | turbulence%coordsys%jacobian (matflt_type) |
| g_11 | turbulence%coordsys%g_11 (matflt_type) |
| g_12 | turbulence%coordsys%g_12 (matflt_type) |
| g_13 | turbulence%coordsys%g_13 (matflt_type) |
| g_22 | turbulence%coordsys%g_22 (matflt_type) |
| g_23 | turbulence%coordsys%g_23 (matflt_type) |
| g_33 | turbulence%coordsys%g_33 (matflt_type) |
| position | turbulence%coordsys%position (rzphi3D) |
| r | turbulence%coordsys%position%r (array3dflt_type) |
| z | turbulence%coordsys%position%z (array3dflt_type) |
| phi | turbulence%coordsys%position%phi (array3dflt_type) |
| var0d | turbulence%var0d (turbvar0d) |
| dtime_type | turbulence%var0d%dtime_type (string) |
| dtime | turbulence%var0d%dtime (vecflt_type) |
| en_exb | turbulence%var0d%en_exb (vecflt_type) |
| en_mag | turbulence%var0d%en_mag (vecflt_type) |
| en_el_th | turbulence%var0d%en_el_th (vecflt_type) |
| en_ion_th | turbulence%var0d%en_ion_th (matflt_type) |
| en_el_par | turbulence%var0d%en_el_par (vecflt_type) |
| en_ion_par | turbulence%var0d%en_ion_par (matflt_type) |
| en_tot | turbulence%var0d%en_tot (vecflt_type) |
| fl_el | turbulence%var0d%fl_el (vecflt_type) |
| fl_heatel | turbulence%var0d%fl_heatel (vecflt_type) |
| fl_ion | turbulence%var0d%fl_ion (matflt_type) |
| fl_heation | turbulence%var0d%fl_heation (matflt_type) |
| fl_magel | turbulence%var0d%fl_magel (vecflt_type) |
| fl_magheatel | turbulence%var0d%fl_magheatel (vecflt_type) |
| fl_magion | turbulence%var0d%fl_magion (matflt_type) |
| flmagheation | turbulence%var0d%flmagheation (matflt_type) |
| var1d | turbulence%var1d (turbvar1d) |
| rho_tor_norm | turbulence%var1d%rho_tor_norm (vecflt_type) |
| phi | turbulence%var1d%phi (vecflt_type) |
| er | turbulence%var1d%er (vecflt_type) |
| vor | turbulence%var1d%vor (vecflt_type) |
| apl | turbulence%var1d%apl (vecflt_type) |
| jpl | turbulence%var1d%jpl (vecflt_type) |
| ne | turbulence%var1d%ne (vecflt_type) |
| te | turbulence%var1d%te (vecflt_type) |
| ni | turbulence%var1d%ni (matflt_type) |
| ti | turbulence%var1d%ti (matflt_type) |
| ui | turbulence%var1d%ui (matflt_type) |
| var2d | turbulence%var2d (turbvar2d) |
| rho_tor_norm | turbulence%var2d%rho_tor_norm (vecflt_type) |
| theta | turbulence%var2d%theta (vecflt_type) |
| phi | turbulence%var2d%phi (matflt_type) |
| apl | turbulence%var2d%apl (matflt_type) |
| jpl | turbulence%var2d%jpl (matflt_type) |
| vor | turbulence%var2d%vor (matflt_type) |
| ne | turbulence%var2d%ne (matflt_type) |
| te | turbulence%var2d%te (matflt_type) |
| ni | turbulence%var2d%ni (array3dflt_type) |
| ti | turbulence%var2d%ti (array3dflt_type) |
| ui | turbulence%var2d%ui (array3dflt_type) |
| var3d | turbulence%var3d (turbvar3d) |
| phi | turbulence%var3d%phi (array3dflt_type) |
| vor | turbulence%var3d%vor (array3dflt_type) |
| jpl | turbulence%var3d%jpl (array3dflt_type) |
| ne | turbulence%var3d%ne (array3dflt_type) |
| var4d | turbulence%var4d (turbvar4d) |
| fe | turbulence%var4d%fe (array4dflt_type) |
| fi | turbulence%var4d%fi (array5dflt_type) |
| var5d | turbulence%var5d (turbvar5d) |
| fe | turbulence%var5d%fe (array5dflt_type) |
| fi | turbulence%var5d%fi (array6dflt_type) |
| spec1d | turbulence%spec1d (turbspec1d) |
| kperp | turbulence%spec1d%kperp (vecflt_type) |
| phi | turbulence%spec1d%phi (vecflt_type) |
| vor | turbulence%spec1d%vor (vecflt_type) |
| b | turbulence%spec1d%b (vecflt_type) |
| jpl | turbulence%spec1d%jpl (vecflt_type) |
| ne | turbulence%spec1d%ne (vecflt_type) |
| te | turbulence%spec1d%te (vecflt_type) |
| ti | turbulence%spec1d%ti (matflt_type) |
| fe | turbulence%spec1d%fe (vecflt_type) |
| qe | turbulence%spec1d%qe (vecflt_type) |
| qi | turbulence%spec1d%qi (matflt_type) |
| me | turbulence%spec1d%me (vecflt_type) |
| mi | turbulence%spec1d%mi (matflt_type) |
| env1d | turbulence%env1d (turbenv1d) |
| theta | turbulence%env1d%theta (vecflt_type) |
| phi | turbulence%env1d%phi (vecflt_type) |
| vor | turbulence%env1d%vor (vecflt_type) |
| jpl | turbulence%env1d%jpl (vecflt_type) |
| ne | turbulence%env1d%ne (vecflt_type) |
| he | turbulence%env1d%he (vecflt_type) |
| te | turbulence%env1d%te (vecflt_type) |
| ni | turbulence%env1d%ni (matflt_type) |
| ti | turbulence%env1d%ti (matflt_type) |
| ui | turbulence%env1d%ui (matflt_type) |
| fe | turbulence%env1d%fe (vecflt_type) |
| qe | turbulence%env1d%qe (vecflt_type) |
| qi | turbulence%env1d%qi (matflt_type) |
| me | turbulence%env1d%me (vecflt_type) |
| mi | turbulence%env1d%mi (matflt_type) |
| codeparam | turbulence%codeparam (codeparam) |
| codename | turbulence%codeparam%codename (string) |
| codeversion | turbulence%codeparam%codeversion (string) |
| parameters | turbulence%codeparam%parameters (string) |
| output_diag | turbulence%codeparam%output_diag (string) |
| output_flag | turbulence%codeparam%output_flag (integer) |
| time | turbulence%time (float) |
| datainfo | wall%datainfo (datainfo) |
| dataprovider | wall%datainfo%dataprovider (string) |
| putdate | wall%datainfo%putdate (string) |
| source | wall%datainfo%source (string) |
| comment | wall%datainfo%comment (string) |
| cocos | wall%datainfo%cocos (integer) |
| id | wall%datainfo%id (integer) |
| isref | wall%datainfo%isref (integer) |
| whatref | wall%datainfo%whatref (whatref) |
| user | wall%datainfo%whatref%user (string) |
| machine | wall%datainfo%whatref%machine (string) |
| shot | wall%datainfo%whatref%shot (integer) |
| run | wall%datainfo%whatref%run (integer) |
| occurrence | wall%datainfo%whatref%occurrence (integer) |
| putinfo | wall%datainfo%putinfo (putinfo) |
| putmethod | wall%datainfo%putinfo%putmethod (string) |
| putaccess | wall%datainfo%putinfo%putaccess (string) |
| putlocation | wall%datainfo%putinfo%putlocation (string) |
| rights | wall%datainfo%putinfo%rights (string) |
| wall0d | wall%wall0d (wall_wall0d) |
| pumping_speed | wall%wall0d%pumping_speed (vecflt_type) |
| gas_puff | wall%wall0d%gas_puff (vecflt_type) |
| wall_inventory | wall%wall0d%wall_inventory (vecflt_type) |
| recycling_coefficient | wall%wall0d%recycling_coefficient (vecflt_type) |
| wall_temperature | wall%wall0d%wall_temperature (float) |
| power_from_plasma | wall%wall0d%power_from_plasma (float) |
| power_to_cooling | wall%wall0d%power_to_cooling (float) |
| plasma | wall%wall0d%plasma (wall_wall0d_plasma) |
| species_index | wall%wall0d%plasma%species_index (matint_type) |
| flux | wall%wall0d%plasma%flux (vecflt_type) |
| energy | wall%wall0d%plasma%energy (vecflt_type) |
| wall2d_mhd | wall%wall2d_mhd (wall2d_mhd) |
| res_wall | wall%wall2d_mhd%res_wall(:) (mhd_res_wall2d) |
| walltype | wall%wall2d_mhd%res_wall(:)%walltype (identifier) |
| id | wall%wall2d_mhd%res_wall(:)%walltype%id (string) |
| flag | wall%wall2d_mhd%res_wall(:)%walltype%flag (integer) |
| description | wall%wall2d_mhd%res_wall(:)%walltype%description (string) |
| delta | wall%wall2d_mhd%res_wall(:)%delta (float) |
| eta | wall%wall2d_mhd%res_wall(:)%eta (float) |
| npoloidal | wall%wall2d_mhd%res_wall(:)%npoloidal (integer) |
| position | wall%wall2d_mhd%res_wall(:)%position (rz1D) |
| r | wall%wall2d_mhd%res_wall(:)%position%r (vecflt_type) |
| z | wall%wall2d_mhd%res_wall(:)%position%z (vecflt_type) |
| holes | wall%wall2d_mhd%res_wall(:)%holes (holes) |
| n_holes | wall%wall2d_mhd%res_wall(:)%holes%n_holes (integer) |
| coordinates | wall%wall2d_mhd%res_wall(:)%holes%coordinates (coordinates) |
| theta | wall%wall2d_mhd%res_wall(:)%holes%coordinates%theta (vecflt_type) |
| phi | wall%wall2d_mhd%res_wall(:)%holes%coordinates%phi (vecflt_type) |
| width | wall%wall2d_mhd%res_wall(:)%holes%width (width) |
| dtheta | wall%wall2d_mhd%res_wall(:)%holes%width%dtheta (vecflt_type) |
| phi | wall%wall2d_mhd%res_wall(:)%holes%width%phi (vecflt_type) |
| eta | wall%wall2d_mhd%res_wall(:)%holes%eta (vecflt_type) |
| ideal_wall | wall%wall2d_mhd%ideal_wall (mhd_ideal_wall2d) |
| walltype | wall%wall2d_mhd%ideal_wall%walltype (identifier) |
| id | wall%wall2d_mhd%ideal_wall%walltype%id (string) |
| flag | wall%wall2d_mhd%ideal_wall%walltype%flag (integer) |
| description | wall%wall2d_mhd%ideal_wall%walltype%description (string) |
| position | wall%wall2d_mhd%ideal_wall%position (rz1D) |
| r | wall%wall2d_mhd%ideal_wall%position%r (vecflt_type) |
| z | wall%wall2d_mhd%ideal_wall%position%z (vecflt_type) |
| wall2d | wall%wall2d(:) (wall2d) |
| wall_id | wall%wall2d(:)%wall_id (identifier) |
| id | wall%wall2d(:)%wall_id%id (string) |
| flag | wall%wall2d(:)%wall_id%flag (integer) |
| description | wall%wall2d(:)%wall_id%description (string) |
| limiter | wall%wall2d(:)%limiter (wall_limiter) |
| limiter_id | wall%wall2d(:)%limiter%limiter_id (identifier) |
| id | wall%wall2d(:)%limiter%limiter_id%id (string) |
| flag | wall%wall2d(:)%limiter%limiter_id%flag (integer) |
| description | wall%wall2d(:)%limiter%limiter_id%description (string) |
| limiter_unit | wall%wall2d(:)%limiter%limiter_unit(:) (limiter_unit) |
| name | wall%wall2d(:)%limiter%limiter_unit(:)%name (string) |
| closed | wall%wall2d(:)%limiter%limiter_unit(:)%closed (string) |
| position | wall%wall2d(:)%limiter%limiter_unit(:)%position (rz1D) |
| r | wall%wall2d(:)%limiter%limiter_unit(:)%position%r (vecflt_type) |
| z | wall%wall2d(:)%limiter%limiter_unit(:)%position%z (vecflt_type) |
| eta | wall%wall2d(:)%limiter%limiter_unit(:)%eta (float) |
| delta | wall%wall2d(:)%limiter%limiter_unit(:)%delta (float) |
| permeability | wall%wall2d(:)%limiter%limiter_unit(:)%permeability (float) |
| vessel | wall%wall2d(:)%vessel (wall_vessel) |
| vessel_id | wall%wall2d(:)%vessel%vessel_id (identifier) |
| id | wall%wall2d(:)%vessel%vessel_id%id (string) |
| flag | wall%wall2d(:)%vessel%vessel_id%flag (integer) |
| description | wall%wall2d(:)%vessel%vessel_id%description (string) |
| vessel_unit | wall%wall2d(:)%vessel%vessel_unit(:) (wall_vessel_unit) |
| annular | wall%wall2d(:)%vessel%vessel_unit(:)%annular (wall_vessel_annular) |
| name | wall%wall2d(:)%vessel%vessel_unit(:)%annular%name (string) |
| inside | wall%wall2d(:)%vessel%vessel_unit(:)%annular%inside (rz1D) |
| r | wall%wall2d(:)%vessel%vessel_unit(:)%annular%inside%r (vecflt_type) |
| z | wall%wall2d(:)%vessel%vessel_unit(:)%annular%inside%z (vecflt_type) |
| outside | wall%wall2d(:)%vessel%vessel_unit(:)%annular%outside (rz1D) |
| r | wall%wall2d(:)%vessel%vessel_unit(:)%annular%outside%r (vecflt_type) |
| z | wall%wall2d(:)%vessel%vessel_unit(:)%annular%outside%z (vecflt_type) |
| eta | wall%wall2d(:)%vessel%vessel_unit(:)%annular%eta (float) |
| permeability | wall%wall2d(:)%vessel%vessel_unit(:)%annular%permeability (float) |
| blocks | wall%wall2d(:)%vessel%vessel_unit(:)%blocks (wall_blocks) |
| blocks_unit | wall%wall2d(:)%vessel%vessel_unit(:)%blocks%blocks_unit(:) (wall_blocks_unit) |
| name | wall%wall2d(:)%vessel%vessel_unit(:)%blocks%blocks_unit(:)%name (string) |
| position | wall%wall2d(:)%vessel%vessel_unit(:)%blocks%blocks_unit(:)%position (rz1D) |
| r | wall%wall2d(:)%vessel%vessel_unit(:)%blocks%blocks_unit(:)%position%r (vecflt_type) |
| z | wall%wall2d(:)%vessel%vessel_unit(:)%blocks%blocks_unit(:)%position%z (vecflt_type) |
| eta | wall%wall2d(:)%vessel%vessel_unit(:)%blocks%blocks_unit(:)%eta (float) |
| permeability | wall%wall2d(:)%vessel%vessel_unit(:)%blocks%blocks_unit(:)%permeability (float) |
| j_phi | wall%wall2d(:)%vessel%vessel_unit(:)%blocks%blocks_unit(:)%j_phi (float) |
| resistance | wall%wall2d(:)%vessel%vessel_unit(:)%blocks%blocks_unit(:)%resistance (float) |
| radial_build | wall%wall2d(:)%vessel%vessel_unit(:)%radial_build (wall_wall2d_vessel_radial_build) |
| r1_inb | wall%wall2d(:)%vessel%vessel_unit(:)%radial_build%r1_inb (float) |
| r2_inb | wall%wall2d(:)%vessel%vessel_unit(:)%radial_build%r2_inb (float) |
| r1_outb | wall%wall2d(:)%vessel%vessel_unit(:)%radial_build%r1_outb (float) |
| r2_outb | wall%wall2d(:)%vessel%vessel_unit(:)%radial_build%r2_outb (float) |
| raddim | wall%wall2d(:)%vessel%vessel_unit(:)%radial_build%raddim (float) |
| nmat | wall%wall2d(:)%vessel%vessel_unit(:)%radial_build%nmat (float) |
| composition | wall%wall2d(:)%vessel%vessel_unit(:)%radial_build%composition (vecflt_type) |
| pow_dens_inb | wall%wall2d(:)%vessel%vessel_unit(:)%radial_build%pow_dens_inb (float) |
| pow_dens_outb | wall%wall2d(:)%vessel%vessel_unit(:)%radial_build%pow_dens_outb (float) |
| fn_flux_inb | wall%wall2d(:)%vessel%vessel_unit(:)%radial_build%fn_flux_inb (float) |
| fn_flux_outb | wall%wall2d(:)%vessel%vessel_unit(:)%radial_build%fn_flux_outb (float) |
| plasma | wall%wall2d(:)%plasma(:) (plasmaComplexType) |
| species | wall%wall2d(:)%plasma(:)%species (vecint_type) |
| flux | wall%wall2d(:)%plasma(:)%flux (matflt_type) |
| b | wall%wall2d(:)%plasma(:)%b (matflt_type) |
| energy | wall%wall2d(:)%plasma(:)%energy (matflt_type) |
| wall_state | wall%wall2d(:)%wall_state(:) (wall_unitsComplexType) |
| wall_type | wall%wall2d(:)%wall_state(:)%wall_type (integer) |
| n_depo_layer | wall%wall2d(:)%wall_state(:)%n_depo_layer (integer) |
| layers | wall%wall2d(:)%wall_state(:)%layers(:) (wall_unitsComplexType_layers) |
| elements | wall%wall2d(:)%wall_state(:)%layers(:)%elements (vecint_type) |
| gases | wall%wall2d(:)%wall_state(:)%layers(:)%gases (vecint_type) |
| compounds | wall%wall2d(:)%wall_state(:)%layers(:)%compounds (vecint_type) |
| density | wall%wall2d(:)%wall_state(:)%layers(:)%density (matflt_type) |
| dx | wall%wall2d(:)%wall_state(:)%layers(:)%dx (matflt_type) |
| thickness | wall%wall2d(:)%wall_state(:)%layers(:)%thickness (vecflt_type) |
| roughness | wall%wall2d(:)%wall_state(:)%layers(:)%roughness (array3dflt_type) |
| porosity | wall%wall2d(:)%wall_state(:)%layers(:)%porosity (array3dflt_type) |
| dpa | wall%wall2d(:)%wall_state(:)%layers(:)%dpa (matflt_type) |
| temperature | wall%wall2d(:)%wall_state(:)%layers(:)%temperature (matflt_type) |
| element_frac | wall%wall2d(:)%wall_state(:)%layers(:)%element_frac (array3dflt_type) |
| chem_comp | wall%wall2d(:)%wall_state(:)%layers(:)%chem_comp (array3dflt_type) |
| bulk_D | wall%wall2d(:)%wall_state(:)%layers(:)%bulk_D (array4dflt_type) |
| surface_D | wall%wall2d(:)%wall_state(:)%layers(:)%surface_D (array4dflt_type) |
| bulk_solute | wall%wall2d(:)%wall_state(:)%layers(:)%bulk_solute (array4dflt_type) |
| surf_solute | wall%wall2d(:)%wall_state(:)%layers(:)%surf_solute (array4dflt_type) |
| pore_content | wall%wall2d(:)%wall_state(:)%layers(:)%pore_content (array3dflt_type) |
| trap_type | wall%wall2d(:)%wall_state(:)%layers(:)%trap_type(:) (trap_type) |
| trap_id | wall%wall2d(:)%wall_state(:)%layers(:)%trap_type(:)%trap_id (identifier) |
| id | wall%wall2d(:)%wall_state(:)%layers(:)%trap_type(:)%trap_id%id (string) |
| flag | wall%wall2d(:)%wall_state(:)%layers(:)%trap_type(:)%trap_id%flag (integer) |
| description | wall%wall2d(:)%wall_state(:)%layers(:)%trap_type(:)%trap_id%description (string) |
| compound | wall%wall2d(:)%wall_state(:)%layers(:)%trap_type(:)%compound (integer) |
| gas_species | wall%wall2d(:)%wall_state(:)%layers(:)%trap_type(:)%gas_species (integer) |
| energy | wall%wall2d(:)%wall_state(:)%layers(:)%trap_type(:)%energy (float) |
| fill_factor | wall%wall2d(:)%wall_state(:)%layers(:)%trap_type(:)%fill_factor (matflt_type) |
| density | wall%wall2d(:)%wall_state(:)%layers(:)%trap_type(:)%density (matflt_type) |
| eta | wall%wall2d(:)%wall_state(:)%eta (complexgrid_scalar) |
| griduid | wall%wall2d(:)%wall_state(:)%eta%griduid (integer) |
| subgrid | wall%wall2d(:)%wall_state(:)%eta%subgrid (integer) |
| scalar | wall%wall2d(:)%wall_state(:)%eta%scalar (vecflt_type) |
| vector | wall%wall2d(:)%wall_state(:)%eta%vector (matflt_type) |
| matrix | wall%wall2d(:)%wall_state(:)%eta%matrix (array3dflt_type) |
| permeability | wall%wall2d(:)%wall_state(:)%permeability (complexgrid_scalar) |
| griduid | wall%wall2d(:)%wall_state(:)%permeability%griduid (integer) |
| subgrid | wall%wall2d(:)%wall_state(:)%permeability%subgrid (integer) |
| scalar | wall%wall2d(:)%wall_state(:)%permeability%scalar (vecflt_type) |
| vector | wall%wall2d(:)%wall_state(:)%permeability%vector (matflt_type) |
| matrix | wall%wall2d(:)%wall_state(:)%permeability%matrix (array3dflt_type) |
| j | wall%wall2d(:)%wall_state(:)%j (complexgrid_vector) |
| griduid | wall%wall2d(:)%wall_state(:)%j%griduid (integer) |
| label | wall%wall2d(:)%wall_state(:)%j%label (string) |
| comp | wall%wall2d(:)%wall_state(:)%j%comp(:) (complexgrid_scalar) |
| griduid | wall%wall2d(:)%wall_state(:)%j%comp(:)%griduid (integer) |
| subgrid | wall%wall2d(:)%wall_state(:)%j%comp(:)%subgrid (integer) |
| scalar | wall%wall2d(:)%wall_state(:)%j%comp(:)%scalar (vecflt_type) |
| vector | wall%wall2d(:)%wall_state(:)%j%comp(:)%vector (matflt_type) |
| matrix | wall%wall2d(:)%wall_state(:)%j%comp(:)%matrix (array3dflt_type) |
| align | wall%wall2d(:)%wall_state(:)%j%align (vecint_type) |
| alignid | wall%wall2d(:)%wall_state(:)%j%alignid (vecstring_type) |
| basis | wall%wall2d(:)%wall_state(:)%j%basis (integer) |
| wall3d | wall%wall3d(:) (wall3d) |
| wall_id | wall%wall3d(:)%wall_id (identifier) |
| id | wall%wall3d(:)%wall_id%id (string) |
| flag | wall%wall3d(:)%wall_id%flag (integer) |
| description | wall%wall3d(:)%wall_id%description (string) |
| grid | wall%wall3d(:)%grid (complexgrid) |
| uid | wall%wall3d(:)%grid%uid (integer) |
| id | wall%wall3d(:)%grid%id (string) |
| spaces | wall%wall3d(:)%grid%spaces(:) (complexgrid_space) |
| geotype | wall%wall3d(:)%grid%spaces(:)%geotype (vecint_type) |
| geotypeid | wall%wall3d(:)%grid%spaces(:)%geotypeid (vecstring_type) |
| coordtype | wall%wall3d(:)%grid%spaces(:)%coordtype (matint_type) |
| objects | wall%wall3d(:)%grid%spaces(:)%objects(:) (objects) |
| boundary | wall%wall3d(:)%grid%spaces(:)%objects(:)%boundary (matint_type) |
| neighbour | wall%wall3d(:)%grid%spaces(:)%objects(:)%neighbour (array3dint_type) |
| geo | wall%wall3d(:)%grid%spaces(:)%objects(:)%geo (array4dflt_type) |
| measure | wall%wall3d(:)%grid%spaces(:)%objects(:)%measure (matflt_type) |
| xpoints | wall%wall3d(:)%grid%spaces(:)%xpoints (vecint_type) |
| subgrids | wall%wall3d(:)%grid%subgrids(:) (complexgrid_subgrid) |
| id | wall%wall3d(:)%grid%subgrids(:)%id (string) |
| list | wall%wall3d(:)%grid%subgrids(:)%list(:) (complexgrid_objectlist) |
| cls | wall%wall3d(:)%grid%subgrids(:)%list(:)%cls (vecint_type) |
| indset | wall%wall3d(:)%grid%subgrids(:)%list(:)%indset(:) (complexgrid_indexlist) |
| range | wall%wall3d(:)%grid%subgrids(:)%list(:)%indset(:)%range (vecint_type) |
| ind | wall%wall3d(:)%grid%subgrids(:)%list(:)%indset(:)%ind (vecint_type) |
| ind | wall%wall3d(:)%grid%subgrids(:)%list(:)%ind (matint_type) |
| metric | wall%wall3d(:)%grid%metric (complexgrid_metric) |
| measure | wall%wall3d(:)%grid%metric%measure(:) (complexgrid_scalar) |
| griduid | wall%wall3d(:)%grid%metric%measure(:)%griduid (integer) |
| subgrid | wall%wall3d(:)%grid%metric%measure(:)%subgrid (integer) |
| scalar | wall%wall3d(:)%grid%metric%measure(:)%scalar (vecflt_type) |
| vector | wall%wall3d(:)%grid%metric%measure(:)%vector (matflt_type) |
| matrix | wall%wall3d(:)%grid%metric%measure(:)%matrix (array3dflt_type) |
| g11 | wall%wall3d(:)%grid%metric%g11(:) (complexgrid_scalar) |
| griduid | wall%wall3d(:)%grid%metric%g11(:)%griduid (integer) |
| subgrid | wall%wall3d(:)%grid%metric%g11(:)%subgrid (integer) |
| scalar | wall%wall3d(:)%grid%metric%g11(:)%scalar (vecflt_type) |
| vector | wall%wall3d(:)%grid%metric%g11(:)%vector (matflt_type) |
| matrix | wall%wall3d(:)%grid%metric%g11(:)%matrix (array3dflt_type) |
| g12 | wall%wall3d(:)%grid%metric%g12(:) (complexgrid_scalar) |
| griduid | wall%wall3d(:)%grid%metric%g12(:)%griduid (integer) |
| subgrid | wall%wall3d(:)%grid%metric%g12(:)%subgrid (integer) |
| scalar | wall%wall3d(:)%grid%metric%g12(:)%scalar (vecflt_type) |
| vector | wall%wall3d(:)%grid%metric%g12(:)%vector (matflt_type) |
| matrix | wall%wall3d(:)%grid%metric%g12(:)%matrix (array3dflt_type) |
| g13 | wall%wall3d(:)%grid%metric%g13(:) (complexgrid_scalar) |
| griduid | wall%wall3d(:)%grid%metric%g13(:)%griduid (integer) |
| subgrid | wall%wall3d(:)%grid%metric%g13(:)%subgrid (integer) |
| scalar | wall%wall3d(:)%grid%metric%g13(:)%scalar (vecflt_type) |
| vector | wall%wall3d(:)%grid%metric%g13(:)%vector (matflt_type) |
| matrix | wall%wall3d(:)%grid%metric%g13(:)%matrix (array3dflt_type) |
| g22 | wall%wall3d(:)%grid%metric%g22(:) (complexgrid_scalar) |
| griduid | wall%wall3d(:)%grid%metric%g22(:)%griduid (integer) |
| subgrid | wall%wall3d(:)%grid%metric%g22(:)%subgrid (integer) |
| scalar | wall%wall3d(:)%grid%metric%g22(:)%scalar (vecflt_type) |
| vector | wall%wall3d(:)%grid%metric%g22(:)%vector (matflt_type) |
| matrix | wall%wall3d(:)%grid%metric%g22(:)%matrix (array3dflt_type) |
| g23 | wall%wall3d(:)%grid%metric%g23(:) (complexgrid_scalar) |
| griduid | wall%wall3d(:)%grid%metric%g23(:)%griduid (integer) |
| subgrid | wall%wall3d(:)%grid%metric%g23(:)%subgrid (integer) |
| scalar | wall%wall3d(:)%grid%metric%g23(:)%scalar (vecflt_type) |
| vector | wall%wall3d(:)%grid%metric%g23(:)%vector (matflt_type) |
| matrix | wall%wall3d(:)%grid%metric%g23(:)%matrix (array3dflt_type) |
| g33 | wall%wall3d(:)%grid%metric%g33(:) (complexgrid_scalar) |
| griduid | wall%wall3d(:)%grid%metric%g33(:)%griduid (integer) |
| subgrid | wall%wall3d(:)%grid%metric%g33(:)%subgrid (integer) |
| scalar | wall%wall3d(:)%grid%metric%g33(:)%scalar (vecflt_type) |
| vector | wall%wall3d(:)%grid%metric%g33(:)%vector (matflt_type) |
| matrix | wall%wall3d(:)%grid%metric%g33(:)%matrix (array3dflt_type) |
| jacobian | wall%wall3d(:)%grid%metric%jacobian(:) (complexgrid_scalar) |
| griduid | wall%wall3d(:)%grid%metric%jacobian(:)%griduid (integer) |
| subgrid | wall%wall3d(:)%grid%metric%jacobian(:)%subgrid (integer) |
| scalar | wall%wall3d(:)%grid%metric%jacobian(:)%scalar (vecflt_type) |
| vector | wall%wall3d(:)%grid%metric%jacobian(:)%vector (matflt_type) |
| matrix | wall%wall3d(:)%grid%metric%jacobian(:)%matrix (array3dflt_type) |
| geo | wall%wall3d(:)%grid%geo(:) (complexgrid_geo_global) |
| geotype | wall%wall3d(:)%grid%geo(:)%geotype (integer) |
| geotypeid | wall%wall3d(:)%grid%geo(:)%geotypeid (string) |
| coordtype | wall%wall3d(:)%grid%geo(:)%coordtype (vecint_type) |
| geo_matrix | wall%wall3d(:)%grid%geo(:)%geo_matrix(:) (complexgrid_scalar) |
| griduid | wall%wall3d(:)%grid%geo(:)%geo_matrix(:)%griduid (integer) |
| subgrid | wall%wall3d(:)%grid%geo(:)%geo_matrix(:)%subgrid (integer) |
| scalar | wall%wall3d(:)%grid%geo(:)%geo_matrix(:)%scalar (vecflt_type) |
| vector | wall%wall3d(:)%grid%geo(:)%geo_matrix(:)%vector (matflt_type) |
| matrix | wall%wall3d(:)%grid%geo(:)%geo_matrix(:)%matrix (array3dflt_type) |
| measure | wall%wall3d(:)%grid%geo(:)%measure(:) (complexgrid_scalar) |
| griduid | wall%wall3d(:)%grid%geo(:)%measure(:)%griduid (integer) |
| subgrid | wall%wall3d(:)%grid%geo(:)%measure(:)%subgrid (integer) |
| scalar | wall%wall3d(:)%grid%geo(:)%measure(:)%scalar (vecflt_type) |
| vector | wall%wall3d(:)%grid%geo(:)%measure(:)%vector (matflt_type) |
| matrix | wall%wall3d(:)%grid%geo(:)%measure(:)%matrix (array3dflt_type) |
| bases | wall%wall3d(:)%grid%bases(:) (complexgrid_vector) |
| griduid | wall%wall3d(:)%grid%bases(:)%griduid (integer) |
| label | wall%wall3d(:)%grid%bases(:)%label (string) |
| comp | wall%wall3d(:)%grid%bases(:)%comp(:) (complexgrid_scalar) |
| griduid | wall%wall3d(:)%grid%bases(:)%comp(:)%griduid (integer) |
| subgrid | wall%wall3d(:)%grid%bases(:)%comp(:)%subgrid (integer) |
| scalar | wall%wall3d(:)%grid%bases(:)%comp(:)%scalar (vecflt_type) |
| vector | wall%wall3d(:)%grid%bases(:)%comp(:)%vector (matflt_type) |
| matrix | wall%wall3d(:)%grid%bases(:)%comp(:)%matrix (array3dflt_type) |
| align | wall%wall3d(:)%grid%bases(:)%align (vecint_type) |
| alignid | wall%wall3d(:)%grid%bases(:)%alignid (vecstring_type) |
| basis | wall%wall3d(:)%grid%bases(:)%basis (integer) |
| plasma | wall%wall3d(:)%plasma(:) (plasmaComplexType) |
| species | wall%wall3d(:)%plasma(:)%species (vecint_type) |
| flux | wall%wall3d(:)%plasma(:)%flux (matflt_type) |
| b | wall%wall3d(:)%plasma(:)%b (matflt_type) |
| energy | wall%wall3d(:)%plasma(:)%energy (matflt_type) |
| wall_state | wall%wall3d(:)%wall_state(:) (wall_unitsComplexType) |
| wall_type | wall%wall3d(:)%wall_state(:)%wall_type (integer) |
| n_depo_layer | wall%wall3d(:)%wall_state(:)%n_depo_layer (integer) |
| layers | wall%wall3d(:)%wall_state(:)%layers(:) (wall_unitsComplexType_layers) |
| elements | wall%wall3d(:)%wall_state(:)%layers(:)%elements (vecint_type) |
| gases | wall%wall3d(:)%wall_state(:)%layers(:)%gases (vecint_type) |
| compounds | wall%wall3d(:)%wall_state(:)%layers(:)%compounds (vecint_type) |
| density | wall%wall3d(:)%wall_state(:)%layers(:)%density (matflt_type) |
| dx | wall%wall3d(:)%wall_state(:)%layers(:)%dx (matflt_type) |
| thickness | wall%wall3d(:)%wall_state(:)%layers(:)%thickness (vecflt_type) |
| roughness | wall%wall3d(:)%wall_state(:)%layers(:)%roughness (array3dflt_type) |
| porosity | wall%wall3d(:)%wall_state(:)%layers(:)%porosity (array3dflt_type) |
| dpa | wall%wall3d(:)%wall_state(:)%layers(:)%dpa (matflt_type) |
| temperature | wall%wall3d(:)%wall_state(:)%layers(:)%temperature (matflt_type) |
| element_frac | wall%wall3d(:)%wall_state(:)%layers(:)%element_frac (array3dflt_type) |
| chem_comp | wall%wall3d(:)%wall_state(:)%layers(:)%chem_comp (array3dflt_type) |
| bulk_D | wall%wall3d(:)%wall_state(:)%layers(:)%bulk_D (array4dflt_type) |
| surface_D | wall%wall3d(:)%wall_state(:)%layers(:)%surface_D (array4dflt_type) |
| bulk_solute | wall%wall3d(:)%wall_state(:)%layers(:)%bulk_solute (array4dflt_type) |
| surf_solute | wall%wall3d(:)%wall_state(:)%layers(:)%surf_solute (array4dflt_type) |
| pore_content | wall%wall3d(:)%wall_state(:)%layers(:)%pore_content (array3dflt_type) |
| trap_type | wall%wall3d(:)%wall_state(:)%layers(:)%trap_type(:) (trap_type) |
| trap_id | wall%wall3d(:)%wall_state(:)%layers(:)%trap_type(:)%trap_id (identifier) |
| id | wall%wall3d(:)%wall_state(:)%layers(:)%trap_type(:)%trap_id%id (string) |
| flag | wall%wall3d(:)%wall_state(:)%layers(:)%trap_type(:)%trap_id%flag (integer) |
| description | wall%wall3d(:)%wall_state(:)%layers(:)%trap_type(:)%trap_id%description (string) |
| compound | wall%wall3d(:)%wall_state(:)%layers(:)%trap_type(:)%compound (integer) |
| gas_species | wall%wall3d(:)%wall_state(:)%layers(:)%trap_type(:)%gas_species (integer) |
| energy | wall%wall3d(:)%wall_state(:)%layers(:)%trap_type(:)%energy (float) |
| fill_factor | wall%wall3d(:)%wall_state(:)%layers(:)%trap_type(:)%fill_factor (matflt_type) |
| density | wall%wall3d(:)%wall_state(:)%layers(:)%trap_type(:)%density (matflt_type) |
| eta | wall%wall3d(:)%wall_state(:)%eta (complexgrid_scalar) |
| griduid | wall%wall3d(:)%wall_state(:)%eta%griduid (integer) |
| subgrid | wall%wall3d(:)%wall_state(:)%eta%subgrid (integer) |
| scalar | wall%wall3d(:)%wall_state(:)%eta%scalar (vecflt_type) |
| vector | wall%wall3d(:)%wall_state(:)%eta%vector (matflt_type) |
| matrix | wall%wall3d(:)%wall_state(:)%eta%matrix (array3dflt_type) |
| permeability | wall%wall3d(:)%wall_state(:)%permeability (complexgrid_scalar) |
| griduid | wall%wall3d(:)%wall_state(:)%permeability%griduid (integer) |
| subgrid | wall%wall3d(:)%wall_state(:)%permeability%subgrid (integer) |
| scalar | wall%wall3d(:)%wall_state(:)%permeability%scalar (vecflt_type) |
| vector | wall%wall3d(:)%wall_state(:)%permeability%vector (matflt_type) |
| matrix | wall%wall3d(:)%wall_state(:)%permeability%matrix (array3dflt_type) |
| j | wall%wall3d(:)%wall_state(:)%j (complexgrid_vector) |
| griduid | wall%wall3d(:)%wall_state(:)%j%griduid (integer) |
| label | wall%wall3d(:)%wall_state(:)%j%label (string) |
| comp | wall%wall3d(:)%wall_state(:)%j%comp(:) (complexgrid_scalar) |
| griduid | wall%wall3d(:)%wall_state(:)%j%comp(:)%griduid (integer) |
| subgrid | wall%wall3d(:)%wall_state(:)%j%comp(:)%subgrid (integer) |
| scalar | wall%wall3d(:)%wall_state(:)%j%comp(:)%scalar (vecflt_type) |
| vector | wall%wall3d(:)%wall_state(:)%j%comp(:)%vector (matflt_type) |
| matrix | wall%wall3d(:)%wall_state(:)%j%comp(:)%matrix (array3dflt_type) |
| align | wall%wall3d(:)%wall_state(:)%j%align (vecint_type) |
| alignid | wall%wall3d(:)%wall_state(:)%j%alignid (vecstring_type) |
| basis | wall%wall3d(:)%wall_state(:)%j%basis (integer) |
| basis_index | wall%wall3d(:)%basis_index (integer) |
| wall_types | wall%wall_types(:) (wall_types) |
| label | wall%wall_types(:)%label (string) |
| layers | wall%wall_types(:)%layers(:) (wall_types_layers) |
| thickness | wall%wall_types(:)%layers(:)%thickness (float) |
| chem_comp | wall%wall_types(:)%layers(:)%chem_comp (vecflt_type) |
| compounds | wall%compounds(:) (compound_desc) |
| label | wall%compounds(:)%label (string) |
| stochiometry | wall%compounds(:)%stochiometry (vecflt_type) |
| density | wall%compounds(:)%density (float) |
| heat_cap | wall%compounds(:)%heat_cap (float) |
| heat_cond | wall%compounds(:)%heat_cond (vecflt_type) |
| surf_recrate | wall%compounds(:)%surf_recrate (matflt_type) |
| elements | wall%elements(:) (element_desc) |
| nucindex | wall%elements(:)%nucindex (integer) |
| label | wall%elements(:)%label (string) |
| zn | wall%elements(:)%zn (float) |
| amn | wall%elements(:)%amn (float) |
| compositions | wall%compositions (compositions_type) |
| nuclei | wall%compositions%nuclei(:) (nuclei) |
| zn | wall%compositions%nuclei(:)%zn (float) |
| amn | wall%compositions%nuclei(:)%amn (float) |
| label | wall%compositions%nuclei(:)%label (string) |
| ions | wall%compositions%ions(:) (ions) |
| nucindex | wall%compositions%ions(:)%nucindex (integer) |
| zion | wall%compositions%ions(:)%zion (float) |
| imp_flag | wall%compositions%ions(:)%imp_flag (integer) |
| label | wall%compositions%ions(:)%label (string) |
| impurities | wall%compositions%impurities(:) (impurities) |
| nucindex | wall%compositions%impurities(:)%nucindex (integer) |
| i_ion | wall%compositions%impurities(:)%i_ion (integer) |
| nzimp | wall%compositions%impurities(:)%nzimp (integer) |
| zmin | wall%compositions%impurities(:)%zmin (vecflt_type) |
| zmax | wall%compositions%impurities(:)%zmax (vecflt_type) |
| label | wall%compositions%impurities(:)%label (vecstring_type) |
| neutralscomp | wall%compositions%neutralscomp(:) (composition_neutralscomp) |
| neutcomp | wall%compositions%neutralscomp(:)%neutcomp(:) (composition_neutrals_neutcomp) |
| nucindex | wall%compositions%neutralscomp(:)%neutcomp(:)%nucindex (integer) |
| multiplicity | wall%compositions%neutralscomp(:)%neutcomp(:)%multiplicity (integer) |
| type | wall%compositions%neutralscomp(:)%type(:) (identifier) |
| id | wall%compositions%neutralscomp(:)%type(:)%id (string) |
| flag | wall%compositions%neutralscomp(:)%type(:)%flag (integer) |
| description | wall%compositions%neutralscomp(:)%type(:)%description (string) |
| label | wall%compositions%neutralscomp(:)%label (string) |
| edgespecies | wall%compositions%edgespecies(:) (edgespecies) |
| nucindex | wall%compositions%edgespecies(:)%nucindex (integer) |
| zmin | wall%compositions%edgespecies(:)%zmin (float) |
| zmax | wall%compositions%edgespecies(:)%zmax (float) |
| label | wall%compositions%edgespecies(:)%label (string) |
| signature | wall%compositions%signature (identifier) |
| id | wall%compositions%signature%id (string) |
| flag | wall%compositions%signature%flag (integer) |
| description | wall%compositions%signature%description (string) |
| codeparam | wall%codeparam (codeparam) |
| codename | wall%codeparam%codename (string) |
| codeversion | wall%codeparam%codeversion (string) |
| parameters | wall%codeparam%parameters (string) |
| output_diag | wall%codeparam%output_diag (string) |
| output_flag | wall%codeparam%output_flag (integer) |
| time | wall%time (float) |
| datainfo | waves%datainfo (datainfo) |
| dataprovider | waves%datainfo%dataprovider (string) |
| putdate | waves%datainfo%putdate (string) |
| source | waves%datainfo%source (string) |
| comment | waves%datainfo%comment (string) |
| cocos | waves%datainfo%cocos (integer) |
| id | waves%datainfo%id (integer) |
| isref | waves%datainfo%isref (integer) |
| whatref | waves%datainfo%whatref (whatref) |
| user | waves%datainfo%whatref%user (string) |
| machine | waves%datainfo%whatref%machine (string) |
| shot | waves%datainfo%whatref%shot (integer) |
| run | waves%datainfo%whatref%run (integer) |
| occurrence | waves%datainfo%whatref%occurrence (integer) |
| putinfo | waves%datainfo%putinfo (putinfo) |
| putmethod | waves%datainfo%putinfo%putmethod (string) |
| putaccess | waves%datainfo%putinfo%putaccess (string) |
| putlocation | waves%datainfo%putinfo%putlocation (string) |
| rights | waves%datainfo%putinfo%rights (string) |
| coherentwave | waves%coherentwave(:) (coherentwave) |
| wave_id | waves%coherentwave(:)%wave_id (enum_instance) |
| type | waves%coherentwave(:)%wave_id%type (identifier) |
| id | waves%coherentwave(:)%wave_id%type%id (string) |
| flag | waves%coherentwave(:)%wave_id%type%flag (integer) |
| description | waves%coherentwave(:)%wave_id%type%description (string) |
| name | waves%coherentwave(:)%wave_id%name (string) |
| index | waves%coherentwave(:)%wave_id%index (integer) |
| composition | waves%coherentwave(:)%composition (composition) |
| amn | waves%coherentwave(:)%composition%amn (vecflt_type) |
| zn | waves%coherentwave(:)%composition%zn (vecflt_type) |
| zion | waves%coherentwave(:)%composition%zion (vecflt_type) |
| imp_flag | waves%coherentwave(:)%composition%imp_flag (vecint_type) |
| label | waves%coherentwave(:)%composition%label (vecstring_type) |
| compositions | waves%coherentwave(:)%compositions (compositions_type) |
| nuclei | waves%coherentwave(:)%compositions%nuclei(:) (nuclei) |
| zn | waves%coherentwave(:)%compositions%nuclei(:)%zn (float) |
| amn | waves%coherentwave(:)%compositions%nuclei(:)%amn (float) |
| label | waves%coherentwave(:)%compositions%nuclei(:)%label (string) |
| ions | waves%coherentwave(:)%compositions%ions(:) (ions) |
| nucindex | waves%coherentwave(:)%compositions%ions(:)%nucindex (integer) |
| zion | waves%coherentwave(:)%compositions%ions(:)%zion (float) |
| imp_flag | waves%coherentwave(:)%compositions%ions(:)%imp_flag (integer) |
| label | waves%coherentwave(:)%compositions%ions(:)%label (string) |
| impurities | waves%coherentwave(:)%compositions%impurities(:) (impurities) |
| nucindex | waves%coherentwave(:)%compositions%impurities(:)%nucindex (integer) |
| i_ion | waves%coherentwave(:)%compositions%impurities(:)%i_ion (integer) |
| nzimp | waves%coherentwave(:)%compositions%impurities(:)%nzimp (integer) |
| zmin | waves%coherentwave(:)%compositions%impurities(:)%zmin (vecflt_type) |
| zmax | waves%coherentwave(:)%compositions%impurities(:)%zmax (vecflt_type) |
| label | waves%coherentwave(:)%compositions%impurities(:)%label (vecstring_type) |
| neutralscomp | waves%coherentwave(:)%compositions%neutralscomp(:) (composition_neutralscomp) |
| neutcomp | waves%coherentwave(:)%compositions%neutralscomp(:)%neutcomp(:) (composition_neutrals_neutcomp) |
| nucindex | waves%coherentwave(:)%compositions%neutralscomp(:)%neutcomp(:)%nucindex (integer) |
| multiplicity | waves%coherentwave(:)%compositions%neutralscomp(:)%neutcomp(:)%multiplicity (integer) |
| type | waves%coherentwave(:)%compositions%neutralscomp(:)%type(:) (identifier) |
| id | waves%coherentwave(:)%compositions%neutralscomp(:)%type(:)%id (string) |
| flag | waves%coherentwave(:)%compositions%neutralscomp(:)%type(:)%flag (integer) |
| description | waves%coherentwave(:)%compositions%neutralscomp(:)%type(:)%description (string) |
| label | waves%coherentwave(:)%compositions%neutralscomp(:)%label (string) |
| edgespecies | waves%coherentwave(:)%compositions%edgespecies(:) (edgespecies) |
| nucindex | waves%coherentwave(:)%compositions%edgespecies(:)%nucindex (integer) |
| zmin | waves%coherentwave(:)%compositions%edgespecies(:)%zmin (float) |
| zmax | waves%coherentwave(:)%compositions%edgespecies(:)%zmax (float) |
| label | waves%coherentwave(:)%compositions%edgespecies(:)%label (string) |
| signature | waves%coherentwave(:)%compositions%signature (identifier) |
| id | waves%coherentwave(:)%compositions%signature%id (string) |
| flag | waves%coherentwave(:)%compositions%signature%flag (integer) |
| description | waves%coherentwave(:)%compositions%signature%description (string) |
| global_param | waves%coherentwave(:)%global_param (waves_global_param) |
| name | waves%coherentwave(:)%global_param%name (string) |
| type | waves%coherentwave(:)%global_param%type (string) |
| f_assumption | waves%coherentwave(:)%global_param%f_assumption (vecint_type) |
| code_type | waves%coherentwave(:)%global_param%code_type (integer) |
| frequency | waves%coherentwave(:)%global_param%frequency (float) |
| ntor | waves%coherentwave(:)%global_param%ntor (vecint_type) |
| power_tot | waves%coherentwave(:)%global_param%power_tot (float) |
| p_frac_ntor | waves%coherentwave(:)%global_param%p_frac_ntor (vecflt_type) |
| pow_e | waves%coherentwave(:)%global_param%pow_e (float) |
| pow_i | waves%coherentwave(:)%global_param%pow_i (vecflt_type) |
| pow_z | waves%coherentwave(:)%global_param%pow_z (matflt_type) |
| pow_fe | waves%coherentwave(:)%global_param%pow_fe (float) |
| pow_fi | waves%coherentwave(:)%global_param%pow_fi (vecflt_type) |
| pow_fz | waves%coherentwave(:)%global_param%pow_fz (matflt_type) |
| pow_ntor_e | waves%coherentwave(:)%global_param%pow_ntor_e (vecflt_type) |
| pow_ntor_i | waves%coherentwave(:)%global_param%pow_ntor_i (matflt_type) |
| pow_ntor_z | waves%coherentwave(:)%global_param%pow_ntor_z (array3dflt_type) |
| pow_ntor_fe | waves%coherentwave(:)%global_param%pow_ntor_fe (vecflt_type) |
| pow_ntor_fi | waves%coherentwave(:)%global_param%pow_ntor_fi (matflt_type) |
| pow_ntor_fz | waves%coherentwave(:)%global_param%pow_ntor_fz (array3dflt_type) |
| cur_tor | waves%coherentwave(:)%global_param%cur_tor (float) |
| cur_tor_ntor | waves%coherentwave(:)%global_param%cur_tor_ntor (vecflt_type) |
| mag_axis | waves%coherentwave(:)%global_param%mag_axis (rz0D) |
| r | waves%coherentwave(:)%global_param%mag_axis%r (float) |
| z | waves%coherentwave(:)%global_param%mag_axis%z (float) |
| toroid_field | waves%coherentwave(:)%global_param%toroid_field (b0r0) |
| r0 | waves%coherentwave(:)%global_param%toroid_field%r0 (float) |
| b0 | waves%coherentwave(:)%global_param%toroid_field%b0 (float) |
| grid_1d | waves%coherentwave(:)%grid_1d (waves_grid_1d) |
| rho_tor | waves%coherentwave(:)%grid_1d%rho_tor (vecflt_type) |
| rho_tor_norm | waves%coherentwave(:)%grid_1d%rho_tor_norm (vecflt_type) |
| psi | waves%coherentwave(:)%grid_1d%psi (vecflt_type) |
| volume | waves%coherentwave(:)%grid_1d%volume (vecflt_type) |
| area | waves%coherentwave(:)%grid_1d%area (vecflt_type) |
| grid_2d | waves%coherentwave(:)%grid_2d (waves_grid_2d) |
| grid_type | waves%coherentwave(:)%grid_2d%grid_type (integer) |
| rho_tor_norm | waves%coherentwave(:)%grid_2d%rho_tor_norm (matflt_type) |
| rho_tor | waves%coherentwave(:)%grid_2d%rho_tor (matflt_type) |
| psi | waves%coherentwave(:)%grid_2d%psi (matflt_type) |
| theta | waves%coherentwave(:)%grid_2d%theta (matflt_type) |
| r | waves%coherentwave(:)%grid_2d%r (matflt_type) |
| z | waves%coherentwave(:)%grid_2d%z (matflt_type) |
| theta_info | waves%coherentwave(:)%grid_2d%theta_info (theta_info) |
| angl_type | waves%coherentwave(:)%grid_2d%theta_info%angl_type (integer) |
| th2th_pol | waves%coherentwave(:)%grid_2d%theta_info%th2th_pol (matflt_type) |
| profiles_1d | waves%coherentwave(:)%profiles_1d (waves_profiles_1d) |
| powd_tot | waves%coherentwave(:)%profiles_1d%powd_tot (vecflt_type) |
| powd_e | waves%coherentwave(:)%profiles_1d%powd_e (vecflt_type) |
| powd_i | waves%coherentwave(:)%profiles_1d%powd_i (matflt_type) |
| powd_z | waves%coherentwave(:)%profiles_1d%powd_z (array3dflt_type) |
| powd_fe | waves%coherentwave(:)%profiles_1d%powd_fe (vecflt_type) |
| powd_fi | waves%coherentwave(:)%profiles_1d%powd_fi (matflt_type) |
| powd_fz | waves%coherentwave(:)%profiles_1d%powd_fz (array3dflt_type) |
| powd_ntor | waves%coherentwave(:)%profiles_1d%powd_ntor (matflt_type) |
| powd_ntor_e | waves%coherentwave(:)%profiles_1d%powd_ntor_e (matflt_type) |
| powd_ntor_i | waves%coherentwave(:)%profiles_1d%powd_ntor_i (array3dflt_type) |
| powd_ntor_z | waves%coherentwave(:)%profiles_1d%powd_ntor_z (array4dflt_type) |
| powd_ntor_fe | waves%coherentwave(:)%profiles_1d%powd_ntor_fe (matflt_type) |
| powd_ntor_fi | waves%coherentwave(:)%profiles_1d%powd_ntor_fi (array3dflt_type) |
| powd_ntor_fz | waves%coherentwave(:)%profiles_1d%powd_ntor_fz (array4dflt_type) |
| curd_tor | waves%coherentwave(:)%profiles_1d%curd_tor (vecflt_type) |
| curd_torntor | waves%coherentwave(:)%profiles_1d%curd_torntor (matflt_type) |
| pow_tot | waves%coherentwave(:)%profiles_1d%pow_tot (vecflt_type) |
| pow_e | waves%coherentwave(:)%profiles_1d%pow_e (vecflt_type) |
| pow_i | waves%coherentwave(:)%profiles_1d%pow_i (matflt_type) |
| pow_z | waves%coherentwave(:)%profiles_1d%pow_z (array3dflt_type) |
| pow_fe | waves%coherentwave(:)%profiles_1d%pow_fe (vecflt_type) |
| pow_fi | waves%coherentwave(:)%profiles_1d%pow_fi (matflt_type) |
| pow_fz | waves%coherentwave(:)%profiles_1d%pow_fz (array3dflt_type) |
| pow_ntor | waves%coherentwave(:)%profiles_1d%pow_ntor (matflt_type) |
| pow_ntor_e | waves%coherentwave(:)%profiles_1d%pow_ntor_e (matflt_type) |
| pow_ntor_i | waves%coherentwave(:)%profiles_1d%pow_ntor_i (array3dflt_type) |
| pow_ntor_z | waves%coherentwave(:)%profiles_1d%pow_ntor_z (array3dflt_type) |
| pow_ntor_fe | waves%coherentwave(:)%profiles_1d%pow_ntor_fe (matflt_type) |
| pow_ntor_fi | waves%coherentwave(:)%profiles_1d%pow_ntor_fi (array3dflt_type) |
| pow_ntor_fz | waves%coherentwave(:)%profiles_1d%pow_ntor_fz (array3dflt_type) |
| curd_par | waves%coherentwave(:)%profiles_1d%curd_par (vecflt_type) |
| curd_parntor | waves%coherentwave(:)%profiles_1d%curd_parntor (matflt_type) |
| cur_tor | waves%coherentwave(:)%profiles_1d%cur_tor (vecflt_type) |
| cur_tor_ntor | waves%coherentwave(:)%profiles_1d%cur_tor_ntor (matflt_type) |
| e_plus_ave | waves%coherentwave(:)%profiles_1d%e_plus_ave (matflt_type) |
| e_minus_ave | waves%coherentwave(:)%profiles_1d%e_minus_ave (matflt_type) |
| e_para_ave | waves%coherentwave(:)%profiles_1d%e_para_ave (matflt_type) |
| k_perp_ave | waves%coherentwave(:)%profiles_1d%k_perp_ave (matflt_type) |
| profiles_2d | waves%coherentwave(:)%profiles_2d (waves_profiles_2d) |
| powd_tot | waves%coherentwave(:)%profiles_2d%powd_tot (matflt_type) |
| powd_e | waves%coherentwave(:)%profiles_2d%powd_e (matflt_type) |
| powd_i | waves%coherentwave(:)%profiles_2d%powd_i (array3dflt_type) |
| powd_z | waves%coherentwave(:)%profiles_2d%powd_z (array4dflt_type) |
| powd_fe | waves%coherentwave(:)%profiles_2d%powd_fe (matflt_type) |
| powd_fi | waves%coherentwave(:)%profiles_2d%powd_fi (array3dflt_type) |
| powd_fz | waves%coherentwave(:)%profiles_2d%powd_fz (array4dflt_type) |
| powd_ntor | waves%coherentwave(:)%profiles_2d%powd_ntor (array3dflt_type) |
| powd_ntor_e | waves%coherentwave(:)%profiles_2d%powd_ntor_e (array3dflt_type) |
| powd_ntor_i | waves%coherentwave(:)%profiles_2d%powd_ntor_i (array4dflt_type) |
| powd_ntor_z | waves%coherentwave(:)%profiles_2d%powd_ntor_z (array5dflt_type) |
| powd_ntor_fe | waves%coherentwave(:)%profiles_2d%powd_ntor_fe (array3dflt_type) |
| powd_ntor_fi | waves%coherentwave(:)%profiles_2d%powd_ntor_fi (array4dflt_type) |
| powd_ntor_fz | waves%coherentwave(:)%profiles_2d%powd_ntor_fz (array5dflt_type) |
| powd_iharm | waves%coherentwave(:)%profiles_2d%powd_iharm (array5dflt_type) |
| beamtracing | waves%coherentwave(:)%beamtracing(:) (beamtracing) |
| npoints | waves%coherentwave(:)%beamtracing(:)%npoints (integer) |
| power | waves%coherentwave(:)%beamtracing(:)%power (float) |
| dnpar | waves%coherentwave(:)%beamtracing(:)%dnpar (vecflt_type) |
| length | waves%coherentwave(:)%beamtracing(:)%length (vecflt_type) |
| position | waves%coherentwave(:)%beamtracing(:)%position (waves_rtposition) |
| r | waves%coherentwave(:)%beamtracing(:)%position%r (vecflt_type) |
| z | waves%coherentwave(:)%beamtracing(:)%position%z (vecflt_type) |
| phi | waves%coherentwave(:)%beamtracing(:)%position%phi (vecflt_type) |
| psi | waves%coherentwave(:)%beamtracing(:)%position%psi (vecflt_type) |
| theta | waves%coherentwave(:)%beamtracing(:)%position%theta (vecflt_type) |
| wavevector | waves%coherentwave(:)%beamtracing(:)%wavevector (waves_rtwavevector) |
| kr | waves%coherentwave(:)%beamtracing(:)%wavevector%kr (vecflt_type) |
| kz | waves%coherentwave(:)%beamtracing(:)%wavevector%kz (vecflt_type) |
| kphi | waves%coherentwave(:)%beamtracing(:)%wavevector%kphi (vecflt_type) |
| npar | waves%coherentwave(:)%beamtracing(:)%wavevector%npar (vecflt_type) |
| nperp | waves%coherentwave(:)%beamtracing(:)%wavevector%nperp (vecflt_type) |
| ntor | waves%coherentwave(:)%beamtracing(:)%wavevector%ntor (vecflt_type) |
| var_ntor | waves%coherentwave(:)%beamtracing(:)%wavevector%var_ntor (integer) |
| polarization | waves%coherentwave(:)%beamtracing(:)%polarization (polarization) |
| epol_p_re | waves%coherentwave(:)%beamtracing(:)%polarization%epol_p_re (vecflt_type) |
| epol_p_im | waves%coherentwave(:)%beamtracing(:)%polarization%epol_p_im (vecflt_type) |
| epol_m_re | waves%coherentwave(:)%beamtracing(:)%polarization%epol_m_re (vecflt_type) |
| epol_m_im | waves%coherentwave(:)%beamtracing(:)%polarization%epol_m_im (vecflt_type) |
| epol_par_re | waves%coherentwave(:)%beamtracing(:)%polarization%epol_par_re (vecflt_type) |
| epol_par_im | waves%coherentwave(:)%beamtracing(:)%polarization%epol_par_im (vecflt_type) |
| powerflow | waves%coherentwave(:)%beamtracing(:)%powerflow (powerflow) |
| phi_perp | waves%coherentwave(:)%beamtracing(:)%powerflow%phi_perp (vecflt_type) |
| phi_par | waves%coherentwave(:)%beamtracing(:)%powerflow%phi_par (vecflt_type) |
| power_e | waves%coherentwave(:)%beamtracing(:)%powerflow%power_e (vecflt_type) |
| power_i | waves%coherentwave(:)%beamtracing(:)%powerflow%power_i (matflt_type) |
| fullwave | waves%coherentwave(:)%fullwave (fullwave) |
| grid | waves%coherentwave(:)%fullwave%grid (complexgrid) |
| uid | waves%coherentwave(:)%fullwave%grid%uid (integer) |
| id | waves%coherentwave(:)%fullwave%grid%id (string) |
| spaces | waves%coherentwave(:)%fullwave%grid%spaces(:) (complexgrid_space) |
| geotype | waves%coherentwave(:)%fullwave%grid%spaces(:)%geotype (vecint_type) |
| geotypeid | waves%coherentwave(:)%fullwave%grid%spaces(:)%geotypeid (vecstring_type) |
| coordtype | waves%coherentwave(:)%fullwave%grid%spaces(:)%coordtype (matint_type) |
| objects | waves%coherentwave(:)%fullwave%grid%spaces(:)%objects(:) (objects) |
| boundary | waves%coherentwave(:)%fullwave%grid%spaces(:)%objects(:)%boundary (matint_type) |
| neighbour | waves%coherentwave(:)%fullwave%grid%spaces(:)%objects(:)%neighbour (array3dint_type) |
| geo | waves%coherentwave(:)%fullwave%grid%spaces(:)%objects(:)%geo (array4dflt_type) |
| measure | waves%coherentwave(:)%fullwave%grid%spaces(:)%objects(:)%measure (matflt_type) |
| xpoints | waves%coherentwave(:)%fullwave%grid%spaces(:)%xpoints (vecint_type) |
| subgrids | waves%coherentwave(:)%fullwave%grid%subgrids(:) (complexgrid_subgrid) |
| id | waves%coherentwave(:)%fullwave%grid%subgrids(:)%id (string) |
| list | waves%coherentwave(:)%fullwave%grid%subgrids(:)%list(:) (complexgrid_objectlist) |
| cls | waves%coherentwave(:)%fullwave%grid%subgrids(:)%list(:)%cls (vecint_type) |
| indset | waves%coherentwave(:)%fullwave%grid%subgrids(:)%list(:)%indset(:) (complexgrid_indexlist) |
| range | waves%coherentwave(:)%fullwave%grid%subgrids(:)%list(:)%indset(:)%range (vecint_type) |
| ind | waves%coherentwave(:)%fullwave%grid%subgrids(:)%list(:)%indset(:)%ind (vecint_type) |
| ind | waves%coherentwave(:)%fullwave%grid%subgrids(:)%list(:)%ind (matint_type) |
| metric | waves%coherentwave(:)%fullwave%grid%metric (complexgrid_metric) |
| measure | waves%coherentwave(:)%fullwave%grid%metric%measure(:) (complexgrid_scalar) |
| griduid | waves%coherentwave(:)%fullwave%grid%metric%measure(:)%griduid (integer) |
| subgrid | waves%coherentwave(:)%fullwave%grid%metric%measure(:)%subgrid (integer) |
| scalar | waves%coherentwave(:)%fullwave%grid%metric%measure(:)%scalar (vecflt_type) |
| vector | waves%coherentwave(:)%fullwave%grid%metric%measure(:)%vector (matflt_type) |
| matrix | waves%coherentwave(:)%fullwave%grid%metric%measure(:)%matrix (array3dflt_type) |
| g11 | waves%coherentwave(:)%fullwave%grid%metric%g11(:) (complexgrid_scalar) |
| griduid | waves%coherentwave(:)%fullwave%grid%metric%g11(:)%griduid (integer) |
| subgrid | waves%coherentwave(:)%fullwave%grid%metric%g11(:)%subgrid (integer) |
| scalar | waves%coherentwave(:)%fullwave%grid%metric%g11(:)%scalar (vecflt_type) |
| vector | waves%coherentwave(:)%fullwave%grid%metric%g11(:)%vector (matflt_type) |
| matrix | waves%coherentwave(:)%fullwave%grid%metric%g11(:)%matrix (array3dflt_type) |
| g12 | waves%coherentwave(:)%fullwave%grid%metric%g12(:) (complexgrid_scalar) |
| griduid | waves%coherentwave(:)%fullwave%grid%metric%g12(:)%griduid (integer) |
| subgrid | waves%coherentwave(:)%fullwave%grid%metric%g12(:)%subgrid (integer) |
| scalar | waves%coherentwave(:)%fullwave%grid%metric%g12(:)%scalar (vecflt_type) |
| vector | waves%coherentwave(:)%fullwave%grid%metric%g12(:)%vector (matflt_type) |
| matrix | waves%coherentwave(:)%fullwave%grid%metric%g12(:)%matrix (array3dflt_type) |
| g13 | waves%coherentwave(:)%fullwave%grid%metric%g13(:) (complexgrid_scalar) |
| griduid | waves%coherentwave(:)%fullwave%grid%metric%g13(:)%griduid (integer) |
| subgrid | waves%coherentwave(:)%fullwave%grid%metric%g13(:)%subgrid (integer) |
| scalar | waves%coherentwave(:)%fullwave%grid%metric%g13(:)%scalar (vecflt_type) |
| vector | waves%coherentwave(:)%fullwave%grid%metric%g13(:)%vector (matflt_type) |
| matrix | waves%coherentwave(:)%fullwave%grid%metric%g13(:)%matrix (array3dflt_type) |
| g22 | waves%coherentwave(:)%fullwave%grid%metric%g22(:) (complexgrid_scalar) |
| griduid | waves%coherentwave(:)%fullwave%grid%metric%g22(:)%griduid (integer) |
| subgrid | waves%coherentwave(:)%fullwave%grid%metric%g22(:)%subgrid (integer) |
| scalar | waves%coherentwave(:)%fullwave%grid%metric%g22(:)%scalar (vecflt_type) |
| vector | waves%coherentwave(:)%fullwave%grid%metric%g22(:)%vector (matflt_type) |
| matrix | waves%coherentwave(:)%fullwave%grid%metric%g22(:)%matrix (array3dflt_type) |
| g23 | waves%coherentwave(:)%fullwave%grid%metric%g23(:) (complexgrid_scalar) |
| griduid | waves%coherentwave(:)%fullwave%grid%metric%g23(:)%griduid (integer) |
| subgrid | waves%coherentwave(:)%fullwave%grid%metric%g23(:)%subgrid (integer) |
| scalar | waves%coherentwave(:)%fullwave%grid%metric%g23(:)%scalar (vecflt_type) |
| vector | waves%coherentwave(:)%fullwave%grid%metric%g23(:)%vector (matflt_type) |
| matrix | waves%coherentwave(:)%fullwave%grid%metric%g23(:)%matrix (array3dflt_type) |
| g33 | waves%coherentwave(:)%fullwave%grid%metric%g33(:) (complexgrid_scalar) |
| griduid | waves%coherentwave(:)%fullwave%grid%metric%g33(:)%griduid (integer) |
| subgrid | waves%coherentwave(:)%fullwave%grid%metric%g33(:)%subgrid (integer) |
| scalar | waves%coherentwave(:)%fullwave%grid%metric%g33(:)%scalar (vecflt_type) |
| vector | waves%coherentwave(:)%fullwave%grid%metric%g33(:)%vector (matflt_type) |
| matrix | waves%coherentwave(:)%fullwave%grid%metric%g33(:)%matrix (array3dflt_type) |
| jacobian | waves%coherentwave(:)%fullwave%grid%metric%jacobian(:) (complexgrid_scalar) |
| griduid | waves%coherentwave(:)%fullwave%grid%metric%jacobian(:)%griduid (integer) |
| subgrid | waves%coherentwave(:)%fullwave%grid%metric%jacobian(:)%subgrid (integer) |
| scalar | waves%coherentwave(:)%fullwave%grid%metric%jacobian(:)%scalar (vecflt_type) |
| vector | waves%coherentwave(:)%fullwave%grid%metric%jacobian(:)%vector (matflt_type) |
| matrix | waves%coherentwave(:)%fullwave%grid%metric%jacobian(:)%matrix (array3dflt_type) |
| geo | waves%coherentwave(:)%fullwave%grid%geo(:) (complexgrid_geo_global) |
| geotype | waves%coherentwave(:)%fullwave%grid%geo(:)%geotype (integer) |
| geotypeid | waves%coherentwave(:)%fullwave%grid%geo(:)%geotypeid (string) |
| coordtype | waves%coherentwave(:)%fullwave%grid%geo(:)%coordtype (vecint_type) |
| geo_matrix | waves%coherentwave(:)%fullwave%grid%geo(:)%geo_matrix(:) (complexgrid_scalar) |
| griduid | waves%coherentwave(:)%fullwave%grid%geo(:)%geo_matrix(:)%griduid (integer) |
| subgrid | waves%coherentwave(:)%fullwave%grid%geo(:)%geo_matrix(:)%subgrid (integer) |
| scalar | waves%coherentwave(:)%fullwave%grid%geo(:)%geo_matrix(:)%scalar (vecflt_type) |
| vector | waves%coherentwave(:)%fullwave%grid%geo(:)%geo_matrix(:)%vector (matflt_type) |
| matrix | waves%coherentwave(:)%fullwave%grid%geo(:)%geo_matrix(:)%matrix (array3dflt_type) |
| measure | waves%coherentwave(:)%fullwave%grid%geo(:)%measure(:) (complexgrid_scalar) |
| griduid | waves%coherentwave(:)%fullwave%grid%geo(:)%measure(:)%griduid (integer) |
| subgrid | waves%coherentwave(:)%fullwave%grid%geo(:)%measure(:)%subgrid (integer) |
| scalar | waves%coherentwave(:)%fullwave%grid%geo(:)%measure(:)%scalar (vecflt_type) |
| vector | waves%coherentwave(:)%fullwave%grid%geo(:)%measure(:)%vector (matflt_type) |
| matrix | waves%coherentwave(:)%fullwave%grid%geo(:)%measure(:)%matrix (array3dflt_type) |
| bases | waves%coherentwave(:)%fullwave%grid%bases(:) (complexgrid_vector) |
| griduid | waves%coherentwave(:)%fullwave%grid%bases(:)%griduid (integer) |
| label | waves%coherentwave(:)%fullwave%grid%bases(:)%label (string) |
| comp | waves%coherentwave(:)%fullwave%grid%bases(:)%comp(:) (complexgrid_scalar) |
| griduid | waves%coherentwave(:)%fullwave%grid%bases(:)%comp(:)%griduid (integer) |
| subgrid | waves%coherentwave(:)%fullwave%grid%bases(:)%comp(:)%subgrid (integer) |
| scalar | waves%coherentwave(:)%fullwave%grid%bases(:)%comp(:)%scalar (vecflt_type) |
| vector | waves%coherentwave(:)%fullwave%grid%bases(:)%comp(:)%vector (matflt_type) |
| matrix | waves%coherentwave(:)%fullwave%grid%bases(:)%comp(:)%matrix (array3dflt_type) |
| align | waves%coherentwave(:)%fullwave%grid%bases(:)%align (vecint_type) |
| alignid | waves%coherentwave(:)%fullwave%grid%bases(:)%alignid (vecstring_type) |
| basis | waves%coherentwave(:)%fullwave%grid%bases(:)%basis (integer) |
| e_components | waves%coherentwave(:)%fullwave%e_components (e_components) |
| e_plus | waves%coherentwave(:)%fullwave%e_components%e_plus (complexgrid_scalar_cplx) |
| griduid | waves%coherentwave(:)%fullwave%e_components%e_plus%griduid (integer) |
| subgrid | waves%coherentwave(:)%fullwave%e_components%e_plus%subgrid (integer) |
| scalar | waves%coherentwave(:)%fullwave%e_components%e_plus%scalar (veccplx_type) |
| vector | waves%coherentwave(:)%fullwave%e_components%e_plus%vector (matcplx_type) |
| matrix | waves%coherentwave(:)%fullwave%e_components%e_plus%matrix (array3dcplx_type) |
| e_minus | waves%coherentwave(:)%fullwave%e_components%e_minus (complexgrid_scalar_cplx) |
| griduid | waves%coherentwave(:)%fullwave%e_components%e_minus%griduid (integer) |
| subgrid | waves%coherentwave(:)%fullwave%e_components%e_minus%subgrid (integer) |
| scalar | waves%coherentwave(:)%fullwave%e_components%e_minus%scalar (veccplx_type) |
| vector | waves%coherentwave(:)%fullwave%e_components%e_minus%vector (matcplx_type) |
| matrix | waves%coherentwave(:)%fullwave%e_components%e_minus%matrix (array3dcplx_type) |
| e_para | waves%coherentwave(:)%fullwave%e_components%e_para (complexgrid_scalar_cplx) |
| griduid | waves%coherentwave(:)%fullwave%e_components%e_para%griduid (integer) |
| subgrid | waves%coherentwave(:)%fullwave%e_components%e_para%subgrid (integer) |
| scalar | waves%coherentwave(:)%fullwave%e_components%e_para%scalar (veccplx_type) |
| vector | waves%coherentwave(:)%fullwave%e_components%e_para%vector (matcplx_type) |
| matrix | waves%coherentwave(:)%fullwave%e_components%e_para%matrix (array3dcplx_type) |
| e_norm | waves%coherentwave(:)%fullwave%e_components%e_norm (complexgrid_scalar_cplx) |
| griduid | waves%coherentwave(:)%fullwave%e_components%e_norm%griduid (integer) |
| subgrid | waves%coherentwave(:)%fullwave%e_components%e_norm%subgrid (integer) |
| scalar | waves%coherentwave(:)%fullwave%e_components%e_norm%scalar (veccplx_type) |
| vector | waves%coherentwave(:)%fullwave%e_components%e_norm%vector (matcplx_type) |
| matrix | waves%coherentwave(:)%fullwave%e_components%e_norm%matrix (array3dcplx_type) |
| e_binorm | waves%coherentwave(:)%fullwave%e_components%e_binorm (complexgrid_scalar_cplx) |
| griduid | waves%coherentwave(:)%fullwave%e_components%e_binorm%griduid (integer) |
| subgrid | waves%coherentwave(:)%fullwave%e_components%e_binorm%subgrid (integer) |
| scalar | waves%coherentwave(:)%fullwave%e_components%e_binorm%scalar (veccplx_type) |
| vector | waves%coherentwave(:)%fullwave%e_components%e_binorm%vector (matcplx_type) |
| matrix | waves%coherentwave(:)%fullwave%e_components%e_binorm%matrix (array3dcplx_type) |
| b_norm | waves%coherentwave(:)%fullwave%e_components%b_norm (complexgrid_scalar_cplx) |
| griduid | waves%coherentwave(:)%fullwave%e_components%b_norm%griduid (integer) |
| subgrid | waves%coherentwave(:)%fullwave%e_components%b_norm%subgrid (integer) |
| scalar | waves%coherentwave(:)%fullwave%e_components%b_norm%scalar (veccplx_type) |
| vector | waves%coherentwave(:)%fullwave%e_components%b_norm%vector (matcplx_type) |
| matrix | waves%coherentwave(:)%fullwave%e_components%b_norm%matrix (array3dcplx_type) |
| b_binorm | waves%coherentwave(:)%fullwave%e_components%b_binorm (complexgrid_scalar_cplx) |
| griduid | waves%coherentwave(:)%fullwave%e_components%b_binorm%griduid (integer) |
| subgrid | waves%coherentwave(:)%fullwave%e_components%b_binorm%subgrid (integer) |
| scalar | waves%coherentwave(:)%fullwave%e_components%b_binorm%scalar (veccplx_type) |
| vector | waves%coherentwave(:)%fullwave%e_components%b_binorm%vector (matcplx_type) |
| matrix | waves%coherentwave(:)%fullwave%e_components%b_binorm%matrix (array3dcplx_type) |
| b_para | waves%coherentwave(:)%fullwave%e_components%b_para (complexgrid_scalar_cplx) |
| griduid | waves%coherentwave(:)%fullwave%e_components%b_para%griduid (integer) |
| subgrid | waves%coherentwave(:)%fullwave%e_components%b_para%subgrid (integer) |
| scalar | waves%coherentwave(:)%fullwave%e_components%b_para%scalar (veccplx_type) |
| vector | waves%coherentwave(:)%fullwave%e_components%b_para%vector (matcplx_type) |
| matrix | waves%coherentwave(:)%fullwave%e_components%b_para%matrix (array3dcplx_type) |
| k_perp | waves%coherentwave(:)%fullwave%e_components%k_perp (complexgrid_scalar_cplx) |
| griduid | waves%coherentwave(:)%fullwave%e_components%k_perp%griduid (integer) |
| subgrid | waves%coherentwave(:)%fullwave%e_components%k_perp%subgrid (integer) |
| scalar | waves%coherentwave(:)%fullwave%e_components%k_perp%scalar (veccplx_type) |
| vector | waves%coherentwave(:)%fullwave%e_components%k_perp%vector (matcplx_type) |
| matrix | waves%coherentwave(:)%fullwave%e_components%k_perp%matrix (array3dcplx_type) |
| pol_decomp | waves%coherentwave(:)%fullwave%pol_decomp (pol_decomp) |
| mpol | waves%coherentwave(:)%fullwave%pol_decomp%mpol (vecint_type) |
| e_plus | waves%coherentwave(:)%fullwave%pol_decomp%e_plus (array3dflt_type) |
| e_plus_ph | waves%coherentwave(:)%fullwave%pol_decomp%e_plus_ph (array3dflt_type) |
| e_minus | waves%coherentwave(:)%fullwave%pol_decomp%e_minus (array3dflt_type) |
| e_minus_ph | waves%coherentwave(:)%fullwave%pol_decomp%e_minus_ph (array3dflt_type) |
| e_norm | waves%coherentwave(:)%fullwave%pol_decomp%e_norm (array3dflt_type) |
| e_norm_ph | waves%coherentwave(:)%fullwave%pol_decomp%e_norm_ph (array3dflt_type) |
| e_binorm | waves%coherentwave(:)%fullwave%pol_decomp%e_binorm (array3dflt_type) |
| e_binorm_ph | waves%coherentwave(:)%fullwave%pol_decomp%e_binorm_ph (array3dflt_type) |
| e_para | waves%coherentwave(:)%fullwave%pol_decomp%e_para (array3dflt_type) |
| e_para_ph | waves%coherentwave(:)%fullwave%pol_decomp%e_para_ph (array3dflt_type) |
| b_norm | waves%coherentwave(:)%fullwave%pol_decomp%b_norm (array3dflt_type) |
| b_norm_ph | waves%coherentwave(:)%fullwave%pol_decomp%b_norm_ph (array3dflt_type) |
| b_binorm | waves%coherentwave(:)%fullwave%pol_decomp%b_binorm (array3dflt_type) |
| b_binorm_ph | waves%coherentwave(:)%fullwave%pol_decomp%b_binorm_ph (array3dflt_type) |
| b_para | waves%coherentwave(:)%fullwave%pol_decomp%b_para (array3dflt_type) |
| b_para_ph | waves%coherentwave(:)%fullwave%pol_decomp%b_para_ph (array3dflt_type) |
| k_perp | waves%coherentwave(:)%fullwave%pol_decomp%k_perp (array3dflt_type) |
| local | waves%coherentwave(:)%fullwave%local (local) |
| e_plus | waves%coherentwave(:)%fullwave%local%e_plus (array3dflt_type) |
| e_plus_ph | waves%coherentwave(:)%fullwave%local%e_plus_ph (array3dflt_type) |
| e_minus | waves%coherentwave(:)%fullwave%local%e_minus (array3dflt_type) |
| e_minus_ph | waves%coherentwave(:)%fullwave%local%e_minus_ph (array3dflt_type) |
| e_norm | waves%coherentwave(:)%fullwave%local%e_norm (array3dint_type) |
| enorm_ph | waves%coherentwave(:)%fullwave%local%enorm_ph (array3dflt_type) |
| e_binorm | waves%coherentwave(:)%fullwave%local%e_binorm (array3dflt_type) |
| e_binorm_ph | waves%coherentwave(:)%fullwave%local%e_binorm_ph (array3dflt_type) |
| e_para | waves%coherentwave(:)%fullwave%local%e_para (array3dflt_type) |
| e_para_ph | waves%coherentwave(:)%fullwave%local%e_para_ph (array3dflt_type) |
| b_norm | waves%coherentwave(:)%fullwave%local%b_norm (array3dflt_type) |
| b_norm_ph | waves%coherentwave(:)%fullwave%local%b_norm_ph (array3dflt_type) |
| b_binorm | waves%coherentwave(:)%fullwave%local%b_binorm (array3dflt_type) |
| b_binorm_ph | waves%coherentwave(:)%fullwave%local%b_binorm_ph (array3dflt_type) |
| b_para | waves%coherentwave(:)%fullwave%local%b_para (array3dflt_type) |
| b_para_ph | waves%coherentwave(:)%fullwave%local%b_para_ph (array3dflt_type) |
| k_perp | waves%coherentwave(:)%fullwave%local%k_perp (array3dflt_type) |
| codeparam | waves%coherentwave(:)%codeparam (codeparam) |
| codename | waves%coherentwave(:)%codeparam%codename (string) |
| codeversion | waves%coherentwave(:)%codeparam%codeversion (string) |
| parameters | waves%coherentwave(:)%codeparam%parameters (string) |
| output_diag | waves%coherentwave(:)%codeparam%output_diag (string) |
| output_flag | waves%coherentwave(:)%codeparam%output_flag (integer) |
| codeparam | waves%codeparam (codeparam) |
| codename | waves%codeparam%codename (string) |
| codeversion | waves%codeparam%codeversion (string) |
| parameters | waves%codeparam%parameters (string) |
| output_diag | waves%codeparam%output_diag (string) |
| output_flag | waves%codeparam%output_flag (integer) |
| time | waves%time (float) |